| Hardcore, Gabber/12 Gauge/tg004/00_a_blunted_vision-cause_a_riot_remixes-(tg004)-vinyl-1994-hm.m3u |
259 B |
| Hardcore, Gabber/12 Gauge/tg004/00_a_blunted_vision-cause_a_riot_remixes-(tg004)-vinyl-1994-hm.nfo |
2 KB |
| Hardcore, Gabber/12 Gauge/tg004/00_a_blunted_vision-cause_a_riot_remixes-(tg004)-vinyl-1994-hm.sfv |
295 B |
| Hardcore, Gabber/12 Gauge/tg004/a1-a_blunted_vision-cause_a_riot_(dj_dano_and_liza_n_eliaz_remix)-hm.mp3 |
7.7 MB |
| Hardcore, Gabber/12 Gauge/tg004/a2-a_blunted_vision-cause_a_riot_(dj_delirium_the_hardcore_hippie_remix)-hm.mp3 |
7.7 MB |
| Hardcore, Gabber/12 Gauge/tg004/b1-a_blunted_vision-cause_a_riot_(rob_gee_riot_squad_remix)-hm.mp3 |
7.4 MB |
| Hardcore, Gabber/12 Gauge/tg004/b2-a_blunted_vision-nothing-hm.mp3 |
274 KB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 001 davex - new dimensions/A1.Davex - Untitled.mp3 |
5.2 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 001 davex - new dimensions/A2.Davex - Untitled.mp3 |
5.1 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 001 davex - new dimensions/B1.Davex - Sex Permitted.mp3 |
5 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 002 - the classic men - the brainstormer ep/A1 - The Classic Men - Can We Help You.mp3 |
3.9 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 002 - the classic men - the brainstormer ep/A2 - The Classic Men - Now It Begins.mp3 |
4.2 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 002 - the classic men - the brainstormer ep/B1 - The Classic Men - We're Gonna Get This Place.mp3 |
4.3 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 002 - the classic men - the brainstormer ep/B2 - The Classic Men - Bassex.mp3 |
4.3 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 003 - dj buzz fuzz - nostalgica ep/A1 - DJ Buzz Fuzz - Power Punch.mp3 |
6.2 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 003 - dj buzz fuzz - nostalgica ep/A2 - DJ Buzz Fuzz - Cocaine (The Colombian Dancing Dust).mp3 |
6.3 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 003 - dj buzz fuzz - nostalgica ep/B1 - DJ Buzz Fuzz - Ghost Town.mp3 |
6.2 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 003 - dj buzz fuzz - nostalgica ep/B2 - DJ Buzz Fuzz - Hard As Rock.mp3 |
5.8 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 005 - hardcore brothers - smoke motherfuckers [1998]/A1 - THE HARDCORE BROTHERS - Can You Thrill Me.mp3 |
6.1 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 005 - hardcore brothers - smoke motherfuckers [1998]/A2 - THE HARDCORE BROTHERS - My Shit Is Raw.mp3 |
4.8 MB |
| Hardcore, Gabber/160 BPM Speedlimit/bpm 005 - hardcore brothers - smoke motherfuckers [1998]/B1 - THE HARDCORE BROTHERS - Back To Da Past.mp3 |
5.8 MB |
| Hardcore, Gabber/289 Records/289-3/00-boom_terrorism-eardrum_ep-(289-3)-vinyl-1993-homely.m3u |
264 B |
| Hardcore, Gabber/289 Records/289-3/00-boom_terrorism-eardrum_ep-(289-3)-vinyl-1993-homely.nfo |
6 KB |
| Hardcore, Gabber/289 Records/289-3/00-boom_terrorism-eardrum_ep-(289-3)-vinyl-1993-homely.sfv |
2 KB |
| Hardcore, Gabber/289 Records/289-3/01-boom_terrorism-a-boom_terrorism_-_muay_thai_(289_records)_(289-3)_(1993)-homely.mp3 |
7.4 MB |
| Hardcore, Gabber/289 Records/289-3/02-boom_terrorism-b1-boom_terrorism_-_wicky_(289_records)_(289-3)_(1993)-homely.mp3 |
5.2 MB |
| Hardcore, Gabber/289 Records/289-3/03-boom_terrorism-b2-boom_terrorism_-_gabberhouse_(289_records)_(289-3)_(1993)-homely.mp3 |
4.6 MB |
| Hardcore, Gabber/289 Records/289-4/00-va-beverly_kills_ep-(289-5)-vinyl-1995-homely.m3u |
152 B |
| Hardcore, Gabber/289 Records/289-4/00-va-beverly_kills_ep-(289-5)-vinyl-1995-homely.nfo |
6 KB |
| Hardcore, Gabber/289 Records/289-4/00-va-beverly_kills_ep-(289-5)-vinyl-1995-homely.sfv |
2 KB |
| Hardcore, Gabber/289 Records/289-4/01-a1_musical_vandals-_warface-homely.mp3 |
5.8 MB |
| Hardcore, Gabber/289 Records/289-4/02-a2_general_noise-_yoohoo-homely.mp3 |
6.4 MB |
| Hardcore, Gabber/289 Records/289-4/03-b1_droxz-_jippie_jee-homely.mp3 |
5.9 MB |
| Hardcore, Gabber/289 Records/289-4/04-b2_conabis-_grass-homely.mp3 |
6.1 MB |
| Hardcore, Gabber/46 records/46 001/a1_aphasia_and_torgull_and_manu_le_malin_-_l_gong-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/46 records/46 001/b1_torgull_-_halo-sq.mp3 |
6.4 MB |
| Hardcore, Gabber/46 records/46 001/b2_manu_le_malin_-_halfcut-sq.mp3 |
5.5 MB |
| Hardcore, Gabber/46 records/46 002/a1_the_dj_producer_-_noise_annoyz-sq.mp3 |
9 MB |
| Hardcore, Gabber/46 records/46 002/a2_aphasia_-_collect_your_fucking_head-sq.mp3 |
10.8 MB |
| Hardcore, Gabber/46 records/46 002/b1_moleculez_-_legally_insane-sq.mp3 |
7.9 MB |
| Hardcore, Gabber/46 records/46 002/b2_floorkiller_project_-_nosferatu-sq.mp3 |
11.3 MB |
| Hardcore, Gabber/46 records/46 004/a1_the_dj_producer_-_history_lesson-sq.mp3 |
11 MB |
| Hardcore, Gabber/46 records/46 004/b1_the_dj_producer_-_the_devil_made_me_do_it-sq.mp3 |
11.1 MB |
| Hardcore, Gabber/46 records/46 004/b2_the_dj_producer_-_that_guitar_track-sq.mp3 |
10.3 MB |
| Hardcore, Gabber/46 records/46 005/a1_the_dj_producer_-_suffering-sq.mp3 |
12 MB |
| Hardcore, Gabber/46 records/46 005/b1_the_dj_producer_-_the_biggest_rave_on_earth-sq.mp3 |
9.7 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/A - New School Hip-Hop.mp3 |
4.1 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/A2 - Ben (9mm) - Renegade.mp3 |
2 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/B1 - Ben (9mm) - Dancing To My Beats.mp3 |
2.2 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/B1 - Tribal.wma |
2.8 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/B2 - Domen - Lsdomen.mp3 |
1.9 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/B2 - Moksarkozy.mp3 |
2.4 MB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/face a.jpg |
33 KB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/face b.jpg |
24 KB |
| Hardcore, Gabber/9mm/9mmht 04 - ben (9mm) & domen - untitled/Thumbs.db |
7 KB |
| Hardcore, Gabber/9mm/[9mmht 03] - ben (9mm) - untitled/A1 - Tribal.mp3 |
11 MB |
| Hardcore, Gabber/9mm/[9mmht 03] - ben (9mm) - untitled/A2 - Putain De Rap Hardcore.mp3 |
4.9 MB |
| Hardcore, Gabber/Abralcore/abralcore002/00_psiko_-_banging_again-(abralcore02)-vinyl-2008.m3u |
108 B |
| Hardcore, Gabber/Abralcore/abralcore002/00_psiko_-_banging_again-(abralcore02)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Abralcore/abralcore002/00_psiko_-_banging_again-(abralcore02)-vinyl-2008.sfv |
144 B |
| Hardcore, Gabber/Abralcore/abralcore002/00_psiko_-_banging_again-trackfix-(abralcore02)-vinyl-2008.m3u |
29 B |
| Hardcore, Gabber/Abralcore/abralcore002/00_psiko_-_banging_again-trackfix-(abralcore02)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Abralcore/abralcore002/00_psiko_-_banging_again-trackfix-(abralcore02)-vinyl-2008.sfv |
38 B |
| Hardcore, Gabber/Abralcore/abralcore002/01_psiko_-_alienaction.mp3 |
9.6 MB |
| Hardcore, Gabber/Abralcore/abralcore002/02_psiko_-_psikonexxion.mp3 |
7.8 MB |
| Hardcore, Gabber/Abralcore/abralcore002/03_psiko_-_to_the_one.mp3 |
7.9 MB |
| Hardcore, Gabber/Abralcore/abralcore002/04_psiko_-_magneto.mp3 |
8 MB |
| Hardcore, Gabber/Absurd Audio/aa001/a-the_speed_freak-banging_shit-(shit_1-3)-def.mp3 |
18.8 MB |
| Hardcore, Gabber/Absurd Audio/aa001/b-the_speed_freak-mac-cow_zombie-trash-def.mp3 |
15.2 MB |
| Hardcore, Gabber/Absurd Audio/aa002/a1_the_speed_freak_-_slammit.mp3 |
12.4 MB |
| Hardcore, Gabber/Absurd Audio/aa002/a2_the_speed_freak_-_the_way_of_destruction.mp3 |
9.7 MB |
| Hardcore, Gabber/Absurd Audio/aa002/b1_the_speed_freak_-_the_ultimate_battlefield.mp3 |
12.3 MB |
| Hardcore, Gabber/Absurd Audio/aa002/b2_the_speed_freak_-_hate_missile_f1-666.mp3 |
6.2 MB |
| Hardcore, Gabber/Absurd Audio/aa003/a1_the_speed_freak_and_stormtrooper_-_nukem_now_(noiserave_version).mp3 |
13.4 MB |
| Hardcore, Gabber/Absurd Audio/aa003/a2_the_speed_freak_and_stormtrooper_-_controlling_pathetic_humans.mp3 |
7.6 MB |
| Hardcore, Gabber/Absurd Audio/aa003/b1_the_speed_freak_and_stormtrooper_-_worst_case_scenario.mp3 |
9.6 MB |
| Hardcore, Gabber/Absurd Audio/aa003/b2_the_speed_freak_and_stormtrooper_-_die_earthscum.mp3 |
8.9 MB |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/00_frazzbass_and_negative_network_-_silence_ep-(aa04)-vinyl-2007.m3u |
270 B |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/00_frazzbass_and_negative_network_-_silence_ep-(aa04)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/00_frazzbass_and_negative_network_-_silence_ep-(aa04)-vinyl-2007.sfv |
315 B |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/a1_frazzbass_and_negative_network_-_suck_my_balls.mp3 |
7 MB |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/a2_frazzbass_and_negative_network_-_internal_error.mp3 |
6.7 MB |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/a3_frazzbass_and_negative_network_-_silence.mp3 |
5.7 MB |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/b1_frazzbass_and_negative_network_-_flesh_inferno.mp3 |
7.8 MB |
| Hardcore, Gabber/Absurd Audio/aa004/Frazzbass_and_Negative_Network_-_Silence_EP-(AA04)-Vinyl-2007-SQ/b2_frazzbass_and_negative_network_-_hammer_frequencies.mp3 |
6.5 MB |
| Hardcore, Gabber/Absurd Audio/aa005/00-the_speed_freak-hammerhead-(aa05)-vinyl-2007-1king.m3u |
210 B |
| Hardcore, Gabber/Absurd Audio/aa005/00-the_speed_freak-hammerhead-(aa05)-vinyl-2007-1king.nfo |
10 KB |
| Hardcore, Gabber/Absurd Audio/aa005/00-the_speed_freak-hammerhead-(aa05)-vinyl-2007-1king.sfv |
3 KB |
| Hardcore, Gabber/Absurd Audio/aa005/a1-the_speed_freak-el_gringo_loco.mp3 |
11.4 MB |
| Hardcore, Gabber/Absurd Audio/aa005/a2-the_speed_freak-little_bit_of_oldschool_(loopwars_02).mp3 |
8.9 MB |
| Hardcore, Gabber/Absurd Audio/aa005/b1-the_speed_freak-puppetmaster_(absurd_audio_version).mp3 |
12.1 MB |
| Hardcore, Gabber/Absurd Audio/aa005/b2-the_speed_freak-buried_alive_(biobreaks_mix).mp3 |
8.9 MB |
| Hardcore, Gabber/Absurd Audio/aa006/a1-stormtrooper_and_mck-definition.mp3 |
10.4 MB |
| Hardcore, Gabber/Absurd Audio/aa006/a2-stormtrooper_and_mck-beweg_dich.mp3 |
7.7 MB |
| Hardcore, Gabber/Absurd Audio/aa006/b1-stormtrooper-rap_whores.mp3 |
8.1 MB |
| Hardcore, Gabber/Absurd Audio/aa006/b2-stormtrooper-rock_is_satanic_noise.mp3 |
8.4 MB |
| Hardcore, Gabber/Absurd Audio/aa008/00_va_-_mighty_manipulating_masters_of_midi-chlorian_mind-masturbation-(aa08)-vinyl-2007.m3u |
164 B |
| Hardcore, Gabber/Absurd Audio/aa008/00_va_-_mighty_manipulating_masters_of_midi-chlorian_mind-masturbation-(aa08)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Absurd Audio/aa008/00_va_-_mighty_manipulating_masters_of_midi-chlorian_mind-masturbation-(aa08)-vinyl-2007.sfv |
200 B |
| Hardcore, Gabber/Absurd Audio/aa008/a1_the_speed_freak_-_dying_galaxies.mp3 |
11.3 MB |
| Hardcore, Gabber/Absurd Audio/aa008/a2_stormtrooper_-_dark_side_in_the_house.mp3 |
8.8 MB |
| Hardcore, Gabber/Absurd Audio/aa008/b1_stormtrooper_-_thee_force_is_pain.mp3 |
10.6 MB |
| Hardcore, Gabber/Absurd Audio/aa008/b2_the_speed_freak_-_auggies_bass.mp3 |
7.7 MB |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/00_autopsy_-_edit_this_(subvert_and_destroy_ep)-(aa09)-vinyl-2008.m3u |
128 B |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/00_autopsy_-_edit_this_(subvert_and_destroy_ep)-(aa09)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/00_autopsy_-_edit_this_(subvert_and_destroy_ep)-(aa09)-vinyl-2008.sfv |
164 B |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/a1_autopsy_-_leave_mics_torn.mp3 |
8 MB |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/a2_autopsy_-_ghetto_anti-hero.mp3 |
6.9 MB |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/b1_autopsy_-_audio_hijack.mp3 |
5.8 MB |
| Hardcore, Gabber/Absurd Audio/Autopsy_-_Edit_this_(Subvert_and_Destroy_EP)-(AA09)-Vinyl-2008-SQ/b2_autopsy_-_self_harm.mp3 |
7.6 MB |
| Hardcore, Gabber/Absurd Audio/[aa 07] pattern-j - machine-drum juice/a1_pattern-j_-_jacks_machine-drum.mp3 |
8.4 MB |
| Hardcore, Gabber/Absurd Audio/[aa 07] pattern-j - machine-drum juice/a2_pattern-j_-_radio-monsters.mp3 |
7.8 MB |
| Hardcore, Gabber/Absurd Audio/[aa 07] pattern-j - machine-drum juice/b1_pattern-j_-_twist_with_my_grandma.mp3 |
8.5 MB |
| Hardcore, Gabber/Absurd Audio/[aa 07] pattern-j - machine-drum juice/b2_pattern-j_-_inside_my_blood.mp3 |
10 MB |
| Hardcore, Gabber/Acardipane/A2017.C02-12/00-turbolence-classic_hardcore_vol_2_(aca201706d)-vinyl-2007.m3u |
157 B |
| Hardcore, Gabber/Acardipane/A2017.C02-12/00-turbolence-classic_hardcore_vol_2_(aca201706d)-vinyl-2007.nfo |
614 B |
| Hardcore, Gabber/Acardipane/A2017.C02-12/00-turbolence-classic_hardcore_vol_2_(aca201706d)-vinyl-2007.sfv |
184 B |
| Hardcore, Gabber/Acardipane/A2017.C02-12/01-turbolence-6_million_ways_to_die_(headbanger_remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Acardipane/A2017.C02-12/02-turbolence-6_million_ways_to_die_(remastered).mp3 |
4.4 MB |
| Hardcore, Gabber/Acardipane/A2017.C02-12/03-turbolence-disaster_area_(remastered).mp3 |
4.4 MB |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/00_marc_acardipane_feat_the_ultimate_mc_-_hardcore_vibes__pum_pum-remixes-(aca201704d)-web-2007-est-cover.jpg |
112 KB |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/00_marc_acardipane_feat_the_ultimate_mc_-_hardcore_vibes__pum_pum-remixes-(aca201704d)-web-2007-est.m3u |
240 B |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/00_marc_acardipane_feat_the_ultimate_mc_-_hardcore_vibes__pum_pum-remixes-(aca201704d)-web-2007-est.nfo |
2 KB |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/00_marc_acardipane_feat_the_ultimate_mc_-_hardcore_vibes__pum_pum-remixes-(aca201704d)-web-2007-est.sfv |
267 B |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/01_marc_acardipane_feat_the_ultimate_mc_-_hardcore_vibes_(neo-rave_anthem_2007)-est.mp3 |
13.2 MB |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/02_marc_acardipane_feat_the_ultimate_mc_-_pum_pum_(dj_furax_remix)-est.mp3 |
11.4 MB |
| Hardcore, Gabber/Acardipane/ACA2017.P0212/03_marc_acardipane_feat_the_ultimate_mc_-_pum_pum_(dj_mystery_remix)-est.mp3 |
14.3 MB |
| Hardcore, Gabber/Adam World Wide/aww005/a1-delta_9-erased.mp3 |
8.9 MB |
| Hardcore, Gabber/Adam World Wide/aww005/a2-delta_9-all_your_base.mp3 |
9.4 MB |
| Hardcore, Gabber/Adam World Wide/aww005/b1-delta_9-sex_and_drinking_binges.mp3 |
9.5 MB |
| Hardcore, Gabber/Adam World Wide/aww005/b2-delta_9-alucarda_(einsteins_remix).mp3 |
6.8 MB |
| Hardcore, Gabber/Adam World Wide/aww006/a1_rob_gee_-_hows_everybody.mp3 |
5.4 MB |
| Hardcore, Gabber/Adam World Wide/aww006/a2_rob_gee_-_adrenalize.mp3 |
6.2 MB |
| Hardcore, Gabber/Adam World Wide/aww006/b1_rob_gee_-_pretty_fucked_up_(p.f.u.).mp3 |
6.1 MB |
| Hardcore, Gabber/Adam World Wide/aww006/b2_tripax_-_what_the_fuck_are_you_laughing_at.mp3 |
9.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon001] -/Max E-Crew ft Miro - cutmasters (max e-crew rmx).mp3 |
6.1 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon001] -/Max E-Crew ft Miro - head hunter.mp3 |
6.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon001] -/Max-E-Crew ft Miro - cutmasters (miro rmx).mp3 |
6.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon002] -/[A1] System 3 - Like a shot.mp3 |
4.7 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon002] -/[A2] System 3 - Like a shot (Arena mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon002] -/[B1] Crime Lab - We are moving (Ghost mix).mp3 |
4.1 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon003] - nfo/a1-crime_lab_-_the_dope_of_mankind-dfi.mp3 |
5.8 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon003] - nfo/b1-crime_lab_-_tommorows_down_(john_connor_remix)-dfi.mp3 |
6.7 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon003] - nfo/b2-crime_lab_-_tommorows_down_(skynet_mix)-dfi.mp3 |
6.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon004] -/A1 - Terror Positive vs Bayno DJ - Hell`s Raving (Acheron Mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon004] -/A2 - Terror Positive vs Bayno DJ - X-Periment.mp3 |
946 KB |
| Hardcore, Gabber/Aeon Tracks/[aeon004] -/B1 - Terror Positive vs Bayno DJ - Hell`s Raving (Huge Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon004] -/B2 - Terror Positive vs Bayno DJ - Hell`s Raving (Original Mix).mp3 |
5.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon005] - nfo/a1_max-e-crew_-_mike_and_turntables-dfi.mp3 |
5.9 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon005] - nfo/a2_max-e-crew_-_mike_and_turntables_(groovy_mix)-dfi.mp3 |
3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon005] - nfo/b1_max-e-crew_-_enemies_(hardcore_mix)-dfi.mp3 |
6.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon005] - nfo/b2_max-e-crew_-_enemies_(techno_mix)-dfi.mp3 |
7.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon006] -/A1 Keep On Fuckin' 2001 (1st Mix).MP3 |
3.9 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon006] -/B1 Keep On Fuckin' 2001 (2nd Mix).MP3 |
4.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon006] -/B2 - System 3 - S.Y.S.T.E.M. 3 (The Outro).mp3 |
3.8 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon007] - crime_lab_-_4_the_hardcore-(aeon07)-2001-ind/01_crime_lab_-_4_the_hardcore_(ice_remix)-ind.mp3 |
6 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon007] - crime_lab_-_4_the_hardcore-(aeon07)-2001-ind/02_crime_lab_-_4_the_hardcore_(grave_remix)-ind.mp3 |
5.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon007] - crime_lab_-_4_the_hardcore-(aeon07)-2001-ind/03_crime_lab_-_infinity-ind.mp3 |
7.9 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon008] - bayno_dj_-_my_favourite_dee_jay-(aeon008)-vinyl-2001-ind/01_bayno_dj_-_my_favourite_dee_jay_(goten_mix)-ind.mp3 |
6.9 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon008] - bayno_dj_-_my_favourite_dee_jay-(aeon008)-vinyl-2001-ind/02_bayno_dj_-_my_favourite_dee_jay_(kame_mix)-ind.mp3 |
7.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon008] - bayno_dj_-_my_favourite_dee_jay-(aeon008)-vinyl-2001-ind/03_bayno_dj_-_continuation-ind.mp3 |
7.6 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon009] - deevoid-decimation-(aeon009)-vinyl-2001-trt/a1-deevoid-decimation-trt.mp3 |
6.5 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon009] - deevoid-decimation-(aeon009)-vinyl-2001-trt/b1-deevoid-decimation_(straight_mix)-trt.mp3 |
5.9 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon009] - deevoid-decimation-(aeon009)-vinyl-2001-trt/b2-deevoid-decimation_(cave_mix)-trt.mp3 |
6.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon010] - various artists - the allstars ep volume 1/A1 - System 3 - The Heat.mp3 |
7 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon010] - various artists - the allstars ep volume 1/A2 - Deevoid - Dee Vision.mp3 |
7.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon010] - various artists - the allstars ep volume 1/B1 - Max-E-Crew - From Beyond.mp3 |
7.6 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon010] - various artists - the allstars ep volume 1/B2 - Crime Lab - Infrared.mp3 |
7.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon011] - system 3 - shades of black/a1 - system 3 - shades of black.mp3 |
5.1 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon011] - system 3 - shades of black/b1 - system 3 - shades of black (kickin mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon011] - system 3 - shades of black/b2 - system 3 - shades of black (black mix).mp3 |
5.7 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon012] -/A1 The Fog (Dense Mix).mp3 |
6.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon012] -/A2 The Fog (Grey Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon012] -/B1 Haze.mp3 |
4.8 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon013] -/Crime Lab - scream (up and down mix).mp3 |
6 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon013] -/Crime Lab - scream.mp3 |
6.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon013] -/Crime Lab - sex crime.mp3 |
6.4 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon014] -/a1_deevoid_-_the_phoenix_(rising_remix).mp3 |
8.1 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon014] -/b1_deevoid_-_the_phoenix_(original_mix).mp3 |
10.3 MB |
| Hardcore, Gabber/Aeon Tracks/[aeon014] -/b2_deevoid_-_post_mortem.mp3 |
8.7 MB |
| Hardcore, Gabber/AfterMatch/aft004/00_va-shattered-(aft04)-vinyl-2008.m3u |
123 B |
| Hardcore, Gabber/AfterMatch/aft004/00_va-shattered-(aft04)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/AfterMatch/aft004/00_va-shattered-(aft04)-vinyl-2008.sfv |
159 B |
| Hardcore, Gabber/AfterMatch/aft004/a1_tieum_feat._dr_core-no_competition.mp3 |
7.7 MB |
| Hardcore, Gabber/AfterMatch/aft004/a2_cyan-instinct_of_survival.mp3 |
6.6 MB |
| Hardcore, Gabber/AfterMatch/aft004/b1_tymon-got_it_all.mp3 |
8.8 MB |
| Hardcore, Gabber/AfterMatch/aft004/b2_bartoch-sick.mp3 |
7.5 MB |
| Hardcore, Gabber/Agent Orange/ao01/A1 - Olsky & Mumpitz - Untitled.mp3 |
6 MB |
| Hardcore, Gabber/Agent Orange/ao01/B1 - Olsky & Mumpitz - Untitled.mp3 |
4.6 MB |
| Hardcore, Gabber/Agent Orange/ao02/A1 - Somatic Responses - Untitled.mp3 |
4.4 MB |
| Hardcore, Gabber/Agent Orange/ao02/B1 - Somatic Responses - Untitled.mp3 |
3.8 MB |
| Hardcore, Gabber/Agent Orange/ao03/A1 - Doc Gringo - Untitled.mp3 |
3.5 MB |
| Hardcore, Gabber/Agent Orange/ao03/B1 - Doc Gringo - Untitled.mp3 |
2.9 MB |
| Hardcore, Gabber/Agent Orange/ao04/A1 - Somatic Responses - Untitled.mp3 |
4.4 MB |
| Hardcore, Gabber/Agent Orange/ao04/A2 - Somatic Responses - Untitled.mp3 |
3.8 MB |
| Hardcore, Gabber/Agent Orange/ao04/B1 - Somatic Responses - Untitled.mp3 |
4.7 MB |
| Hardcore, Gabber/Agent Orange/ao04/B2 - Somatic Responses - Untitled.mp3 |
3.5 MB |
| Hardcore, Gabber/Agent Orange/ao05/A1 - Biochip C. - So What.mp3 |
6.7 MB |
| Hardcore, Gabber/Agent Orange/ao05/B1 - Biochip C. - Black Sunday.mp3 |
6.8 MB |
| Hardcore, Gabber/Agent Orange/ao06/A1 - DJ Vibe-Rider - Untitled.mp3 |
6 MB |
| Hardcore, Gabber/Agent Orange/ao06/B1 - DJ Vibe-Rider - Untitled.mp3 |
4.5 MB |
| Hardcore, Gabber/Agent Orange/ao07/A1 - Skullblower - Untitled.mp3 |
5.6 MB |
| Hardcore, Gabber/Agent Orange/ao07/B1 - Skullblower - Untitled.mp3 |
6.3 MB |
| Hardcore, Gabber/Agent Orange/ao08/A1 - D.D.T. - Untitled.mp3 |
3.7 MB |
| Hardcore, Gabber/Agent Orange/ao08/B1 - D.D.T. - Untitled.mp3 |
4.2 MB |
| Hardcore, Gabber/Agent Orange/ao10/01_the_speed_freak_-_unknown_side_a-hb.mp3 |
6.5 MB |
| Hardcore, Gabber/Agent Orange/ao10/02_the_speed_freak_-_unknown_side_b-hb.mp3 |
6.4 MB |
| Hardcore, Gabber/Agent Orange/ao11/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/00_biochip_c._and_alice_d._-_agent_orange_11-(ao11)-vinyl-2007.m3u |
100 B |
| Hardcore, Gabber/Agent Orange/ao11/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/00_biochip_c._and_alice_d._-_agent_orange_11-(ao11)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Agent Orange/ao11/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/00_biochip_c._and_alice_d._-_agent_orange_11-(ao11)-vinyl-2007.sfv |
118 B |
| Hardcore, Gabber/Agent Orange/ao11/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/A1_biochip_c._and_alice_d._-_unknown_track_01.mp3 |
8 MB |
| Hardcore, Gabber/Agent Orange/ao11/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/B1_biochip_c._and_alice_d._-_unknown_track_02.mp3 |
7.3 MB |
| Hardcore, Gabber/Agent Orange/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/00_biochip_c._and_alice_d._-_agent_orange_11-(ao11)-vinyl-2007.m3u |
100 B |
| Hardcore, Gabber/Agent Orange/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/00_biochip_c._and_alice_d._-_agent_orange_11-(ao11)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Agent Orange/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/00_biochip_c._and_alice_d._-_agent_orange_11-(ao11)-vinyl-2007.sfv |
118 B |
| Hardcore, Gabber/Agent Orange/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/A1_biochip_c._and_alice_d._-_unknown_track_01.mp3 |
8 MB |
| Hardcore, Gabber/Agent Orange/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)/Biochip_C._and_Alice_D._-_Agent_Orange_11-(AO11)-Vinyl-2007-SQ/B1_biochip_c._and_alice_d._-_unknown_track_02.mp3 |
7.3 MB |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/00_cemtex_-_untitled-(alcaloide008)-vinyl-2008.m3u |
136 B |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/00_cemtex_-_untitled-(alcaloide008)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/00_cemtex_-_untitled-(alcaloide008)-vinyl-2008.sfv |
172 B |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/a1_cemtex_-_back_from_jamaica.mp3 |
10.1 MB |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/a2_cemtex_-_beasty_inside.mp3 |
8.1 MB |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/b1_cemtex_-_dont_be_alarm.mp3 |
8.9 MB |
| Hardcore, Gabber/Alcaloide/Cemtex_-_Untitled-(Alcaloide008)-Vinyl-2008-SQ/b2_cemtex_-_scratchin_core_part_3.mp3 |
9.1 MB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/00_aurel_vs_kik-reve_party_intergalactik-(al03)-vinyl-2006-side_a.jpg |
72 KB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/00_aurel_vs_kik-reve_party_intergalactik-(al03)-vinyl-2006-side_b.jpg |
81 KB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/00_aurel_vs_kik-reve_party_intergalactik-(al03)-vinyl-2006.m3u |
115 B |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/00_aurel_vs_kik-reve_party_intergalactik-(al03)-vinyl-2006.nfo |
1 KB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/00_aurel_vs_kik-reve_party_intergalactik-(al03)-vinyl-2006.sfv |
151 B |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/a1-aurel-reve_party_intergalactik.mp3 |
9.1 MB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/a2-aurel-im_hardcore.mp3 |
7.5 MB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/b1-kik-architek.mp3 |
7.9 MB |
| Hardcore, Gabber/Aliens/Aurel_Vs_Kik-Reve_Party_Intergalactik-(AL03)-Vinyl-2006-hM/b2-kik-chemical_sisters.mp3 |
7.5 MB |
| Hardcore, Gabber/Altern-Hate/a8010/00-tieum_and_dr_macabre-altern-hate_10-(a8010)-vinyl-2007-1king.m3u |
143 B |
| Hardcore, Gabber/Altern-Hate/a8010/00-tieum_and_dr_macabre-altern-hate_10-(a8010)-vinyl-2007-1king.nfo |
9 KB |
| Hardcore, Gabber/Altern-Hate/a8010/00-tieum_and_dr_macabre-altern-hate_10-(a8010)-vinyl-2007-1king.sfv |
3 KB |
| Hardcore, Gabber/Altern-Hate/a8010/a1-tieum_and_dr._macabre-hatefull.mp3 |
6.9 MB |
| Hardcore, Gabber/Altern-Hate/a8010/a2-tieum_and_dr._macabre-we_still_have_much_to_do.mp3 |
7.4 MB |
| Hardcore, Gabber/Altern-Hate/a8010/b1-tieum-i_still_fuct_up.mp3 |
7.7 MB |
| Hardcore, Gabber/Altern-Hate/a8010/b2-tieum-j.o.y..mp3 |
6.9 MB |
| Hardcore, Gabber/Altern-Hate/a8012/00_2_disorder_minds_-_untitled-(a8012)-vinyl-2007.m3u |
137 B |
| Hardcore, Gabber/Altern-Hate/a8012/00_2_disorder_minds_-_untitled-(a8012)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Altern-Hate/a8012/00_2_disorder_minds_-_untitled-(a8012)-vinyl-2007.sfv |
173 B |
| Hardcore, Gabber/Altern-Hate/a8012/a1_2_disorder_minds_-_rock.mp3 |
6.9 MB |
| Hardcore, Gabber/Altern-Hate/a8012/a2_2_disorder_minds_-_obsession.mp3 |
7.2 MB |
| Hardcore, Gabber/Altern-Hate/a8012/b1_2_disorder_minds_-_suck.mp3 |
6.4 MB |
| Hardcore, Gabber/Altern-Hate/a8012/b2_2_disorder_minds_-_halucinogene.mp3 |
6.7 MB |
| Hardcore, Gabber/Anticore/01/a1 Mouse - Vlad.mp3 |
9.2 MB |
| Hardcore, Gabber/Anticore/01/a2 Mouse - T4.mp3 |
8.9 MB |
| Hardcore, Gabber/Anticore/01/b1 Mouse - Hemostase.mp3 |
9 MB |
| Hardcore, Gabber/Anticore/01/b2 Mouse - Shift.mp3 |
10 MB |
| Hardcore, Gabber/Anticore/02/A1 - Dome.mp3 |
5.7 MB |
| Hardcore, Gabber/Anticore/02/A2 - Pussy Cat.mp3 |
8.6 MB |
| Hardcore, Gabber/Anticore/02/B1 - Dead.mp3 |
4.2 MB |
| Hardcore, Gabber/Anticore/02/B2 - Terzog.mp3 |
5.5 MB |
| Hardcore, Gabber/Anticore/03/Anticore_003_A1.mp3 |
5.4 MB |
| Hardcore, Gabber/Anticore/03/Anticore_003_A2.mp3 |
3.9 MB |
| Hardcore, Gabber/Anticore/03/Anticore_003_B1.mp3 |
6.1 MB |
| Hardcore, Gabber/Anticore/04/A1 - Armaguet Nad - Motaba Fils d'Ebola.mp3 |
4.9 MB |
| Hardcore, Gabber/Anticore/04/A2 - Armaguet Nad - Death Is My Sanctuary.mp3 |
5.2 MB |
| Hardcore, Gabber/Anticore/04/B1 - Maniak - Ultimate Scream Part 1.mp3 |
4.1 MB |
| Hardcore, Gabber/Anticore/04/B2 - Maniak - Ultimate Scream Part 2.mp3 |
4.3 MB |
| Hardcore, Gabber/Anticore/05/A1.mp3 |
7.7 MB |
| Hardcore, Gabber/Anticore/05/A2.mp3 |
7.5 MB |
| Hardcore, Gabber/Anticore/05/B1.mp3 |
7.7 MB |
| Hardcore, Gabber/Anticore/05/B2.mp3 |
10 MB |
| Hardcore, Gabber/Anticore/06/a1_maniak_-_unknown_track_01-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Anticore/06/a2_maniak_-_unknown_track_02-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Anticore/06/b1_maniak_-_unknown_track_03-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Anticore/06/b2_maniak_-_unknown_track_04-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Anticore/07/a1_maniak_vs_phantom_-_unknown_track_01-sq.mp3 |
10.1 MB |
| Hardcore, Gabber/Anticore/07/a2_maniak_vs_phantom_-_unknown_track_02-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Anticore/07/b1_maniak_vs_phantom_-_unknown_track_03-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Anticore/07/b2_maniak_vs_phantom_-_unknown_track_04-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Arcade/9909241/01. DJ Weirdo & DJ Sim - Go Get Busy On The Tempo (Hardcore Edition).mp3 |
6.8 MB |
| Hardcore, Gabber/Arcade/9909241/02. DJ Weirdo & DJ Sim - Go Get Busy On The Tempo (Single Edition) .mp3 |
7 MB |
| Hardcore, Gabber/Arcade/9909241/03. DJ Weirdo & DJ Sim - Go Get Busy On The Tempo (Rave Version) .mp3 |
9.9 MB |
| Hardcore, Gabber/Arcade/9909241/04. Critical Mass - Dancing Together.mp3 |
9.8 MB |
| Hardcore, Gabber/Area 51 Recordings/(area 066) - bong project - untitled/a - bong project - something wicked.mp3 |
10.9 MB |
| Hardcore, Gabber/Area 51 Recordings/(area 066) - bong project - untitled/b - bong project - flatliner.mp3 |
9.2 MB |
| Hardcore, Gabber/Area 51 Recordings/area 59 - songs from the abyss/a1 dj clarkee - flashback.mp3 |
7.3 MB |
| Hardcore, Gabber/Arena/arn 01 nihilist, the no free style (12)/A1 - Radium - No Free Style.mp3 |
6.8 MB |
| Hardcore, Gabber/Arena/arn 01 nihilist, the no free style (12)/A2 - Radium - Ex Nihilo.mp3 |
1.3 MB |
| Hardcore, Gabber/Arena/arn 01 nihilist, the no free style (12)/B1 - Radium - Russian Roulette.mp3 |
7.1 MB |
| Hardcore, Gabber/Arena/arn 01 nihilist, the no free style (12)/B2 - Radium - Power Of Nothing.mp3 |
5.8 MB |
| Hardcore, Gabber/Arena/arn 02 tieum fuck an other shit (12)/A1 - Tieum - Fuck An Other Shit.mp3 |
6.3 MB |
| Hardcore, Gabber/Arena/arn 02 tieum fuck an other shit (12)/A2 - Tieum - +1.mp3 |
6.5 MB |
| Hardcore, Gabber/Arena/arn 02 tieum fuck an other shit (12)/B1 - Tieum - Xes Again.mp3 |
6.6 MB |
| Hardcore, Gabber/Arena/arn 02 tieum fuck an other shit (12)/B2 - Tieum - Coffee Or Tea.mp3 |
5.7 MB |
| Hardcore, Gabber/Arena/arn 03 radium ersatz ep (12)/A1 - Radium - Another Day.mp3 |
7.1 MB |
| Hardcore, Gabber/Arena/arn 03 radium ersatz ep (12)/B1 - Radium - Prolotype.mp3 |
7.7 MB |
| Hardcore, Gabber/Arena/arn 04 radium vs. tieum goodbye et (12)/A1 - Tieum vs. Radium - Goodbye ET.mp3 |
6.1 MB |
| Hardcore, Gabber/Arena/arn 04 radium vs. tieum goodbye et (12)/B1 - Radium - Pigs.mp3 |
6.8 MB |
| Hardcore, Gabber/Arena/arn 04 radium vs. tieum goodbye et (12)/B2 - Tieum - Bass For Me.mp3 |
6.5 MB |
| Hardcore, Gabber/Arena/arn 05 nihilist, the volume 2 (12)/a1_the_nihilist_-_for_nothing-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Arena/arn 05 nihilist, the volume 2 (12)/b1_the_nihilist_-_cut_verb-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Arena/arn 05 nihilist, the volume 2 (12)/b2_the_nihilist_-_survive-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Arena/arn 06 atk hell singer's (12)/a1_atk_-_hell_singers-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Arena/arn 06 atk hell singer's (12)/a2_atk_-_the_fifth_fire_place-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Arena/arn 06 atk hell singer's (12)/b1_atk_-_gabba_neo_school-sq.mp3 |
8.7 MB |
| Hardcore, Gabber/Arena/arn 06 atk hell singer's (12)/b2_atk_-_fuck_da_killer-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Arena/arn 07 nihilist, the volume 3 (12)/a1_the_nihilist_-_same_old_song-sq.mp3 |
11.2 MB |
| Hardcore, Gabber/Arena/arn 07 nihilist, the volume 3 (12)/b1_the_nihilist_-_kik_plus_noise-sq.mp3 |
7.7 MB |
| Hardcore, Gabber/Arena/arn 07 nihilist, the volume 3 (12)/b2_the_nihilist_-_crash_plus_loop-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Arena/arn 10/00_industrial_terror_squad_-_moments_of_execution_ep-(arn10)-vinyl-2007.m3u |
140 B |
| Hardcore, Gabber/Arena/arn 10/00_industrial_terror_squad_-_moments_of_execution_ep-(arn10)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Arena/arn 10/00_industrial_terror_squad_-_moments_of_execution_ep-(arn10)-vinyl-2007.sfv |
167 B |
| Hardcore, Gabber/Arena/arn 10/a1_industrial_terror_squad_-_soundz_of_death.mp3 |
7.3 MB |
| Hardcore, Gabber/Arena/arn 10/b1_industrial_terror_squad_-_channel_red.mp3 |
7.4 MB |
| Hardcore, Gabber/Arena/arn 10/b2_industrial_terror_squad_-_born_in_pain.mp3 |
7.5 MB |
| Hardcore, Gabber/Arena/arn 11/00_radium_and_daisy_-_trust_or_die-(arn11)-vinyl-2007.m3u |
110 B |
| Hardcore, Gabber/Arena/arn 11/00_radium_and_daisy_-_trust_or_die-(arn11)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Arena/arn 11/00_radium_and_daisy_-_trust_or_die-(arn11)-vinyl-2007.sfv |
130 B |
| Hardcore, Gabber/Arena/arn 11/01_radium_and_daisy_-_trust_or_die_(trust_mix).mp3 |
9.7 MB |
| Hardcore, Gabber/Arena/arn 11/02_radium_and_daisy_-_trust_or_die_(die_mix_by_radium).mp3 |
9.9 MB |
| Hardcore, Gabber/Arena/arn 12/00_radium_-_aggressive_ep-(arn12)-vinyl-2007.m3u |
55 B |
| Hardcore, Gabber/Arena/arn 12/00_radium_-_aggressive_ep-(arn12)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Arena/arn 12/00_radium_-_aggressive_ep-(arn12)-vinyl-2007.sfv |
73 B |
| Hardcore, Gabber/Arena/arn 12/a1_radium_-_fuck_with_me.mp3 |
9.1 MB |
| Hardcore, Gabber/Arena/arn 12/b1_radium_-_dangerous.mp3 |
8.3 MB |
| Hardcore, Gabber/Artillery/(artillery008) dj amok - nightmare ii/00_dj_amok_-_nightmare_2-(artillery008)-promo_vinyl-2004-utz.nfo |
10 KB |
| Hardcore, Gabber/Artillery/(artillery008) dj amok - nightmare ii/01_dj_amok_-_untitled-a1.mp3 |
8.8 MB |
| Hardcore, Gabber/Artillery/(artillery008) dj amok - nightmare ii/03_dj_amok_-_untitled-b2-utz.mp3 |
5.9 MB |
| Hardcore, Gabber/Artillery/(artillery008) dj amok - nightmare ii/04_dj_amok_-_untitled-a2-utz.mp3 |
6.1 MB |
| Hardcore, Gabber/Artillery/[artillery015] rude_awakening_vs_dj_amok_-_robotic_fannys_and_enhanced_willies-(artillery015)-vinyl-2007-hb/a1-rude_awakening_vs_dj_amok_-_cross_the_rubicon.mp3 |
6.8 MB |
| Hardcore, Gabber/Artillery/[artillery015] rude_awakening_vs_dj_amok_-_robotic_fannys_and_enhanced_willies-(artillery015)-vinyl-2007-hb/a2-rude_awakening_vs_dj_amok_-_electronic_rod.mp3 |
8.2 MB |
| Hardcore, Gabber/Artillery/[artillery015] rude_awakening_vs_dj_amok_-_robotic_fannys_and_enhanced_willies-(artillery015)-vinyl-2007-hb/b1-rude_awakening_vs_dj_amok_-_schranzlutscher.mp3 |
10.9 MB |
| Hardcore, Gabber/Artillery/[artillery015] rude_awakening_vs_dj_amok_-_robotic_fannys_and_enhanced_willies-(artillery015)-vinyl-2007-hb/b2-rude_awakening_vs_dj_amok_-_electronic_rod_(waldhaus_remix).mp3 |
7.2 MB |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/00_va-nologo-(astroprojekt_07)-vinyl-2007-ct.m3u |
108 B |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/00_va-nologo-(astroprojekt_07)-vinyl-2007-ct.nfo |
11 KB |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/00_va-nologo-(astroprojekt_07)-vinyl-2007-ct.sfv |
144 B |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/a1_meloops-fougiz-ct.mp3 |
7.2 MB |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/a2_meloops-otone_1975-ct.mp3 |
7.3 MB |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/b1_tlb-satarode-ct.mp3 |
8.7 MB |
| Hardcore, Gabber/Astrofonik/AstroProJeKt007/b2_kyftek-jumpin_moving-ct.mp3 |
8.5 MB |
| Hardcore, Gabber/Aussie Records/(as 001) - dj delirium & friends - the cricket gets wicked (album sampler)/A1 - DJ DELIRIUM vs DJ BUZZ FUZZ - Immortality.mp3 |
3.7 MB |
| Hardcore, Gabber/Aussie Records/(as 001) - dj delirium & friends - the cricket gets wicked (album sampler)/A2 - DJ DELIRIUM vs GUITAR ROB - Where I'm From.mp3 |
3.9 MB |
| Hardcore, Gabber/Aussie Records/(as 001) - dj delirium & friends - the cricket gets wicked (album sampler)/B1 - DJ DELIRIUM vs OMAR SANTANA - Drop Da Beat.mp3 |
4.8 MB |
| Hardcore, Gabber/Aussie Records/(as 001) - dj delirium & friends - the cricket gets wicked (album sampler)/B2 - DJ DELIRIUM - Rock Your Body.mp3 |
4.5 MB |
| Hardcore, Gabber/Aussie Records/(as 003) - james daltan - hallucinator ep/_AS 003 (front).jpg |
39 KB |
| Hardcore, Gabber/Aussie Records/(as 003) - james daltan - hallucinator ep/A1 - JAMES DALTAN - Hallucinator (Perry's Choice).mp3 |
4.2 MB |
| Hardcore, Gabber/Aussie Records/(as 003) - james daltan - hallucinator ep/A2 - JAMES DALTAN - Hallucinator (Hard As...).mp3 |
4.7 MB |
| Hardcore, Gabber/Aussie Records/(as 003) - james daltan - hallucinator ep/B1 - JAMES DALTAN - Warpspeed vs Hyperspeed.mp3 |
4.3 MB |
| Hardcore, Gabber/Aussie Records/(as 003) - james daltan - hallucinator ep/B2 - JAMES DALTAN - Arrested Beatz.mp3 |
4.3 MB |
| Hardcore, Gabber/Aussie Records/(as 004) - dj e-rick & tactic - time to party/A1 - DJ E-RICK & TACTIC - Time To Party.mp3 |
6.6 MB |
| Hardcore, Gabber/Aussie Records/(as 004) - dj e-rick & tactic - time to party/A2 - DJ E-RICK & TACTIC - Our House Is Your House.mp3 |
6.1 MB |
| Hardcore, Gabber/Aussie Records/(as 004) - dj e-rick & tactic - time to party/B1 - DJ E-RICK & TACTIC - Not Change Our Style.mp3 |
7.3 MB |
| Hardcore, Gabber/Aussie Records/(as 004) - dj e-rick & tactic - time to party/B2 - DJ E-RICK & TACTIC - Terrortrance.mp3 |
6 MB |
| Hardcore, Gabber/Axis/ax-035/jeff mills - a1 - condor to mallorca (transition mix by ken ishii).mp3 |
7.1 MB |
| Hardcore, Gabber/Axis/ax-035/jeff mills - b1 - condor to mallorca (condor express by ken ishii).mp3 |
7.6 MB |
| Hardcore, Gabber/Axis/ax-035/jeff mills - b2 - condor to mallorca (classic mix by ken ishii).mp3 |
8.6 MB |
| Hardcore, Gabber/B2K/b2k011/a1-the_enticer-there_is_no_future.mp3 |
12 MB |
| Hardcore, Gabber/B2K/b2k011/a2-the_enticer-an_empty_feeling.mp3 |
11.5 MB |
| Hardcore, Gabber/B2K/b2k011/b1-the_enticer-for_all_the_wrong_reasons_(absent_matrimony).mp3 |
12.1 MB |
| Hardcore, Gabber/B2K/b2k011/b2-the_enticer-jewelz_and_diamondz.mp3 |
9.6 MB |
| Hardcore, Gabber/Babyboom/baby001/[A1] Brothers In Crime - Hallucinating.mp3 |
6.8 MB |
| Hardcore, Gabber/Babyboom/baby001/[B1] Brothers In Crime - Funatic.mp3 |
5.1 MB |
| Hardcore, Gabber/Babyboom/baby001/[B2] Brothers In Crime - Check Your Body.mp3 |
5.6 MB |
| Hardcore, Gabber/Babyboom/baby001/A2 - Brothers In Crime - Out Of Sight (Rave Storm Live Edit).mp3 |
4.8 MB |
| Hardcore, Gabber/Babyboom/baby002/[A1] The Scotchman - Happy Vibes.mp3 |
5.8 MB |
| Hardcore, Gabber/Babyboom/baby002/[B1] The Scotchman - Terror Breed.mp3 |
4.2 MB |
| Hardcore, Gabber/Babyboom/baby002/[B2] The Scotchman - Self Destruct.mp3 |
4.2 MB |
| Hardcore, Gabber/Babyboom/baby003/[A1] Smile - A Good Time.mp3 |
9.8 MB |
| Hardcore, Gabber/Babyboom/baby003/[A2] Smile - Set You Free.mp3 |
7.6 MB |
| Hardcore, Gabber/Babyboom/baby003/[B1] Smile - Cut The Midrange.mp3 |
8.1 MB |
| Hardcore, Gabber/Babyboom/baby003/[B2] Smile - Atlantis.mp3 |
12.5 MB |
| Hardcore, Gabber/Babyboom/baby003/[B3] Smile - In Your Happy Face.mp3 |
6.8 MB |
| Hardcore, Gabber/Babyboom/baby004/[A1] Obliterator - Ruff To The Max.mp3 |
6.1 MB |
| Hardcore, Gabber/Babyboom/baby004/[A2] Obliterator - Work It To The Bone.mp3 |
6.6 MB |
| Hardcore, Gabber/Babyboom/baby004/[B1] Obliterator - Higher (Bang To The Beat).mp3 |
7.1 MB |
| Hardcore, Gabber/Babyboom/baby004/[B2] Obliterator - Wicked Drums.mp3 |
5.2 MB |
| Hardcore, Gabber/Babyboom/baby005/[A1] Infernus - Funcore.mp3 |
6.6 MB |
| Hardcore, Gabber/Babyboom/baby005/[A2] Infernus - Hardcore Destiny.mp3 |
7.2 MB |
| Hardcore, Gabber/Babyboom/baby005/[B1] Infernus - Happy Forest People.mp3 |
8.7 MB |
| Hardcore, Gabber/Babyboom/baby005/[B2] Infernus - Want Your Baby (Scotland Mix).mp3 |
6.3 MB |
| Hardcore, Gabber/Babyboom/baby006/[A1] Technosis - Rushbins.mp3 |
4.5 MB |
| Hardcore, Gabber/Babyboom/baby006/[A2] Technosis - Rhytmic Riot.mp3 |
5.1 MB |
| Hardcore, Gabber/Babyboom/baby006/[B1] Technosis - Confusion.mp3 |
3.7 MB |
| Hardcore, Gabber/Babyboom/baby007/[A1] DJ Isaac - Fuckin' Boots.mp3 |
5.5 MB |
| Hardcore, Gabber/Babyboom/baby007/[A3] DJ Isaac - Seduce Me.mp3 |
6 MB |
| Hardcore, Gabber/Babyboom/baby007/[B1] DJ Isaac - Darlin' Come Here.mp3 |
5.3 MB |
| Hardcore, Gabber/Babyboom/baby007/[B2] DJ Isaac - The Party Is Mine.mp3 |
6 MB |
| Hardcore, Gabber/Babyboom/baby007/[B3] DJ Isaac - Pump Up The Party.mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom/baby008/[A1] DJ Gizmo & Larsh - Baby I Know (Original Mix).mp3 |
7.6 MB |
| Hardcore, Gabber/Babyboom/baby008/[A2] DJ Gizmo & Larsh - Baby I Know (El Bruto Mix).mp3 |
3.7 MB |
| Hardcore, Gabber/Babyboom/baby008/[B1] DJ Gizmo & Larsh - Breakout.mp3 |
4.1 MB |
| Hardcore, Gabber/Babyboom/baby008/[B2] Larsh - Aggressive.mp3 |
3.4 MB |
| Hardcore, Gabber/Babyboom/baby009/[A1] Sonicdriver - Standing On The Top.mp3 |
5.5 MB |
| Hardcore, Gabber/Babyboom/baby009/[A2] Sonicdriver - Terrorpods.mp3 |
5.3 MB |
| Hardcore, Gabber/Babyboom/baby009/[B1] Sonicdriver - Mind On The Beat.mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom/baby009/[B2] Sonicdriver - In Your Arms Tonight.mp3 |
4.2 MB |
| Hardcore, Gabber/Babyboom/baby010/[A1] Davie Forbes - Apolypse Now.mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom/baby010/[B1] Davie Forbes - DeKay Rate.mp3 |
5.7 MB |
| Hardcore, Gabber/Babyboom/baby010/[B2] Davie Forbes - V.G.8. (D.J.K.2. Mix).mp3 |
6.2 MB |
| Hardcore, Gabber/Babyboom/baby011/[A1] DJ Isaac - Dumcore.mp3 |
6.2 MB |
| Hardcore, Gabber/Babyboom/baby011/[A2] DJ Isaac - The Place 2 B.mp3 |
6.9 MB |
| Hardcore, Gabber/Babyboom/baby011/[B1] DJ Isaac - Damn Hardcore.mp3 |
6.7 MB |
| Hardcore, Gabber/Babyboom/baby011/[B2] DJ Isaac - Girls And Boys.mp3 |
6.9 MB |
| Hardcore, Gabber/Babyboom/baby012/[A1] DJ Gizmo - Resque.mp3 |
6.7 MB |
| Hardcore, Gabber/Babyboom/baby012/[A2] DJ Gizmo - Play My Song.mp3 |
7.1 MB |
| Hardcore, Gabber/Babyboom/baby012/[B1] DJ Gizmo - Play My Song (DJ Norman Remix).mp3 |
7.2 MB |
| Hardcore, Gabber/Babyboom/baby013/[A1] Obliterator - Break It Down.mp3 |
6.2 MB |
| Hardcore, Gabber/Babyboom/baby013/[A2] Obliterator - New Improved Shit.mp3 |
6.3 MB |
| Hardcore, Gabber/Babyboom/baby013/[B1] Obliterator - Ruff To The Max (El Bruto Remix).mp3 |
6.4 MB |
| Hardcore, Gabber/Babyboom/baby013/[B2] Obliterator - Mind Twist.mp3 |
5 MB |
| Hardcore, Gabber/Babyboom/baby014/[A1] DJ Mongoose - Rip Shit Up (DJ Isaac Remix).mp3 |
4 MB |
| Hardcore, Gabber/Babyboom/baby014/[A2] DJ Mongoose - Rip Shit Up (Original Mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Babyboom/baby014/[B1] DJ Mongoose - Flame On (El Bruto Remix).mp3 |
4.2 MB |
| Hardcore, Gabber/Babyboom/baby014/[B2] DJ Mongoose - Flame On (Original Mix).mp3 |
4.8 MB |
| Hardcore, Gabber/Babyboom/baby014/[B3] DJ Mongoose - Struck By Lightning.mp3 |
5 MB |
| Hardcore, Gabber/Babyboom/baby015/[A1] Boombastic - Rudeboy.mp3 |
6 MB |
| Hardcore, Gabber/Babyboom/baby015/[A2] Boombastic - Jump And Jam.mp3 |
6 MB |
| Hardcore, Gabber/Babyboom/baby015/[B1] Boombastic - Here We Go.mp3 |
5.6 MB |
| Hardcore, Gabber/Babyboom/baby015/[B2] Boombastic - Take Me Higher.mp3 |
5.4 MB |
| Hardcore, Gabber/Babyboom/baby016/[A1] Davie Forbes - Remember That.mp3 |
3.8 MB |
| Hardcore, Gabber/Babyboom/baby016/[B1] Davie Forbes - Remember That (Stovie Mix).mp3 |
3.6 MB |
| Hardcore, Gabber/Babyboom/baby016/[B2] Davie Forbes - Intelegator.mp3 |
3.9 MB |
| Hardcore, Gabber/Babyboom/baby017/[A1] Happymen - Love Is You (DJ Isaac Remix).mp3 |
6.6 MB |
| Hardcore, Gabber/Babyboom/baby017/[A2] Happymen - Love Is You (Happy Mix).mp3 |
6.6 MB |
| Hardcore, Gabber/Babyboom/baby017/[B1] Happymen - Love Is You (Stunned Guys Hardcore Mix).mp3 |
7.2 MB |
| Hardcore, Gabber/Babyboom/baby017/[B2] Happymen - Love Is You (Dance Anthem Mix).mp3 |
6.2 MB |
| Hardcore, Gabber/Babyboom/baby018/[A1] Boombastic - Booooom!!!!!.mp3 |
4.9 MB |
| Hardcore, Gabber/Babyboom/baby018/[A2] Boombastic - Ain't That Fresh.mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom/baby018/[B1] Boombastic - One Love.mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom/baby018/[B2] Boombastic - You Got That Feeling.mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom/baby019/[A1] Don Escobar - Heart.mp3 |
6.2 MB |
| Hardcore, Gabber/Babyboom/baby019/[A2] Don Escobar - I Need It.mp3 |
6 MB |
| Hardcore, Gabber/Babyboom/baby019/[B1] Don Escobar - Wooh.mp3 |
5.6 MB |
| Hardcore, Gabber/Babyboom/baby019/[B2] Don Escobar - The God Of House.mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom/baby022/[A1] B.S.E. - Hard Attack.mp3 |
7.1 MB |
| Hardcore, Gabber/Babyboom/baby022/[A2] B.S.E. - Time Bomb.mp3 |
6.7 MB |
| Hardcore, Gabber/Babyboom/baby022/[B1] B.S.E. - Headache FM.mp3 |
7.3 MB |
| Hardcore, Gabber/Babyboom/baby022/[B2] B.S.E. - Make My Day.mp3 |
7.8 MB |
| Hardcore, Gabber/Babyboom/baby023/[B1] The Darkraver & DJ Vince - Tunnel.mp3 |
7.3 MB |
| Hardcore, Gabber/Babyboom/baby024/[A1] B.S.E. - Good Old Days.mp3 |
8.8 MB |
| Hardcore, Gabber/Babyboom/baby024/[B1] B.S.E. - Dance With The Devil.mp3 |
7 MB |
| Hardcore, Gabber/Babyboom/baby024/[B2] B.S.E. - Psalm 69.mp3 |
6.3 MB |
| Hardcore, Gabber/Babyboom/baby025/[B1] Boombastic - Rockin' Nation.mp3 |
6.3 MB |
| Hardcore, Gabber/Babyboom/baby025/[B2] Boombastic - Pussy.mp3 |
5.8 MB |
| Hardcore, Gabber/Babyboom/baby026/[A1] Black Knight - Back To Tha 'O' School.mp3 |
3 MB |
| Hardcore, Gabber/Babyboom/baby026/[B1] Black Knight - Bring The Basze.mp3 |
1.6 MB |
| Hardcore, Gabber/Babyboom/baby026/[B2] Black Knight - Keep It Going Now.mp3 |
3.8 MB |
| Hardcore, Gabber/Babyboom/baby027/[A1] Mister DJ - Screaming.mp3 |
3.9 MB |
| Hardcore, Gabber/Babyboom/baby027/[B1] Mister DJ - Time To Get Up.mp3 |
3.3 MB |
| Hardcore, Gabber/Babyboom/baby027/[B2] Mister DJ - Maximizer.mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom/baby028/[A1] B.S.E. - Wreerw.mp3 |
8 MB |
| Hardcore, Gabber/Babyboom/baby028/[B1] B.S.E. - Motherfxxker.mp3 |
5.4 MB |
| Hardcore, Gabber/Babyboom/baby028/[B2] B.S.E. - Adess Se Qui.mp3 |
7 MB |
| Hardcore, Gabber/Babyboom/baby029/[A1] Radical 2 React - Eliminating Suckers.mp3 |
2.8 MB |
| Hardcore, Gabber/Babyboom/baby029/[B1] Radical 2 React - Hardstreer Shit.mp3 |
6.5 MB |
| Hardcore, Gabber/Babyboom/baby029/[B2] Radical 2 React - Whoop My Body.mp3 |
3.8 MB |
| Hardcore, Gabber/Babyboom/baby030/[A1] Sound Enhancers - Punk Professionals.mp3 |
7.5 MB |
| Hardcore, Gabber/Babyboom/baby030/[A2] Sound Enhancers - Bass Gets Loose.mp3 |
6.8 MB |
| Hardcore, Gabber/Babyboom/baby030/[B1] Sound Enhancers - Drop That Sucker.mp3 |
5.6 MB |
| Hardcore, Gabber/Babyboom/baby030/[B2] Sound Enhancers - Arena Creations.mp3 |
8 MB |
| Hardcore, Gabber/Babyboom/baby031/[A1] Mister DJ - Freakin' It.mp3 |
4.4 MB |
| Hardcore, Gabber/Babyboom/baby031/[B1] Mister DJ - Nhema Gayakaya.mp3 |
2.9 MB |
| Hardcore, Gabber/Babyboom/baby031/[B2] Mister DJ - Real Drugdealer.mp3 |
3.2 MB |
| Hardcore, Gabber/Babyboom/baby032/[A1] DJ Isaac & The Viper - The Real Shit.mp3 |
5 MB |
| Hardcore, Gabber/Babyboom/baby032/[B1] DJ Isaac & The Viper - Fun-ky Beats.mp3 |
5.7 MB |
| Hardcore, Gabber/Babyboom/baby033/[A1] B.S.E. - I Have Your Power.mp3 |
4.9 MB |
| Hardcore, Gabber/Babyboom/baby033/[A2] B.S.E. - Darwin.mp3 |
4.4 MB |
| Hardcore, Gabber/Babyboom/baby033/[B1] B.S.E. - BSE.mp3 |
4.3 MB |
| Hardcore, Gabber/Babyboom/baby033/[B2] B.S.E. - Little White Pill.mp3 |
4.4 MB |
| Hardcore, Gabber/Babyboom/baby034/[A1] Mister DJ - It Ain't Over.mp3 |
4.8 MB |
| Hardcore, Gabber/Babyboom/baby034/[A2] Mister DJ - Pump Up Da Volume.mp3 |
6.7 MB |
| Hardcore, Gabber/Babyboom/baby034/[B1] Mister DJ - Completely Fucked Up (2nd Approach).mp3 |
6.5 MB |
| Hardcore, Gabber/Babyboom/baby034/[B2] Mister DJ - Get The Feeling.mp3 |
6.3 MB |
| Hardcore, Gabber/Babyboom/baby035/[A1] Be-As-Me - Virgin.mp3 |
7.3 MB |
| Hardcore, Gabber/Babyboom/baby036/[A1] Black Knight - What's Up Suckers.mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom/baby036/[A2] Black Knight - Hardcore Rhyme.mp3 |
3.7 MB |
| Hardcore, Gabber/Babyboom/baby036/[B1] Black Knight - Ruff Rider.mp3 |
4.2 MB |
| Hardcore, Gabber/Babyboom/baby037/[A1] Mister DJ - Nowhereland.mp3 |
2.9 MB |
| Hardcore, Gabber/Babyboom/baby037/[A2] Mister DJ - Wake Up.mp3 |
3.8 MB |
| Hardcore, Gabber/Babyboom/baby037/[B1] Mister DJ - Liberty.mp3 |
3.9 MB |
| Hardcore, Gabber/Babyboom/baby039/[A1] Mad-E-Fact - The Hustle.mp3 |
8.3 MB |
| Hardcore, Gabber/Babyboom/baby039/[A2] Mad-E-Fact - Elfland.mp3 |
8.9 MB |
| Hardcore, Gabber/Babyboom/baby039/[B1] Mad-E-Fact - Evil Returns.mp3 |
8.4 MB |
| Hardcore, Gabber/Babyboom/baby039/[B2] Mad-E-Fact - Tell The DJ.mp3 |
7.8 MB |
| Hardcore, Gabber/Babyboom/baby040/[A1] The Darkraver & DJ Vince - Thunderground.mp3 |
3.7 MB |
| Hardcore, Gabber/Babyboom/baby040/[A2] B.S.E. - Headache FM.mp3 |
7.2 MB |
| Hardcore, Gabber/Babyboom/baby040/[A3] Black Knight - Back To Da 'O' School.mp3 |
3 MB |
| Hardcore, Gabber/Babyboom/baby040/[B1] The Darkraver & DJ Vince - Intelligent Hardcore.mp3 |
4.6 MB |
| Hardcore, Gabber/Babyboom/baby040/[B2] Radical 2 React - Hardstreet Shit.mp3 |
6.5 MB |
| Hardcore, Gabber/Babyboom/baby040/[B3] DJ Isaac & The Viper - Fun-ky Beats.mp3 |
5.6 MB |
| Hardcore, Gabber/Babyboom/baby041/[B1] The Viper - No Tricks.mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom/baby042/[A1] G-Town Madness - Locked Down.mp3 |
3.4 MB |
| Hardcore, Gabber/Babyboom/baby042/[B1] G-Town Madness - Shot Up In The Brain.mp3 |
4.9 MB |
| Hardcore, Gabber/Babyboom/baby042/[B2] G-Town Madness - Smoked.mp3 |
7.4 MB |
| Hardcore, Gabber/Babyboom/baby043/[A1] The Viper - X-Terminate (T-1000 Mix).mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom/baby043/[A2] The Viper - X-Apella.mp3 |
1.6 MB |
| Hardcore, Gabber/Babyboom/baby043/[B1] The Viper - X-Terminate (CDS 101 Mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Babyboom/baby044/[A1] G-Town Madness vs. The Viper - Here It Comes.mp3 |
7.1 MB |
| Hardcore, Gabber/Babyboom/baby044/[B1] G-Town Madness vs. The Viper - Buck 'Em Down.mp3 |
7.6 MB |
| Hardcore, Gabber/Babyboom/baby045/[A1] The Viper - Bulletproof.mp3 |
7.8 MB |
| Hardcore, Gabber/Babyboom/baby045/[B1] The Viper - Be Hurt.mp3 |
7.2 MB |
| Hardcore, Gabber/Babyboom/baby046/[A1] The Viper - Intellectual Killer.mp3 |
8.4 MB |
| Hardcore, Gabber/Babyboom/baby046/[A2] The Viper - Don't Sample This (For Skilled DJ's Only).mp3 |
4.3 MB |
| Hardcore, Gabber/Babyboom/baby046/[B1] The Viper - Intellectual Killer (Nosferatu & Endymion Remix).mp3 |
9.3 MB |
| Hardcore, Gabber/Babyboom/baby046/[B2] The Viper - Drumz 2 Da Core.mp3 |
8.1 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse001/A.I.R. Miles - Children (BBSE001).mp3 |
8.3 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse001/A.I.R. Miles - Children (DJ Isaac remix) (BBSE001).mp3 |
6.4 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse002/Ferocious - Devistated (BBSE002).mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse002/Ferocious - Hardcore files (BBSE002).mp3 |
7.4 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse002/Ferocious - X-Hardcore files (DJ Rob mix) (BBSE002).mp3 |
5.9 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse003/Unknown - Drag u down (BBSE003).mp3 |
5.4 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse003/Unknown - Let's have some fun (DJ Isaac remix) (BBSE003).mp3 |
5.7 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse003/Unknown - Let's have some fun (El bruto mix) (BBSE003).mp3 |
4.7 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse003/Unknown - Let's have some fun (Extended version) (BBSE003).mp3 |
5.3 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse003/Unknown - Wicked (BBSE003).mp3 |
4.8 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse004/Black knight - Bomb, drop the bass (BBSE004).mp3 |
5.2 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse004/DJ Gizmo - Hurt nobody (BBSE004).mp3 |
9.3 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse004/DJ Isaac & mad-e-fact - Shuffle 2 tha middle (BBSE004).mp3 |
5.6 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse004/Radical 2 react - Get the crowd into it (BBSE004).mp3 |
6.8 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse005/DJ Isaac - Face down, ass up (BBSE005).mp3 |
6.9 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse005/DJ Isaac - Face down, ass up (Beatless) (BBSE005).mp3 |
2.6 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse005/DJ Isaac - Hardcore 2000 (BBSE005).mp3 |
7.2 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse005/DJ Isaac - Irritation (BBSE005).mp3 |
7.4 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse005/DJ Isaac - Super DJ (BBSE005).mp3 |
7.8 MB |
| Hardcore, Gabber/Babyboom Special Edition/bbse005/DJ Isaac - Super DJ (Techno warriors remix) (BBSE005).mp3 |
7.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 001 - bass-d & king matthew - the introduction ep/_BAD 001 (front).jpg |
191 KB |
| Hardcore, Gabber/Bad Vibes/bad 001 - bass-d & king matthew - the introduction ep/A1 - BASS-D & KING MATTHEW - Your Mind Is Right.mp3 |
4.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 001 - bass-d & king matthew - the introduction ep/A2 - BASS-D & KING MATTHEW - Listen To The Bass Go Boom.mp3 |
3.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 001 - bass-d & king matthew - the introduction ep/B1 - BASS-D & KING MATTHEW - Bugles.mp3 |
4.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 001 - bass-d & king matthew - the introduction ep/B2 - BASS-D & KING MATTHEW - Fucking Noise.mp3 |
4.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 002 - jean sibart & joel trambel - right is wrong/_BAD 002 (A).jpg |
352 KB |
| Hardcore, Gabber/Bad Vibes/bad 002 - jean sibart & joel trambel - right is wrong/_BAD 002 (B).jpg |
115 KB |
| Hardcore, Gabber/Bad Vibes/bad 002 - jean sibart & joel trambel - right is wrong/_BAD 002 (front).jpg |
77 KB |
| Hardcore, Gabber/Bad Vibes/bad 002 - jean sibart & joel trambel - right is wrong/_BAD 002 (sticker).jpg |
89 KB |
| Hardcore, Gabber/Bad Vibes/bad 002 - jean sibart & joel trambel - right is wrong/A1 - JEAN SIBART & JOEL TRAMBEL - Right Is Wrong.mp3 |
3.5 MB |
| Hardcore, Gabber/Bad Vibes/bad 002 - jean sibart & joel trambel - right is wrong/A2 - JEAN SIBART & JOEL TRAMBEL - Right Is Wrong (Right Mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 003 - bass-d & king matthew - happical vibratium/A1 - BASS-D & KING MATTHEW - Klik.mp3 |
5.5 MB |
| Hardcore, Gabber/Bad Vibes/bad 003 - bass-d & king matthew - happical vibratium/A2 - BASS-D & KING MATTHEW - What U Gonna Do.mp3 |
4.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 003 - bass-d & king matthew - happical vibratium/B1 - BASS-D & KING MATTHEW - Everybody Is Pumpin'.mp3 |
4.1 MB |
| Hardcore, Gabber/Bad Vibes/bad 003 - bass-d & king matthew - happical vibratium/B2 - BASS-D & KING MATTHEW - The Witch.mp3 |
4.7 MB |
| Hardcore, Gabber/Bad Vibes/bad 004 - dj weirdo & dj sim - borrowed sounds ep/_BAD 004 (A).jpg |
457 KB |
| Hardcore, Gabber/Bad Vibes/bad 004 - dj weirdo & dj sim - borrowed sounds ep/_BAD 004 (B).jpg |
415 KB |
| Hardcore, Gabber/Bad Vibes/bad 004 - dj weirdo & dj sim - borrowed sounds ep/A1 - DJ WEIRDO & DJ SIM - Kick This Muthaf#@ka.mp3 |
4.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 004 - dj weirdo & dj sim - borrowed sounds ep/A2 - DJ WEIRDO & DJ SIM - Good Times (Ragga Mix).mp3 |
4.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 004 - dj weirdo & dj sim - borrowed sounds ep/B1 - DJ WEIRDO & DJ SIM - It's Gonna Be Allright.mp3 |
4.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 004 - dj weirdo & dj sim - borrowed sounds ep/B2 - DJ SIM - Juno Testdrive.mp3 |
1.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 005 - re-charge - high voltage ep/_BAD 005 (A).jpg |
129 KB |
| Hardcore, Gabber/Bad Vibes/bad 005 - re-charge - high voltage ep/_BAD 005 (B).jpg |
166 KB |
| Hardcore, Gabber/Bad Vibes/bad 005 - re-charge - high voltage ep/A1 - RE-CHARGE - Experienz.mp3 |
5 MB |
| Hardcore, Gabber/Bad Vibes/bad 005 - re-charge - high voltage ep/A2 - RE-CHARGE - Big Beat.mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 005 - re-charge - high voltage ep/B1 - RE-CHARGE - Push It.mp3 |
4.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 005 - re-charge - high voltage ep/B2 - RE-CHARGE - Don't Worry About It.mp3 |
4.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 006 - duo pennotti - the beat goes/_BAD 006 (B).jpg |
415 KB |
| Hardcore, Gabber/Bad Vibes/bad 006 - duo pennotti - the beat goes/_BAD 006 (front).jpg |
265 KB |
| Hardcore, Gabber/Bad Vibes/bad 006 - duo pennotti - the beat goes/A1 - DUO PENNOTTI - The Beat Goes....mp3 |
5.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 006 - duo pennotti - the beat goes/A2 - DUO PENNOTTI - Tov Beatz (Punami Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 006 - duo pennotti - the beat goes/B1 - DUO PENNOTTI - Drop In Loading.mp3 |
3.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 006 - duo pennotti - the beat goes/B2 - DUO PENNOTTI - Addicted II Raves.mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 007 - bass d & king matthew - stick 'em up/A1 - Bass D & King Matthew - Stick 'Em Up (Symphony Mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 007 - bass d & king matthew - stick 'em up/A2 - Bass D & King Matthew - Stick 'Em Up (Gabba Mix).mp3 |
3.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 007 - bass d & king matthew - stick 'em up/B1 - Bass D & King Matthew ft. DJ XD - Heartbeat (Champ-E-On & Skorp Mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 007 - bass d & king matthew - stick 'em up/B2 - Bass D & King Matthew ft. DJ XD - Heartbeat (Party Mix).mp3 |
4.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 007 - bass d & king matthew - stick 'em up/B3 - Bass D & King Matthew ft. DJ XD - Heartbeat (Original Mix).mp3 |
5 MB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/_BAD 008 (A).jpg |
146 KB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/_BAD 008 (B).jpg |
172 KB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/_BAD 008 (sticker).jpg |
117 KB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/A1 - RE-CHARGE - Higher.mp3 |
4.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/A2 - RE-CHARGE - Everybody.mp3 |
4.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/B1 - RE-CHARGE - Ya' Ready.mp3 |
4 MB |
| Hardcore, Gabber/Bad Vibes/bad 008 - re-charge - high energy ep/B2 - RE-CHARGE - Voyager.mp3 |
4.1 MB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/_BAD 009 (A).jpg |
210 KB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/_BAD 009 (B).jpg |
219 KB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/_BAD 009 (front).jpg |
161 KB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/A1 - BRAINIAC - Put Your Hands Together.mp3 |
2.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/A2 - BRAINIAC - The Rhyme Goes On.mp3 |
3.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/B1 - BRAINIAC - No Shit For Me.mp3 |
3.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/B2 - BRAINIAC - I Feel Good.mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 009 - brainiac - the rhyme goes on/B3 - BRAINIAC - Put Your Hands Together (Remix).mp3 |
2.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 010 - various - the anniversary ep/A1 - Duo Penotti - Addicted 2 Raves (Dj Buzz Fuzz Remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 010 - various - the anniversary ep/A2 - Dj Weirdo & Dj Sim - Kick This Muthaf#@ka (Dj Jordens Remix).mp3 |
5.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 010 - various - the anniversary ep/B1 - Dj Weirdo & Dj Sim - It's Gonna Be Alright (Bass-D & King Matthew Remix).mp3 |
7 MB |
| Hardcore, Gabber/Bad Vibes/bad 010 - various - the anniversary ep/B2 - Bass-D & King Matthew - The Witch (Dj Promo Remix).mp3 |
8.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 011 - dj sim - cartoons in progress/A1 - Cartoons In Progress (Original Mix).mp3 |
5.5 MB |
| Hardcore, Gabber/Bad Vibes/bad 011 - dj sim - cartoons in progress/B1 - Loud As Fuck.mp3 |
6.5 MB |
| Hardcore, Gabber/Bad Vibes/bad 011 - dj sim - cartoons in progress/B2 - Loud As Fuck (54321 Mix).mp3 |
5.7 MB |
| Hardcore, Gabber/Bad Vibes/bad 012 - lords of the underworld - mind explosion/A1 - Lords Of The Underworld - Mind Explosion.mp3 |
6.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 012 - lords of the underworld - mind explosion/A2 - Lords Of The Underworld - Basic Ingredients.mp3 |
5.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 012 - lords of the underworld - mind explosion/B1 - Lords Of The Underworld - Hardcore Funk.mp3 |
4.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 012 - lords of the underworld - mind explosion/B2 - Lords Of The Underworld - Take It Easy.mp3 |
5.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/_BAD 014 (A).jpg |
143 KB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/_BAD 014 (B).jpg |
118 KB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/_BAD 014 (back).jpeg |
298 KB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/_BAD 014 (front).jpeg |
367 KB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/A1 - JEREMY - Throw (Hard Experience).mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/A2 - JEREMY - Throw (Original).mp3 |
5.1 MB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/B1 - JEREMY - Why Don't You Dance (Blub Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 014 - jeremy - nothing like yesterday ep/B2 - JEREMY - Why Don't You Dance (Cut Mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/_BAD 015 (A).jpg |
214 KB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/_BAD 015 (B).jpg |
160 KB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/_BAD 015 (back).jpeg |
333 KB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/_BAD 015 (front).jpeg |
406 KB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/A1 - RE-CHARGE - Fuck Me.mp3 |
4 MB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/B1 - RE-CHARGE - Why Can't We See.mp3 |
4 MB |
| Hardcore, Gabber/Bad Vibes/bad 015 - re-charge - why can't we see/B2 - RE-CHARGE - You Are A Sucka.mp3 |
3.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/00-3_steps_ahead_-_gangster-(bad016)-vinyl-1996-upe.jpg |
63 KB |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/00-3_steps_ahead_-_gangster-(bad016)-vinyl-1996-upe.m3u |
170 B |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/00-3_steps_ahead_-_gangster-(bad016)-vinyl-1996-upe.nfo |
16 KB |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/00-3_steps_ahead_-_gangster-(bad016)-vinyl-1996-upe.sfv |
327 B |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/01-3_steps_ahead_-_gangster_(feel_so_good)-upe.mp3 |
6.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/02-3_steps_ahead_-_in_the_name_of_love-upe.mp3 |
4.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/03-the_ender_-_me_so_horny-upe.mp3 |
10 MB |
| Hardcore, Gabber/Bad Vibes/bad 016 - 3 steps ahead - gangster/04-3_steps_ahead_-_crazy-upe.mp3 |
7.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/_BAD 017 (A).jpg |
152 KB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/_BAD 017 (back).jpg |
84 KB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/_BAD 017 (front).jpg |
129 KB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/A1 - DOMINION - Unicorn Evils (Strings Of Death).mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/A2 - DOMINION - Unicorn Evils (Strings Of Life).mp3 |
4 MB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/B1 - DOMINION - Hardcore Fantasy (Remix).mp3 |
4.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 017 - dominion - unicorn evils ep/B2 - DOMINION - Hardcore Fantasy (Original).mp3 |
4.5 MB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/_BAD 017.5 (A).jpg |
103 KB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/_BAD 017.5 (B).jpg |
124 KB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/_BAD 017.5 (back).jpg |
50 KB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/_BAD 017.5 (front).jpg |
126 KB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/A1 - DJ SIM - My Territory.mp3 |
3.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/A2 - DJ SIM - 24k Solid Bass.mp3 |
3.8 MB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/A3 - DJ SIM - When I Start To Kick It.mp3 |
4.1 MB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/B1 - DJ SIM - Take This.mp3 |
4.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 017.5 - dj sim - hardcore tracks vol. 1/B2 - DJ SIM - Track With Rhythm.mp3 |
3.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 018 - dj delirium & guitar rob - the way that we rocked it/_BAD 018 (A).jpg |
123 KB |
| Hardcore, Gabber/Bad Vibes/bad 018 - dj delirium & guitar rob - the way that we rocked it/A1 - DJ DELIRIUM & GUITAR ROB - The Way That...(Live In NYC).mp3 |
5.5 MB |
| Hardcore, Gabber/Bad Vibes/bad 018 - dj delirium & guitar rob - the way that we rocked it/A2 - DJ DELIRIUM & GUITAR ROB - The Way... (NYC Live Short).mp3 |
3.6 MB |
| Hardcore, Gabber/Bad Vibes/bad 018 - dj delirium & guitar rob - the way that we rocked it/B1 - DJ DELIRIUM & GUITAR ROB - Speakermurder.mp3 |
4.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 018 - dj delirium & guitar rob - the way that we rocked it/B2 - DJ DELIRIUM & GUITAR ROB - Sexdrive.mp3 |
3.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 019 - public domain - old domain/A1 - Old Domain.mp3 |
4.1 MB |
| Hardcore, Gabber/Bad Vibes/bad 019 - public domain - old domain/A2 - The Puritan (Voice Mix).mp3 |
5.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 019 - public domain - old domain/B1 - It's Not Over.mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 019 - public domain - old domain/B2 - Hypnotise.mp3 |
3.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 019 - public domain - old domain/B3 - Space Mountain.mp3 |
4.3 MB |
| Hardcore, Gabber/Bad Vibes/bad 020 - dj sim, wax & bernd - plain and simple/A1 - Plain And Simple.mp3 |
5.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 020 - dj sim, wax & bernd - plain and simple/A2 - The Saga Continious.mp3 |
5.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 020 - dj sim, wax & bernd - plain and simple/A3 - Untitled.mp3 |
4.9 MB |
| Hardcore, Gabber/Bad Vibes/bad 020 - dj sim, wax & bernd - plain and simple/B1 - Fuckin' Noise.mp3 |
5.4 MB |
| Hardcore, Gabber/Bad Vibes/bad 020 - dj sim, wax & bernd - plain and simple/B2 - Punk Motherfucker.mp3 |
5.2 MB |
| Hardcore, Gabber/Bad Vibes/bad 020 - dj sim, wax & bernd - plain and simple/B3 - Untitled.mp3 |
966 KB |
| Hardcore, Gabber/Bananas Records/bananas007/kgbkid-hideyouremix.mp3 |
6.5 MB |
| Hardcore, Gabber/Bang a Rang/bag001/a1_kid_606_-_wickid_(gabber_recharge_mix)-sq.mp3 |
6.8 MB |
| Hardcore, Gabber/Bang a Rang/bag001/b1_kid_606_-_wickid_(hate_on_version)-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Bang a Rang/bag001/b2_kid_606_-_bonus_beat_1-sq.mp3 |
4.8 MB |
| Hardcore, Gabber/Bang a Rang/bag001/b3_kid_606_-_bonus_beat_2-sq.mp3 |
3.3 MB |
| Hardcore, Gabber/Bang a Rang/bag002/a1-mr_kill-voodoo_magic-trt.mp3 |
12.7 MB |
| Hardcore, Gabber/Bang a Rang/bag002/a2-mr_kill-infinite_loop-trt.mp3 |
416 KB |
| Hardcore, Gabber/Bang a Rang/bag002/b1-mr_kill-brukout-trt.mp3 |
11.6 MB |
| Hardcore, Gabber/Bang a Rang/bag002/b2-mr_kill-xxx-trt.mp3 |
4.1 MB |
| Hardcore, Gabber/Bang a Rang/bag003/a1_venetian_snares_-_die_winnipeg_die_die_die_fuckers_die-sq.mp3 |
9.4 MB |
| Hardcore, Gabber/Bang a Rang/bag003/b1_venetian_snares_-_winnipeg_as_mandatory_scat_feed-sq.mp3 |
9.5 MB |
| Hardcore, Gabber/Bang a Rang/bag004/a1-venetian_snares-sample_loop-trt.mp3 |
803 KB |
| Hardcore, Gabber/Bang a Rang/bag004/a3-venetian_snares-winnipeg_is_a_dogshit_dildo-trt.mp3 |
6.6 MB |
| Hardcore, Gabber/Bang a Rang/bag004/b1-venetian_snares-winnipeg_is_fucking_over-trt.mp3 |
11.7 MB |
| Hardcore, Gabber/Bangers Records/Promo-Up_Yours-(BGR003)-Vinyl-2007-UNiT/00-promo-up_yours-(bgr003)-vinyl-2007-unit.m3u |
105 B |
| Hardcore, Gabber/Bangers Records/Promo-Up_Yours-(BGR003)-Vinyl-2007-UNiT/00-promo-up_yours-(bgr003)-vinyl-2007-unit.nfo |
7 KB |
| Hardcore, Gabber/Bangers Records/Promo-Up_Yours-(BGR003)-Vinyl-2007-UNiT/00-promo-up_yours-(bgr003)-vinyl-2007-unit.sfv |
125 B |
| Hardcore, Gabber/Bangers Records/Promo-Up_Yours-(BGR003)-Vinyl-2007-UNiT/01-promo-up_yours_(original_mix)-unit.mp3 |
8.3 MB |
| Hardcore, Gabber/Bangers Records/Promo-Up_Yours-(BGR003)-Vinyl-2007-UNiT/02-promo-up_yours_(da_hard_bangers_feat_dj_e-max_rmx)-unit.mp3 |
6.6 MB |
| Hardcore, Gabber/bash/bash 07 raver's nature back to the rave ep (12)/a1. raver's nature - sounds of house.mp3 |
7.1 MB |
| Hardcore, Gabber/bash/bash 07 raver's nature back to the rave ep (12)/a2. raver's nature - speed line.mp3 |
7.3 MB |
| Hardcore, Gabber/bash/bash 07 raver's nature back to the rave ep (12)/b1. raver's nature - lost in space.mp3 |
6.6 MB |
| Hardcore, Gabber/bash/bash 07 raver's nature back to the rave ep (12)/b2. raver's nature - hard voice.mp3 |
7.9 MB |
| Hardcore, Gabber/Bionic/bionic001/a1 - ki-real - virus.mp3 |
7.1 MB |
| Hardcore, Gabber/Bionic/bionic001/a2 - ki-real - virus (ferox remix).mp3 |
7.8 MB |
| Hardcore, Gabber/Bionic/bionic001/b1 - ferox - reefer.mp3 |
6.3 MB |
| Hardcore, Gabber/Bionic/bionic001/b2 - ferox - it's just begun.mp3 |
6.6 MB |
| Hardcore, Gabber/Bionic/bionic002/a1-ki-real - claim ur prize.mp3 |
7 MB |
| Hardcore, Gabber/Bionic/bionic002/a2-ferox - fear(ox).mp3 |
8.1 MB |
| Hardcore, Gabber/Bionic/bionic002/b1-ki-real - body and brain.mp3 |
7.1 MB |
| Hardcore, Gabber/Bionic/bionic002/b2-ferox - destiny.mp3 |
7.7 MB |
| Hardcore, Gabber/Bionic/bionic003/A1 - Endymion - Looking For Your Own Kind.mp3 |
8 MB |
| Hardcore, Gabber/Bionic/bionic003/A2 - Endymion - The Blue Dragon.mp3 |
7.1 MB |
| Hardcore, Gabber/Bionic/bionic003/B1 - Endymion - Refuse To Be Bought.mp3 |
6.7 MB |
| Hardcore, Gabber/Bionic/bionic003/B2 - Endymion - I Am For Ever.mp3 |
6.6 MB |
| Hardcore, Gabber/Bionic/bionic004/(a1) ki-real - the warning.mp3 |
6.1 MB |
| Hardcore, Gabber/Bionic/bionic004/(a2) ki-real - let's pray.mp3 |
6.9 MB |
| Hardcore, Gabber/Bionic/bionic004/(b1) ferox - getting high.mp3 |
7.1 MB |
| Hardcore, Gabber/Bionic/bionic004/(b2) ferox - eternity.mp3 |
5 MB |
| Hardcore, Gabber/Bionic/bionic005/a1_ferox_and_ki-real_-_damn_people-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Bionic/bionic005/a2_ferox_-_getting_high_(dj_d_rmx)-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Bionic/bionic005/b1_ki-real_-_fallout_existence-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Bionic/bionic005/b2_ferox_-_shoot_me-sq.mp3 |
7 MB |
| Hardcore, Gabber/Bionic/bionic006/a1_bionic_commanders_-_all_good._all_right-sq.Mp3 |
4.1 MB |
| Hardcore, Gabber/Bionic/bionic006/a2_bionic_commanders_-_why-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Bionic/bionic006/b1_bionic_commanders_-_bjusterbaarlik-sq.mp3 |
7 MB |
| Hardcore, Gabber/Bionic/bionic006/b2_bionic_commanders_-_eternity_(ki-real_remix)-sq.mp3 |
7 MB |
| Hardcore, Gabber/Bionic/bionic007/a1_prowler_-_reality-sq.mp3 |
7.9 MB |
| Hardcore, Gabber/Bionic/bionic007/a2_prowler_-_keep_it_real-sq.mp3 |
7.9 MB |
| Hardcore, Gabber/Bionic/bionic007/b1_archetype_-_proceed_with_caution-sq.mp3 |
8 MB |
| Hardcore, Gabber/Bionic/bionic007/b2_archetype_-_rotation-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Bionic/bionic008/a1_prowler_-_falling_down-sq.mp3 |
7.9 MB |
| Hardcore, Gabber/Bionic/bionic008/a2_prowler_-_no_turning_back-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Bionic/bionic008/b1_prowler_-_face_of_death-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Bionic/bionic009/a1_prowler_vs_nexes_-_polographic_demons-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Bionic/bionic009/a2_d-drive_-_weapons_and_ammunition-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Bionic/bionic009/b1_archetype_-_uncontrollable_urges-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Bionic/bionic009/b2_hamunaptra_-_sector_9-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Bionic/bionic010/a1_d-drive_-_exist-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Bionic/bionic010/a2_d-drive_-_the_pain-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Bionic/bionic010/b1_prowler_vs_nexes_-_advanced_enemies-sq.mp3 |
8 MB |
| Hardcore, Gabber/Bionic/bionic010/b2_prowler_-_devils_chase-sq.mp3 |
9.3 MB |
| Hardcore, Gabber/Bionic/bionic011/a1_ophidian_-_complex-sq.mp3 |
850 KB |
| Hardcore, Gabber/Bionic/bionic011/a2_ophidian_and_tapage_-_the_mine-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Bionic/bionic011/a3_ophidian_-_thilynn-sq.mp3 |
5.8 MB |
| Hardcore, Gabber/Bionic/bionic011/b1_ophidian_and_tapage_-_the_machine-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Bionic/bionic011/b2_ophidian_-_drawhole-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Bionic/bionic011/b3_ophidian_and_tapage_-_taesatttanfos-sq.mp3 |
588 KB |
| Hardcore, Gabber/Bionic/bionic012/BIONIC 12 -A1- DJ Nosferatu & Endymion vs. The Viper - Proje.mp3 |
10.9 MB |
| Hardcore, Gabber/Bionic/bionic012/BIONIC 12 -A2- DJ Nosferatu & Endymion vs. The Viper - Proje.mp3 |
636 KB |
| Hardcore, Gabber/Bionic/bionic012/BIONIC 12 -B1- DJ Nosferatu & Endymion vs. The Viper - Proje.mp3 |
9 MB |
| Hardcore, Gabber/Bionic/bionic012/BIONIC 12 -B2- DJ Nosferatu & Endymion vs. The Viper - Proje.mp3 |
1.2 MB |
| Hardcore, Gabber/Bionic/bionic012/BIONIC 12 -B3- DJ Nosferatu & Endymion - Reformation.mp3 |
8.1 MB |
| Hardcore, Gabber/Bionic/bionic014/00_nexes_-_angry_by_default-(bionic014)-vinyl-2006.m3u |
143 B |
| Hardcore, Gabber/Bionic/bionic014/00_nexes_-_angry_by_default-(bionic014)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Bionic/bionic014/00_nexes_-_angry_by_default-(bionic014)-vinyl-2006.sfv |
179 B |
| Hardcore, Gabber/Bionic/bionic014/a1_nexes_-_project_2501_(merge).mp3 |
11 MB |
| Hardcore, Gabber/Bionic/bionic014/a2_nexes_-_absence_of_light.mp3 |
9.1 MB |
| Hardcore, Gabber/Bionic/bionic014/b1_nexes_-_dedicated_to_dancers_(feat_ophidian).mp3 |
11.2 MB |
| Hardcore, Gabber/Bionic/bionic014/b2_nexes_-_t-virus.mp3 |
8.2 MB |
| Hardcore, Gabber/Bionic/bionic015/00-va-a_kingdom_divided-(bionic15)-vinyl-2007-1real.jpg |
49 KB |
| Hardcore, Gabber/Bionic/bionic015/00-va-a_kingdom_divided-(bionic15)-vinyl-2007-1real.m3u |
149 B |
| Hardcore, Gabber/Bionic/bionic015/00-va-a_kingdom_divided-(bionic15)-vinyl-2007-1real.nfo |
8 KB |
| Hardcore, Gabber/Bionic/bionic015/00-va-a_kingdom_divided-(bionic15)-vinyl-2007-1real.sfv |
185 B |
| Hardcore, Gabber/Bionic/bionic015/a1-scythe-never_wake-1real.mp3 |
9 MB |
| Hardcore, Gabber/Bionic/bionic015/a2-scythe-a_new_world_awaits_you-1real.mp3 |
11 MB |
| Hardcore, Gabber/Bionic/bionic015/b1-necrid-circle_of_sacrifice-1real.mp3 |
9.1 MB |
| Hardcore, Gabber/Bionic/bionic015/b2-necrid-eternal_hunger-1real.mp3 |
8.3 MB |
| Hardcore, Gabber/Bionic/bionic016/00_the_wishmaster_-_ground_pressure-(bionic016)-vinyl-2007.m3u |
200 B |
| Hardcore, Gabber/Bionic/bionic016/00_the_wishmaster_-_ground_pressure-(bionic016)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Bionic/bionic016/00_the_wishmaster_-_ground_pressure-(bionic016)-vinyl-2007.sfv |
236 B |
| Hardcore, Gabber/Bionic/bionic016/a1_the_wishmaster_-_pump_up_the_pressure.mp3 |
6.8 MB |
| Hardcore, Gabber/Bionic/bionic016/a2_the_wishmaster_-_bass_in_ya_face.mp3 |
7.7 MB |
| Hardcore, Gabber/Bionic/bionic016/b1_the_wishmaster_-_to_the_ground_(feat_impulse_factory).mp3 |
7.9 MB |
| Hardcore, Gabber/Bionic/bionic016/b2_the_wishmaster_-_critters_(feat_life_runs_red).mp3 |
7.9 MB |
| Hardcore, Gabber/Bionik/bionik007/00_roms_aka_harry_potar-steeve_austin_powers_ep-(bionik07)-vinyl-2007-ct.m3u |
198 B |
| Hardcore, Gabber/Bionik/bionik007/00_roms_aka_harry_potar-steeve_austin_powers_ep-(bionik07)-vinyl-2007-ct.nfo |
15 KB |
| Hardcore, Gabber/Bionik/bionik007/00_roms_aka_harry_potar-steeve_austin_powers_ep-(bionik07)-vinyl-2007-ct.sfv |
234 B |
| Hardcore, Gabber/Bionik/bionik007/a1_roms_aka_harry_potar-steeve_austin_powers-ct.mp3 |
9.3 MB |
| Hardcore, Gabber/Bionik/bionik007/a2_roms_aka_harry_potar-church_n_destroy-ct.mp3 |
9.5 MB |
| Hardcore, Gabber/Bionik/bionik007/b1_roms_aka_harry_potar-iam_super_heroms-ct.mp3 |
9.5 MB |
| Hardcore, Gabber/Bionik/bionik007/b2_roms_aka_harry_potar-kangooroo_core-ct.mp3 |
9.3 MB |
| Hardcore, Gabber/Blast Beat/005/00-noisekick_and_noizefucker-untitled-(blastbeat05)-vinyl-2006-1real.m3u |
278 B |
| Hardcore, Gabber/Blast Beat/005/00-noisekick_and_noizefucker-untitled-(blastbeat05)-vinyl-2006-1real.nfo |
7 KB |
| Hardcore, Gabber/Blast Beat/005/00-noisekick_and_noizefucker-untitled-(blastbeat05)-vinyl-2006-1real.sfv |
332 B |
| Hardcore, Gabber/Blast Beat/005/a1-noisekick-boterhammen_met_kaas_onder_water_opeten-1real.mp3 |
5.9 MB |
| Hardcore, Gabber/Blast Beat/005/a2-noisekick-believe_in_nothing-1real.mp3 |
5.2 MB |
| Hardcore, Gabber/Blast Beat/005/a3-the_untitled-idols_666-1real.mp3 |
7.2 MB |
| Hardcore, Gabber/Blast Beat/005/b1-noizefucker-murderers_of_death-1real.mp3 |
8 MB |
| Hardcore, Gabber/Blast Beat/005/b2-noizefucker-feelings_of_hate_(666_mix)-1real.mp3 |
6.5 MB |
| Hardcore, Gabber/Blast Beat/005/b3-noizefucker-info_lame_frame-1real.mp3 |
7 MB |
| Hardcore, Gabber/Bloodshed Unlimited/shed002/a1 hell itself.mp3 |
7 MB |
| Hardcore, Gabber/Bloodshed Unlimited/shed002/a2 hate is a strong word.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloodshed Unlimited/shed002/b1 angel.mp3 |
6.3 MB |
| Hardcore, Gabber/Bloodshed Unlimited/shed002/b2 i am the fear (nightmare).mp3 |
6.5 MB |
| Hardcore, Gabber/Bloody Fist/fist 35 aftermath epsilon 1994-2004 (black vinyl version) (12)/B1 - Epsilon - No Try.mp3 |
7 MB |
| Hardcore, Gabber/Bloody Fist/fist001/A1 - Syndicate - Lower Level.mp3 |
5 MB |
| Hardcore, Gabber/Bloody Fist/fist001/A2 - Pendulum - Minchia.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist001/A3 - Nasenbluten - What Ye Deserve.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist001/B1 - Syndicate - Appleseed.mp3 |
4.6 MB |
| Hardcore, Gabber/Bloody Fist/fist001/B2 - Pendulum - Feel The Pain.mp3 |
3.5 MB |
| Hardcore, Gabber/Bloody Fist/fist001/B3 - Nasenbluten - Blows T' The Nose (+Dannii Gets A Fucking Bullet - Cliched Samples).mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist001/B4 - Nasenbluten - Cocksucker (Xylocaine Remix).mp3 |
1018 KB |
| Hardcore, Gabber/Bloody Fist/fist002/[A1] The Shaftman - Shaftman.mp3 |
4.8 MB |
| Hardcore, Gabber/Bloody Fist/fist002/[A2] Xylocaine - Luftwaffe.mp3 |
5.1 MB |
| Hardcore, Gabber/Bloody Fist/fist002/[A3] Pendulum - Uncle Sam.mp3 |
3.9 MB |
| Hardcore, Gabber/Bloody Fist/fist002/[A4] Gonad Brigade - Fritz Doesn't Give A Shit.mp3 |
212 KB |
| Hardcore, Gabber/Bloody Fist/fist002/[B1] Overcast - Rougher.mp3 |
4.8 MB |
| Hardcore, Gabber/Bloody Fist/fist002/[B2] Syndicate - M'Shit Hardcore.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist002/[B3] Pendulum - Restricted Area (+ Stolen Scratch Samples).mp3 |
4.8 MB |
| Hardcore, Gabber/Bloody Fist/fist003/a1 - nasenbluten - garbage.mp3 |
4.6 MB |
| Hardcore, Gabber/Bloody Fist/fist003/a2 - nasenbluten - painbringer.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist003/a3 - nasenbluten - skullbash.mp3 |
5.6 MB |
| Hardcore, Gabber/Bloody Fist/fist003/b1 - nasenbluten - homicide.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist003/b2 - nasenbluten - disassembler.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist003/b3 - nasenbluten - we've got the balls.mp3 |
5.4 MB |
| Hardcore, Gabber/Bloody Fist/fist003/b4 - nasenbluten - bitch (where's ya fuckin' drummer).mp3 |
1.8 MB |
| Hardcore, Gabber/Bloody Fist/fist005/a1 - memetic - more fukt crap.mp3 |
3 MB |
| Hardcore, Gabber/Bloody Fist/fist005/a2 - memetic - whine spritzer.mp3 |
3.4 MB |
| Hardcore, Gabber/Bloody Fist/fist005/a3 - memetic - all picture sy.mp3 |
3.6 MB |
| Hardcore, Gabber/Bloody Fist/fist005/a4 - memetic - femme fatality.mp3 |
2.6 MB |
| Hardcore, Gabber/Bloody Fist/fist005/a5 - memetic - destruk.mp3 |
714 KB |
| Hardcore, Gabber/Bloody Fist/fist005/b1 - netas - sex passage.mp3 |
5.5 MB |
| Hardcore, Gabber/Bloody Fist/fist005/b2 - netas - circus mayhem.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist005/b3 - netas - gustav bootlikma.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist006/01 - appetite for destruction.mp3 |
4.1 MB |
| Hardcore, Gabber/Bloody Fist/fist006/02 - wize wordz.mp3 |
3.7 MB |
| Hardcore, Gabber/Bloody Fist/fist006/03 - nightmare v3.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist006/04 - watch me bash this.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist006/05 - jungle fever.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist006/06 - keep it hardcore.mp3 |
3.9 MB |
| Hardcore, Gabber/Bloody Fist/fist006/07 - icepick.mp3 |
3.2 MB |
| Hardcore, Gabber/Bloody Fist/fist006/08 - suicide.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist006/09 - live 'n love.mp3 |
4.6 MB |
| Hardcore, Gabber/Bloody Fist/fist006/10 - guerillas in the mist.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist006/11 - full contact.mp3 |
4.8 MB |
| Hardcore, Gabber/Bloody Fist/fist006/12 - face down arse up.mp3 |
3.5 MB |
| Hardcore, Gabber/Bloody Fist/fist007/A1 - Public Enemy.mp3 |
4.7 MB |
| Hardcore, Gabber/Bloody Fist/fist007/A2 - Bunker.mp3 |
3.9 MB |
| Hardcore, Gabber/Bloody Fist/fist007/A3 - Vortex (Armageddon Mix).mp3 |
2.1 MB |
| Hardcore, Gabber/Bloody Fist/fist007/B1 - Sourre.mp3 |
4.8 MB |
| Hardcore, Gabber/Bloody Fist/fist007/B2 - Feel This.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist007/B3 - Motherfuck.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist008/a1 - hedonist - mind grind.mp3 |
6.1 MB |
| Hardcore, Gabber/Bloody Fist/fist008/a2 - hedonist - noise job.mp3 |
4.5 MB |
| Hardcore, Gabber/Bloody Fist/fist008/a3 - hedonist - botulism.mp3 |
3.1 MB |
| Hardcore, Gabber/Bloody Fist/fist008/b1 - hedonist - talk back.mp3 |
3.4 MB |
| Hardcore, Gabber/Bloody Fist/fist008/b2 - hedonist - bothered.mp3 |
4.4 MB |
| Hardcore, Gabber/Bloody Fist/fist008/b3 - hedonist - drop in.mp3 |
3.3 MB |
| Hardcore, Gabber/Bloody Fist/fist008/b4 - hedonist - divide overflow.mp3 |
3.9 MB |
| Hardcore, Gabber/Bloody Fist/fist009/a1_xylocaine_-_minder-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Bloody Fist/fist009/a2_xylocaine_-_krack-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Bloody Fist/fist009/a3_xylocaine_-_violent_thoughts_use_me-sq.mp3 |
4.4 MB |
| Hardcore, Gabber/Bloody Fist/fist009/b1_xylocaine_-_c.-sq.mp3 |
1.9 MB |
| Hardcore, Gabber/Bloody Fist/fist009/b2_xylocaine_-_street_sam-sq.mp3 |
9.4 MB |
| Hardcore, Gabber/Bloody Fist/fist009/b3_xylocaine_-_440hz-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Bloody Fist/fist009/c1_xylocaine_-_special_treat-sq.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist009/c2_xylocaine_-_cluster_bombs-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Bloody Fist/fist009/c3_xylocaine_-_phys_add-sq.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist009/c4_xylocaine_-_research-sq.mp3 |
3.5 MB |
| Hardcore, Gabber/Bloody Fist/fist009/d1_xylocaine_-_vampire-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Bloody Fist/fist009/d2_xylocaine_-_decker-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Bloody Fist/fist009/d3_xylocaine_-_styling-sq.mp3 |
6.8 MB |
| Hardcore, Gabber/Bloody Fist/fist010/A1 - Intensity.mp3 |
2 MB |
| Hardcore, Gabber/Bloody Fist/fist010/A2 - Lunatic.mp3 |
3.8 MB |
| Hardcore, Gabber/Bloody Fist/fist010/A3 - Killer.mp3 |
3.8 MB |
| Hardcore, Gabber/Bloody Fist/fist010/A4 - Devil Spawn.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist010/B1 - Dead Babies.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist010/B2 - Grim Reaper.mp3 |
3.8 MB |
| Hardcore, Gabber/Bloody Fist/fist010/B3 - Massacre.mp3 |
4.5 MB |
| Hardcore, Gabber/Bloody Fist/fist011/A1. Memetic - Untitled.mp3 |
5.5 MB |
| Hardcore, Gabber/Bloody Fist/fist011/A2. Memetic - Untitled.mp3 |
7.1 MB |
| Hardcore, Gabber/Bloody Fist/fist011/A3. Memetic - Untitled.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist011/A4. Memetic - Untitled.mp3 |
490 KB |
| Hardcore, Gabber/Bloody Fist/fist011/B1. Memetic - Untitled.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist011/B2. Memetic - Untitled.mp3 |
2.9 MB |
| Hardcore, Gabber/Bloody Fist/fist011/B3. Memetic - Untitled.mp3 |
2.6 MB |
| Hardcore, Gabber/Bloody Fist/fist011/B4. Memetic - Untitled.mp3 |
6 MB |
| Hardcore, Gabber/Bloody Fist/fist011/B5. Memetic - Untitled.mp3 |
738 KB |
| Hardcore, Gabber/Bloody Fist/fist012/a1_disable.mp3 |
6.5 MB |
| Hardcore, Gabber/Bloody Fist/fist012/a2_muthafucker.mp3 |
5.8 MB |
| Hardcore, Gabber/Bloody Fist/fist012/a3_ground_zero.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist012/b1_termination.mp3 |
7.3 MB |
| Hardcore, Gabber/Bloody Fist/fist012/b2_raw.mp3 |
6.1 MB |
| Hardcore, Gabber/Bloody Fist/fist012/b3_terrorists.mp3 |
4.5 MB |
| Hardcore, Gabber/Bloody Fist/fist013/A1 - Discharge.mp3 |
7.4 MB |
| Hardcore, Gabber/Bloody Fist/fist013/A2 - Mortar Attack.mp3 |
5.6 MB |
| Hardcore, Gabber/Bloody Fist/fist013/B1 - Polis.mp3 |
3.6 MB |
| Hardcore, Gabber/Bloody Fist/fist013/B2 - Piledriver.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist013/B3 - Barbara.mp3 |
4.5 MB |
| Hardcore, Gabber/Bloody Fist/fist013/B4 - Noize Outro.mp3 |
829 KB |
| Hardcore, Gabber/Bloody Fist/fist014/A1 - Race Through Hell.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist014/A2 - Sweet Dreams.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist014/A3 - Crackhead.mp3 |
4.7 MB |
| Hardcore, Gabber/Bloody Fist/fist014/B1 - Final Step.mp3 |
4.4 MB |
| Hardcore, Gabber/Bloody Fist/fist014/B2 - Darkness.mp3 |
4.4 MB |
| Hardcore, Gabber/Bloody Fist/fist014/B3 - Help Me Mama.mp3 |
4.5 MB |
| Hardcore, Gabber/Bloody Fist/fist015/01 - Fraughman - All gone.mp3 |
4.6 MB |
| Hardcore, Gabber/Bloody Fist/fist015/02 - Fraughman - Gas mask.mp3 |
4.7 MB |
| Hardcore, Gabber/Bloody Fist/fist015/03 - Fraughman - Murdered with scissors.mp3 |
6.8 MB |
| Hardcore, Gabber/Bloody Fist/fist015/03 - Fraughman - Noise (Memetic rmx).mp3 |
1.9 MB |
| Hardcore, Gabber/Bloody Fist/fist015/04 - Fraughman - Backstah.mp3 |
3.6 MB |
| Hardcore, Gabber/Bloody Fist/fist015/05 - Fraughman - Onslaught.mp3 |
5 MB |
| Hardcore, Gabber/Bloody Fist/fist015/06 - Fraughman - Profits of doom.mp3 |
5.7 MB |
| Hardcore, Gabber/Bloody Fist/fist015/07 - Fraughman - Know my hanger.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist015/08 - Fraughman - Crop.mp3 |
3.5 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[a1] overcast - intro.mp3 |
1.1 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[a2] overcast - punk motherfuckers.mp3 |
6.4 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[a3] overcast - i will attack.mp3 |
5.3 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[a4] overcast - noise 1.mp3 |
394 KB |
| Hardcore, Gabber/Bloody Fist/fist016/[b1] overcast - sydney.mp3 |
1.2 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[b2] overcast - scratch track.mp3 |
5 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[b3] overcast - raining stones.mp3 |
6.7 MB |
| Hardcore, Gabber/Bloody Fist/fist016/[b4] overcast - last track.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist017/A - Grief.mp3 |
11.1 MB |
| Hardcore, Gabber/Bloody Fist/fist017/B - Fallout.mp3 |
11.2 MB |
| Hardcore, Gabber/Bloody Fist/fist018/A1 - Fuck Sydney.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist018/A2 - Visions of Death.mp3 |
4.6 MB |
| Hardcore, Gabber/Bloody Fist/fist018/A3 - Mac Eleven.mp3 |
5.5 MB |
| Hardcore, Gabber/Bloody Fist/fist018/B1 - Hypnotize (Rmx).mp3 |
5.4 MB |
| Hardcore, Gabber/Bloody Fist/fist018/B2 - Compton.mp3 |
5.1 MB |
| Hardcore, Gabber/Bloody Fist/fist018/B3 - Jungle Muffin.mp3 |
5.1 MB |
| Hardcore, Gabber/Bloody Fist/fist019/A1 - Lotsawayz To Die.mp3 |
4.1 MB |
| Hardcore, Gabber/Bloody Fist/fist019/A2 - The Player.mp3 |
3.9 MB |
| Hardcore, Gabber/Bloody Fist/fist019/A3 - Traitor.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist019/B1 - Shadow Of Darkness.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist019/B2 - 0 Degrees Kelvin.mp3 |
3.7 MB |
| Hardcore, Gabber/Bloody Fist/fist019/B3 - B Grade.mp3 |
5.9 MB |
| Hardcore, Gabber/Bloody Fist/fist020/[A1] Memetic - Untitled.mp3 |
7.5 MB |
| Hardcore, Gabber/Bloody Fist/fist020/[B1] Memetic - Untitled.mp3 |
3.2 MB |
| Hardcore, Gabber/Bloody Fist/fist020/[B2] Memetic - Untitled.mp3 |
5.3 MB |
| Hardcore, Gabber/Bloody Fist/fist020/[B3] Memetic - Untitled.mp3 |
2.2 MB |
| Hardcore, Gabber/Bloody Fist/fist020/[B4] Memetic - Untitled.mp3 |
6.4 MB |
| Hardcore, Gabber/Bloody Fist/fist020/[B5] Memetic - Untitled.mp3 |
3.6 MB |
| Hardcore, Gabber/Bloody Fist/fist023/A1 - Badman.mp3 |
4.2 MB |
| Hardcore, Gabber/Bloody Fist/fist023/A2 - Resurrection.mp3 |
4 MB |
| Hardcore, Gabber/Bloody Fist/fist023/A3 - I Think It's Time.mp3 |
4.7 MB |
| Hardcore, Gabber/Bloody Fist/fist023/B1 - No Escape.mp3 |
5.4 MB |
| Hardcore, Gabber/Bloody Fist/fist023/B2 - Revenge.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist024/A1 - Intro.mp3 |
324 KB |
| Hardcore, Gabber/Bloody Fist/fist024/A2 - 21%.mp3 |
5.8 MB |
| Hardcore, Gabber/Bloody Fist/fist024/A3 - Fully Industrial A.mp3 |
5.3 MB |
| Hardcore, Gabber/Bloody Fist/fist024/B1 - How's Work.mp3 |
7.4 MB |
| Hardcore, Gabber/Bloody Fist/fist024/B2 - Trash.mp3 |
4.3 MB |
| Hardcore, Gabber/Bloody Fist/fist025/a1 - fluorocarbon - breakfast biscuit.mp3 |
3.8 MB |
| Hardcore, Gabber/Bloody Fist/fist025/a2 - fluorocarbon - poozer.mp3 |
2.6 MB |
| Hardcore, Gabber/Bloody Fist/fist025/a3 - fluorocarbon - subsidence.mp3 |
2.6 MB |
| Hardcore, Gabber/Bloody Fist/fist025/b1 - fluorocarbon - terrace rats.mp3 |
2.5 MB |
| Hardcore, Gabber/Bloody Fist/fist025/b2 - fluorocarbon - intentional misuse.mp3 |
5.7 MB |
| Hardcore, Gabber/Bloody Fist/fist025/b3 - fluorocarbon - i.t..mp3 |
5.7 MB |
| Hardcore, Gabber/Bloody Fist/fist026/01-subsonic-a_braized-def.mp3 |
9.8 MB |
| Hardcore, Gabber/Bloody Fist/fist026/02-subsonic-b_c_bus-def.mp3 |
9.2 MB |
| Hardcore, Gabber/Bloody Fist/fist027/01 - 18 million dead plebs.mp3 |
5.7 MB |
| Hardcore, Gabber/Bloody Fist/fist027/02 - milt.mp3 |
6.4 MB |
| Hardcore, Gabber/Bloody Fist/fist027/03 - hurricane 2000.mp3 |
7.1 MB |
| Hardcore, Gabber/Bloody Fist/fist027/04 - avenging angel.mp3 |
6.7 MB |
| Hardcore, Gabber/Bloody Fist/fist027/05 - fertmn.mp3 |
8.3 MB |
| Hardcore, Gabber/Bloody Fist/fist027/06 - fuck my sister.mp3 |
944 KB |
| Hardcore, Gabber/Bloody Fist/fist027/07 - steelworks requiem.mp3 |
7.9 MB |
| Hardcore, Gabber/Bloody Fist/fist027/08 - tom's discharge.mp3 |
2.3 MB |
| Hardcore, Gabber/Bloody Fist/fist027/09 - hair by stefan.mp3 |
6.4 MB |
| Hardcore, Gabber/Bloody Fist/fist027/10 - c is for .....mp3 |
1.1 MB |
| Hardcore, Gabber/Bloody Fist/fist027/11 - blasphem.mp3 |
6.3 MB |
| Hardcore, Gabber/Bloody Fist/fist027/12 - hockey.mp3 |
5.2 MB |
| Hardcore, Gabber/Bloody Fist/fist027/13 - no more fucking credibility.mp3 |
6.4 MB |
| Hardcore, Gabber/Bloody Fist/fist027/14 - i'll ave ya.mp3 |
3.8 MB |
| Hardcore, Gabber/Bloody Fist/fist027/15 - 75 cd's.mp3 |
1.1 MB |
| Hardcore, Gabber/Bloody Fist/fist027/16 - trench warfare.mp3 |
5.1 MB |
| Hardcore, Gabber/Bloody Fist/fist027/17 - filth.mp3 |
7.6 MB |
| Hardcore, Gabber/Bloody Fist/fist028/a1 - epsilon - out cunting.mp3 |
3.2 MB |
| Hardcore, Gabber/Bloody Fist/fist028/a2 - epsilon - smallfry.mp3 |
5 MB |
| Hardcore, Gabber/Bloody Fist/fist028/a3 - epsilon - resident evil.mp3 |
7.2 MB |
| Hardcore, Gabber/Bloody Fist/fist028/b1 - epsilon - swimmingliver drunk.mp3 |
6.6 MB |
| Hardcore, Gabber/Bloody Fist/fist028/b2 - epsilon - phasers to kill.mp3 |
3.4 MB |
| Hardcore, Gabber/Bloody Fist/fist028/b3 - epsilon - regular crite.mp3 |
5.7 MB |
| Hardcore, Gabber/Bloody Fist/fist028/c1 - epsilon - homemade bomb.mp3 |
9.9 MB |
| Hardcore, Gabber/Bloody Fist/fist028/c2 - epsilon - supply module 6666.mp3 |
8 MB |
| Hardcore, Gabber/Bloody Fist/fist028/d1 - epsilon - calavera.mp3 |
6.1 MB |
| Hardcore, Gabber/Bloody Fist/fist028/d2 - epsilon - killmonkey eatmonkey.mp3 |
9.5 MB |
| Hardcore, Gabber/Bloody Fist/fist029/a1 - guyver - lyrics to breakbeats.mp3 |
5.5 MB |
| Hardcore, Gabber/Bloody Fist/fist029/a2 - guyver - 4 hours.mp3 |
5.8 MB |
| Hardcore, Gabber/Bloody Fist/fist029/b1 - guyver - divide & conquer.mp3 |
7.6 MB |
| Hardcore, Gabber/Bloody Fist/fist029/b2 - guyver - insanity.mp3 |
5 MB |
| Hardcore, Gabber/Bloody Fist/fist030/a - paul blackout - the number.mp3 |
8.7 MB |
| Hardcore, Gabber/Bloody Fist/fist030/b - paul blackout - the enemy.mp3 |
8 MB |
| Hardcore, Gabber/Bloody Fist/fist031/a1 - de-koder - knife (de-koder's 1995 original mix).mp3 |
10.2 MB |
| Hardcore, Gabber/Bloody Fist/fist031/b1 - de-koder - knife (paul blackout's 2003 remix).mp3 |
10.6 MB |
| Hardcore, Gabber/Bloody Fist/fist032/a1 - aftermath - howdown.mp3 |
7.4 MB |
| Hardcore, Gabber/Bloody Fist/fist032/a2 - aftermath - disservice.mp3 |
6.8 MB |
| Hardcore, Gabber/Bloody Fist/fist032/b1 - aftermath - sadisitic mind.mp3 |
5.9 MB |
| Hardcore, Gabber/Bloody Fist/fist032/b2 - aftermath - doomsday.mp3 |
7.7 MB |
| Hardcore, Gabber/Bloody Fist/fist033/a1_overcast_-_pe1_(remix_at_3pm)-sq.mp3 |
6.2 MB |
| Hardcore, Gabber/Bloody Fist/fist033/a2_overcast_-_gorky_parked-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Bloody Fist/fist033/a3_overcast_-_f-projection-sq.mp3 |
4.9 MB |
| Hardcore, Gabber/Bloody Fist/fist033/b1_overcast_-_brains-sq.mp3 |
8.9 MB |
| Hardcore, Gabber/Bloody Fist/fist033/c2_overcast_-_loom_(remix_at_3pm)-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Bloody Fist/fist033/d1_overcast_-_cycle_recycled-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Bloody Fist/fist033/d2_overcast_-_raining_brains-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Bloody Fist/fist033/d3_overcast_-_whos_fxxking_who-sq.mp3 |
3.7 MB |
| Hardcore, Gabber/Bloody Fist/fist034/B1 - Epsilon - The Dig.mp3 |
6 MB |
| Hardcore, Gabber/Bloody Fist/fist034/B3 - Epsilon - Aim Self-Affliction.mp3 |
5.4 MB |
| Hardcore, Gabber/Bloody Fist/fist035/B1 - Epsilon - No Try.mp3 |
7 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a01 - launch.mp3 |
2.1 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a03 - crops.mp3 |
5.8 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a04 - wheel of misfortune pt ii.mp3 |
852 KB |
| Hardcore, Gabber/Bloody Fist/fistc004/a05 - gunshot wound to the head.mp3 |
5.5 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a07 - smells like fish.mp3 |
1.2 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a10 - broken arse.mp3 |
4.5 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a11 - vampires.mp3 |
1.6 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/a13 - fresh whole chicken.mp3 |
668 KB |
| Hardcore, Gabber/Bloody Fist/fistc004/a15 - nasenbluten [all the old shit mixed into one...].mp3 |
8.6 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b01 - cut her to bits.mp3 |
8 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b02 - muddy crabs.mp3 |
5.2 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b04 - wonderful life.mp3 |
5.9 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b05 - -.mp3 |
6.2 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b06 - god.mp3 |
5.8 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b07 - pessimistic guy (intro perhaps).mp3 |
2.1 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b08 - pessimistic guy.mp3 |
5.2 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b09 - intellectual killer.mp3 |
7.1 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b10 - beer drinkers.mp3 |
5.4 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b11 - toys.mp3 |
5 MB |
| Hardcore, Gabber/Bloody Fist/fistc004/b12 - retrospective _ idle banter.mp3 |
191 KB |
| Hardcore, Gabber/Booby Trap Project/btp 00/00_wipeout_vs_iom_factory_-_welcome_to_the_battlefield-(btp00)-vinyl-2007.m3u |
145 B |
| Hardcore, Gabber/Booby Trap Project/btp 00/00_wipeout_vs_iom_factory_-_welcome_to_the_battlefield-(btp00)-vinyl-2007.nfo |
8 KB |
| Hardcore, Gabber/Booby Trap Project/btp 00/00_wipeout_vs_iom_factory_-_welcome_to_the_battlefield-(btp00)-vinyl-2007.sfv |
181 B |
| Hardcore, Gabber/Booby Trap Project/btp 00/a1_wipeout_-_darkened_world.mp3 |
7.9 MB |
| Hardcore, Gabber/Booby Trap Project/btp 00/a2_wipeout_-_the_wrecking_walk.mp3 |
7.5 MB |
| Hardcore, Gabber/Booby Trap Project/btp 00/b1_iom_factory_-_b52_airstrike.mp3 |
7.6 MB |
| Hardcore, Gabber/Booby Trap Project/btp 00/b2_iom_factory_-_motherfuckin_beez.mp3 |
8.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buv001/a1 - Hellfish - Ultraviolence (Weapons Of Mass Destraction Edit).mp3 |
7.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buv001/b1 - Hellfish - Pill Lesson.mp3 |
6.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buv002/a1 - messiah corps - fire at will.mp3 |
7 MB |
| Hardcore, Gabber/Born Ultraviolent/buv002/a2 - messiah corps - abuse.mp3 |
6.3 MB |
| Hardcore, Gabber/Born Ultraviolent/buv002/b1 - messiah corps - play it rough.mp3 |
7.5 MB |
| Hardcore, Gabber/Born Ultraviolent/buv002/b2 - messiah corps - discipline.mp3 |
5.3 MB |
| Hardcore, Gabber/Born Ultraviolent/buv003/a1_bryan_fury_-_faster_stronger_better-sq.mp3 |
9.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buv003/b1_bryan_fury_-_enemy_for_real-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Born Ultraviolent/buv004/a1_hellfish_-_drunkenmaster-sq.mp3 |
11.7 MB |
| Hardcore, Gabber/Born Ultraviolent/buv004/b1_hellfish_-_gettin_paid_for_this_shit-sq.mp3 |
9.3 MB |
| Hardcore, Gabber/Born Ultraviolent/buv005/a1_moleculez_-_steelworks-sq.mp3 |
12.1 MB |
| Hardcore, Gabber/Born Ultraviolent/buv005/a2_moleculez_-_strange_reflections-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Born Ultraviolent/buv005/b1_moleculez_-_nixons_revenge-sq.mp3 |
8.7 MB |
| Hardcore, Gabber/Born Ultraviolent/buv005/b2_moleculez_-_prototype_b-sq.mp3 |
12 MB |
| Hardcore, Gabber/Born Ultraviolent/buv006/buv06a1.mp3 |
6.5 MB |
| Hardcore, Gabber/Born Ultraviolent/buv006/buv06b1.mp3 |
5.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buv007/a1_unseen_-_hell_in_a_cell-sq.mp3 |
11.9 MB |
| Hardcore, Gabber/Born Ultraviolent/buv007/a2_unseen_-_stair_decadence-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buv007/b1_unseen_-_fuck_off-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Born Ultraviolent/buv007/b2_unseen_-_aspirnt-sq.mp3 |
8 MB |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/00_gnark_-_syntonisation-(buv009)-vinyl-2007.m3u |
111 B |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/00_gnark_-_syntonisation-(buv009)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/00_gnark_-_syntonisation-(buv009)-vinyl-2007.sfv |
147 B |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/a1_gnark_-_syntonisation.mp3 |
9.8 MB |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/a2_gnark_-_chicken_head.mp3 |
11.2 MB |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/b1_gnark_-_2222.mp3 |
9.4 MB |
| Hardcore, Gabber/Born Ultraviolent/buv009/Gnark_-_Syntonisation-(BUV009)-Vinyl-2007-SQ/b2_gnark_-_final_host_process.mp3 |
9 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/00-micron-chaos_theory_overide_lp-(buvlp01)-2xvinyl-2006-unit.m3u |
289 B |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/00-micron-chaos_theory_overide_lp-(buvlp01)-2xvinyl-2006-unit.nfo |
4 KB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/00-micron-chaos_theory_overide_lp-(buvlp01)-2xvinyl-2006-unit.sfv |
361 B |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/01-micron-the_first_chamber-unit.mp3 |
9.8 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/02-micron-white_sands-unit.mp3 |
7.9 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/03-micron-indie_mashup-unit.mp3 |
11.9 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/04-micron-crossing_the_chasm-unit.mp3 |
8 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/05-micron-the_butterfly_effect-unit.mp3 |
7.6 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/06-micron-d_600-unit.mp3 |
8.5 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/07-micron-the_one_they_were-unit.mp3 |
9.2 MB |
| Hardcore, Gabber/Born Ultraviolent/buvlp001/08-micron-break_implode_(its_like_that)-unit.mp3 |
8.4 MB |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/00_lebask_vs_moga-untitled-(bouinbouin02)-vinyl-2007-ct.m3u |
104 B |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/00_lebask_vs_moga-untitled-(bouinbouin02)-vinyl-2007-ct.nfo |
11 KB |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/00_lebask_vs_moga-untitled-(bouinbouin02)-vinyl-2007-ct.sfv |
140 B |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/a1_lebask-emperia_23-ct.mp3 |
8 MB |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/a2_moga-nosferatu-ct.mp3 |
8.9 MB |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/b1_lebask-asilyum-ct.mp3 |
8.7 MB |
| Hardcore, Gabber/Bouin Bouin/bouinbouin02/b2_moga-reloop-ct.mp3 |
7.5 MB |
| Hardcore, Gabber/Brrr/br 160/A1 - SCARFACE - I'll Take You All To Fuckin' Hell (Mix I).mp3 |
4 MB |
| Hardcore, Gabber/Brrr/br 160/A2 - SCARFACE - I'll Take You All To Fuckin' Hell (Mix II).mp3 |
4.4 MB |
| Hardcore, Gabber/Brrr/br 160/B1 - SCARFACE - I'll Take You All To Fuckin' Hell (Mix III).mp3 |
4.8 MB |
| Hardcore, Gabber/Brutal Rage/brr001/00_va_-_soup_du_jour_vs_dim_sum-(brr01)-vinyl-2008.m3u |
196 B |
| Hardcore, Gabber/Brutal Rage/brr001/00_va_-_soup_du_jour_vs_dim_sum-(brr01)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Brutal Rage/brr001/00_va_-_soup_du_jour_vs_dim_sum-(brr01)-vinyl-2008.sfv |
232 B |
| Hardcore, Gabber/Brutal Rage/brr001/a1_akira_-_no_more_mu-sick_(the_absolute_absolution_remix).mp3 |
9.5 MB |
| Hardcore, Gabber/Brutal Rage/brr001/a2_bonehead_-_from_the_netherlands_(speedcore_terror_kinetic_rmx).mp3 |
7.2 MB |
| Hardcore, Gabber/Brutal Rage/brr001/b1_goetia_-_brutal_rage.mp3 |
7.5 MB |
| Hardcore, Gabber/Brutal Rage/brr001/b2_venom_-_ruthless_terror.mp3 |
7.2 MB |
| Hardcore, Gabber/Bzrk/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/00-bertocucci_feranzano-xtc_love_ep-(bzrk1a)-vinyl-2007-rst.m3u |
40 B |
| Hardcore, Gabber/Bzrk/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/00-bertocucci_feranzano-xtc_love_ep-(bzrk1a)-vinyl-2007-rst.nfo |
7 KB |
| Hardcore, Gabber/Bzrk/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/00-bertocucci_feranzano-xtc_love_ep-(bzrk1a)-vinyl-2007-rst.sfv |
49 B |
| Hardcore, Gabber/Bzrk/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/Bertocucci_Feranzano-XTC_Love_EP-(BZRK1A)-Vinyl-2007-RST/01-bertocucci_feranzano-xtc_love_ep.mp3 |
10.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 001] bertocucci feranzano - xtc love ep/_BZRK 001 (A).jpg |
126 KB |
| Hardcore, Gabber/Bzrk/[bzrk 001] bertocucci feranzano - xtc love ep/_BZRK 001 (B).jpg |
134 KB |
| Hardcore, Gabber/Bzrk/[bzrk 001] bertocucci feranzano - xtc love ep/A1 - BERTOCUCCI FERANZANO - XTC Love (Original Mix).mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 001] bertocucci feranzano - xtc love ep/A2 - BERTOCUCCI FERANZANO - XTC Love (Buzz Fuzz Mix).mp3 |
7.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 001] bertocucci feranzano - xtc love ep/B1 - BERTOCUCCI FERANZANO - Raver's Movement.mp3 |
6.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 001] bertocucci feranzano - xtc love ep/B2 - BERTOCUCCI FERANZANO - Sax B4 Dinner.mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 002] - public domain - in the house e.p/A1 - Public Domain - In The House [Original Mix].mp3 |
5.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 002] - public domain - in the house e.p/B1 - Public Domain - So Get Up.mp3 |
3.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 002] - public domain - in the house e.p/B2 - Public Domain - Don't Stop [Wiggle Mix].mp3 |
1.9 MB |
| Hardcore, Gabber/Bzrk/[bzrk 003] - tony salmonelli - hey!/A1 - Tony Salmonelli - Hey!.mp3 |
10.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 003] - tony salmonelli - hey!/A2 - Tony Salmonelli - Hey! (Buzzy's Ragga Mix).mp3 |
6.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 003] - tony salmonelli - hey!/B1 - Tony Salmonelli - L.O.V.E..mp3 |
8.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 003] - tony salmonelli - hey!/B2 - Tony Salmonelli - Foreign Affair.mp3 |
7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 004] dr. phil omanski - 'feeling'/A1-dr. phil omanski - feeling (radio mix).mp3 |
4.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 004] dr. phil omanski - 'feeling'/A2-dr. phil omanski - bzrk feelings (toni salmonelli mix).mp3 |
4.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 004] dr. phil omanski - 'feeling'/B1-dr. phil omanski - feeling (public domain mix).mp3 |
3.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 004] dr. phil omanski - 'feeling'/B2-dr. phil omanski - feeling (uk mix).mp3 |
5.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 005] bertocucci feranzano - e-motion ep/A1 - Bertocucci Feranzano - E-Motion (Original Mix).mp3 |
6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 005] bertocucci feranzano - e-motion ep/A2 - Bertocucci Feranzano - E-Motion (DJ Buzz Fuzz Remix).mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 005] bertocucci feranzano - e-motion ep/B1 - BERTOCUCCI FERANZANO - Don't Stop.mp3 |
5.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 005] bertocucci feranzano - e-motion ep/B2 - Bertocucci Feranzano - I Want Your Love.mp3 |
4.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 006] jeremy - the flow ep/A1 - Jeremy - The Flow (Original Mix).mp3 |
4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 006] jeremy - the flow ep/A2 - Jeremy - The Flow (DJ Buzz Fuzz Remix).mp3 |
5.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 006] jeremy - the flow ep/B1 - Jeremy - Maximum Respect.mp3 |
3.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 006] jeremy - the flow ep/B2 - Jeremy - We're Giving You Hardcore.mp3 |
4.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 007] toni salmonelli - bzrk ep/A1 - Toni Salmonelli - Once Again (Original Mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 007] toni salmonelli - bzrk ep/A2 - TONY SALMONELLI - Once Again (Buzz Fuzz Mix).mp3 |
4.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 007] toni salmonelli - bzrk ep/B1 - Toni Salmonelli - Class Axion Take 1.mp3 |
5.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 007] toni salmonelli - bzrk ep/B2 - TONY SALMONELLI - Class Axion Take 1.mp3 |
5.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 008] - public domain - 'meatbeat'/bzrk008 -a1- public domain - meatbeat (original).mp3 |
4.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 008] - public domain - 'meatbeat'/bzrk008 -a2- public domain - meatbeat (amsterdam mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 008] - public domain - 'meatbeat'/bzrk008 -b1- public domain - get stupid.mp3 |
3.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 008] - public domain - 'meatbeat'/bzrk008 -b2- public domain - i know it.mp3 |
4.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 009] dj e-rick & tactic - the time has come ep/A1 - DJ E-RICK & TACTIC - Goddamn' House (Original Mix).mp3 |
4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 009] dj e-rick & tactic - the time has come ep/A2 - DJ E-RICK & TACTIC - Goddamn' House (Buzz Fuzz Mix).mp3 |
4.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 009] dj e-rick & tactic - the time has come ep/B1 - DJ E-RICK & TACTIC - Now Is The Time.mp3 |
4.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 009] dj e-rick & tactic - the time has come ep/B2 - DJ E-RICK & TACTIC - Bring The Noise.mp3 |
4.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 010] masoko solo - pessa pessa (bzrk rmxes)/A1 - MASOKO SOLO - Pessa Pessa (DJ Cerla's 172BPM Rave Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 010] masoko solo - pessa pessa (bzrk rmxes)/A2 - MASOKO SOLO - Pessa Pessa (Buzzy Goes Bzrk Mix).mp3 |
6.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 010] masoko solo - pessa pessa (bzrk rmxes)/B1 - MASOKO SOLO - Pessa Pessa (DJ E-Rick & Tactic Remix).mp3 |
6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 010] masoko solo - pessa pessa (bzrk rmxes)/B2 - MASOKO SOLO - Pessa Pessa (The Prophet's Mix).mp3 |
7.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 011] bertocucci feranzano - 'daddy snow'/A1 - Bertocucci Feranzano - Daddy Snow [Original Mix].mp3 |
5.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 011] bertocucci feranzano - 'daddy snow'/A2 - Bertocucci Feranzano - Daddy Snow [Buzzy's Ragga Mix].mp3 |
7.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 011] bertocucci feranzano - 'daddy snow'/B1 - Bertocucci Feranzano - Higher Love.mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 011] bertocucci feranzano - 'daddy snow'/B2 - Bertocucci Feranzano - Class Axion [Take 2].mp3 |
8.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 012] dj e-rick & tactic - hysterical drumbeats/A1 - DJ E-RICK & TACTIC - Hysterical Drumbeats (Original Mix).mp3 |
4.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 012] dj e-rick & tactic - hysterical drumbeats/A2 - DJ E-RICK & TACTIC - Hysterical Drumbeats (Angel's Black Label Mix).mp3 |
5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 012] dj e-rick & tactic - hysterical drumbeats/B1 - DJ E-RICK & TACTIC - Wanna Dance.mp3 |
6.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 012] dj e-rick & tactic - hysterical drumbeats/B2 - DJ E-RICK & TACTIC - It's Gonna Be Alright.mp3 |
5.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 013] dr. phil omanski & jeremy - joint venture ep/A1 - Dr. Phil Omanski & Jeremy - Rockin Your Body (Original Mix).mp3 |
5.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 013] dr. phil omanski & jeremy - joint venture ep/A2 - Dr. Phil Omanski & Jeremy - Rockin Your Body (Buzzy Go.mp3 |
5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 013] dr. phil omanski & jeremy - joint venture ep/A2 - Dr. Phil Omanski vs. Jeremy - Rockin' Your Body (Buzzy.mp3 |
5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 013] dr. phil omanski & jeremy - joint venture ep/B1 - Dr. Phil Omanski & Jeremy - Feel The Rhythm (Original Mix).mp3 |
7.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 013] dr. phil omanski & jeremy - joint venture ep/B2 - Dr. Phil Omanski & Jeremy - Feel The Rhythm (Bounty Mix).mp3 |
5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 014] da beatblower - fuck your s off (the remixes)/a1 - da beatblower - fuck your s off (buzzy goes bzrk mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Bzrk/[bzrk 014] da beatblower - fuck your s off (the remixes)/b1 - da beatblower - fuck your s off (dj e-rick & tactic remix).mp3 |
4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 014] da beatblower - fuck your s off (the remixes)/b2 - da beatblower - fuck your s off (scott brown remix).mp3 |
4.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 014] da beatblower - fuck your s off (the remixes)/b3 - da beatblower - fuck your s off (pino d'ambini's hardmix).mp3 |
4.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 015] - nina feranzano & dj buzz fuzz - 'keep it up'/A1 - Nina Feranzano & Bertocucci Feranzano - Keep It Up [Radio Mix].mp3 |
4.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 015] - nina feranzano & dj buzz fuzz - 'keep it up'/A2 - Nina Feranzano & Bertocucci Feranzano - Keep It Up [Buzzy Goes BZRK Mix].mp3 |
6.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 015] - nina feranzano & dj buzz fuzz - 'keep it up'/B1 - Nina Feranzano & Bertocucci Feranzano - Statica.mp3 |
5.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 016] - pino d'ambini - 'up & down'/A1 - Pino D'Ambini - Up & Down, Ballz (Original Mix).mp3 |
7.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 016] - pino d'ambini - 'up & down'/A2 - Pino D'Ambini - Up & Down, Ballz (Buzzy Goes BZRK Mix).mp3 |
4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 016] - pino d'ambini - 'up & down'/B1 - Pino D'Ambini - Do It Right.mp3 |
5.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 016] - pino d'ambini - 'up & down'/B2 - Pino D'Ambini - Land Of Promises.mp3 |
7.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 017] dj e-rick & tactic - don't like mondays/A1 - DJ E-RICK & TACTIC - Don't Like Mondays (Original Bzrk Mix).mp3 |
5.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 017] dj e-rick & tactic - don't like mondays/A2 - DJ E-RICK & TACTIC - Don't Like Mondays (Ulli Kneudelbaum & Franz Putzenbacher Mix).mp3 |
6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 017] dj e-rick & tactic - don't like mondays/B1 - DJ E-RICK & TACTIC - Return To The Classics.mp3 |
5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 017] dj e-rick & tactic - don't like mondays/B2 - DJ E-RICK & TACTIC - Stop The Music.mp3 |
5.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 018] - ramirez - 'apocalixis (the remixes)'/A1 - Ramirez - Apocalixis (Placid K Remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 018] - ramirez - 'apocalixis (the remixes)'/A2 - Ramirez - Apocalixis (Lenny Dee Remix).mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 018] - ramirez - 'apocalixis (the remixes)'/B1 - Ramirez - Apocalixis (Buzzy Goes BZRK Remix).mp3 |
6.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 018] - ramirez - 'apocalixis (the remixes)'/B2 - Ramirez - Apocalixis (DJ Gizmo Remix).mp3 |
7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 019] wasting program - bring that shit back (rmxes)/A1 - WASTING PROGRAM - Bring That Shit Back (Buzzy Goes BZRK Mix).mp3 |
5.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 019] wasting program - bring that shit back (rmxes)/A2 - WASTING PROGRAM - Bring That Shit Back (DJ Promo's Not For Sale Remix).mp3 |
4.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 019] wasting program - bring that shit back (rmxes)/B1 - WASTING PROGRAM - Bring That Shit Back (Gizmaniax Remix).mp3 |
4.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 019] wasting program - bring that shit back (rmxes)/B2 - WASTING PROGRAM - Bring That Shit Back (Arjuna's Remix).mp3 |
3.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 019] wasting program - bring that shit back (rmxes)/B3 - WASTING PROGRAM - Bring That Shit Back (DJ Yves Remix).mp3 |
3.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 020] toni salmonelli - 'the wizard'/A1 - Toni Salmonelli - The Wizard (To Tha Crowd) (Buzzy's Old Style Fix).mp3 |
4.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 020] toni salmonelli - 'the wizard'/A2 - Toni Salmonelli - The Wizard (To Tha Crowd) (Toni & Bertocucci's Hardmix).mp3 |
4.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 020] toni salmonelli - 'the wizard'/B1 - Toni Salmonelli ft. Pino d'Ambini - Class Axion Take 3.mp3 |
6.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 020] toni salmonelli - 'the wizard'/B2 - Toni Salmonelli ft. DJ Buzz Fuzz - Class Axion Take 3.mp3 |
7.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 021] public domain - 'rock this joint'/a1 - public domain - rock this joint [original mix].mp3 |
5.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 021] public domain - 'rock this joint'/a2 - public domain - rock this joint [arjuna remix].mp3 |
5.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 021] public domain - 'rock this joint'/b1 - public domain - mellow maniacs.mp3 |
5.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 021] public domain - 'rock this joint'/b2 - public domain - all you bastards.mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 022] dj buzz fuzz - 'dreamgirl'/A1 - Dj Buzz Fuzz - Dreamgirl (Original Mix).mp3 |
9.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 022] dj buzz fuzz - 'dreamgirl'/A2 - Dj Buzz Fuzz - Dreamgirl (Just A Buzzy Dream Mix).mp3 |
9.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 022] dj buzz fuzz - 'dreamgirl'/B1 - Dj Buzz Fuzz - Just Another Humdrum.mp3 |
7.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 022] dj buzz fuzz - 'dreamgirl'/B2 - Dj Buzz Fuzz - Break It Down.mp3 |
7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 023] t-wisted - listen to the rhythm ep/A1 - T-WISTED - Intro.mp3 |
1.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 023] t-wisted - listen to the rhythm ep/A2 - T-WISTED - Listen To The Rhythm (Original Mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Bzrk/[bzrk 023] t-wisted - listen to the rhythm ep/A3 - T-WISTED - Listen To The Rhythm (Buzzy Goes BZRK Mix).mp3 |
6.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 023] t-wisted - listen to the rhythm ep/B1 - T-WISTED - You Got Me Buring.mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 023] t-wisted - listen to the rhythm ep/B2 - T-WISTED - Never Be Mine.mp3 |
6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 023] t-wisted - listen to the rhythm ep/INCOMPLETE~A3 - T-WISTED - Listen To The Rhythm (Buzzy Goes BZRK Mix).mp3 |
6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 024] square dimensione - dope professionals ep/A1 - SQUARE DIMENSIONE - So Dope (Original Mix By Buzz Fuzz).mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 024] square dimensione - dope professionals ep/A2 - SQUARE DIMENSIONE - So Dope (Remix By DJ Gizmo).mp3 |
5.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 024] square dimensione - dope professionals ep/B1 - SQUARE DIMENSIONE - The Professionals (Original Mix By DJ Gizmo).mp3 |
3.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 024] square dimensione - dope professionals ep/B2 - SQUARE DIMENSIONE - The Professionals (Remix By DJ Buzz Fuzz).mp3 |
6.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 024] square dimensione - dope professionals ep/B3 - SQUARE DIMENSIONE - Square Elementz Part 1.mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 026] dj promo - king of pain/A1 - DJ Promo - King of pain.mp3 |
7.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 026] dj promo - king of pain/A2 - DJ Promo - Lost minds.mp3 |
7.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 026] dj promo - king of pain/B1 - DJ Promo - Just a feeling.mp3 |
9.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 026] dj promo - king of pain/B2 - DJ Promo - Cheating bitch.mp3 |
7.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 027] t-wisted - g.d.t.t.f.b/A1 - T-Wisted - Funky emotions.mp3 |
5.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 027] t-wisted - g.d.t.t.f.b/A2 - T-Wisted - G.d.t.t.f.b..mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 027] t-wisted - g.d.t.t.f.b/B1 - T-Wisted - Give me back the underground.mp3 |
6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 027] t-wisted - g.d.t.t.f.b/B2 - T-Wisted - House of parish.mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 028] 50% of the dreamteam - harakiri vol. 1/_BZRK 028 (front).jpg |
8 KB |
| Hardcore, Gabber/Bzrk/[bzrk 028] 50% of the dreamteam - harakiri vol. 1/A1 - 50% OF THE DREAMTEAM - Open Sesame! (Theme From Hell).mp3 |
3.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 028] 50% of the dreamteam - harakiri vol. 1/B1 - 50% OF THE DREAMTEAM - Careless As Usual.mp3 |
4.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 028] 50% of the dreamteam - harakiri vol. 1/B2 - 50% OF THE DREAMTEAM - Cyber 2000.mp3 |
4.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 029] dj buzz fuzz - destruction ep vol. 3/A1 - DJ BUZZ FUZZ - King Of The Beatz.mp3 |
3.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 029] dj buzz fuzz - destruction ep vol. 3/B1 - DJ BUZZ FUZZ - Buzzyness = Buzzyness.mp3 |
3.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 029] dj buzz fuzz - destruction ep vol. 3/B2 - DJ BUZZ FUZZ - Emergency Call.mp3 |
1.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 030r] t-wisted vs. pino d'ambini - respect the cock (remixed)/A1 - T-Wisted vs. Pino D'Ambini - Respect The Cock (DJ Paul Remix).mp3 |
5.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 030r] t-wisted vs. pino d'ambini - respect the cock (remixed)/B1 - T-Wisted vs. Pino D'Ambini - Respect The Cock (Original Mix).mp3 |
3.9 MB |
| Hardcore, Gabber/Bzrk/[bzrk 030] t-wisted feat. pino d'ambini - respect the cock ep/A1 - T-WISTED Feat. PINO D'AMBINI - Respect The Cock.mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 030] t-wisted feat. pino d'ambini - respect the cock ep/B1 - T-WISTED - Come With Me.mp3 |
6.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 030] t-wisted feat. pino d'ambini - respect the cock ep/B2 - T-WISTED - Questions.mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 031] dj promo - not down with the standard'/A1 - DJ Promo - Not Down with the Standard.mp3 |
7.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 031] dj promo - not down with the standard'/B1 - DJ Promo - 95 % Against Me.mp3 |
3.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 032] pino d'ambini vs dj buzz fuzz - murphy's law/A1 - BUZZ FUZZ - Murphy's Law.mp3 |
7.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 032] pino d'ambini vs dj buzz fuzz - murphy's law/B1 - BUZZ FUZZ - Master Madness.mp3 |
7.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk 032] pino d'ambini vs dj buzz fuzz - murphy's law/B2 - PINO D'AMBINI - Feel Da Beat.mp3 |
7.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 033r] menace ii society - son of a bitch (remixed)/A1 - Menace II Society - Son Of A Bitch (Remix).mp3 |
7.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 033r] menace ii society - son of a bitch (remixed)/B1 - Menace II Society - Son Of A Bitch (Original Mix).mp3 |
9.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 033] menace ii society - son of a bitch/a1 son of a bitch.mp3 |
9.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 033] menace ii society - son of a bitch/b1 chronic disorder.mp3 |
4.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 033] menace ii society - son of a bitch/b2 into the dark skies.mp3 |
6.4 MB |
| Hardcore, Gabber/Bzrk/[bzrk 034] dj buzz fuzz - the revisited ep/A1 - TONI SALMONELLI - Hey (2002 Mix By The Viper & Mad-E-Fact).mp3 |
7.9 MB |
| Hardcore, Gabber/Bzrk/[bzrk 034] dj buzz fuzz - the revisited ep/B1 - BUZZ FUZZ - Frequencies (2002 Mix By T-Wisted).mp3 |
7.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 034] dj buzz fuzz - the revisited ep/B2 - BUZZ FUZZ - Frequencies (Original 1995 Version).mp3 |
9.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 035] menace ii society - fear of others/A1 - Menace II Society - Fear Of Others.mp3 |
7.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk 035] menace ii society - fear of others/B1 - Menace II Society - Do It From The Heart.mp3 |
5.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk 035] menace ii society - fear of others/B2 - Menace II Society - Suffer Eternal Torment.mp3 |
4.7 MB |
| Hardcore, Gabber/Bzrk/[bzrk 036] menace 2 society vs kid morbid - definition of the end/a1_menace_2_society_vs_kid_morbid_-_definition_of_the_end-sq.mp3 |
9.9 MB |
| Hardcore, Gabber/Bzrk/[bzrk 036] menace 2 society vs kid morbid - definition of the end/b1_menace_2_society_vs_kid_morbid_-_the_path_of_hell-sq.mp3 |
9.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 036] menace 2 society vs kid morbid - definition of the end/b2_menace_2_society_vs_kid_morbid_-_alkoholik-sq.mp3 |
9.6 MB |
| Hardcore, Gabber/Bzrk/[bzrk 037] va - all starz project volume 1/00_va_-_all_starz_project_volume_1-(bzrk037)-vinyl-2006-sq.m3u |
129 B |
| Hardcore, Gabber/Bzrk/[bzrk 037] va - all starz project volume 1/00_va_-_all_starz_project_volume_1-(bzrk037)-vinyl-2006-sq.nfo |
7 KB |
| Hardcore, Gabber/Bzrk/[bzrk 037] va - all starz project volume 1/00_va_-_all_starz_project_volume_1-(bzrk037)-vinyl-2006-sq.sfv |
159 B |
| Hardcore, Gabber/Bzrk/[bzrk 037] va - all starz project volume 1/a1_project_overdrive_-_p.o.-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk 037] va - all starz project volume 1/b1_buzz_fuzz_-_men_of_teflon_(dj_d_remix)-sq.mp3 |
8.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk 037] va - all starz project volume 1/b2_kid_morbid_-_50_yrz_in_san_quentin-sq.mp3 |
10.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/A1 - Bertocucci Feranzano - XTC love (Dr. Phil's trance Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/A2 - Public Domain - In the house (Rob Gee's Hardcore Mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/A3 - Bertocucci Feranzano - Sax b 4 dinner (Public domain's version).mp3 |
4.5 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/A4 - Toni Salmonelli - Hey ! (the Prophet Rmx).mp3 |
5.1 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/B1 - Toni Salmonelli - Hey ! (DJ Buzz Fuzz hardjungle Mix).mp3 |
6.3 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/B2 - Public Domain - So get up (Toni Salmonelli's wWorkout).mp3 |
4.2 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/B3 - Bertocucci Feranzano - Raver's movement (Vinyl Maniacs & Chosen Few Mix).mp3 |
4 MB |
| Hardcore, Gabber/Bzrk/[bzrk lp1] the bzrk anniversary album/B4 - Public Domain - So get up (Dr. Phil's Mix).mp3 |
3.4 MB |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/-[100%]--[All-files-CRC-OK]--[3-files]--[H0RATi0]- |
0 B |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/-[Hardcore]--[2005]--[128 KBit]--[H0RATi0]- |
0 B |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/00_bzrk_anniversary_trilogy_-_part_one_of_three-vinyl-2005-hb.m3u |
125 B |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/00_bzrk_anniversary_trilogy_-_part_one_of_three-vinyl-2005-hb.nfo |
15 KB |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/00_bzrk_anniversary_trilogy_-_part_one_of_three-vinyl-2005-hb.sfv |
208 B |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/01_buzz_fuzz_-_men_of_teflon-hb.mp3 |
8.9 MB |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/02_menace_ii_society_-_chronic_disorder-hb.mp3 |
8.5 MB |
| Hardcore, Gabber/Bzrk/[bzrkan1] various - bzrk anniversary trilogy part one of three/03_public_domain_-_rock_this_joint-hb.mp3 |
6.6 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr001/a1 - Interrupt Vector Vs Dj Plague - We Gotz Game.mp3 |
6.5 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr001/a2 - Interrupt Vector - N Word Jim.mp3 |
6.1 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr001/a3 - Terrorist Kriss - Dasf.mp3 |
2.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr001/b1 - Dj Plague - Squeal Like A Pig.mp3 |
7.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr001/b2 - Dj Plague - Eat This.mp3 |
4.9 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr001/b3 - Interupt Vector - Lost Faith.mp3 |
3.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr002/a1_The_Speed_Freak_-_Body_Rock-SQ.mp3 |
5.2 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr002/a2_The_Speed_Freak_-_Computation_666-SQ.mp3 |
4.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr002/a3_The_Speed_Freak_-_Zero_Hour-SQ.mp3 |
5.5 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr002/b1_Interrupt_Vector_Vs_DJ_Plague_-_Drinking_Beers-SQ.mp3 |
5.9 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr002/b2_Terrorist_Kriss_-_Get_Hurt-SQ.mp3 |
4.9 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr002/b3_Interrupt_Vector_Vs_DJ_Plague_-_Nasty_Things-SQ.mp3 |
3 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr003/a1 - dj plague - stick em.mp3 |
7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr003/a2 - dj plague - suck my dick.mp3 |
7.4 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr003/a3 - c.s.r. - c.s.r scratch samples.mp3 |
2.1 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr003/b1 - interrupt vector vs dj plague - crush a man to death.mp3 |
7.9 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr003/b2 - interrupt vector - hardcore lampin.mp3 |
7.9 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/a1_dj_plague_-_whatcha_gonna_do-sq.mp3 |
7.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/a2_stinger_-_commando_(dedicated_to_sgt.jacob_flores)-sq.mp3 |
3.4 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/a3_interrupt_vector_-_speedcore_sunday-sq.mp3 |
4.4 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/b1_dj_plague_-_decepticon-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/b2_gabber_foxx_-_south_park_french_canada_(arsecore_mix)-sq.mp3 |
3.3 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/b2_gabber_foxx_-_south_park_french_canada_(arsecore_mix)-sq.mp3.asd |
293 KB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr004/b3_csr_-_scratch_samples-sq.mp3 |
1.2 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr005/a1 - sonic overkill - canario.mp3 |
7.3 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr005/a2 - sonic overkill - the power of base (trash and noize edit).mp3 |
6.1 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr005/a3 - sonic overkill - exit of hell (o-mix).mp3 |
6.2 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr005/b1 - sonic overkill - sonics theme.mp3 |
9.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr005/b2 - sonic overkill - metal attakk.mp3 |
5.9 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr005/b3 - sonic overkill - born into this world.mp3 |
7.2 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/00_va_-_the_longest_war-(csr7)-vinyl-2007.m3u |
179 B |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/00_va_-_the_longest_war-(csr7)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/00_va_-_the_longest_war-(csr7)-vinyl-2007.sfv |
229 B |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/a1_dj_plague_-_the_longest_war.mp3 |
7.7 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/a2_mutante_-_children_are_nice.mp3 |
11 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/b1_stinger_vs_dj_plague_-_kill_everything.mp3 |
8.1 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/b2_interrupt_vector_-_no_joke.mp3 |
7.4 MB |
| Hardcore, Gabber/Canadian Speedcore Resistance/csr007/b3_terrorist_kriss_-_pin.mp3 |
3.7 MB |
| Hardcore, Gabber/Cenobite/666 05 01 leviathan unleash the power (12)/a2_leviathan_-_fuck_off-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Cenobite/cen07002095 - leviathan - the new generation/a1 - leviathan - block fucking beats.mp3 |
4 MB |
| Hardcore, Gabber/Cenobite/cen07002095 - leviathan - the new generation/a2 - leviathan - the new generation.mp3 |
5.2 MB |
| Hardcore, Gabber/Cenobite/cen07002095 - leviathan - the new generation/a3 - leviathan - lord of the labyrinth.mp3 |
4.1 MB |
| Hardcore, Gabber/Cenobite/cen07002095 - leviathan - the new generation/b1 - leviathan - close encounters 1999.mp3 |
7.9 MB |
| Hardcore, Gabber/Cenobite/cen07002095 - leviathan - the new generation/b2 - leviathan - step into the light.mp3 |
4.3 MB |
| Hardcore, Gabber/Cenobite/cen07002095 - leviathan - the new generation/b3 - leviathan - electrified.mp3 |
5.6 MB |
| Hardcore, Gabber/Cenobite/cen07002105 - dj arjuna - totally lost/a1 - dj arjuna - totally lost.mp3 |
2.9 MB |
| Hardcore, Gabber/Cenobite/cen07002105 - dj arjuna - totally lost/a2 - dj arjuna & beyonder - shoot that motherfuck (original mix).mp3 |
3.4 MB |
| Hardcore, Gabber/Cenobite/cen07002105 - dj arjuna - totally lost/b1 - dj arjuna - rough is the texture.mp3 |
3.6 MB |
| Hardcore, Gabber/Cenobite/cen07002105 - dj arjuna - totally lost/b3 - dj arjuna & beyonder - shoot this motherfuck (guitar rob remix).mp3 |
3.8 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/a1 - leviathan - drug invasion.mp3 |
5.5 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/a2 - ancient heroes - life.mp3 |
4 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/b1 - ancient heroes - the waltz.mp3 |
4.6 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/b2 - holocron - apocalypse.mp3 |
5.1 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/c1 - tellurian - big bad city.mp3 |
5.5 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/c2 - dj dano vs. leviathan - the revelation.mp3 |
4.8 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/d1 - leviathan - nuclear transfer.mp3 |
5.6 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/d2 - matrox - beware.mp3 |
3.9 MB |
| Hardcore, Gabber/Cenobite/cen07002751 - various artists - the revelation/d3 - beyonder - the prophecy.mp3 |
6.4 MB |
| Hardcore, Gabber/Cenobite/cen60016 - leviathan - we'll tear your soul apart/A1 - Leviathan - We'll Tear Your Soul Apart.mp3 |
4.1 MB |
| Hardcore, Gabber/Cenobite/cen60016 - leviathan - we'll tear your soul apart/B1 - Leviathan - Yes...No....mp3 |
5.1 MB |
| Hardcore, Gabber/Cenobite/cen60016 - leviathan - we'll tear your soul apart/B2 - Leviathan - Wrong Decision.mp3 |
4.1 MB |
| Hardcore, Gabber/Cenobite/cen60026 - beyonder - the wish/A1 - Beyonder - The Wish.mp3 |
2.9 MB |
| Hardcore, Gabber/Cenobite/cen60026 - beyonder - the wish/B1 - Beyonder - Dark Shadow.mp3 |
4.2 MB |
| Hardcore, Gabber/Cenobite/cen60026 - beyonder - the wish/B2 - Beyonder - The Mind Is A Labyrinth.mp3 |
3.9 MB |
| Hardcore, Gabber/Cenobite/cen60042 - dj arjuna & beyonder - shoot that motherfuck/a1 - dj arjuna & beyonder - shoot that motherfuck (original mix).mp3 |
3.4 MB |
| Hardcore, Gabber/Cenobite/cen60042 - dj arjuna & beyonder - shoot that motherfuck/a2 - dj arjuna & beyonder - shoot that motherfuck (raising hell mix).mp3 |
5.1 MB |
| Hardcore, Gabber/Cenobite/cen60042 - dj arjuna & beyonder - shoot that motherfuck/b1 - dj arjuna & beyonder - rock on 'till the break of dawn.mp3 |
4.5 MB |
| Hardcore, Gabber/Cenobite/cen60042 - dj arjuna & beyonder - shoot that motherfuck/b2 - dj arjuna - terrifying sound.mp3 |
5.2 MB |
| Hardcore, Gabber/Cenobite/cen60052 - crypt - the 9th circle/a1 - crypt - the 9th circle.mp3 |
7 MB |
| Hardcore, Gabber/Cenobite/cen60052 - crypt - the 9th circle/b1 - crypt - delusion.mp3 |
4.6 MB |
| Hardcore, Gabber/Cenobite/cen60052 - crypt - the 9th circle/b2 - crypt - rise and shine.mp3 |
4.2 MB |
| Hardcore, Gabber/Cenobite/cen7003085 - holocron - liberate me/a1 - holocron - liberate me.mp3 |
5.3 MB |
| Hardcore, Gabber/Cenobite/cen7003085 - holocron - liberate me/a2 - holocron - ready to flow.mp3 |
4.9 MB |
| Hardcore, Gabber/Cenobite/cen7003085 - holocron - liberate me/b1 - holocron - we have a choice.mp3 |
4.3 MB |
| Hardcore, Gabber/Cenobite/cen7003085 - holocron - liberate me/b2 - holocron - always awake.mp3 |
4.6 MB |
| Hardcore, Gabber/Cerebral Destruction/sana011/00_kenny_gee_-_boom_breaker-(sana011)-vinyl-2006.m3u |
129 B |
| Hardcore, Gabber/Cerebral Destruction/sana011/00_kenny_gee_-_boom_breaker-(sana011)-vinyl-2006.nfo |
8 KB |
| Hardcore, Gabber/Cerebral Destruction/sana011/00_kenny_gee_-_boom_breaker-(sana011)-vinyl-2006.sfv |
165 B |
| Hardcore, Gabber/Cerebral Destruction/sana011/a1_kenny_gee_-_boom_breaker.mp3 |
9.5 MB |
| Hardcore, Gabber/Cerebral Destruction/sana011/a2_kenny_gee_-_sweet_revenge.mp3 |
8.1 MB |
| Hardcore, Gabber/Cerebral Destruction/sana011/b1_kenny_gee_-_ill_take_your_life.mp3 |
11.2 MB |
| Hardcore, Gabber/Cerebral Destruction/sana011/b2_kenny_gee_-_afraid.mp3 |
5.5 MB |
| Hardcore, Gabber/Cheeze Graterz/grater001/00_dj_hektek_and_star_destroyer_-_let_the_game_begin-(grater01)-vinyl-2006.m3u |
177 B |
| Hardcore, Gabber/Cheeze Graterz/grater001/00_dj_hektek_and_star_destroyer_-_let_the_game_begin-(grater01)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Cheeze Graterz/grater001/00_dj_hektek_and_star_destroyer_-_let_the_game_begin-(grater01)-vinyl-2006.sfv |
213 B |
| Hardcore, Gabber/Cheeze Graterz/grater001/a1_dj_hektek_-_let_the_game_begin.mp3 |
11.3 MB |
| Hardcore, Gabber/Cheeze Graterz/grater001/a2_dj_hektek_-_creaturez.mp3 |
8.6 MB |
| Hardcore, Gabber/Cheeze Graterz/grater001/b1_dj_hektek_-_creaturez_(the_dj_producers_zombie_holocaust_remix).mp3 |
8.5 MB |
| Hardcore, Gabber/Cheeze Graterz/grater001/b2_star_destroyer_-_to_cheat_death.mp3 |
8.3 MB |
| Hardcore, Gabber/Cheeze Graterz/grater003/00_va_-_in_the_mouth_of_madness_e.p.-(grater03)-vinyl-2008.m3u |
151 B |
| Hardcore, Gabber/Cheeze Graterz/grater003/00_va_-_in_the_mouth_of_madness_e.p.-(grater03)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Cheeze Graterz/grater003/00_va_-_in_the_mouth_of_madness_e.p.-(grater03)-vinyl-2008.sfv |
187 B |
| Hardcore, Gabber/Cheeze Graterz/grater003/a1_dj_hektek_-_in_the_mouth_of_madness.mp3 |
8.2 MB |
| Hardcore, Gabber/Cheeze Graterz/grater003/a2_autopsy_-_blowin_speakers.mp3 |
5.4 MB |
| Hardcore, Gabber/Cheeze Graterz/grater003/b1_intergalactik_purifier_-_re-soul.mp3 |
8.6 MB |
| Hardcore, Gabber/Cheeze Graterz/grater003/b2_tripped_-_meet_my_bitch.mp3 |
8.1 MB |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/00_va_-_the_collected_hardcore_works_vol_2-(hawor002)-vinyl-2008.jpg |
106 KB |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/00_va_-_the_collected_hardcore_works_vol_2-(hawor002)-vinyl-2008.m3u |
167 B |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/00_va_-_the_collected_hardcore_works_vol_2-(hawor002)-vinyl-2008.nfo |
799 B |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/00_va_-_the_collected_hardcore_works_vol_2-(hawor002)-vinyl-2008.sfv |
203 B |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/a1_dj_isaac_-_bad_dreams.mp3 |
7.5 MB |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/a2_dj_gizmo_-_the_end_of_the_beginning.mp3 |
7.3 MB |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/b1_square_dimensione_-_a_brand_new_dance.mp3 |
9.3 MB |
| Hardcore, Gabber/Cloud 9 Dance/hawor002/b2_dj_gizmo_and_delerium_-_do_you_wanna_dance.mp3 |
7.9 MB |
| Hardcore, Gabber/Coolman/(cm 001) - 6 pack - drunken piece of shit/_cm 001 (back.jpg |
174 KB |
| Hardcore, Gabber/Coolman/(cm 001) - 6 pack - drunken piece of shit/_cm 001 (front).jpg |
223 KB |
| Hardcore, Gabber/Coolman/(cm 001) - 6 pack - drunken piece of shit/a1 - 6 pack - drunken piece of shit (mix 1).mp3 |
3.3 MB |
| Hardcore, Gabber/Coolman/(cm 001) - 6 pack - drunken piece of shit/a2 - 6 pack - drunken piece of shit (mix 2).mp3 |
3.4 MB |
| Hardcore, Gabber/Coolman/(cm 001) - 6 pack - drunken piece of shit/b1 - 6 pack - drunken piece of shit (mix 3).mp3 |
4.4 MB |
| Hardcore, Gabber/Coolman/(cm 001) - 6 pack - drunken piece of shit/b2 - 6 pack - drunken piece of shit (mix 4).mp3 |
3.1 MB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/_cm 004 (a).jpeg |
393 KB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/_cm 004 (front).jpg |
206 KB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/a1 - mc r.a.w. - we, who are opressed (rob g, r. & d.w. mix).mp3 |
5.2 MB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/a2 - mc r.a.w. - we, who are opressed (frankfurt tc mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/b1 - mc r.a.w. - we, who are opressed (the prophet mix).mp3 |
7.2 MB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/b2 - mc r.a.w. - we, who are opressed (f.j. & bountyh. mix).mp3 |
5.4 MB |
| Hardcore, Gabber/Coolman/(cm 004) - mc r.a.w. - we, who are opressed/b3 - mc r.a.w. - we, who are opressed (dj rob mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Coolman/(cm 005) - dj rob & smash - korrekte bassdrum remixes/a1 - dj rob & smash - korrekte atmosphere (original smash).mp3 |
4 MB |
| Hardcore, Gabber/Coolman/(cm 005) - dj rob & smash - korrekte bassdrum remixes/a2 - dj rob & smash - ist diesen bassdrum korrekt.mp3 |
5.5 MB |
| Hardcore, Gabber/Coolman/(cm 005) - dj rob & smash - korrekte bassdrum remixes/b1 - dj rob & smash - korrekte bassdrum.mp3 |
5.7 MB |
| Hardcore, Gabber/Coolman/(cm 005) - dj rob & smash - korrekte bassdrum remixes/b2 - dj rob & smash - und diese.mp3 |
4.9 MB |
| Hardcore, Gabber/Coolman/(cm 006) - dj limited - arabsession/_cm 006 (a).jpeg |
356 KB |
| Hardcore, Gabber/Coolman/(cm 006) - dj limited - arabsession/_cm 006 (front).jpeg |
76 KB |
| Hardcore, Gabber/Coolman/(cm 006) - dj limited - arabsession/a1 - dj limited - arabsession.mp3 |
7 MB |
| Hardcore, Gabber/Coolman/(cm 006) - dj limited - arabsession/a2 - dj limited - devestading.mp3 |
7.3 MB |
| Hardcore, Gabber/Coolman/(cm 006) - dj limited - arabsession/b1 - dj limited - the anthem.mp3 |
7 MB |
| Hardcore, Gabber/Coolman/(cm 006) - dj limited - arabsession/b2 - dj limited - mind of a lunatic.mp3 |
5.7 MB |
| Hardcore, Gabber/Coolman/(cm 007) - citrus & dj rob - cybernetic empire from citrus/_cm 007 (front).jpg |
74 KB |
| Hardcore, Gabber/Coolman/(cm 007) - citrus & dj rob - cybernetic empire from citrus/a1 - citrus - you know what time it is.mp3 |
4.1 MB |
| Hardcore, Gabber/Coolman/(cm 007) - citrus & dj rob - cybernetic empire from citrus/a2 - citrus - you know what time it is (crytical mix).mp3 |
3.6 MB |
| Hardcore, Gabber/Coolman/(cm 007) - citrus & dj rob - cybernetic empire from citrus/b1 - citrus - you know what time it is (breakbeat edit).mp3 |
4 MB |
| Hardcore, Gabber/Coolman/(cm 007) - citrus & dj rob - cybernetic empire from citrus/b2 - dj rob - city to country.mp3 |
4.8 MB |
| Hardcore, Gabber/Coolman/(cm 008) - roughadam meets ganstadam - unsatisfied evil ii/a1 - roughadam meets ganstadam - een spannend avonttuurtje.mp3 |
6 MB |
| Hardcore, Gabber/Coolman/(cm 008) - roughadam meets ganstadam - unsatisfied evil ii/a2 - roughadam meets ganstadam - moerders houdt je dochters thuis.mp3 |
3.8 MB |
| Hardcore, Gabber/Coolman/(cm 008) - roughadam meets ganstadam - unsatisfied evil ii/b1 - roughadam meets ganstadam - bad creations.mp3 |
6.3 MB |
| Hardcore, Gabber/Coolman/(cm 008) - roughadam meets ganstadam - unsatisfied evil ii/b2 - roughadam meets ganstadam - the gangbangers.mp3 |
6.4 MB |
| Hardcore, Gabber/Coolman/(cm 009) - tim b - tim b ep/_cm 009 (a).jpeg |
162 KB |
| Hardcore, Gabber/Coolman/(cm 009) - tim b - tim b ep/_cm 009 (front).jpg |
9 KB |
| Hardcore, Gabber/Coolman/(cm 009) - tim b - tim b ep/a1 - tim b - step to it.mp3 |
7.8 MB |
| Hardcore, Gabber/Coolman/(cm 009) - tim b - tim b ep/a2 - tim b - step to it (dj rob & tim b remix).mp3 |
9.3 MB |
| Hardcore, Gabber/Coolman/(cm 009) - tim b - tim b ep/b1 - tim b - tim tim.mp3 |
6.9 MB |
| Hardcore, Gabber/Coolman/(cm 009) - tim b - tim b ep/b2 - tim b - bang.mp3 |
8.5 MB |
| Hardcore, Gabber/Coolman/(cm 010) - northern boys - from the north ep/_cm 010 (a).jpg |
170 KB |
| Hardcore, Gabber/Coolman/(cm 010) - northern boys - from the north ep/_cm 010 (front).jpg |
9 KB |
| Hardcore, Gabber/Coolman/(cm 010) - northern boys - from the north ep/a1 - northern boys - can you feel the passion.mp3 |
4.2 MB |
| Hardcore, Gabber/Coolman/(cm 010) - northern boys - from the north ep/a2 - northern boys - can you feel (remix).mp3 |
4.7 MB |
| Hardcore, Gabber/Coolman/(cm 010) - northern boys - from the north ep/b1 - northern boys - feel da passion (dutch dj squad remix).mp3 |
4 MB |
| Hardcore, Gabber/Coolman/(cm 010) - northern boys - from the north ep/b2 - northern boys - rock you again.mp3 |
4.2 MB |
| Hardcore, Gabber/Coolman/cm 018 - dark destination - sounds of darkness/a1 - dark destination - impulsive.mp3 |
5.3 MB |
| Hardcore, Gabber/Coolman/cm 018 - dark destination - sounds of darkness/a2 - dark destination - dark wizzdom.mp3 |
5.6 MB |
| Hardcore, Gabber/Coolman/cm 018 - dark destination - sounds of darkness/b1 - dark destination - don't fuck with me.mp3 |
5.5 MB |
| Hardcore, Gabber/Coolman/cm 018 - dark destination - sounds of darkness/b2 - dark destination - paroxysm.mp3 |
5.2 MB |
| Hardcore, Gabber/Coolman/cm051/00-na-goyah-beyond_my_sound-(cm051)-vinyl-2007-qtxmp3.m3u |
118 B |
| Hardcore, Gabber/Coolman/cm051/00-na-goyah-beyond_my_sound-(cm051)-vinyl-2007-qtxmp3.nfo |
9 KB |
| Hardcore, Gabber/Coolman/cm051/00-na-goyah-beyond_my_sound-(cm051)-vinyl-2007-qtxmp3.sfv |
148 B |
| Hardcore, Gabber/Coolman/cm051/a1-na-goyah-beyond_my_sound-qtxmp3.mp3 |
10.1 MB |
| Hardcore, Gabber/Coolman/cm051/b1-na-goyah-the_dark_myth-qtxmp3.mp3 |
9.9 MB |
| Hardcore, Gabber/Coolman/cm051/b2-na-goyah-fingers_in_tha_air-qtxmp3.mp3 |
10.3 MB |
| Hardcore, Gabber/Core Tex Labs/crtx005/a1 le-dealer-de-bruit - broken hierarchy.mp3 |
6 MB |
| Hardcore, Gabber/Core Tex Labs/crtx005/a2 knifehandchop - the way it has to be.mp3 |
2.1 MB |
| Hardcore, Gabber/Core Tex Labs/crtx005/a3 knifehandchop - i used to be a raver.mp3 |
4 MB |
| Hardcore, Gabber/Core Tex Labs/crtx005/b zip-le-robot & mr x - pathological grottecore.mp3 |
10.7 MB |
| Hardcore, Gabber/Corrupt Redux/redux001/00_matt_green-corrupt_redux_01-(redux01)-vinyl-2008.m3u |
133 B |
| Hardcore, Gabber/Corrupt Redux/redux001/00_matt_green-corrupt_redux_01-(redux01)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Corrupt Redux/redux001/00_matt_green-corrupt_redux_01-(redux01)-vinyl-2008.sfv |
169 B |
| Hardcore, Gabber/Corrupt Redux/redux001/a1_matt_green-thursday_nite_youth.mp3 |
6.9 MB |
| Hardcore, Gabber/Corrupt Redux/redux001/a2_matt_green-operation_wolf.mp3 |
6.7 MB |
| Hardcore, Gabber/Corrupt Redux/redux001/b1_matt_green-oyster_card.mp3 |
6.2 MB |
| Hardcore, Gabber/Corrupt Redux/redux001/b2_matt_green-rip_bodie.mp3 |
7.6 MB |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/00_cemtex_-_under_autority-(cosmic08)-vinyl-2008.m3u |
126 B |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/00_cemtex_-_under_autority-(cosmic08)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/00_cemtex_-_under_autority-(cosmic08)-vinyl-2008.sfv |
162 B |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/a1_cemtex_-_under_autority.mp3 |
9.6 MB |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/a2_cemtex_-_armater_pandouille.mp3 |
7.8 MB |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/b1_cemtex_-_metamorphing.mp3 |
10.5 MB |
| Hardcore, Gabber/Cosmic Baby/Cemtex_-_Under_Autority-(COSMIC08)-Vinyl-2008-SQ/b2_cemtex_-_wu_are_you.mp3 |
10.6 MB |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/00_catscan_-_my_first_response-(cr001)-vinyl-2007.m3u |
144 B |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/00_catscan_-_my_first_response-(cr001)-vinyl-2007.nfo |
8 KB |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/00_catscan_-_my_first_response-(cr001)-vinyl-2007.sfv |
180 B |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/a1_catscan_-_my_first_response.mp3 |
8.2 MB |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/a2_catscan_-_return_to_my_own_world.mp3 |
6.5 MB |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/b1_catscan_-_cr8tiv_counter.mp3 |
9.2 MB |
| Hardcore, Gabber/Cr8tiv Response/CR8T001/b2_catscan_-_philosopher_reading.mp3 |
10 MB |
| Hardcore, Gabber/Crossbones/bones010/00_va_-_a_decade_of_darkness-(bones10)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Crossbones/bones010/00_va_-_a_decade_of_darkness-(bones10)-vinyl-2006.sfv |
216 B |
| Hardcore, Gabber/Crossbones/bones010/a1_face_hoover_-_voices.mp3 |
10 MB |
| Hardcore, Gabber/Crossbones/bones010/a2_without_soul_and_in-tune_-_over_all_frequencies.mp3 |
7.2 MB |
| Hardcore, Gabber/Crossbones/bones010/b1_face_hoover_-_pure_fucking_armageddon.mp3 |
8 MB |
| Hardcore, Gabber/Crossbones/bones010/b2_floorkiller_project_-_let_the_light_take_you.mp3 |
8.5 MB |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/a1-tomash_gee-disco_quazar-sweet.mp3 |
9.9 MB |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/a2-tomash_gee-c21h27no-sweet.mp3 |
7.1 MB |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/b1-waldhaus-assault-sweet.mp3 |
6.8 MB |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/b2-waldhaus-grob-sweet.mp3 |
6.8 MB |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-sweet.m3u |
127 B |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-sweet.nfo |
9 KB |
| Hardcore, Gabber/Crowbar Recordings/[crowbar002] tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-2004-sweet/tomash_gee_vs_waldhaus-betta_getcha_off_that_heroin-sweet.sfv |
228 B |
| Hardcore, Gabber/Danamite/dnmt001/A1 Dana - Unendlichkeit.mp3 |
726 KB |
| Hardcore, Gabber/Danamite/dnmt001/B1 Dana - Restyled.mp3 |
9.7 MB |
| Hardcore, Gabber/Danamite/dnmt002/A1. DJ Dana - Back in time (Original mix).mp3 |
6.5 MB |
| Hardcore, Gabber/Danamite/dnmt002/B1. DJ Dana - Back in time (Temper Temper mix).mp3 |
6.4 MB |
| Hardcore, Gabber/Danamite/dnmt003/a1 - Dana - Catch My Drift (Mash Mix).mp3 |
7.6 MB |
| Hardcore, Gabber/Danamite/dnmt003/b1 - Dana - Catch My Drift (Rave Mix).mp3 |
8.5 MB |
| Hardcore, Gabber/Danamite/dnmt004/A1. D-Block & S-te-fan - Fresh new beat.mp3 |
10.7 MB |
| Hardcore, Gabber/Danamite/dnmt004/B1. D-Block & S-te-fan - Fresh new beat (Dana remix).mp3 |
9 MB |
| Hardcore, Gabber/Danamite/dnmt005/a1-dana-mash_(original_mix).mp3 |
10.5 MB |
| Hardcore, Gabber/Danamite/dnmt005/b1-dana-mash_(zany_remix).mp3 |
8.4 MB |
| Hardcore, Gabber/Dance Ecstasy 2001/de2029/00_rave_creator-a_new_mind-(de2029)-vinyl-1995.m3u |
76 B |
| Hardcore, Gabber/Dance Ecstasy 2001/de2029/00_rave_creator-a_new_mind-(de2029)-vinyl-1995.nfo |
900 B |
| Hardcore, Gabber/Dance Ecstasy 2001/de2029/00_rave_creator-a_new_mind-(de2029)-vinyl-1995.sfv |
94 B |
| Hardcore, Gabber/Dance Ecstasy 2001/de2029/a_rave_creator-a_new_mind_(mix-b).mp3 |
10 MB |
| Hardcore, Gabber/Dance Ecstasy 2001/de2029/b_rave_creator-a_new_mind_(mix-a).mp3 |
8.7 MB |
| Hardcore, Gabber/Dance Pool/dan6601496/00-va--we_are_frankfurt_(dan660149_6)-ep-1994-cmc.m3u |
257 B |
| Hardcore, Gabber/Dance Pool/dan6601496/00-va--we_are_frankfurt_(dan660149_6)-ep-1994-cmc.nfo |
1 KB |
| Hardcore, Gabber/Dance Pool/dan6601496/00-va--we_are_frankfurt_(dan660149_6)-ep-1994-cmc.sfv |
316 B |
| Hardcore, Gabber/Dance Pool/dan6601496/a1-mescalinum_united--symphonies_of_steel_part_1-cmc.mp3 |
5.6 MB |
| Hardcore, Gabber/Dance Pool/dan6601496/a2-program_1--shoot_dis_mf-cmc.mp3 |
3.6 MB |
| Hardcore, Gabber/Dance Pool/dan6601496/a3-100_percent_acidferous--101_scout-cmc.mp3 |
4.4 MB |
| Hardcore, Gabber/Dance Pool/dan6601496/b1-turbulence--six_million_ways_to_die-cmc.mp3 |
5.5 MB |
| Hardcore, Gabber/Dance Pool/dan6601496/b2-terrorists--interzone-cmc.mp3 |
3.8 MB |
| Hardcore, Gabber/Dance Pool/dan6601496/b3-stickhead--get_in_gear-cmc.mp3 |
4.3 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 001] - noisebuilder - untitled/[dancemaker 01] noisebuilder - untitled (a).mp3 |
9.7 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 001] - noisebuilder - untitled/[dancemaker 01] noisebuilder - untitled (b).mp3 |
8.7 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 001] - noisebuilder - untitled/face a.jpg |
35 KB |
| Hardcore, Gabber/Dancemaker/[dancemaker 002] - noisebuilder - untitled/[dancemaker 02] noisebuilder - untitled (a).mp3 |
10.1 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 002] - noisebuilder - untitled/[dancemaker 02] noisebuilder - untitled (b).mp3 |
9.5 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 002] - noisebuilder - untitled/face a.jpg |
22 KB |
| Hardcore, Gabber/Dancemaker/[dancemaker 003] - noisebuilder - dancemaker 3/[dancemaker 03] noisebuilder - kdrive (a2).mp3 |
7.6 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 003] - noisebuilder - dancemaker 3/[dancemaker 03] noisebuilder - yahoo (b).mp3 |
7.2 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 003] - noisebuilder - dancemaker 3/[dancemaker 03] noisebuilder - zav-01 (a1).mp3 |
3.2 MB |
| Hardcore, Gabber/Dancemaker/[dancemaker 003] - noisebuilder - dancemaker 3/face a.jpg |
247 KB |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/00_keja_and_k-plan-dans_le_rouge_03-(dlr03)-vinyl-2007-ct.m3u |
148 B |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/00_keja_and_k-plan-dans_le_rouge_03-(dlr03)-vinyl-2007-ct.nfo |
11 KB |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/00_keja_and_k-plan-dans_le_rouge_03-(dlr03)-vinyl-2007-ct.sfv |
184 B |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/a1_keja_vs_wantchouzis_krew-mother_fuck_version_francaise-ct.mp3 |
8.7 MB |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/a2_keja-b2_is_nosamplentube-ct.mp3 |
9.2 MB |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/b1_k-plan-zipzap-ct.mp3 |
7.2 MB |
| Hardcore, Gabber/Dans Le Rouge Production/dlr003/b2_keja-allusion-ct.mp3 |
7.7 MB |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/00-gabba_front_berlin_vs_hellseeker-project_enigma-(dark_2)-proper-vinyl-2006-1real.m3u |
162 B |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/00-gabba_front_berlin_vs_hellseeker-project_enigma-(dark_2)-proper-vinyl-2006-1real.nfo |
7 KB |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/00-gabba_front_berlin_vs_hellseeker-project_enigma-(dark_2)-proper-vinyl-2006-1real.sfv |
198 B |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/a1-gabba_front_berlin-lacrima_mosa_est-1real.mp3 |
7.2 MB |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/a2-gabba_front_berlin-bloodstorm-1real.mp3 |
6 MB |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/b1-hellseeker-forever-1real.mp3 |
6 MB |
| Hardcore, Gabber/Darkera/dark_2/Gabba_Front_Berlin_Vs_Hellseeker-Project_Enigma-(DARK_2)-PROPER-Vinyl-2006-1REAL/b2-hellseeker-into_the_dark-1real.mp3 |
5.4 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/_DF 003 (front).jpg |
5 KB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/A1 - DJ DIONE - Rude Boy Ragga.mp3 |
6 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/A2 - DJ DIONE - Energy.mp3 |
6.5 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/A3 - DJ DIONE - Ready To Rumble.mp3 |
5.3 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/B1 - DJ DIONE - Keep It Movin' (Gangsta Rhyme).mp3 |
6.9 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/B2 - DJ DIONE - Open Sesame.mp3 |
8.2 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 003) - dj dione - rude boy ragga/B3 - DJ DIONE - R.U. Readie.mp3 |
6.5 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/_DF 004 (front).jpg |
51 KB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/A1 - DJ PROMO - From Da Darkside.mp3 |
7.6 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/A2 - DJ PROMO - Boomin' Out The Box.mp3 |
5.1 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/A3 - DJ PROMO - Keep It Bouncings.mp3 |
8.4 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/B1 - DJ PROMO - The Killing Fields.mp3 |
2.3 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/B2 - DJ PROMO - Kill Da Noise.mp3 |
8.1 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/B3 - DJ PROMO - Killers (Original Mix).mp3 |
7.1 MB |
| Hardcore, Gabber/Dead Fly Cuts/(df 004) - promo - the killing fields/B4 - DJ PROMO - Killers (Drokz Remix).mp3 |
6.6 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 003 - dj dione - rude boy ragga (1997)/a1 - Dj Dione - Rude Boy Ragga.mp3 |
6 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 003 - dj dione - rude boy ragga (1997)/a2 - Dj Dione - Energy.mp3 |
6.5 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 003 - dj dione - rude boy ragga (1997)/a3 - Dj Dione - Ready To Rumble.mp3 |
5.3 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 003 - dj dione - rude boy ragga (1997)/b1 - Dj Dione - Keep It Movin' [Gangsta Rhyme].mp3 |
6.9 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 003 - dj dione - rude boy ragga (1997)/b2 - Dj Dione - Open Sesame.mp3 |
8.2 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 003 - dj dione - rude boy ragga (1997)/b3 - Dj Dione - R.U. Readie.mp3 |
6.5 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/00 - Dj Promo - The Killing Fields - cover.jpg |
74 KB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/A1 - Dj Promo - From Da Darkside.mp3 |
7.6 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/A2 - Dj Promo - Boomin Out The Box.mp3 |
5.1 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/A3 - Dj Promo - Keep It Bouncings.mp3 |
8.4 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/B1 - Dj Promo - The Killing Fields.mp3 |
2.3 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/B2 - Dj Promo - Kill Da Noise.mp3 |
8.1 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/B3 - Dj Promo - Killers (Original Mix).mp3 |
7.1 MB |
| Hardcore, Gabber/Dead Fly Cuts/df 004 - dj promo - the killing fields - vinyl-1997/B4 - Dj Promo - Killers (Drokz Remix).mp3 |
6.6 MB |
| Hardcore, Gabber/dEAdGirL/dg001/a1 - hourglass.mp3 |
8.9 MB |
| Hardcore, Gabber/dEAdGirL/dg001/a2 - thermonuclear war.mp3 |
8.5 MB |
| Hardcore, Gabber/dEAdGirL/dg001/a3 - east.mp3 |
7 MB |
| Hardcore, Gabber/dEAdGirL/dg001/a4 - complex pt. 1.mp3 |
9.3 MB |
| Hardcore, Gabber/dEAdGirL/dg001/a5 - 60 minute egg.mp3 |
8 MB |
| Hardcore, Gabber/dEAdGirL/dg001/a6 - it did work.mp3 |
1.8 MB |
| Hardcore, Gabber/dEAdGirL/dg001/b1 - chaos.mp3 |
6.3 MB |
| Hardcore, Gabber/dEAdGirL/dg001/b2 - top gold.mp3 |
8.1 MB |
| Hardcore, Gabber/dEAdGirL/dg001/b3 - blinded.mp3 |
6.8 MB |
| Hardcore, Gabber/dEAdGirL/dg001/b4 - complex pt. 2 (call the president).mp3 |
8.7 MB |
| Hardcore, Gabber/dEAdGirL/dg001/b5 - fuck you.mp3 |
11.7 MB |
| Hardcore, Gabber/dEAdGirL/dg002/01 - nasenbluten - cops and robbers.mp3 |
4.1 MB |
| Hardcore, Gabber/dEAdGirL/dg002/02 - nasenbluten - nice.mp3 |
1.4 MB |
| Hardcore, Gabber/dEAdGirL/dg002/03 - nasenbluten - razor gauntlet.mp3 |
1.4 MB |
| Hardcore, Gabber/dEAdGirL/dg002/04 - nasenbluten - fuck off.mp3 |
2.1 MB |
| Hardcore, Gabber/dEAdGirL/dg702/01 - nasenbluten - cops and robbers.mp3 |
4.1 MB |
| Hardcore, Gabber/dEAdGirL/dg702/02 - nasenbluten - nile.mp3 |
1.4 MB |
| Hardcore, Gabber/dEAdGirL/dg702/03 - nasenbluten - razor gauntlet.mp3 |
1.4 MB |
| Hardcore, Gabber/dEAdGirL/dg702/04 - nasenbluten - fuck off.mp3 |
2.1 MB |
| Hardcore, Gabber/dEAdGirL/dg703/a - xylocaine - we like dogs (spidergrind mix).mp3 |
6.9 MB |
| Hardcore, Gabber/dEAdGirL/dg703/b - xylocaine - medical suction dishes.mp3 |
7.2 MB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 01 -Track01.mp3 |
876 KB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 02 -Track02.mp3 |
6 MB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 03 -Track03.mp3 |
4.9 MB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 04 -Track04.mp3 |
4.7 MB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 05 -Track05.mp3 |
4 MB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 06 -Track06.mp3 |
1.3 MB |
| Hardcore, Gabber/dEAdGirL/dg803/[Xylocaine - Stoma Care] 07 -Track07.mp3 |
4.5 MB |
| Hardcore, Gabber/dEAdGirL/dg804/[Xylocaine - Unprofitable Servant] 01 -Unprofitable Servant.mp3 |
8.5 MB |
| Hardcore, Gabber/dEAdGirL/dg804/[Xylocaine - Unprofitable Servant] 02 -Chronic Illness.mp3 |
6.4 MB |
| Hardcore, Gabber/dEAdGirL/dg804/[Xylocaine - Unprofitable Servant] 03 -Grand Gland.mp3 |
5.5 MB |
| Hardcore, Gabber/dEAdGirL/dg804/[Xylocaine - Unprofitable Servant] 04 -Karpol Tunnol.mp3 |
5.8 MB |
| Hardcore, Gabber/dEAdGirL/dg804/[Xylocaine - Unprofitable Servant] 05 -Skippy Burger.mp3 |
5 MB |
| Hardcore, Gabber/dEAdGirL/dg805/[Data - Big Tit] 01 -FFF Antix.mp3 |
4.7 MB |
| Hardcore, Gabber/dEAdGirL/dg805/[Data - Big Tit] 02 -Frunt.mp3 |
7.3 MB |
| Hardcore, Gabber/dEAdGirL/dg805/[Data - Big Tit] 03 -Baked Fish.mp3 |
7.4 MB |
| Hardcore, Gabber/dEAdGirL/dg805/[Data - Big Tit] 04 -Max Dan Shit.mp3 |
4.8 MB |
| Hardcore, Gabber/dEAdGirL/dg805/[Data - Big Tit] 05 -Number 12.mp3 |
8.8 MB |
| Hardcore, Gabber/dEAdGirL/dg806/[Data - OneFourFive] 01 -OneFourFive.mp3 |
28.5 MB |
| Hardcore, Gabber/dEAdGirL/dgl005/a1-nasenbluten-concrete_compressor-original.mp3 |
6.8 MB |
| Hardcore, Gabber/dEAdGirL/dgl005/a2-nasenbluten-being_useful_drives_me_silly.mp3 |
3.7 MB |
| Hardcore, Gabber/dEAdGirL/dgl005/b1-nasenbluten-concrete_compressor-fuck_a_meathead.mp3 |
6.1 MB |
| Hardcore, Gabber/dEAdGirL/dgl005/b2-nasenbluten-out_for_blood.mp3 |
3.6 MB |
| Hardcore, Gabber/dEAdGirL/dgl005/b3-nasenbluten-smap_1.mp3 |
1 MB |
| Hardcore, Gabber/dEAdGirL/dgl006/01-nasenbluten-concrete compressor [billy graham remix].mp3 |
7.2 MB |
| Hardcore, Gabber/dEAdGirL/dgl006/02-nasenbluten-piss myself.mp3 |
3.6 MB |
| Hardcore, Gabber/dEAdGirL/dgl006/03-nasenbluten-concrete compressor [renal remix].mp3 |
6.2 MB |
| Hardcore, Gabber/dEAdGirL/dgl006/04-nasenbluten-what a complete fuckstick.mp3 |
1.2 MB |
| Hardcore, Gabber/dEAdGirL/dgl006/05-nasenbluten-wheel of misfortune.mp3 |
3.3 MB |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/00_kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf.m3u |
201 B |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/00_kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf.nfo |
994 B |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/00_kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf.sfv |
673 B |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/a1_kesj_&_donut_-_keep_it_hardcore_(k&d_remix)-hf.mp3 |
6.7 MB |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/a2_kesj_&_donut_-_motherfucker_bass-hf.mp3 |
6 MB |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/b1_kesj_&_donut_-_bumrush_the_whole_thing-hf.mp3 |
5.6 MB |
| Hardcore, Gabber/Death Blow/db9712005 - kesj_&_donut_-_bumrush_it_all_ep-(db9712005)-vinyl-1997-hf/b2_kesj_&_donut_-_keep_it_hardcore_(original)-hf.mp3 |
6.3 MB |
| Hardcore, Gabber/Deathchant/afghan001/a1 - diplomat & hellfish - untitled.mp3 |
14.1 MB |
| Hardcore, Gabber/Deathchant/afghan001/a2 - diplomat & hellfish - untitled.mp3 |
3.8 MB |
| Hardcore, Gabber/Deathchant/afghan001/a3 - diplomat & hellfish - untitled.mp3 |
4.8 MB |
| Hardcore, Gabber/Deathchant/afghan001/b1 - diplomat & hellfish - untitled.mp3 |
4.8 MB |
| Hardcore, Gabber/Deathchant/afghan001/b2 - diplomat & hellfish - untitled.mp3 |
5.1 MB |
| Hardcore, Gabber/Deathchant/afghan001/b3 - diplomat & hellfish - untitled.mp3 |
3 MB |
| Hardcore, Gabber/Deathchant/afghan001/b4 - diplomat & hellfish - untitled.mp3 |
6.3 MB |
| Hardcore, Gabber/Deathchant/afghan001/b5 - diplomat & hellfish - untitled.mp3 |
666 KB |
| Hardcore, Gabber/Deathchant/chant-1/a1_micron_-_funked_up_hymn-sq.mp3 |
9.3 MB |
| Hardcore, Gabber/Deathchant/chant-1/b1_micron_-_psychik_experiences-sq.mp3 |
9.4 MB |
| Hardcore, Gabber/Deathchant/chant-1/b2_micron_-_the_jackal-sq.mp3 |
9.8 MB |
| Hardcore, Gabber/Deathchant/chant-10/a1_liquid_blasted_-_killers_rave.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chant-10/b1_liquid_blasted_-_break_the_news.mp3 |
8.9 MB |
| Hardcore, Gabber/Deathchant/chant-2/01-hellfish_and_bryan_fury-dog_porn-twc.mp3 |
6.1 MB |
| Hardcore, Gabber/Deathchant/chant-2/02-hellfish_and_bryan_fury-gripper_vs_jumbo_fingers-twc.mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chant-3/a1_liquid_blasted_-_back_in_ussr-sq.mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chant-3/a2_liquid_blasted_-_feel_so_grey-sq.mp3 |
9.2 MB |
| Hardcore, Gabber/Deathchant/chant-3/b1_liquid_blasted_-_blunt_light_sabre-sq.mp3 |
9.2 MB |
| Hardcore, Gabber/Deathchant/chant-3/b2_liquid_blasted_-_this_factory-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Deathchant/chant-4/a1_messiah_corps_-_wrong_side_of_the_grave-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Deathchant/chant-4/a2_messiah_corps_-_check_yourself-sq.mp3 |
6.2 MB |
| Hardcore, Gabber/Deathchant/chant-4/b1_messiah_corps_-_smashin_heads-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chant-4/b2_messiah_corps_-_brain_parasites-sq.mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/chant-5/a1 fucknine.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chant-5/b1 dogporn (bryan fury remix).mp3 |
8.4 MB |
| Hardcore, Gabber/Deathchant/chant-5/b2 fuck (death 2 edit by hellfish).mp3 |
7.4 MB |
| Hardcore, Gabber/Deathchant/chant-6/a1_hellfish_-_armadrillo_mk.2-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Deathchant/chant-6/b1_hellfish_-_rampageat218-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Deathchant/chant-7/a1-moleculez-drumbleed.mp3 |
9.1 MB |
| Hardcore, Gabber/Deathchant/chant-7/a2-moleculez-auto_damage.mp3 |
12 MB |
| Hardcore, Gabber/Deathchant/chant-7/b1-moleculez-stomp_242.mp3 |
2.7 MB |
| Hardcore, Gabber/Deathchant/chant-9/a1_bryan_fury_-_negative_drop-sq.mp3 |
11.9 MB |
| Hardcore, Gabber/Deathchant/chant-9/a2_bryan_fury_-_oblivion_request-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chant-9/b1_bryan_fury_-_critical-sq.mp3 |
11 MB |
| Hardcore, Gabber/Deathchant/chant-9/b2_bryan_fury_-_dead_cycle-sq.mp3 |
8 MB |
| Hardcore, Gabber/Deathchant/chant000/A1 - The Producer - Whatever It Takes.mp3 |
6.5 MB |
| Hardcore, Gabber/Deathchant/chant000/B1 - Hellfish - Radical Digital.mp3 |
4.7 MB |
| Hardcore, Gabber/Deathchant/chant000/B1 - Hellfish - Radical Digital.mp3.asd |
347 KB |
| Hardcore, Gabber/Deathchant/chant001/a1 - where angels fear to tread.mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/chant001/b1 - polaris.mp3 |
5.9 MB |
| Hardcore, Gabber/Deathchant/chant001/b2 - who the fuck are you.mp3 |
5.6 MB |
| Hardcore, Gabber/Deathchant/chant002/[A2] Technological Terror Crew - Purity Of Oblivion.mp3 |
3.1 MB |
| Hardcore, Gabber/Deathchant/chant002/[B1] Technological Terror Crew - Fuck Your System.mp3 |
5.7 MB |
| Hardcore, Gabber/Deathchant/chant002/[B2] Technological Terror Crew - Power Up.mp3 |
5.8 MB |
| Hardcore, Gabber/Deathchant/chant003/[A1] Technological Terror Crew - Technological Terror.mp3 |
4.2 MB |
| Hardcore, Gabber/Deathchant/chant003/[B1] Technological Terror Crew - UK Fresh.mp3 |
5.3 MB |
| Hardcore, Gabber/Deathchant/chant004/[A1] Diplomat - Cool & Deadly.mp3 |
4.6 MB |
| Hardcore, Gabber/Deathchant/chant004/[A2] Diplomat - The Screamer.mp3 |
5 MB |
| Hardcore, Gabber/Deathchant/chant004/[B1] Diplomat - Brainwave.mp3 |
4.6 MB |
| Hardcore, Gabber/Deathchant/chant004/[B2] Diplomat - The Running Man.mp3 |
5.1 MB |
| Hardcore, Gabber/Deathchant/chant005/[A1] Technological Terror Crew - The Ripper.mp3 |
4.9 MB |
| Hardcore, Gabber/Deathchant/chant005/[A1] Technological Terror Crew - Where Angels Fear To Tread .mp3 |
5.2 MB |
| Hardcore, Gabber/Deathchant/chant005/[B1] Technological Terror Crew - 7 Muthafuckas.mp3 |
5.2 MB |
| Hardcore, Gabber/Deathchant/chant005/[B2] Technological Terror Crew - Swearcore.mp3 |
4.2 MB |
| Hardcore, Gabber/Deathchant/chant006/[A1] Wargroover - British Nightmare.mp3 |
4.1 MB |
| Hardcore, Gabber/Deathchant/chant006/[A2] Wargroover - Take That Mutha Fuk.mp3 |
4.1 MB |
| Hardcore, Gabber/Deathchant/chant006/[B1] Wargroover - Terraforming.mp3 |
4.9 MB |
| Hardcore, Gabber/Deathchant/chant006/[B2] Wargroover - Focus On The Beat.mp3 |
4.5 MB |
| Hardcore, Gabber/Deathchant/chant007/a1_hellfish-driven_by_rage-doc.mp3 |
8 MB |
| Hardcore, Gabber/Deathchant/chant007/A2 - Hellfish - The Crippler.mp3 |
8.3 MB |
| Hardcore, Gabber/Deathchant/chant007/b1_hellfish-techno_city-doc.mp3 |
7.4 MB |
| Hardcore, Gabber/Deathchant/chant007/B2 - Hellfish - Terrorizer.mp3 |
8.7 MB |
| Hardcore, Gabber/Deathchant/chant008/[A1] The Producer - Damage By DJ.mp3 |
9.5 MB |
| Hardcore, Gabber/Deathchant/chant008/[B1] The Producer - Screamers Revenge.mp3 |
5.6 MB |
| Hardcore, Gabber/Deathchant/chant008/[B2] The Producer - Ode 2 Death Row.mp3 |
5.8 MB |
| Hardcore, Gabber/Deathchant/chant009/[A1] Diplomat - Mind Winder (Pure Mix).mp3 |
5.2 MB |
| Hardcore, Gabber/Deathchant/chant009/[A2] Diplomat - Mind Winder (One For The Hoes Mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Deathchant/chant009/[B1] Diplomat - Bass Drum Killer.mp3 |
4 MB |
| Hardcore, Gabber/Deathchant/chant009/[B2] Diplomat - Brainwave Live At Rez.mp3 |
7.2 MB |
| Hardcore, Gabber/Deathchant/chant009/[B3] Diplomat - Wrath.mp3 |
5.4 MB |
| Hardcore, Gabber/Deathchant/chant010/01-destined_for_destruction-doc.mp3 |
10.1 MB |
| Hardcore, Gabber/Deathchant/chant010/02-headbanger_(ballbasher_mix)-doc.mp3 |
8.2 MB |
| Hardcore, Gabber/Deathchant/chant010/03-way_of_the_homeboy_part_1-doc.mp3 |
10.7 MB |
| Hardcore, Gabber/Deathchant/chant011/[A1] The Producer - Only I Can Do It (Retarded Kickdrum Remi.mp3 |
5.1 MB |
| Hardcore, Gabber/Deathchant/chant011/[A2] The Producer - Only I Can Do It (The Original Scratch).mp3 |
6.6 MB |
| Hardcore, Gabber/Deathchant/chant011/[B1] The Producer - Religion II (Bringer Of War).mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chant011/[B2] The Producer - Poor Man A Break (2 To The 3...).mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/chant012/a1_hellfish-ultimate_damage_98-doc.mp3 |
8.6 MB |
| Hardcore, Gabber/Deathchant/chant012/b1_the_producer-research_and_development_(21st_century_core).mp3 |
11.3 MB |
| Hardcore, Gabber/Deathchant/chant013/[a1] the death syndicate - no sound fx.mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chant013/[a2] the death syndicate - the gimp.mp3 |
5.9 MB |
| Hardcore, Gabber/Deathchant/chant013/[b1] the death syndicate - system overload.mp3 |
4.9 MB |
| Hardcore, Gabber/Deathchant/chant013/[b2] the death syndicate - metabolic disorder.mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/chant014/[A1] Hellfish & The Producer - Do Ya Like.mp3 |
6.6 MB |
| Hardcore, Gabber/Deathchant/chant015/[a1] dolphin & dj tox - weak motherfuckers.mp3 |
4.9 MB |
| Hardcore, Gabber/Deathchant/chant015/[a2] dolphin & dj tox - the gabba stabba.mp3 |
4.8 MB |
| Hardcore, Gabber/Deathchant/chant015/[b1] dolphin & dj tox - aggravated violent assault.mp3 |
4.4 MB |
| Hardcore, Gabber/Deathchant/chant015/[b2] dolphin & dj tox - the producers crashcan remix.mp3 |
6.4 MB |
| Hardcore, Gabber/Deathchant/chant016/[A1] Hellfish & The Producer - No More Rock 'N Roll (Koala F.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chant016/[B1] Hellfish & The Producer - The Way Of The Homeboy Part 2.mp3 |
6.6 MB |
| Hardcore, Gabber/Deathchant/chant017/a1_hellfish-hardcore_body_harvest_(bunker_clot_mix)-doc.mp3 |
8 MB |
| Hardcore, Gabber/Deathchant/chant017/b1_hellfish-martian_ambassador_(uk_electric_boogie_mix)-doc.mp3 |
8.9 MB |
| Hardcore, Gabber/Deathchant/chant018/a1_the_producer-kickdrum_kamikazee_(stoopid_mutha_fukka)-doc.mp3 |
8.7 MB |
| Hardcore, Gabber/Deathchant/chant018/b1_the_producer-king_of_the_vari-speed_(respect_your_old_sko.mp3 |
10.7 MB |
| Hardcore, Gabber/Deathchant/chant018/b2_the_producer-battle_scar_1-doc.mp3 |
3.6 MB |
| Hardcore, Gabber/Deathchant/chant018/b3_the_producer-battle_scar_2_(bonus_beats_4_jockey_sluts)-d.mp3 |
2.7 MB |
| Hardcore, Gabber/Deathchant/chant019/a1_hellfish-serious-evil-shit-mission-3-doc.mp3 |
12.7 MB |
| Hardcore, Gabber/Deathchant/chant019/b1_hellfish-compression_warrior-doc.mp3 |
8.1 MB |
| Hardcore, Gabber/Deathchant/chant020/b1_hellfish-r2_(the_ascension_of_vengeance_remix)-doc.mp3 |
13.6 MB |
| Hardcore, Gabber/Deathchant/chant020/producer - 21st century core.mp3 |
11.5 MB |
| Hardcore, Gabber/Deathchant/chant021/[a1] micropoint - my computer.mp3 |
5 MB |
| Hardcore, Gabber/Deathchant/chant021/[b1] micropoint - static anger.mp3 |
4.6 MB |
| Hardcore, Gabber/Deathchant/chant022/a1_the_producer-technologikal_revolution.mp3 |
13.3 MB |
| Hardcore, Gabber/Deathchant/chant022/b1_the_producer-the_sirens_of_aqua_sulis.mp3 |
10.7 MB |
| Hardcore, Gabber/Deathchant/chant023/a1 - hellfish & skeeta - the uridium project.mp3 |
4.7 MB |
| Hardcore, Gabber/Deathchant/chant023/b1 - hellfish & diplomat - ffirehs syndrome.mp3 |
5.8 MB |
| Hardcore, Gabber/Deathchant/chant024/[A1] Hellfish - Turntable Savage.mp3 |
6.7 MB |
| Hardcore, Gabber/Deathchant/chant024/[B1] Hellfish - Head Grit.mp3 |
8 MB |
| Hardcore, Gabber/Deathchant/chant025/01-a1_hellfish_the_producer_and_skeeta-spitting_blood-doc.mp3 |
9.6 MB |
| Hardcore, Gabber/Deathchant/chant025/02-b1_hellfish_the_producer_and_skeeta-high_powered_mutant-d.mp3 |
8.6 MB |
| Hardcore, Gabber/Deathchant/chant026/01-a1_the_producer-harder_they_fall_(kamikazees_reprize)-doc.mp3 |
11.3 MB |
| Hardcore, Gabber/Deathchant/chant026/02-b1_the_producer-b-boy_brutality_(uk_reprobate_beats_this).mp3 |
9.9 MB |
| Hardcore, Gabber/Deathchant/chant027/[a1] hellfish - ripper (original mix).mp3 |
5 MB |
| Hardcore, Gabber/Deathchant/chant027/[a2] skeeta - the ripper (remixed).mp3 |
4.6 MB |
| Hardcore, Gabber/Deathchant/chant027/[b2] skeeta - the ripper (final mix).mp3 |
6.2 MB |
| Hardcore, Gabber/Deathchant/chant028/[a1] hellfish - man vs. machine.mp3 |
4.7 MB |
| Hardcore, Gabber/Deathchant/chant028/[b1] hellfish - harder they fall (remix).mp3 |
5.7 MB |
| Hardcore, Gabber/Deathchant/chant028/[b1] hellfish - harder they fall (remix).mp3.asd |
417 KB |
| Hardcore, Gabber/Deathchant/chant029/[A1] Diplomat & Trouble - Tantalum Cones.mp3 |
7.8 MB |
| Hardcore, Gabber/Deathchant/chant029/[B1] Diplomat & Trouble - Accursed Delusions.mp3 |
6.7 MB |
| Hardcore, Gabber/Deathchant/chant030/[A1] Rude Ass Tinker - Imperial Break.mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/chant031/[A1] Hardcoholics - Trashcoders.mp3 |
8.8 MB |
| Hardcore, Gabber/Deathchant/chant031/[B1] Hardcoholics - Shaman Of The Future.mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chant032/[A1] The Producer - Rude Attitude (B-Boy Throwdown Live @ Th.mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chant032/[B1] The Producer - The True Creators, Part 1.mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chant033/[a1] hellfish - speed drinking.mp3 |
6.3 MB |
| Hardcore, Gabber/Deathchant/chant033/[b1] hellfish - control freak.mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chant034/[A1] Hellfish - Bring On The Hurricane Pain.mp3 |
4.9 MB |
| Hardcore, Gabber/Deathchant/chant034/[B1] Hellfish - Meat Machine Broadcast System.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chant035/[A1] Hardcoholics - Oblivious.mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chant035/[B1] Hardcoholics - Chunk Of Meat.mp3 |
6.3 MB |
| Hardcore, Gabber/Deathchant/chant035/[B2] Hardcoholics - Final Conflict.mp3 |
6.2 MB |
| Hardcore, Gabber/Deathchant/chant036/01-no._1_set_and_sound-doc.mp3 |
8.9 MB |
| Hardcore, Gabber/Deathchant/chant036/02-channel_tunnel_prt_2-doc.mp3 |
6.6 MB |
| Hardcore, Gabber/Deathchant/chant037/a1_sammy_-_controlled_module.mp3 |
8.6 MB |
| Hardcore, Gabber/Deathchant/chant037/b1_sammy_-_smash_the_state.mp3 |
7.2 MB |
| Hardcore, Gabber/Deathchant/chant038/a1 - dj producer & hellfish - non standard procedure.mp3 |
9.1 MB |
| Hardcore, Gabber/Deathchant/chant038/b1 - dj producer & hellfish - theme from fuck daddy.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chant039/b1_hellfish_-_line_em_up-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chant039/Hellfish and Producer-Toilet Wars.mp3 |
6.4 MB |
| Hardcore, Gabber/Deathchant/chant040/a-andranim-doc.mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chant040/b-rebel_assault-doc.mp3 |
6.4 MB |
| Hardcore, Gabber/Deathchant/chant041/01-humalien-doc.mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chant041/02-professional_psycho-doc.mp3 |
8.5 MB |
| Hardcore, Gabber/Deathchant/chant042/deathchant42a1- the dj producer - the true creators pt. 2.mp3 |
10.3 MB |
| Hardcore, Gabber/Deathchant/chant042/deathchant42b1- the dj producer - another mindless breakbeat.mp3 |
9 MB |
| Hardcore, Gabber/Deathchant/chant042/deathchant42b2- the dj producer - mechanoid communique.mp3 |
8.5 MB |
| Hardcore, Gabber/Deathchant/chant043/[A1] Hellfish - U Don't Quit.mp3 |
4 MB |
| Hardcore, Gabber/Deathchant/chant043/[B1] The Producer - Megamix 666.mp3 |
7.1 MB |
| Hardcore, Gabber/Deathchant/chant044/a1_radium_and_hellfish_-_detox-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Deathchant/chant044/b1_radium_and_hellfish_-_motordog_bytes_back-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Deathchant/chant045/a1_death_syndicate_-_cytotoxic-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Deathchant/chant045/b1_death_syndicate_-_adrenosceptor-sq.mp3 |
9.6 MB |
| Hardcore, Gabber/Deathchant/chant046/a1_skeeta_vs_hellfish_-_glass_eye_firearm-sq.mp3 |
5.3 MB |
| Hardcore, Gabber/Deathchant/chant046/a2_skeeta_vs_hellfish_-_ant_food-sq.mp3 |
6.2 MB |
| Hardcore, Gabber/Deathchant/chant046/b1_skeeta_vs_hellfish_-_robjok-sq.mp3 |
9.1 MB |
| Hardcore, Gabber/Deathchant/chant046/b2_skeeta_vs_hellfish_-_hipposys-sq.mp3 |
4.1 MB |
| Hardcore, Gabber/Deathchant/chant047/a1_bryan_fury_-_blood_in_blood_out-sq.mp3 |
9.4 MB |
| Hardcore, Gabber/Deathchant/chant047/b2_bryan_fury_-_death_be_not_proud-sq.mp3 |
10.1 MB |
| Hardcore, Gabber/Deathchant/chant048/[A1] Hellfish - Wolfman.mp3 |
6.4 MB |
| Hardcore, Gabber/Deathchant/chant049/a1_dolphin_-_disco_shit-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chant049/b1_the_teknoist_-_kev_mcalls_late_burpday_present-sq.mp3 |
10.3 MB |
| Hardcore, Gabber/Deathchant/chant049/b1_the_teknoist_-_kev_mcalls_late_burpday_present-sq.mp3.asd |
502 KB |
| Hardcore, Gabber/Deathchant/chant050/00_hellfish_-_rip_the_cut_and_hardcore_will_never_die-(deathchant50)-vinyl-2006.m3u |
72 B |
| Hardcore, Gabber/Deathchant/chant050/00_hellfish_-_rip_the_cut_and_hardcore_will_never_die-(deathchant50)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Deathchant/chant050/00_hellfish_-_rip_the_cut_and_hardcore_will_never_die-(deathchant50)-vinyl-2006.sfv |
138 B |
| Hardcore, Gabber/Deathchant/chant050/a1_hellfish_-_rip_the_cut.mp3 |
11.3 MB |
| Hardcore, Gabber/Deathchant/chant050/a1_hellfish_-_rip_the_cut.mp3.asd |
432 KB |
| Hardcore, Gabber/Deathchant/chant050/b1_hellfish_-_hardcore_will_never_die.mp3 |
8.5 MB |
| Hardcore, Gabber/Deathchant/chant051/00-igor-funk_off-(dc51)-vinyl-2007-1king.m3u |
120 B |
| Hardcore, Gabber/Deathchant/chant051/00-igor-funk_off-(dc51)-vinyl-2007-1king.nfo |
10 KB |
| Hardcore, Gabber/Deathchant/chant051/00-igor-funk_off-(dc51)-vinyl-2007-1king.sfv |
3 KB |
| Hardcore, Gabber/Deathchant/chant051/a1-igor-funk_off.mp3 |
8.9 MB |
| Hardcore, Gabber/Deathchant/chant051/a2-igor-drop_it.mp3 |
9.4 MB |
| Hardcore, Gabber/Deathchant/chant051/b1-igor-haters_wanna_war.mp3 |
6.1 MB |
| Hardcore, Gabber/Deathchant/chant051/b2-intensik-nylon.mp3 |
5 MB |
| Hardcore, Gabber/Deathchant/chant051/b3-igor-negative_heaven.mp3 |
8.2 MB |
| Hardcore, Gabber/Deathchant/chant052/00_deathmachine_-_bass_disintegrate-(deathchant52)-vinyl-2007.m3u |
83 B |
| Hardcore, Gabber/Deathchant/chant052/00_deathmachine_-_bass_disintegrate-(deathchant52)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Deathchant/chant052/00_deathmachine_-_bass_disintegrate-(deathchant52)-vinyl-2007.sfv |
136 B |
| Hardcore, Gabber/Deathchant/chant052/a1_deathmachine_-_bass_disintegrate.mp3 |
8.5 MB |
| Hardcore, Gabber/Deathchant/chant052/b1_deathmachine_-_psychotoxic_stompbox.mp3 |
8.7 MB |
| Hardcore, Gabber/Deathchant/chantlp001/Diplomat & Beagle - Polaris Remix.mp3 |
7.7 MB |
| Hardcore, Gabber/Deathchant/chantlp001/Diplomat - Techno City Remix.mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chantlp001/DJ Producer - The DJ Producer Takes Deathchant to the Butche.mp3 |
7.4 MB |
| Hardcore, Gabber/Deathchant/chantlp001/Dolphin & DJ Tox - Who Da Fuck Are You (Remix).mp3 |
7.4 MB |
| Hardcore, Gabber/Deathchant/chantlp001/Hellfish & Skeeta - Running Man (the Butcher of Bakersfield .mp3 |
9.7 MB |
| Hardcore, Gabber/Deathchant/chantlp001/Hellfish, Diplomat & Smarti - Eastcoast Killer.mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/chantlp001/Scorpio & Wargroover - Psychotic Breaks.mp3 |
7.8 MB |
| Hardcore, Gabber/Deathchant/chantlp002/a1 - dj hellfish - ak47 muthaf-cka (rmx).mp3 |
7.2 MB |
| Hardcore, Gabber/Deathchant/chantlp002/a2 - the producer - ultimate damage 98-99.mp3 |
7.9 MB |
| Hardcore, Gabber/Deathchant/chantlp002/b1 - the producer - destined for destruction (rmx).mp3 |
9 MB |
| Hardcore, Gabber/Deathchant/chantlp002/b2 - dj hellfish - shit talker tt part 2 [live @ nosebleed].mp3 |
7 MB |
| Hardcore, Gabber/Deathchant/chantlp002/c1 - dj hellfish - structurally unsound (rmx).mp3 |
6.7 MB |
| Hardcore, Gabber/Deathchant/chantlp002/c2 - dj hellfish - demolition by dj.mp3 |
8.8 MB |
| Hardcore, Gabber/Deathchant/chantlp002/d1 - the diplomat & producer - on fire.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chantlp002/d2 - the producer - the butcher is back!.mp3 |
7.6 MB |
| Hardcore, Gabber/Deathchant/chantlp003/a1_hellfish_-_theme_form_fuck_daddy_(remix)-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Deathchant/chantlp003/a2_skeeta_-_uncontrolled_freak-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Deathchant/chantlp003/b1_rude_ass_tinker_-_magical_digital-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chantlp003/b2_androgyn_network_-_bring_on_the_hurricane_pain_(remix)-sq.mp3 |
6 MB |
| Hardcore, Gabber/Deathchant/chantlp003/c1_speed_freak_-_the_wrath_of_the_psychopath-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Deathchant/chantlp003/c2_ely_muff_-_toilet_muff-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Deathchant/chantlp003/d1_tieum_-_humalien_(remix)-sq.mp3 |
6 MB |
| Hardcore, Gabber/Deathchant/chantlp003/d2_producer_-_body_harvest_death_of_a_bunkerclot_(remix)-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Deathchant/chantlp004/A1 Micron - Hiroshima.mp3 |
9.8 MB |
| Hardcore, Gabber/Deathchant/chantlp004/A2 Micron - Urban Splash.mp3 |
8.4 MB |
| Hardcore, Gabber/Deathchant/chantlp004/B1 Micron - Somnambulism.mp3 |
9.9 MB |
| Hardcore, Gabber/Deathchant/chantlp004/B2 Micron - Phoneutria Fera.mp3 |
6.9 MB |
| Hardcore, Gabber/Deathchant/chantlp004/C1 Micron - Psychotoxic.mp3 |
10.2 MB |
| Hardcore, Gabber/Deathchant/chantlp004/C2 Micron - The Slums Of Caracas.mp3 |
6.4 MB |
| Hardcore, Gabber/Deathchant/chantlp004/D1 Micron - Darkness Falls.mp3 |
9.8 MB |
| Hardcore, Gabber/Deathchant/chantlp004/D2 Micron - Loxosceles Reclusa.mp3 |
6.8 MB |
| Hardcore, Gabber/Deathchant/chantlp005/a1_stormtrooper_-_death_jam-sq.mp3 |
11.2 MB |
| Hardcore, Gabber/Deathchant/chantlp005/a2_stormtrooper_-_meet_your_destiny-sq.mp3 |
8 MB |
| Hardcore, Gabber/Deathchant/chantlp005/b1_stormtrooper_-_der_suden_rockt-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chantlp005/b2_stormtrooper_-_get_slayed-sq.mp3 |
10.1 MB |
| Hardcore, Gabber/Deathchant/chantlp005/c1_stormtrooper_-_porndrums-sq.mp3 |
8.8 MB |
| Hardcore, Gabber/Deathchant/chantlp005/c2_stormtrooper_-_a500-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Deathchant/chantlp005/d1_stormtrooper_-_megara-sq.mp3 |
9.2 MB |
| Hardcore, Gabber/Deathchant/chantlp005/d2_stormtrooper_-_japanese_girls_bring_terror-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Deathchant/chantlp006/a1_liquid_blasted_-_survival-sq.mp3 |
9.3 MB |
| Hardcore, Gabber/Deathchant/chantlp006/a2_liquid_blasted_-_brotherhood_of_pill-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Deathchant/chantlp006/b1_liquid_blasted_-_frakktal_wire-sq.mp3 |
9.3 MB |
| Hardcore, Gabber/Deathchant/chantlp006/b2_liquid_blasted_-_enjoy_my_music_shit-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Deathchant/chantlp006/c1_liquid_blasted_-_insectnoiz-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Deathchant/chantlp006/c2_liqiud_blasted_-_its_time_to_make_it_harder-sq.mp3 |
10.8 MB |
| Hardcore, Gabber/Deathchant/chantlp006/d1_liqiud_blasted_-_chopisdish-sq.mp3 |
10.1 MB |
| Hardcore, Gabber/Deathchant/chantlp006/d2_liquid_blasted_-_speed_(feat_lilya)-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Deathchant/chantlp008/a1_hellfish_-_im_a_psycho.mp3 |
8.8 MB |
| Hardcore, Gabber/Deathchant/chantlp008/b1_hellfish_-_tears_from_beers.mp3 |
6.1 MB |
| Hardcore, Gabber/Deathchant/chantlp008/c1_hellfish_-_my_style.mp3 |
7.6 MB |
| Hardcore, Gabber/Deathchant/chantlp008/d1_hellfish_-_all_my_friends_are_dead.mp3 |
8.3 MB |
| Hardcore, Gabber/Deathchant/chantlp008/d2_hellfish_-_dead_beats.mp3 |
3.4 MB |
| Hardcore, Gabber/Deathchant/chantlp008/e1_hellfish_-_dogfish.mp3 |
6.3 MB |
| Hardcore, Gabber/Deathchant/chantlp008/f1_hellfish_-_back_by_dope_demand-trackfix.mp3 |
3.7 MB |
| Hardcore, Gabber/Deathchant/chantlp008/f2_hellfish_-_greasy_fast_speed-trackfix.mp3 |
8.4 MB |
| Hardcore, Gabber/Deathchant/cjd001/a1_hellfish_-_unknown_track.mp3 |
3.7 MB |
| Hardcore, Gabber/Deathchant/cjd001/a2_hellfish_-_unknown_track.mp3 |
4.3 MB |
| Hardcore, Gabber/Deathchant/cjd001/a2_hellfish_-_unknown_track.mp3.asd |
369 KB |
| Hardcore, Gabber/Deathchant/cjd001/a3_hellfish_-_unknown_track.mp3 |
5.5 MB |
| Hardcore, Gabber/Deathchant/cjd001/a4_hellfish_-_unknown_track.mp3 |
8.2 MB |
| Hardcore, Gabber/Deathchant/cjd001/b1_hellfish_-_unknown_track.mp3 |
5.4 MB |
| Hardcore, Gabber/Deathchant/cjd001/b2_hellfish_-_unknown_track.mp3 |
3.7 MB |
| Hardcore, Gabber/Deathchant/cjd001/b3_hellfish_-_unknown_track.mp3 |
3.6 MB |
| Hardcore, Gabber/Deathchant/cjd001/b4_hellfish_-_unknown_track.mp3 |
784 KB |
| Hardcore, Gabber/Deathchant/cjd001/b5_hellfish_-_unknown_track.mp3 |
856 KB |
| Hardcore, Gabber/Deathchant/cjd001/b6_hellfish_-_unknown_track.mp3 |
1.6 MB |
| Hardcore, Gabber/Deathchant/cjd001/b7_hellfish_-_unknown_track.mp3 |
908 KB |
| Hardcore, Gabber/Deathchant/cjd001/b8_hellfish_-_unknown_track.mp3 |
824 KB |
| Hardcore, Gabber/Deathchant/cjd001/b9_hellfish_-_unknown_track.mp3 |
904 KB |
| Hardcore, Gabber/Deathchant/dca.e.w001/a1-hellfish-hardcore_body_harvest-trt.mp3 |
10.3 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/a2-producer-screamers_revenge-trt.mp3 |
10.5 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/b1-hellfish_and_skeeta-the_running_man-trt.mp3 |
15.6 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/b2-hellfish-uk_fresh-trt.mp3 |
11.3 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/c1-hellfish_and_skeeta-uridium_project-trt.mp3 |
9.8 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/c2-hellfish-do_ya_like-trt.mp3 |
13.6 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/d1-producer-king_of_the_varispeed-trt.mp3 |
14 MB |
| Hardcore, Gabber/Deathchant/dca.e.w001/d2-hellfish-techno_city-trt.mp3 |
10.5 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/a1_hellfish_-_headbanger.mp3 |
10.1 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/a2_producer_-_man_a_break.mp3 |
10.1 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/b1_hellfish_-_destined_for_destruction.mp3 |
12.7 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/b2_hellfish_-_swearcore.mp3 |
7.4 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/c1_hellfish_-_r2_remix.mp3 |
15.8 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/c2_wargroover_-_british_knightmare.mp3 |
7.3 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/d1_hellfish_and_producer_-_no_more_rock_and_roll.mp3 |
13.3 MB |
| Hardcore, Gabber/Deathchant/dca.e.w002/d2_hellfish_and_beagle_and_skeeta_-_technological_terror.mp3 |
8.5 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 01 bring it back.mp3 |
1.1 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 01 bring it back.mp3.asd |
148 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 02 jus call us.mp3 |
2.9 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 02 jus call us.mp3.asd |
387 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 03 gharbled mess.mp3 |
420 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 03 gharbled mess.mp3.asd |
56 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 04 needle presure.mp3 |
274 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 04 needle presure.mp3.asd |
37 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 05 tommos jam.mp3 |
1.5 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 05 tommos jam.mp3.asd |
197 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 06 planetary risk faction.mp3 |
2 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 06 planetary risk faction.mp3.asd |
262 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 07 these r my beats.mp3 |
1.2 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s1 07 these r my beats.mp3.asd |
154 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 01 bugged cut brk.mp3 |
1.5 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 01 bugged cut brk.mp3.asd |
197 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 02 cuts like.mp3 |
2.1 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 02 cuts like.mp3.asd |
275 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 03 noises.mp3 |
246 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 03 noises.mp3.asd |
33 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 04 more noises.mp3 |
624 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 04 more noises.mp3.asd |
81 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 05 i cant stop still.mp3 |
844 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 05 i cant stop still.mp3.asd |
108 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 06 more bass from the planet.mp3 |
2.4 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 06 more bass from the planet.mp3.asd |
313 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 07 case red.mp3 |
1000 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l1 s2 07 case red.mp3.asd |
128 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 01 media rock.mp3 |
1.2 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 01 media rock.mp3.asd |
157 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 02 marijuana brk.mp3 |
2.9 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 02 marijuana brk.mp3.asd |
380 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 03 a sentence.mp3 |
508 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 03 a sentence.mp3.asd |
67 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 04 a nuwa sentence.mp3 |
362 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 04 a nuwa sentence.mp3.asd |
49 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 05 sibrian feedback.mp3 |
1.8 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 05 sibrian feedback.mp3.asd |
238 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 06 drastic dope friend.mp3 |
1.2 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 06 drastic dope friend.mp3.asd |
157 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 07 electrik near 2 minutes.mp3 |
894 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s1 07 electrik near 2 minutes.mp3.asd |
116 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 01 substitution brk.mp3 |
1.9 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 01 substitution brk.mp3.asd |
254 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 02 runs shakedown.mp3 |
1.8 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 02 runs shakedown.mp3.asd |
241 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 03 stylus flight.mp3 |
364 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 03 stylus flight.mp3.asd |
49 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 04 skratching is up.mp3 |
1.1 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 04 skratching is up.mp3.asd |
148 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 05 whos breaks still rock.mp3 |
1.7 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 05 whos breaks still rock.mp3.asd |
223 KB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 06 keeping distance.mp3 |
1.2 MB |
| Hardcore, Gabber/Deathchant/Kriminal Breakz/kriminalbeatz001/l2 s2 06 keeping distance.mp3.asd |
157 KB |
| Hardcore, Gabber/Destroy This System/dts001/00-numek-ghost_st-(dts001)-vinyl-2008-def.m3u |
58 B |
| Hardcore, Gabber/Destroy This System/dts001/00-numek-ghost_st-(dts001)-vinyl-2008-def.nfo |
10 KB |
| Hardcore, Gabber/Destroy This System/dts001/00-numek-ghost_st-(dts001)-vinyl-2008-def.sfv |
76 B |
| Hardcore, Gabber/Destroy This System/dts001/a-numek-ghost_st-def.mp3 |
8.8 MB |
| Hardcore, Gabber/Destroy This System/dts001/b-numek-cardiac_lesion-def.mp3 |
11.1 MB |
| Hardcore, Gabber/Devil Times Nine/dtn1/00_delta_9_-_untitled-(dtn1)-vinyl-2008.m3u |
129 B |
| Hardcore, Gabber/Devil Times Nine/dtn1/00_delta_9_-_untitled-(dtn1)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Devil Times Nine/dtn1/00_delta_9_-_untitled-(dtn1)-vinyl-2008.sfv |
165 B |
| Hardcore, Gabber/Devil Times Nine/dtn1/a1_delta_9_-_from_darkness.mp3 |
6.7 MB |
| Hardcore, Gabber/Devil Times Nine/dtn1/a2_delta_9_-_avi_satani.mp3 |
4.6 MB |
| Hardcore, Gabber/Devil Times Nine/dtn1/b1_delta_9_-_devils_reign.mp3 |
7.3 MB |
| Hardcore, Gabber/Devil Times Nine/dtn1/b2_delta_9_-_devils_reign_remix.mp3 |
7.1 MB |
| Hardcore, Gabber/Diatribe/diatribe001/00_labo_14-fond_de_zik-(diatribe02)-vinyl-2007-ct.m3u |
81 B |
| Hardcore, Gabber/Diatribe/diatribe001/00_labo_14-fond_de_zik-(diatribe02)-vinyl-2007-ct.nfo |
11 KB |
| Hardcore, Gabber/Diatribe/diatribe001/00_labo_14-fond_de_zik-(diatribe02)-vinyl-2007-ct.sfv |
108 B |
| Hardcore, Gabber/Diatribe/diatribe001/a1_labo_14-fond_de_zik-ct.mp3 |
8.4 MB |
| Hardcore, Gabber/Diatribe/diatribe001/a2_labo_14-copx-ct.mp3 |
6.7 MB |
| Hardcore, Gabber/Diatribe/diatribe001/b1_labo_14-best_lock-ct.mp3 |
9.9 MB |
| Hardcore, Gabber/DNA Tracks/dna001/(a1) negative a - fuck it.mp3 |
4.7 MB |
| Hardcore, Gabber/DNA Tracks/dna001/(a2) negative a - dark object.mp3 |
3.6 MB |
| Hardcore, Gabber/DNA Tracks/dna001/(a3) negative a - revenge.mp3 |
4.3 MB |
| Hardcore, Gabber/DNA Tracks/dna001/(b1) negative a - 2 guns up.mp3 |
3.8 MB |
| Hardcore, Gabber/DNA Tracks/dna001/(b2) negative a - da tsjernobyl virus.mp3 |
5.1 MB |
| Hardcore, Gabber/DNA Tracks/dna001/(b3) negative a - sex, drugz, coke.mp3 |
5.5 MB |
| Hardcore, Gabber/DNA Tracks/dna002/(a1) e-noid - dark manoeuvres.mp3 |
4.8 MB |
| Hardcore, Gabber/DNA Tracks/dna002/(a2) e-noid - mano 2 mano.mp3 |
3.9 MB |
| Hardcore, Gabber/DNA Tracks/dna002/(a3) e-noid - disco sucks.mp3 |
4.7 MB |
| Hardcore, Gabber/DNA Tracks/dna002/(b1) e-noid - pulse of pain.mp3 |
5.6 MB |
| Hardcore, Gabber/DNA Tracks/dna002/(b2) e-noid - jerk-off.mp3 |
4.9 MB |
| Hardcore, Gabber/DNA Tracks/dna003/(a1) negative a - suck my dick.mp3 |
6.2 MB |
| Hardcore, Gabber/DNA Tracks/dna003/(a2) negative a - keep you in safety.mp3 |
6.6 MB |
| Hardcore, Gabber/DNA Tracks/dna003/(a3) negative a - tell me what you want.mp3 |
5.8 MB |
| Hardcore, Gabber/DNA Tracks/dna003/(b1) negative a - breaking shit.mp3 |
4.9 MB |
| Hardcore, Gabber/DNA Tracks/dna003/(b2) negative a - bitches.mp3 |
4.1 MB |
| Hardcore, Gabber/DNA Tracks/dna003/(b3) negative a - lower split.mp3 |
5.4 MB |
| Hardcore, Gabber/DNA Tracks/dna004/A1 E-Noid - Follow The Bouncing Bass.mp3 |
7.1 MB |
| Hardcore, Gabber/DNA Tracks/dna004/A2 E-Noid - Act Of Aggression.mp3 |
4.4 MB |
| Hardcore, Gabber/DNA Tracks/dna004/B2 E-Noid - Dawn Of A New Era.mp3 |
4.5 MB |
| Hardcore, Gabber/DNA Tracks/dna004/B2 E-Noid - On The Edge Of Dreams.mp3 |
4.9 MB |
| Hardcore, Gabber/DNA Tracks/dna005/(a1) negative a - masters of the underworld.mp3 |
1.9 MB |
| Hardcore, Gabber/DNA Tracks/dna005/(a2) negative a - d-bad dead.mp3 |
6.9 MB |
| Hardcore, Gabber/DNA Tracks/dna005/(a3) negative a, darkcontroller - wicked 303.mp3 |
7.3 MB |
| Hardcore, Gabber/DNA Tracks/dna005/(b1) negative a - i beat your mama's ass.mp3 |
6.8 MB |
| Hardcore, Gabber/DNA Tracks/dna005/(b2) negative a - welcome to the.....mp3 |
6.3 MB |
| Hardcore, Gabber/DNA Tracks/dna006/(a1) e-noid - hellparty.mp3 |
6.8 MB |
| Hardcore, Gabber/DNA Tracks/dna006/(a2) e-noid - the brain.mp3 |
8.6 MB |
| Hardcore, Gabber/DNA Tracks/dna006/(b1) e-noid - mix master.mp3 |
7.6 MB |
| Hardcore, Gabber/DNA Tracks/dna006/(b2) e-noid - this is not bad.mp3 |
7.8 MB |
| Hardcore, Gabber/DNA Tracks/dna007/(a1) negative a - mother fucking bass.mp3 |
8 MB |
| Hardcore, Gabber/DNA Tracks/dna007/(a2) negative a - party rape.mp3 |
6.9 MB |
| Hardcore, Gabber/DNA Tracks/dna007/(b1) negative a - jockin your shit.mp3 |
6.6 MB |
| Hardcore, Gabber/DNA Tracks/dna007/(b2) negative a - d.n.a..mp3 |
6.7 MB |
| Hardcore, Gabber/DNA Tracks/dna008/A1 - Battlefield 0180 - My Father Lucifer.mp3 |
5.6 MB |
| Hardcore, Gabber/DNA Tracks/dna008/A2 - Battlefield 0180 - The Radikals.mp3 |
5.6 MB |
| Hardcore, Gabber/DNA Tracks/dna008/A3 - Battlefield 0180 - Flaterheads B.V..mp3 |
7.2 MB |
| Hardcore, Gabber/DNA Tracks/dna008/B1 - Battlefield 0180 - All Kinds Of Drugs.mp3 |
6 MB |
| Hardcore, Gabber/DNA Tracks/dna008/B2 - Battlefield 0180 - My Father Lucifer (Coffecore Remix).mp3 |
5.7 MB |
| Hardcore, Gabber/DNA Tracks/dna009/A1 - Parian & Mental Defective - Crazy Beats.mp3 |
6.5 MB |
| Hardcore, Gabber/DNA Tracks/dna009/A2 - Parian & Mental Defective - Intense Nightmare.mp3 |
8.2 MB |
| Hardcore, Gabber/DNA Tracks/dna009/B1 - Parian & Mental Defective - Nasty Bitch.mp3 |
5.9 MB |
| Hardcore, Gabber/DNA Tracks/dna009/B2 - Parian & Mental Defective - Get Ready For Us.mp3 |
7.5 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(a1) e-noid - liquid super drugs.mp3 |
7.3 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(a2) e-noid - ghost and the darkness.mp3 |
5.1 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(a3) e-noid - radiocheck.mp3 |
7.1 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(b1) e-noid - destination death.mp3 |
7.2 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(b2) e-noid - violent content.mp3 |
7.5 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(b3) e-noid - when the sun rises.mp3 |
7.3 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(c1) e-noid - sending the beast.mp3 |
7.2 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(c2) e-noid - selfdestruct.mp3 |
7.2 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(c3) e-noid - allround.mp3 |
7 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(d1) e-noid - devil inside.mp3 |
8.4 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(d2) e-noid - melatonin.mp3 |
7.4 MB |
| Hardcore, Gabber/DNA Tracks/dna010/(d3) e-noid - last laugh.mp3 |
1.7 MB |
| Hardcore, Gabber/DNA Tracks/dna023/a1_darkcontroller_-_twisted_fuck-sq.mp3 |
7.9 MB |
| Hardcore, Gabber/DNA Tracks/dna023/a2_darkcontroller_-_asstortion-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/DNA Tracks/dna023/b1_darkcontroller_-_controlled_by_darkness-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/DNA Tracks/dna023/b2_darkcontroller_-_zuckerzzz-sq.mp3 |
10.4 MB |
| Hardcore, Gabber/DNA Tracks/dna027/00_razor_edge_-_cries_and_whispers-(dna027)-vinyl-2006.m3u |
211 B |
| Hardcore, Gabber/DNA Tracks/dna027/00_razor_edge_-_cries_and_whispers-(dna027)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/DNA Tracks/dna027/00_razor_edge_-_cries_and_whispers-(dna027)-vinyl-2006.sfv |
265 B |
| Hardcore, Gabber/DNA Tracks/dna027/a1_razor_edge_-_deoxybribonucleic_acid.mp3 |
7.6 MB |
| Hardcore, Gabber/DNA Tracks/dna027/a2_razor_edge_-_pure_evil.mp3 |
10.1 MB |
| Hardcore, Gabber/DNA Tracks/dna027/a3_razor_edge_-_when_she_left.mp3 |
6.6 MB |
| Hardcore, Gabber/DNA Tracks/dna027/b1_razor_edge_-_unsolved_mystery.mp3 |
9.1 MB |
| Hardcore, Gabber/DNA Tracks/dna027/b2_razor_edge_-_into_reality.mp3 |
7.7 MB |
| Hardcore, Gabber/DNA Tracks/dna027/b3_razor_edge_-_doom_and_bass.mp3 |
10.3 MB |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/00_va_-_4_elements_ep-(dna029)-vinyl-2006.m3u |
172 B |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/00_va_-_4_elements_ep-(dna029)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/00_va_-_4_elements_ep-(dna029)-vinyl-2006.sfv |
208 B |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/a1_cemon_victa_-_4_elements.mp3 |
7.6 MB |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/a2_phobos_-_dont_trust_anyone.mp3 |
9.9 MB |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/b1_e-noid_-_i_dont_give_a_damn_(nosferatus_arrogance_hatred_remix).mp3 |
10.5 MB |
| Hardcore, Gabber/DNA Tracks/dna029/VA_-_4_Elements_EP-(DNA029)-Vinyl-2006-SQ/b2_d-xtreme_-_play_it_straight.mp3 |
7.8 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/00-e-noid-e-scapism-(dna030)-vinyl-2007-1king.m3u |
224 B |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/00-e-noid-e-scapism-(dna030)-vinyl-2007-1king.nfo |
10 KB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/00-e-noid-e-scapism-(dna030)-vinyl-2007-1king.sfv |
296 B |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/a1-e-noid-my_dreams_my_nightmares.mp3 |
8.7 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/a2-e-noid-youre_all_pigs.mp3 |
8.5 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/b1-e-noid-dna_string.mp3 |
9.9 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/b2-e-noid-own_you.mp3 |
6.7 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/c1-e-noid-intergalactic_spacyness.mp3 |
8.7 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/c2-e-noid-psycho_acid.mp3 |
6.4 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/d1-e-noid-go_home.mp3 |
7.7 MB |
| Hardcore, Gabber/DNA Tracks/dna030/E-Noid-E-Scapism-(DNA030)-Vinyl-2007-1KING/d2-e-noid-e-scapism.mp3 |
11.1 MB |
| Hardcore, Gabber/DNA Tracks/dna031/00-slavefriese-negative_deep_inside_ep-(dna031)-vinyl-2007-1king.m3u |
193 B |
| Hardcore, Gabber/DNA Tracks/dna031/00-slavefriese-negative_deep_inside_ep-(dna031)-vinyl-2007-1king.nfo |
9 KB |
| Hardcore, Gabber/DNA Tracks/dna031/00-slavefriese-negative_deep_inside_ep-(dna031)-vinyl-2007-1king.sfv |
3 KB |
| Hardcore, Gabber/DNA Tracks/dna031/a1-slavefriese-i_call_it_a_loudner.mp3 |
6.9 MB |
| Hardcore, Gabber/DNA Tracks/dna031/a2-slavefriese-matrose_(captains_mix).mp3 |
6 MB |
| Hardcore, Gabber/DNA Tracks/dna031/b1-slavefriese-plutonium_crackers_(moleculez_remix).mp3 |
9.6 MB |
| Hardcore, Gabber/DNA Tracks/dna031/b2-slavefriese-dorm_of_the_future_(catscan_remix).mp3 |
7.2 MB |
| Hardcore, Gabber/DNA Tracks/dna033/00_va_-_guilty_by_affiliation-(dna033)-vinyl-2008.m3u |
151 B |
| Hardcore, Gabber/DNA Tracks/dna033/00_va_-_guilty_by_affiliation-(dna033)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/DNA Tracks/dna033/00_va_-_guilty_by_affiliation-(dna033)-vinyl-2008.sfv |
187 B |
| Hardcore, Gabber/DNA Tracks/dna033/a1_negative_a_-_guilty_by_affiliation.mp3 |
7.4 MB |
| Hardcore, Gabber/DNA Tracks/dna033/a2_cemon_victa_-_digital_noize.mp3 |
7.7 MB |
| Hardcore, Gabber/DNA Tracks/dna033/b1_darkcontroller_-_shot_in_the_dark.mp3 |
8.9 MB |
| Hardcore, Gabber/DNA Tracks/dna033/b2_phobos_-_feel_my_hell.mp3 |
8.7 MB |
| Hardcore, Gabber/DNA Tracks/dnasp-2/E-Noid_and_Negative_A_-_DNA_Hunter-(DNASP-2)-Vinyl-2006-SQ/00_e-noid_and_negative_a_-_dna_hunter-(dnasp-2)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/DNA Tracks/dnasp-2/E-Noid_and_Negative_A_-_DNA_Hunter-(DNASP-2)-Vinyl-2006-SQ/00_e-noid_and_negative_a_-_dna_hunter-(dnasp-2)-vinyl-2006.sfv |
181 B |
| Hardcore, Gabber/DNA Tracks/dnasp-2/E-Noid_and_Negative_A_-_DNA_Hunter-(DNASP-2)-Vinyl-2006-SQ/a1_negative_a_-_one_man_army.mp3 |
8.8 MB |
| Hardcore, Gabber/DNA Tracks/dnasp-2/E-Noid_and_Negative_A_-_DNA_Hunter-(DNASP-2)-Vinyl-2006-SQ/a2_negative_a_-_dna_hunter.mp3 |
7 MB |
| Hardcore, Gabber/DNA Tracks/dnasp-2/E-Noid_and_Negative_A_-_DNA_Hunter-(DNASP-2)-Vinyl-2006-SQ/b1_e-noid_-_piss_u_off.mp3 |
8.4 MB |
| Hardcore, Gabber/DNA Tracks/dnasp-2/E-Noid_and_Negative_A_-_DNA_Hunter-(DNASP-2)-Vinyl-2006-SQ/b2_e-noid_-_act_of_aggression_(slavefriese_remix).mp3 |
8.3 MB |
| Hardcore, Gabber/DNA Tracks/dnasp-3/00_e-noid_and_negative_a_-_dna_most_wanted_3-(dnasp-3)-vinyl-2007.m3u |
66 B |
| Hardcore, Gabber/DNA Tracks/dnasp-3/00_e-noid_and_negative_a_-_dna_most_wanted_3-(dnasp-3)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/DNA Tracks/dnasp-3/00_e-noid_and_negative_a_-_dna_most_wanted_3-(dnasp-3)-vinyl-2007.sfv |
84 B |
| Hardcore, Gabber/DNA Tracks/dnasp-3/a_negative_a_-_audio_hallucination.mp3 |
9.1 MB |
| Hardcore, Gabber/DNA Tracks/dnasp-3/e_e-noid_-_screaming.mp3 |
8 MB |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/00_e-noid_-_efficient_methods-(dna034)-vinyl-2008.m3u |
120 B |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/00_e-noid_-_efficient_methods-(dna034)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/00_e-noid_-_efficient_methods-(dna034)-vinyl-2008.sfv |
160 B |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/a1_e-noid_-_nothing_but_dna.mp3 |
6.4 MB |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/a2_e-noid_-_efficient_methods.mp3 |
7.1 MB |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/b1_e-noid_-_we_are_insane.mp3 |
7.9 MB |
| Hardcore, Gabber/DNA Tracks/e-noid_-_efficient_methods-(dna034)-vinyl-2008-sq/b2_e-noid_-_sadness.mp3 |
8.8 MB |
| Hardcore, Gabber/Dom/dom-001/a1 - r. wagner - beyond the ultimate.mp3 |
5.3 MB |
| Hardcore, Gabber/Dom/dom-001/a2 - r. wagner - it's driven me sick.mp3 |
5.8 MB |
| Hardcore, Gabber/Dom/dom-001/b1 - r. wagner - in sadness and in hell.mp3 |
5.8 MB |
| Hardcore, Gabber/Dom/dom-001/b2 - r. wagner - zone of disaster.mp3 |
7.7 MB |
| Hardcore, Gabber/Dom/dom-004/a1 - r. wagner - my dominion.mp3 |
6.4 MB |
| Hardcore, Gabber/Dom/dom-004/a2 - r. wagner - wicked jungle.mp3 |
5.3 MB |
| Hardcore, Gabber/Dom/dom-004/b1 - r. wagner - final revolution.mp3 |
6 MB |
| Hardcore, Gabber/Dom/dom-004/b2 - r. wagner - keep calm.mp3 |
5.9 MB |
| Hardcore, Gabber/Downtown Records Italy/dtr1061/a1 - Hocus Pocus - Here's Johnny!.mp3 |
6.6 MB |
| Hardcore, Gabber/Downtown Records Italy/dtr1061/a2 - Hocus Pocus - Here's Jonhny! (Bam Bam Bam).mp3 |
7.2 MB |
| Hardcore, Gabber/Downtown Records Italy/dtr1061/a3 - Hocus Pocus - Lips 'N Lungs.mp3 |
7.8 MB |
| Hardcore, Gabber/Downtown Records Italy/dtr1061/b1 - Hocus Pocus - Here's Johnny! (Hardcore).mp3 |
7.9 MB |
| Hardcore, Gabber/Downtown Records Italy/dtr1061/b2 - Hocus Pocus - Let Me Be Your Medicine Man.mp3 |
6.9 MB |
| Hardcore, Gabber/Downtown Records Italy/dtr1061/b3 - Hocus Pocus - Postcard From Armageddon (Hocus Bonus Track).mp3 |
4 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp001 the dreamteam - thunderdome/A1 - Gizmo - Kristalized (Free-Style Remix).mp3 |
8.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp001 the dreamteam - thunderdome/A2 - DJ Buzz Fuzz - Vienna Bass (Moët & Chandon Remix).mp3 |
6.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp001 the dreamteam - thunderdome/B1 - The Prophet - Dominatin' (1993 Summer Remix).mp3 |
8.9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp001 the dreamteam - thunderdome/B2 - DJ Dano - This Is Master Control (I Love It).mp3 |
7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp002 the prophet - dominatin ep/A1 - The Prophet - Dominatin (Original Mix).mp3 |
9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp002 the prophet - dominatin ep/A2 - The Prophet - Dominatin' (Summer Remix).mp3 |
8.9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp002 the prophet - dominatin ep/B1 - The Prophet - Dominatin (Re-Remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp002 the prophet - dominatin ep/B2 - The Prophet - God.mp3 |
5.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp002 the prophet - dominatin ep/B3 - The Prophet - God (Hell Mix).mp3 |
3.7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp003 dj dano - thunderdome 4 ep/A1 - DJ Dano - Welcome To The Thunderdome.mp3 |
6.2 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp003 dj dano - thunderdome 4 ep/A2 - DJ Dano - About Us.mp3 |
7.4 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp003 dj dano - thunderdome 4 ep/B1 - DJ Dano - Marsh Mellow.mp3 |
6.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp003 dj dano - thunderdome 4 ep/B2 - DJ Dano - Best In The West.mp3 |
6.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp004 dj gizmo - thunderdome 4 ep/A1 - DJ Gizmo - A Night In Boston.mp3 |
4.9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp004 dj gizmo - thunderdome 4 ep/A2 - DJ Gizmo - Monological Destruction.mp3 |
6.2 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp004 dj gizmo - thunderdome 4 ep/B1 - DJ Gizmo - The End Of The Beginning.mp3 |
7.1 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp004 dj gizmo - thunderdome 4 ep/B2 - DJ Gizmo - Out Of Order.mp3 |
8.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp005 dj buzz fuzz - thunderdome 4 e.p/A1 - Buzz Fuzz - 100% Effective.mp3 |
4.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp005 dj buzz fuzz - thunderdome 4 e.p/A2 - Buzz Fuzz - D-Leria.mp3 |
6.2 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp005 dj buzz fuzz - thunderdome 4 e.p/B1 - Buzz Fuzz - Yvette.mp3 |
4.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp005 dj buzz fuzz - thunderdome 4 e.p/B2 - Buzz Fuzz - Nasty Man.mp3 |
7.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp006 the prophet - thunderdome 4 ep/A1 - The Prophet - Party Children.mp3 |
4.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp006 the prophet - thunderdome 4 ep/A2 - The Prophet - Spirits Of Soul.mp3 |
6.2 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp006 the prophet - thunderdome 4 ep/B1 - The Prophet - The Dreamtheme.mp3 |
5.6 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp006 the prophet - thunderdome 4 ep/B2 - The Prophet - Feel It.mp3 |
6.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp009 drop the pressure (the mastermixes)/A1 - Drop The Pressure (Buzzy Goes BZRK Mix).mp3 |
6 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp009 drop the pressure (the mastermixes)/A2 - Drop The Pressure (Rob Gee Mix).mp3 |
5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp009 drop the pressure (the mastermixes)/A3 - Drop The Pressure (DJ Chosen Few Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp009 drop the pressure (the mastermixes)/B1 - Drop The Pressure (Mister Mantis Delirium Mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp009 drop the pressure (the mastermixes)/B2 - Drop The Pressure (E-Rick & Tactic Mix).mp3 |
4.7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp009 drop the pressure (the mastermixes)/B3 - Drop The Pressure (Point 44 Remix).mp3 |
6.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp011 50% of the dreamteam - formula-e/A1 - 50% of the dreamteam - freddy's revenge.mp3 |
7.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp011 50% of the dreamteam - formula-e/A2 - 50% of the dreamteam - fatal morgana.mp3 |
5.9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp011 50% of the dreamteam - formula-e/B1 - 50% of the dreamteam - b with u.mp3 |
5.6 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp011 50% of the dreamteam - formula-e/B2 - 50% of the dreamteam - bullshit.mp3 |
5.7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp012 buzz fuzz - frequencies (the remixes)/A1 - dj buzz fuzz - frequencies.mp3 |
4.9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp012 buzz fuzz - frequencies (the remixes)/A2 - dj buzz fuzz - frequencies (pino d'ambini tough remix).mp3 |
3.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp012 buzz fuzz - frequencies (the remixes)/B1 - dj buzz fuzz - frequencies (bumble bee remix).mp3 |
4.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp012 buzz fuzz - frequencies (the remixes)/B2 - dj buzz fuzz - frequencies (buzzy goes bzrk remix).mp3 |
3.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp012 buzz fuzz - frequencies (the remixes)/B3 - dj buzz fuzz - frequencies (dano's ludwig 210 m.f. hardcore remix).mp3 |
4.1 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp014 50% of the dreamteam - formula e2/A1 - 50% Of The Dreamteam - Aw, Awwh!.mp3 |
7.4 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp014 50% of the dreamteam - formula e2/A2 - 50% Of The Dreamteam - Let's Get Back To The Oldschool.mp3 |
9.9 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp014 50% of the dreamteam - formula e2/B1 - 50% Of The Dreamteam - Jam On.mp3 |
5.5 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp014 50% of the dreamteam - formula e2/B2 - 50% Of The Dreamteam - Sweat (I Wanna C Ya).mp3 |
8.1 MB |
| Hardcore, Gabber/Dreamteam Productions/dtp014 50% of the dreamteam - formula e2/B3 - 50% Of The Dreamteam - Terror = Timeless.mp3 |
6 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/A1 - DJ Gizmo - The Fist Of The North Star.mp3 |
9.4 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/A2 - DJ Buzz Fuzz - Ill Behaviour.mp3 |
6.7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/A3 - The Prophet - IC The Future.mp3 |
7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/B1 - DJ Dano - All I Know.mp3 |
8.3 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/B2 - The Prophet - Pump Up The Volume!.mp3 |
7.6 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/B3 - DJ Buzz Fuzz - Frequencies.mp3 |
9.7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/C1 - DJ Gizmo - This Beat Kicks.mp3 |
7.7 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/C2 - The Prophet - With Your Love.mp3 |
7.8 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/C3 - DJ Dano - Bad Attitude.mp3 |
7.2 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/D1 - DJ Buzz Fuzz - Freedom.mp3 |
8.2 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/D2 - DJ Gizmo - Go Get Stupid.mp3 |
6.6 MB |
| Hardcore, Gabber/Dreamteam Productions/dtpcomp004 the dreamteam - x s 4 all/D3 - DJ Dano - Needle Shock.mp3 |
7.3 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 006] - the prophet - thunderdome 4 e.p/A1 - The Prophet - Party Children.mp3 |
4.3 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 006] - the prophet - thunderdome 4 e.p/A2 - The Prophet - Spirits Of Soul.mp3 |
6.1 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 006] - the prophet - thunderdome 4 e.p/B1 - The Prophet - The Dreamtheme.mp3 |
5.6 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 006] - the prophet - thunderdome 4 e.p/B2 - The Prophet - Feel It.mp3 |
6.5 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 009] buzz fuzz - drop the pressure/a1 dj buzz fuzz - drop the pressure (buzzy goes bzrk mix).mp3 |
6 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 009] buzz fuzz - drop the pressure/a2 dj buzz fuzz - drop the pressure (rob gee mix).mp3 |
5 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 009] buzz fuzz - drop the pressure/a3 dj buzz fuzz - drop the pressure (dj chosen few remix).mp3 |
5.8 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 009] buzz fuzz - drop the pressure/b1 dj buzz fuzz - drop the pressure (mr mantis delirium mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 009] buzz fuzz - drop the pressure/b2 dj buzz fuzz - drop the pressure (dj e-rick & tactic mix).mp3 |
4.7 MB |
| Hardcore, Gabber/Dreamteam Productions/[dtp 009] buzz fuzz - drop the pressure/b3 dj buzz fuzz - drop the pressure (point 44 remix).mp3 |
6.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn010/a1 -delta 9 - war.mp3 |
7.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn010/a2 - delta 9 - h.c.m.f..mp3 |
6.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn010/a3 - delta 9 - this is a test.mp3 |
8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn010/b1 - delta 9 - phreaked.mp3 |
5.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn010/b2 - delta 9 - die hard.mp3 |
5.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn010/b3 - delta 9 - hardcore chicago.mp3 |
4.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn011/DBN 011 A1 - Nick East - East Of Index EP - Increased Outline.mp3 |
7.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn011/DBN 011 A2 - Nick East - East Of Index EP - Nose Job.mp3 |
8.7 MB |
| Hardcore, Gabber/Drop Bass Network/dbn011/DBN 011 B1 - Nick East - East Of Index EP - Access.mp3 |
7.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn011/DBN 011 B2 - Nick East - East Of Index EP - Mood Matcher.mp3 |
12 MB |
| Hardcore, Gabber/Drop Bass Network/dbn012/DBN 012 A1 - Dj Hyperactive - Midwest Hardcorps EP - Power Plug.mp3 |
11.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn012/DBN 012 A2 - Manna - Midwest Hardcorps EP - Solypsism.mp3 |
9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn012/DBN 012 B1 - Frank Freek - Midwest Hardcorps EP - Pteridachtile.mp3 |
10.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn012/DBN 012 B2 - Feed - Midwest Hardcorps EP - Fedral.mp3 |
11.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 A1 - Woody McBride - Balance EP - Chilly.mp3 |
6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 A2 - Woody McBride - Balance EP - Aroma.mp3 |
7 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 B1 - Woody McBride - Balance EP - When The Day Turns To Night.mp3 |
5.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 B2 - Woody McBride - Balance EP - Prolonged.mp3 |
5.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 C1 - Woody McBride - Balance EP - Lawrence.mp3 |
5.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 C2 - Woody McBride - Balance EP - Being There (late).mp3 |
6.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 D1 - Woody McBride - Balance EP - Shifted.mp3 |
7.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn013/DBN 013 D2 - Woody McBride - Balance EP - Another Will Begin.mp3 |
8.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn015/a1 & a2 - mooses on acid - mc 202 bpm & wicked acid.mp3 |
21.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn015/b1 & b2 & b3 - mooses on acid - euphoric & red point & bonus track.mp3 |
20.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn016/a1 - adam x - listen (94 remix).mp3 |
8.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn016/a2 - adam x - pollutant emissions.mp3 |
7.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn016/b1 - adam x - octane propellant.mp3 |
8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn016/b2 - adam x - afterlife dweller.mp3 |
7.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn017/a1 & a2 - dj hyperactive - off keel & axxe attack.mp3 |
21 MB |
| Hardcore, Gabber/Drop Bass Network/dbn017/b1 - dj hyperactive - kala ulu.mp3 |
19.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn020/A1 - The last dawn.mp3 |
5.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn020/A2 - Vi bringer dig acid.mp3 |
5.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn020/B1 - Dreamstate.mp3 |
7.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn020/B2 - Exp. Part 2.mp3 |
5.7 MB |
| Hardcore, Gabber/Drop Bass Network/dbn021/a1 choose - slowgain.mp3 |
7.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn021/a2 choose - purzuit of noize.mp3 |
6.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn021/b1 choose - pledge.mp3 |
7.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn021/b2 choose - dual basis.mp3 |
8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn022/a1 - dj pure - speed is my dope.mp3 |
7.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn022/a2 - dj pure - breakfast session (part 2).mp3 |
9.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn022/b1 - dj pure - a ton and a bridge.mp3 |
5.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn022/b2 - dj pure - analogue terror.mp3 |
11.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn023/( Spiral Tribe DBN 023 )-( Apocalycptic Heroes - Base Support DBLE LP )-( A )-( R-ZAC 23 - Junk Y.mp3 |
22.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn023/( Spiral Tribe DBN 023 )-( Apocalycptic Heroes - Base Support DBLE LP )-( B )-( R-ZAC 23 - Apocal.mp3 |
23 MB |
| Hardcore, Gabber/Drop Bass Network/dbn023/( Spiral Tribe DBN 023 )-( Apocalycptic Heroes - Base Support DBLE LP )-( C )-( R-ZAC 23 - Base S.mp3 |
17.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn023/( Spiral Tribe DBN 023 )-( Apocalycptic Heroes - Base Support DBLE LP )-( D )-( R-ZAC 23 - Tactic.mp3 |
20.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/a1 - delta 9 - baked.mp3 |
3.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/a2 - delta 9 - the one & only.mp3 |
4.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/b1 - delta 9 - tough guy.mp3 |
5.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/b2 - delta 9 - intro.mp3 |
3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/c1 - delta 9 - the hate tank.mp3 |
3.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/c2 - delta 9 - the hate tank (buckwild mix).mp3 |
3.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/d1 - delta 9 -gemini.mp3 |
4.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn024/d2 - delta 9 - hardcore chicago (remix).mp3 |
3.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn025/a1 - brixton - untitled.mp3 |
7.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn025/a2 - brixton - untitled.mp3 |
10.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn025/b1 - brixton - untitled.mp3 |
14.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn025/b2 - brixton - untitled.mp3 |
4.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn026/A1 - Astrocat - A space.mp3 |
10.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn026/A2 - Delta 9 - Buried alive.mp3 |
7.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn026/B1 - Drew Young - White light.mp3 |
11.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn026/B2 - Slide - Aliens.mp3 |
11.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn028/a1 - frankie bones - braindead.mp3 |
7.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn028/a2 - frankie bones - point of no return.mp3 |
7.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn028/b1 - frankie bones - einstein.mp3 |
7.7 MB |
| Hardcore, Gabber/Drop Bass Network/dbn028/b2 - frankie bones - move your body.mp3 |
8.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn029/a1 - the speedfreak - kick it.mp3 |
7.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn029/a2 - the speedfreak - dead meat.mp3 |
6.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn029/b1 - the speedfreak - the killer.mp3 |
7.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn029/b2 - the speedfreak - i'm the butcher.mp3 |
7.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn030/a1 - a.c.a.b. - hard hats.mp3 |
6.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn030/a2 - a.c.a.b. - no one owns house.mp3 |
6.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn030/a3 - a.c.a.b. - we are a.c.a.b..mp3 |
4.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn030/b1 - a.c.a.b. - kick it till it breaks.mp3 |
6.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn030/b2 - a.c.a.b. - is 12.mp3 |
10.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn032/a1 - goio - steel.mp3 |
9.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn032/a2 - goio - basic needs.mp3 |
13.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn032/b1 - goio - strike.mp3 |
11.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn032/b2 - goio - wave.mp3 |
11.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn034/a1 - Fanon the Big Kid - Bum Rush.mp3 |
11.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn034/a2 - Fanon the Big Kid - Even Further.mp3 |
7.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn034/b1 Fanon the Big Kid - Groove Expansion.mp3 |
11.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn034/b2 - Fanon the Big Kid - Thrust.mp3 |
7.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn035/a1 choose - authentic mixture.mp3 |
6.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn035/a2 choose - thermal blower.mp3 |
6.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn035/b1 choose - light removal.mp3 |
6.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn035/b2 choose - hard effort (reorganized).mp3 |
5.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn038/a1 - the speed freak - rave signal.mp3 |
4.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn038/a2 - the speed freak - death machine.mp3 |
3.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn038/b1 - the speed freak - fumble tunnel.mp3 |
4.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn038/b2 - the speed freak - puppets.mp3 |
3.7 MB |
| Hardcore, Gabber/Drop Bass Network/dbn039/A1 Beverly Hills 808303 No Marriage Until Sex.mp3 |
11 MB |
| Hardcore, Gabber/Drop Bass Network/dbn039/A2 Beverly Hills 808303 Signals The Acid Planet Is In Sight.mp3 |
12.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn039/B1 Beverly Hills 808303 Enjoy Coke And Stop Smiling.mp3 |
14 MB |
| Hardcore, Gabber/Drop Bass Network/dbn039/B2 Beverly Hills 808303 South Pacific.mp3 |
12.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn040/a1 - fresh - g.mp3 |
9.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn040/a2 - fresh - b.mp3 |
10.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn040/b1 - fresh - c.mp3 |
13.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn040/b2 - fresh - a.mp3 |
12.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn042/a1 Formalities - Condensation.MP3 |
8.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn042/b1 Formalities - Specialized.mp3 |
8.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn042/b2 Formalities - Off Order.mp3 |
8.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn043/somatic responses - side a track 1.mp3 |
8.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn043/somatic responses - side a track 2.mp3 |
6.2 MB |
| Hardcore, Gabber/Drop Bass Network/dbn043/somatic responses - side b track 1.mp3 |
8.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn043/somatic responses - side b track 2.mp3 |
8.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn045/a1 - brixton - dat 11 track 4.mp3 |
4.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn045/a2 - brixton - dat 6 track 5.mp3 |
6.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn045/b1 - brixton - dat 2 track 4.mp3 |
5.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn045/b2 - brixton - misc dat track 4.mp3 |
6.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn045/INCOMPLETE~c1 - brixton - misc dat track 2.mp3 |
2.7 MB |
| Hardcore, Gabber/Drop Bass Network/dbn047/A1 - Beverly Hills 808303 - (Bad Feeling) Throw Up Acid.mp3 |
9.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn047/A2 - Beverly Hills 808303 - Asociaal Hard Op Je Bek !.mp3 |
10.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn047/B1 - Beverly Hills 808303 - Dinner At Barneys.mp3 |
10.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn047/B2 - Beverly Hills 808303 - The Escape (Return To Nothing).mp3 |
10.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn062/a1_adam_x_-_aftermath_of_gomorrah-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Drop Bass Network/dbn062/a2_adam_x_-_desolation-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn062/b1_adam_x_-_death_march-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Drop Bass Network/dbn062/b2_adam_x_-_demonic_machinery-sq.mp3 |
4.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn064/a1_michael_wenz_-_nobody_listens_to_techno-sq.mp3 |
9.8 MB |
| Hardcore, Gabber/Drop Bass Network/dbn064/a2_j-slim_-_listen_(bloodshot_pyramid_radio_remix)-sq.mp3 |
4.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn064/b1_woody_mcbride_-_oh_really-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn064/b2_stunt_rock_-_i_dont_think_im_the_right_person_to_ask_that_question-sq.mp3 |
4.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn066.6/a1_delta_9_-_night_stalker-sq.mp3 |
5.9 MB |
| Hardcore, Gabber/Drop Bass Network/dbn066.6/a2_delta_9_-_dog_soldiers-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Drop Bass Network/dbn066.6/b1_delta_9_-_dropped-sq.mp3 |
6.4 MB |
| Hardcore, Gabber/Drop Bass Network/dbn066.6/b2_delta_9_-_despair-sq.mp3 |
5.3 MB |
| Hardcore, Gabber/Drop Bass Network/dbn066.6/b3_delta_9_-_necron99-sq.mp3 |
5.9 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/00_va-lunatic_pilgrim-cd-2006.m3u |
416 B |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/00_va-lunatic_pilgrim-cd-2006.nfo |
2 KB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/00_va-lunatic_pilgrim-cd-2006.sfv |
1 KB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/01_ark-z-夢見.mp3 |
10.9 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/02_asuka_sakurai-felicital.mp3 |
6.9 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/03_キキ-fantastic_climax.mp3 |
7.9 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/04_ルゼ-dazzzzzzzzzzzling.mp3 |
11.5 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/05_redalice-rize_t2.mp3 |
8.1 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/06_源屋-miss_you.mp3 |
7.7 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/07_takazudo-akisame_tsubame.mp3 |
8.6 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/08_tandpazolite-purify_all_(no_one_can_notice_my_mind_mix).mp3 |
8.4 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/09_篠螺悠那-clash_of_blue.mp3 |
11.7 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/10_lv._4-flashback_rainy_day.mp3 |
14.8 MB |
| Hardcore, Gabber/Druggy's Acid Rack/darkcd-003/11_kenta-v.ez.-speeeeeeeeeeeeeeeedphobia_230plus.mp3 |
5 MB |
| Hardcore, Gabber/DT6 Inc/dt6002/00-v.a.-blood_bath_(dt6.002)-vinyl-2007-side_a.jpg |
855 KB |
| Hardcore, Gabber/DT6 Inc/dt6002/00-v.a.-blood_bath_(dt6.002)-vinyl-2007-side_b.jpg |
824 KB |
| Hardcore, Gabber/DT6 Inc/dt6002/00-v.a.-blood_bath_(dt6.002)-vinyl-2007.m3u |
134 B |
| Hardcore, Gabber/DT6 Inc/dt6002/00-v.a.-blood_bath_(dt6.002)-vinyl-2007.nfo |
905 B |
| Hardcore, Gabber/DT6 Inc/dt6002/00-v.a.-blood_bath_(dt6.002)-vinyl-2007.sfv |
164 B |
| Hardcore, Gabber/DT6 Inc/dt6002/01-a1_dt6-blood_bath.mp3 |
8.8 MB |
| Hardcore, Gabber/DT6 Inc/dt6002/02-b1_unexist_feat._lenny_the_vox_dee-brutal_beatz.mp3 |
6.9 MB |
| Hardcore, Gabber/DT6 Inc/dt6002/03-b2_lenny_dee_and_tieum_and_unexist-get_busy_yo.mp3 |
8 MB |
| Hardcore, Gabber/Dual Kore/dlk001/a1-liquid_blasted-armored_fuck.mp3 |
11.9 MB |
| Hardcore, Gabber/Dual Kore/dlk001/b1-liquid_blasted_and_goetia-roborape.mp3 |
10.3 MB |
| Hardcore, Gabber/Dual Kore/dlk001/b2-goetia-infernal_machine.mp3 |
10.1 MB |
| Hardcore, Gabber/Dual Kore/dlk003/00-va-no_warning_shot-(dlk003)-vinyl-2007-1real.m3u |
232 B |
| Hardcore, Gabber/Dual Kore/dlk003/00-va-no_warning_shot-(dlk003)-vinyl-2007-1real.nfo |
7 KB |
| Hardcore, Gabber/Dual Kore/dlk003/00-va-no_warning_shot-(dlk003)-vinyl-2007-1real.sfv |
286 B |
| Hardcore, Gabber/Dual Kore/dlk003/a1-the_destroyer-mediafucker-1real.mp3 |
10 MB |
| Hardcore, Gabber/Dual Kore/dlk003/a2-goetia-bad_intentions-1real.mp3 |
6.9 MB |
| Hardcore, Gabber/Dual Kore/dlk003/a3-bonehead-french_toast-1real.mp3 |
7.8 MB |
| Hardcore, Gabber/Dual Kore/dlk003/b1-frazzbass-fuck_on_mushroom-1real.mp3 |
9 MB |
| Hardcore, Gabber/Dual Kore/dlk003/b2-akira-manufactured_wind-1real.mp3 |
9 MB |
| Hardcore, Gabber/Dual Kore/dlk003/b3-bonehead-track_with_a_scary_name-1real.mp3 |
7.1 MB |
| Hardcore, Gabber/Dual Kore/dlk005/00_m1dy_and_bokusatsu_shoujo_koubou_-_jappanoize_vol.1-(dlk005)-vinyl-2007.m3u |
211 B |
| Hardcore, Gabber/Dual Kore/dlk005/00_m1dy_and_bokusatsu_shoujo_koubou_-_jappanoize_vol.1-(dlk005)-vinyl-2007.nfo |
8 KB |
| Hardcore, Gabber/Dual Kore/dlk005/00_m1dy_and_bokusatsu_shoujo_koubou_-_jappanoize_vol.1-(dlk005)-vinyl-2007.sfv |
265 B |
| Hardcore, Gabber/Dual Kore/dlk005/a1_m1dy_-_37_dicks.mp3 |
6.2 MB |
| Hardcore, Gabber/Dual Kore/dlk005/a2_m1dy_-_cold_pizza.mp3 |
5.7 MB |
| Hardcore, Gabber/Dual Kore/dlk005/a3_m1dy_-_speedcore_dandy.mp3 |
5.2 MB |
| Hardcore, Gabber/Dual Kore/dlk005/b1_m1dy_-_tokyo_style_speedcore.mp3 |
3.4 MB |
| Hardcore, Gabber/Dual Kore/dlk005/b2_bokusatsu_shoujo_koubou_-_versushunter.mp3 |
8.4 MB |
| Hardcore, Gabber/Dual Kore/dlk005/b3_bokusatsu_shoujo_koubou_-_strikehorse.mp3 |
6.3 MB |
| Hardcore, Gabber/Dutch Gabber Network/dgn008/a1_nero_vs_razorback_-_no_limits.mp3 |
6.7 MB |
| Hardcore, Gabber/Dutch Gabber Network/dgn008/a2_partyraiser_and_distroyer_-_kick_da_ballistic_(original_97_mix).mp3 |
7 MB |
| Hardcore, Gabber/Dutch Gabber Network/dgn008/b1_source_code_and_reflect_-_rockout.mp3 |
10 MB |
| Hardcore, Gabber/Dutch Gabber Network/dgn008/b2_exagon_-_dedicated_(im_back_to_break_your_ass).mp3 |
8.5 MB |
| Hardcore, Gabber/Dwarf/dwarf 123 - forever/A1 Brothers In Crime - Forever (Radio Edit).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf 123 - forever/A2 Brothers In Crime - Forever.mp3 |
4.2 MB |
| Hardcore, Gabber/Dwarf/dwarf 123 - forever/B1 Brothers In Crime - XTC.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf 123 - forever/B2 Brothers In Crime - Slammin' Beat.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 001 - the scotchman - mayhem/(a1) the scotchman - mayhem.mp3 |
2.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 001 - the scotchman - mayhem/(a2) the scotchman - mind transfer.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 001 - the scotchman - mayhem/(b1) the scotchman - asylum.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 001 - the scotchman - mayhem/(b2) the scotchman - get busy time.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 002 - dj gizmo, the darkraver - party animals/(a1) dj gizmo, the darkraver - whoomps.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 002 - dj gizmo, the darkraver - party animals/(b1) dj gizmo - rave organ.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 003 - hyperact - house aggression/(a1) hyperact - house aggression.mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 003 - hyperact - house aggression/(b1) hyperact - my best friend (dirty remix).mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 003 - hyperact - house aggression/(b2) hyperact - my best friend (clean remix).mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 004 - stingray - power of darkness/(a1) stingray - floor filler.mp3 |
5.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 004 - stingray - power of darkness/(a2) stingray - right now.mp3 |
5.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 004 - stingray - power of darkness/(b1) stingray - power of darkness.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 004 - stingray - power of darkness/(b2) stingray - red alert.mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 004 - stingray - power of darkness/(b3) stingray - vortex.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 005 - brothers in crime - let me suck your/(a1) brothers in crime - let me suck your....mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 005 - brothers in crime - let me suck your/(b1) brothers in crime - dance.mp3 |
4.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 005 - brothers in crime - let me suck your/(b2) brothers in crime - drop da beat.mp3 |
3.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 006 - the scotchman - bang the drums/(a1) the scotchman - life force.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 006 - the scotchman - bang the drums/(a2) the scotchman - oblivion.mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 006 - the scotchman - bang the drums/(b1) the scotchman - bang the drums.mp3 |
3.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 006 - the scotchman - bang the drums/(b2) the scotchman - gatecrash.mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 007 - dj gizmo, the dark raver - juicy/(a1) dj gizmo, the dark raver - we got the juice.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 007 - dj gizmo, the dark raver - juicy/(a2) dj gizmo, the dark raver - juicy breaks.mp3 |
2.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 007 - dj gizmo, the dark raver - juicy/(a3) dj gizmo, the dark raver - juicy breakbeats.mp3 |
2.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 007 - dj gizmo, the dark raver - juicy/(b1) dj gizmo - that's all folks.mp3 |
6.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 007 - dj gizmo, the dark raver - juicy/(b2) dj gizmo - reset devices.mp3 |
6.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 008 - warlock - reality is a nightmare/(a1) warlock - reality is a nightmare (south of heaven remix).mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 008 - warlock - reality is a nightmare/(a2) warlock - reality is a nightmare (satanic dwarf remix).mp3 |
4.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 008 - warlock - reality is a nightmare/(b1) warlock - ultra hard frequenties.mp3 |
5.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 008 - warlock - reality is a nightmare/(b2) warlock - yo dj.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 009 - sonicdriver - lethal breaks/(a1) sonicdriver - lethal breaks.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 009 - sonicdriver - lethal breaks/(a2) sonicdriver - back.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 009 - sonicdriver - lethal breaks/(b1) sonicdriver - in the name of god.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 009 - sonicdriver - lethal breaks/(b2) sonicdriver - manic insanity.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 009 - sonicdriver - lethal breaks/(b3) sonicdriver - i'll base you.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 010 - brothers in crime - 100% crisis/(a1) brothers in crime - 100% crisis.mp3 |
6.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 010 - brothers in crime - 100% crisis/(a2) brothers in crime - 100% crisis (mayor daughter conflict remix).mp3 |
5.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 010 - brothers in crime - 100% crisis/(a3) brothers in crime - let me suck your.mp3 |
5.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 010 - brothers in crime - 100% crisis/(b1) brothers in crime - out of sight.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 010 - brothers in crime - 100% crisis/(b2) brothers in crime - dance (charly lownoise remix).mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 010 - brothers in crime - 100% crisis/(b3) brothers in crime - drop da beat (dj paul forze remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 011 - el bruto - hypnotising/(a1) el bruto - hypnotizing.mp3 |
3.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 011 - el bruto - hypnotising/(a2) el bruto - are you down.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 011 - el bruto - hypnotising/(b1) el bruto - bass for ya face.mp3 |
4.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 011 - el bruto - hypnotising/(b2) el bruto - mental breakdown.mp3 |
3.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 012 - stingray, sonicdriver - as cold as ice/(a1) stingray, sonic driver - as cold as ice.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 012 - stingray, sonicdriver - as cold as ice/(b1) stingray, sonic driver - dealin' dope.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 012 - stingray, sonicdriver - as cold as ice/(b2) stingray, sonic driver - in the name of god (stingray remix).mp3 |
3.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 013 - dj isaac - fucking e/(a1) dj isaac - fucking e.mp3 |
5.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 013 - dj isaac - fucking e/(a2) dj isaac - happy hardcore freak.mp3 |
5.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 013 - dj isaac - fucking e/(a3) dj isaac - the hardway.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 013 - dj isaac - fucking e/(b1) dj isaac - hardcore is hardcore.mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 013 - dj isaac - fucking e/(b2) dj isaac - dancehall music.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 013 - dj isaac - fucking e/(b3) dj isaac - short dick.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 014 - warlock - delirious/(a1) warlock - delirious.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 014 - warlock - delirious/(a2) warlock - energize.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 014 - warlock - delirious/(b1) warlock - e-force.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 014 - warlock - delirious/(b2) warlock - straight on and on.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 015 - brothers in crime - how deep is your love/(a1) brothers in crime - how deep is your love (dwarf remix).mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 015 - brothers in crime - how deep is your love/(a2) brothers in crime - how deep is your love (radio edit).mp3 |
4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 015 - brothers in crime - how deep is your love/(b1) brothers in crime - hallucinating.mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 015 - brothers in crime - how deep is your love/(b2) brothers in crime - how deep is your love (techno remix).mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 016 - dj norman - get up and dance/(a1) dj norman - get up and dance.mp3 |
5.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 016 - dj norman - get up and dance/(a2) dj norman - noise.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 016 - dj norman - get up and dance/(b1) dj norman - listen for lessons.mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 016 - dj norman - get up and dance/(b2) dj norman - let me hear you scream.mp3 |
5.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 016 - dj norman - get up and dance/(b3) dj norman - diss you (diss remix).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 017 - the carpenter - nitrious oxide/(a1) the carpenter - jump off the fucking roof.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 017 - the carpenter - nitrious oxide/(a2) the carpenter - nirtious oxide.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 017 - the carpenter - nitrious oxide/(b1) the carpenter - take it 2 da max.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 017 - the carpenter - nitrious oxide/(b2) the carpenter - let the bass kick.mp3 |
4.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 017 - the carpenter - nitrious oxide/(b3) the carpenter - digital orgasm.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 018 - el bruto - watch me dance/(a1) el bruto - watch me dance.mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 018 - el bruto - watch me dance/(a2) el bruto - mind warp.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 018 - el bruto - watch me dance/(b1) el bruto - heaven.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 018 - el bruto - watch me dance/(b2) el bruto - hypnotizing (hard remix).mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 019 - ferocious - get on up/(a1) ferocious - get on up.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 019 - ferocious - get on up/(a2) ferocious - everybody reach to the top.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 019 - ferocious - get on up/(b1) ferocious - please don't go.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 019 - ferocious - get on up/(b2) ferocious - check me sucker.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 019 - ferocious - get on up/(b3) ferocious - listen to me.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 020 - dj isaac, pagan - 2 definitions/(a1) dj isaac, pagan - 2 definitions.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 020 - dj isaac, pagan - 2 definitions/(a2) dj isaac, pagan - up, my way.mp3 |
3.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 020 - dj isaac, pagan - 2 definitions/(b1) dj isaac, pagan - moral hardcore abuse.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 020 - dj isaac, pagan - 2 definitions/(b2) dj isaac, pagan - anyone can dance.mp3 |
4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 020 - dj isaac, pagan - 2 definitions/(b3) dj isaac, pagan - i'll never stop.mp3 |
3.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 021 - stingray - let the bass be louder/(a1) stingray - let the bass be louder.mp3 |
4.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 021 - stingray - let the bass be louder/(a2) stingray - let the bass be louder (el bruto hard remix).mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 021 - stingray - let the bass be louder/(b1) stingray - dance your ass off.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 021 - stingray - let the bass be louder/(b2) stingray - short circuit.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 021 - stingray - let the bass be louder/(b3) stingray - dwarf on tour live act.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 022 - dj norman - fuck you up/(a1) dj norman - fuck you up.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 022 - dj norman - fuck you up/(a2) dj norman - we're here.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 022 - dj norman - fuck you up/(b1) dj norman - listen forlessons (remix).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 022 - dj norman - fuck you up/(b2) dj norman - get a party.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 022 - dj norman - fuck you up/(b3) dj norman - get a party (piano edit).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 023 - brothers in crime - forever/(a1) brothers in crime - xtc.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 023 - brothers in crime - forever/(a2) brothers in crime - forever.mp3 |
4.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 023 - brothers in crime - forever/(b1) brothers in crime - slammin' beat.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 023 - brothers in crime - forever/(b2) brothers in crime - forever (radio edit).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 024 - el bruto - let yourself go/(a1) el bruto - let yourself go.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 024 - el bruto - let yourself go/(a2) el bruto - energy flux.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 024 - el bruto - let yourself go/(b1) el bruto - rock that shit.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 024 - el bruto - let yourself go/(b2) el bruto - hypnotic spectrum.mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 025 - ferocious - cocaine/(a1) ferocious - cocaine.mp3 |
5.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 025 - ferocious - cocaine/(a2) ferocious - life's a bitch.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 025 - ferocious - cocaine/(b1) ferocious - this jam is hype.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 025 - ferocious - cocaine/(b2) ferocious - raped, killed and hung.mp3 |
6.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 026 - ultimate buzz, mc bee - on a mission/(a1) ultimate buzz, mc bee - on a mission (dj isaac's live remix).mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 026 - ultimate buzz, mc bee - on a mission/(a2) ultimate buzz, mc bee - on a mission.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 026 - ultimate buzz, mc bee - on a mission/(b1) ultimate buzz, mc bee - on a mission (el bruto remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 026 - ultimate buzz, mc bee - on a mission/(b2) ultimate buzz, mc bee - on a mission (acapella).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 027 - dj pagan - mister mister scarface/(a1) dj pagan - mister mister scarface.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 027 - dj pagan - mister mister scarface/(a2) dj pagan - mister mister scarface (dj isaac remix).mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 027 - dj pagan - mister mister scarface/(b1) dj pagan - we do it.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 027 - dj pagan - mister mister scarface/(b2) dj pagan - get down easy.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 028 - casio brothers - partytime/(a1) casio brothers - partytime (ferocious remix).mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 028 - casio brothers - partytime/(a2) casio brothers - partytime (big bounce remix).mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 028 - casio brothers - partytime/(b1) casio brothers - partytime (original 303 remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 028 - casio brothers - partytime/(b2) casio brothers - jump (original 12'' edit).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 028 - casio brothers - partytime/(b3) casio brothers - silver box (waveform remix).mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 029 - rave the city - the roman empire/(a1) dj gizmo, dj norman - the roman empire.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 029 - rave the city - the roman empire/(a2) the dark raver - if you believe in having sex.mp3 |
6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 029 - rave the city - the roman empire/(b1) dj isaac - rock this shit.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 029 - rave the city - the roman empire/(b2) dj davie forbes - roman orgy.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 030 - brothers in crime - destiny (hardcore edition)/(b2) drothers in crime - destiny (dj norman's remix).mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 031 - dj pagan - you're the best/(a1) dj pagan - you're the best (g-town madness remix).mp3 |
6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 031 - dj pagan - you're the best/(a2) dj pagan - you're the best.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 031 - dj pagan - you're the best/(b1) dj pagan, t-mc - fear is born.mp3 |
7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 031 - dj pagan - you're the best/(b2) dj pagan - bass be louder.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 031 - dj pagan - you're the best/(b3) dj pagan - bass be louder (don escobar remix).mp3 |
5.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 032 - prezioso - feel the rhythm/(a1) prezioso - feel the rhythm (the stunned guys remix).mp3 |
7.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 032 - prezioso - feel the rhythm/(a2) prezioso - feel the scratch (part 2).mp3 |
2.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 032 - prezioso - feel the rhythm/(b1) prezioso - feel the rhythm (dj isaac remix).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 032 - prezioso - feel the rhythm/(b2) prezioso - feel the scratch (part 1).mp3 |
2.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 033 - el bruto - hardcore motherfucker/(a1) el bruto - hardcore motherfucker.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 033 - el bruto - hardcore motherfucker/(b1) el bruto - mindstab.mp3 |
6.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 033 - el bruto - hardcore motherfucker/(b2) el bruto - braingeyser.mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 034 - the ultimate buzz, mc bee - rofo's theme/(a1) the ultimate buzz, mc bee - rofo's theme (dj isaac remix).mp3 |
8.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 034 - the ultimate buzz, mc bee - rofo's theme/(b1) the ultimate buzz, mc bee - rofo's theme (el burto remix).mp3 |
5.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 035 - sonicdriver, wicked e - exited/(a1) sonicdriver, wicked e - exited.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 035 - sonicdriver, wicked e - exited/(b1) sonicdriver, wicked e - darkside.mp3 |
6.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 035 - sonicdriver, wicked e - exited/(b2) sonicdriver, wicked e - the trip.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 036 - the viper - rude boy man/(a1) the viper - rude boy man.mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 036 - the viper - rude boy man/(a2) the viper - viper's freestyle ,ix (part 2).mp3 |
3.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 036 - the viper - rude boy man/(b1) the viper - the beat (dj attic, dj stylzz remix).mp3 |
6.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 036 - the viper - rude boy man/(b2) the viper - voodoo magic.mp3 |
7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 037 - dj isaac - another dream/(a1) dj isaac - another dream.mp3 |
7.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 037 - dj isaac - another dream/(b1) dj isaac - rock tha beat.mp3 |
6.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 037 - dj isaac - another dream/(b2) dj isaac - hardcore from the underland.mp3 |
7.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 038 - ultimate buzz, mc bee - back in business/(a1) ultimate buzz, mc bee - back in business (dj isaac remix).mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 038 - ultimate buzz, mc bee - back in business/(b1) ultimate buzz, mc bee - back in business (b.s.e. remix).mp3 |
5.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 039 - the scotchman - asylum (remixes)/(a1) the scotchman - asylum (bse remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 039 - the scotchman - asylum (remixes)/(b1) the scotchman - asylum.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 039 - the scotchman - asylum (remixes)/(b2) the scotchman - asylum (digital boy remix).mp3 |
8.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 040 - zero tollerance - rubber biscuit/(a1) zero tollerance - big rhythm.mp3 |
6.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 040 - zero tollerance - rubber biscuit/(a1) zero tollerance - rubber biscuit.mp3 |
7.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 040 - zero tollerance - rubber biscuit/(a2) zero tollerance - body motion.mp3 |
6.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 041 - exodus - bust da beat/(a1) exodus - bust da beat.mp3 |
6.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 041 - exodus - bust da beat/(b1) exodus - more addictive.mp3 |
7.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 042 - dj isaac - sex on the casio/(a1) dj isaac - sex on the casio.mp3 |
6.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 042 - dj isaac - sex on the casio/(b1) dj isaac - bitches and money.mp3 |
7.8 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 042 - dj isaac - sex on the casio/(b2) dj isaac - get with the bass.mp3 |
6.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 043 - sound enhancers - serious shit/(a1) sound enhancers - serious shit.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 043 - sound enhancers - serious shit/(a2) sound enhancers - come and test me.mp3 |
7.9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 043 - sound enhancers - serious shit/(b1) sound enhancers - musicaaah.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 043 - sound enhancers - serious shit/(b2) sound enhancers - i'll behaviour.mp3 |
8.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 044 - the viper - hardcore gangster/(a1) the viper - hardcore gangster.mp3 |
10 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 044 - the viper - hardcore gangster/(a2) the viper - hardcore gangster (dj promo remix).mp3 |
7.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 044 - the viper - hardcore gangster/(b1) the viper - rock the disc-o-tek.mp3 |
6.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 044 - the viper - hardcore gangster/(b2) the viper - def with the records.mp3 |
6.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 045 - g-town madness - put your hands up/(a1) g-town madness - put your hands up.mp3 |
6.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 045 - g-town madness - put your hands up/(a2) g-town madness - eternal energy flow.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 045 - g-town madness - put your hands up/(b1) g-town madness - boomin up the system.mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 045 - g-town madness - put your hands up/(b2) g-town madness - silence.mp3 |
7.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 046 - the hitsquad - voodoo/(a1) the hitsquad - voodoo.mp3 |
6.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 046 - the hitsquad - voodoo/(a2) the hitsquad - bouncin' bass.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 046 - the hitsquad - voodoo/(b1) the hitsquad - the madnezzz.mp3 |
5.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 046 - the hitsquad - voodoo/(b2) the hitsquad - understanding.mp3 |
7.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 047 - don diablo - return of the psycho/(a1) don diablo - return of the psycho.mp3 |
10.2 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 047 - don diablo - return of the psycho/(a2) don diablo - tom sawyer's revenge.mp3 |
9.1 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 047 - don diablo - return of the psycho/(b1) don diablo - city of angels.mp3 |
8.5 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 047 - don diablo - return of the psycho/(b2) don diablo - nothing is over.mp3 |
9 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 048 - the hitsquad - insanity/(a1) the hitsquad - insanity.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 048 - the hitsquad - insanity/(a2) the hitsquad - conquer the world.mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 048 - the hitsquad - insanity/(b1) the hitsquad - roll it up.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf records - 048 - the hitsquad - insanity/(b2) the hitsquad - one and two.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf001/Dwarf001 -A1- The Scotchman - Mayhem.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf001/Dwarf001 -A2- The Scotchman - Mind Transfer.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf001/Dwarf001 -B1- The Scotchman - Asylum.mp3 |
3.1 MB |
| Hardcore, Gabber/Dwarf/dwarf001/Dwarf001 -B2- The Scotchman - Get Busy Time.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf005/Dwarf005 -A1- Brothers In Crime - Let Me Suck Your....mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf005/Dwarf005 -B1- Brothers In Crime - Dance.mp3 |
4.1 MB |
| Hardcore, Gabber/Dwarf/dwarf005/Dwarf005 -B2- Brothers In Crime - Drop Da Beat.mp3 |
3.1 MB |
| Hardcore, Gabber/Dwarf/dwarf006/Dwarf006 -A1- The Scotchman - Life Force.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf006/Dwarf006 -A2- The Scotchman - Oblivion.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf006/Dwarf006 -B1- The Scotchman - Bang The Drums.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf006/Dwarf006 -B2- The Scotchman - Gatecrash.mp3 |
4.5 MB |
| Hardcore, Gabber/Dwarf/dwarf011/Dwarf011 -A1- El Bruto - Hypnotizing.mp3 |
3.9 MB |
| Hardcore, Gabber/Dwarf/dwarf011/Dwarf011 -A2- El Bruto - Are You Down.mp3 |
3.4 MB |
| Hardcore, Gabber/Dwarf/dwarf011/Dwarf011 -B1- El Bruto - Bass For Ya Face.mp3 |
4.2 MB |
| Hardcore, Gabber/Dwarf/dwarf011/Dwarf011 -B2- El Bruto - Mental Breakdown.mp3 |
3.3 MB |
| Hardcore, Gabber/Dwarf/dwarf012r/A1. Stingray & Sonicdriver - As Cold As Ice (El Bruto Remix).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf012r/A2. Stingray & Sonicdriver - As Cold As Ice (12inch Version).mp3 |
4 MB |
| Hardcore, Gabber/Dwarf/dwarf012r/B1. Stingray & Sonicdriver - As Cold As Ice (Sonicdriver Remix).mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf012r/B2. Stingray & Sonicdriver - As Cold As Ice (Original Remastered).mp3 |
3.6 MB |
| Hardcore, Gabber/Dwarf/dwarf012r/B3. Stingray & Sonicdriver - As Cold As Ice (Airplay Remix).mp3 |
2.9 MB |
| Hardcore, Gabber/Dwarf/dwarf021/(a1) stingray - let the bass be louder.mp3 |
4.3 MB |
| Hardcore, Gabber/Dwarf/dwarf021/(a2) stingray - let the bass be louder (el bruto hard remix).mp3 |
4.6 MB |
| Hardcore, Gabber/Dwarf/dwarf021/(b1) stingray - dance your ass off.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf021/(b2) stingray - short circuit.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf021/(b3) stingray - dwarf on tour live act.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf022/(a1) dj norman - fuck you up.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf022/(a2) dj norman - we're here.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf022/(b1) dj norman - listen forlessons (remix).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf022/(b2) dj norman - get a party.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf022/(b3) dj norman - get a party (piano edit).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf023/(a1) brothers in crime - xtc.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf023/(a2) brothers in crime - forever.mp3 |
4.1 MB |
| Hardcore, Gabber/Dwarf/dwarf023/(b1) brothers in crime - slammin' beat.mp3 |
3.7 MB |
| Hardcore, Gabber/Dwarf/dwarf023/(b2) brothers in crime - forever (radio edit).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf024/(a1) el bruto - let yourself go.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf024/(a2) el bruto - energy flux.mp3 |
4.7 MB |
| Hardcore, Gabber/Dwarf/dwarf024/(b1) el bruto - rock that shit.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf024/(b2) el bruto - hypnotic spectrum.mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf025/(a1) ferocious - cocaine.mp3 |
5.8 MB |
| Hardcore, Gabber/Dwarf/dwarf025/(a2) ferocious - life's a bitch.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf025/(b1) ferocious - this jam is hype.mp3 |
5.4 MB |
| Hardcore, Gabber/Dwarf/dwarf025/(b2) ferocious - raped, killed and hung.mp3 |
6.4 MB |
| Hardcore, Gabber/Dwarf/dwarf026/(a1) ultimate buzz, mc bee - on a mission (dj isaac's live r.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf026/(a2) ultimate buzz, mc bee - on a mission.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf026/(b1) ultimate buzz, mc bee - on a mission (el bruto remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Dwarf/dwarf026/(b2) ultimate buzz, mc bee - on a mission (acapella).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf027/(a1) dj pagan - mister mister scarface.mp3 |
5 MB |
| Hardcore, Gabber/Dwarf/dwarf027/(a2) dj pagan - mister mister scarface (dj isaac remix).mp3 |
5.1 MB |
| Hardcore, Gabber/Dwarf/dwarf027/(b1) dj pagan - we do it.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf027/(b2) dj pagan - get down easy.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf028/(a1) casio brothers - partytime (ferocious remix).mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf028/(a2) casio brothers - partytime (big bounce remix).mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf028/(b1) casio brothers - partytime (original 303 remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf028/(b2) casio brothers - jump (original 12'' edit).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf028/(b3) casio brothers - silver box (waveform remix).mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf029/(a1) dj gizmo, dj norman - the roman empire.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf029/(a2) the dark raver - if you believe in having sex.mp3 |
6 MB |
| Hardcore, Gabber/Dwarf/dwarf029/(b1) dj isaac - rock this shit.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf029/(b2) dj davie forbes - roman orgy.mp3 |
4.9 MB |
| Hardcore, Gabber/Dwarf/dwarf030/(b2) drothers in crime - destiny (dj norman's remix).mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf031/(a1) dj pagan - you're the best (g-town madness remix).mp3 |
6 MB |
| Hardcore, Gabber/Dwarf/dwarf031/(a2) dj pagan - you're the best.mp3 |
6.1 MB |
| Hardcore, Gabber/Dwarf/dwarf031/(b1) dj pagan, t-mc - fear is born.mp3 |
7 MB |
| Hardcore, Gabber/Dwarf/dwarf031/(b2) dj pagan - bass be louder.mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf031/(b3) dj pagan - bass be louder (don escobar remix).mp3 |
5.8 MB |
| Hardcore, Gabber/Dwarf/dwarf032/(a1) prezioso - feel the rhythm (the stunned guys remix).mp3 |
7.7 MB |
| Hardcore, Gabber/Dwarf/dwarf032/(a2) prezioso - feel the scratch (part 2).mp3 |
2.8 MB |
| Hardcore, Gabber/Dwarf/dwarf032/(b1) prezioso - feel the rhythm (dj isaac remix).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf032/(b2) prezioso - feel the scratch (part 1).mp3 |
2.7 MB |
| Hardcore, Gabber/Dwarf/dwarf033/(a1) el bruto - hardcore motherfucker.mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf033/(b1) el bruto - mindstab.mp3 |
6.6 MB |
| Hardcore, Gabber/Dwarf/dwarf033/(b2) el bruto - braingeyser.mp3 |
5.6 MB |
| Hardcore, Gabber/Dwarf/dwarf034/(b1) the ultimate buzz, mc bee - rofo's theme (el burto remi.mp3 |
5.7 MB |
| Hardcore, Gabber/Dwarf/dwarf036/(a1) the viper - rude boy man.mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf036/(a2) the viper - viper's freestyle ,ix (part 2).mp3 |
3.6 MB |
| Hardcore, Gabber/Dwarf/dwarf036/(b1) the viper - the beat (dj attic, dj stylzz remix).mp3 |
6.9 MB |
| Hardcore, Gabber/Dwarf/dwarf036/(b2) the viper - voodoo magic.mp3 |
7 MB |
| Hardcore, Gabber/Dwarf/dwarf037/(b1) dj isaac - rock tha beat.mp3 |
6.8 MB |
| Hardcore, Gabber/Dwarf/dwarf039/A The Scotchman - Asylum (bse Remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf039/B1 The Scotchman - Asylum.mp3 |
5.3 MB |
| Hardcore, Gabber/Dwarf/dwarf039/B2 The Scotchman - Asylum (digital Boy Remix).mp3 |
8.3 MB |
| Hardcore, Gabber/Dwarf/dwarf115/01 - Brothers In Crime - How Deep Is Your Love (Radio Edit).mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf115/02 - Brothers In Crime - How Deep Is Your Love (Techno Mix).mp3 |
6.5 MB |
| Hardcore, Gabber/Dwarf/dwarf115/03 - Brothers In Crime - How Deep Is Your Love (Dwarf Mix).mp3 |
5.9 MB |
| Hardcore, Gabber/Dwarf/dwarf115/04 - Brothers In Crime - Hallucinating.mp3 |
6.8 MB |
| Hardcore, Gabber/Dwarf/dwarf115/05 - Brothers In Crime - Dance (Charly Lownoise Mix).mp3 |
6.2 MB |
| Hardcore, Gabber/Dwarf/dwarf115/06 - Brothers In Crime - Drop Da Beat (Paul Elstak Mix).mp3 |
6.3 MB |
| Hardcore, Gabber/Dwarf/dwarf123/A1 Brothers In Crime - Forever (Radio Edit).mp3 |
3.5 MB |
| Hardcore, Gabber/Dwarf/dwarf123/A2 Brothers In Crime - Forever.mp3 |
4.1 MB |
| Hardcore, Gabber/Dwarf/dwarf123/B1 Brothers In Crime - XTC.mp3 |
4.8 MB |
| Hardcore, Gabber/Dwarf/dwarf123/B2 Brothers In Crime - Slammin' Beat.mp3 |
3.7 MB |
| Hardcore, Gabber/Elektrokut/elk005/00_igneon_system_-_existenz-(elk05)-vinyl-2008.m3u |
194 B |
| Hardcore, Gabber/Elektrokut/elk005/00_igneon_system_-_existenz-(elk05)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Elektrokut/elk005/00_igneon_system_-_existenz-(elk05)-vinyl-2008.sfv |
239 B |
| Hardcore, Gabber/Elektrokut/elk005/a1_igneon_system_-_pain_has_a_face.mp3 |
8.3 MB |
| Hardcore, Gabber/Elektrokut/elk005/a2_igneon_system_-_this_is_how_we_do_it.mp3 |
6.5 MB |
| Hardcore, Gabber/Elektrokut/elk005/b1_igneon_system_-_global_128.mp3 |
5.8 MB |
| Hardcore, Gabber/Elektrokut/elk005/b2_igneon_system_-_x-black_society.mp3 |
5.4 MB |
| Hardcore, Gabber/Elektrokut/elk005/b3_igneon_system_-_freaktrip.mp3 |
7.3 MB |
| Hardcore, Gabber/Elite Hardcore/ehc002/a1_the_bouncemasters_and_the_vizitor-he_is_from_hell-1real.mp3 |
8.4 MB |
| Hardcore, Gabber/Elite Hardcore/ehc002/a2_the_bouncemasters_and_the_vizitor-where_are_you-1real.mp3 |
6 MB |
| Hardcore, Gabber/Elite Hardcore/ehc002/b1_the_bouncemasters_and_the_vizitor-c.orp-1real.mp3 |
7.4 MB |
| Hardcore, Gabber/Elite Hardcore/ehc002/b2_the_bouncemasters_and_the_vizitor-total_state_of_paranoia.mp3 |
7.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme001/A1. Endymion - Chemical implant.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme001/A2. Endymion - It's all music.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme001/B1. Endymion - Drunk with revenge.mp3 |
8.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme001/B2. Endymion - The core (dj promo & catscan remix).mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme002/A1. Weapon X - Strictly the mf core.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme002/A2. Weapon X - Close to defeat.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme002/B1. Weapon X - Compose the beat.mp3 |
7.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme002/B2. Weapon X - Cross the world.mp3 |
7.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme003/A1 - Ophidian - Order Out Of Chaos.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme003/A2 - Ophidian - Scrapmetal.mp3 |
9.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme003/B1 - Ophidian - Ghosts.mp3 |
9.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme004/A2. Project Omeaga - Prozac Attack.mp3 |
8.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme004/enzyme 004 - a1 - meagashira - dj killa.mp3 |
9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme004/enzyme 004 - b1 - meagashira - end of line (endymion rmx).mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme004/enzyme 004 - b2 - meagashira - loss of intelligence (stay....mp3 |
9.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme005/a1-nosferatu_vs._endymion_-_stay_focussed-doc.mp3 |
8.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme005/A2. DJ Nosferatu vs. Endymion - Industrial Wreckage.mp3 |
1.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme005/b1-nosferatu_vs._endymion_-_broken_rules-doc.mp3 |
8.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme005/b2-dj nosferatu vs. endymion - life is pain.mp3 |
4.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme006/a1_nexes_feat._dj_nosferatu_-_welcome_to_nexes-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme006/a2_dj_lyrix_feat._endymion_-_asset_for_error-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme006/b1_hamunaptra_feat._dj_nosferatu_-_soul_entrapment_(riot)-sq.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme006/b2_hamunaptra_feat._ophidian_-_frighning_phobia-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme007/a1_dj_nosferatu_-_the_undead-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme007/Nosferatu - Bloody Mary.mp3 |
8.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme007/Nosferatu - Purgatory knowledge.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme007/Nosferatu - The Life You Told.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme008/a1 Whatz 'yo name!.mp3 |
6.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme008/a2 In distrezz mode.mp3 |
7.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme008/b1 The mf psycho.mp3 |
6.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme009/A1 - Meagashira - The Sound Of The Record (Is Meagashira Sty.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme009/B1 - Meagashira - Lost In Music.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme009/B2 - Project Omeaga - Prednison-Attack.mp3 |
6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/A1. Nosferatu & Endymion - All The Way Up.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/A2. Ophidian - Insects.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/B1. Ophidian & Hamunaptra - Whispers Of A Nameless Fear.mp3 |
7.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/B2. Hamunaptra - Plague upon mankind.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/C1. D'Spyre & Hamunaptra - Threebond of consent.mp3 |
6.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/C2. Project omeaga - For Enzyme X.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme010/D1. DJ Nosferatu - The Underground Stream.mp3 |
5.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme011/A1. Endymion - Wild.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme011/A2. Endymion - Involuntary intoxication.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme011/B1. Endymion - Contact.mp3 |
7.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme011/B2. Endymion - Stay focussed (the viper rmx).mp3 |
7.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme0111213/a1_endymion_-_rock_the_part-e-klf.mp3 |
7.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme0111213/a2_endymion_-_inner_sanctum-klf.mp3 |
5.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme0111213/b1_endymion_-_voices_from_the_death.mp3 |
6.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme0111213/b2_endymion_-_emotional_relapse-klf.mp3 |
5.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme012/A1. Endymion - In the dark.mp3 |
7.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme012/A2. Endymion - Failure (nosferatu rmx).mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme012/B1. Endymion - Anger.mp3 |
7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme012/B2. Endymion - Pussy motherfuckerz.mp3 |
6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme013/A1. Endymion - Payback.mp3 |
8.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme013/A2. Endymion - Art of time.mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme013/B1. Endymion - You are not in control.mp3 |
7.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme013/B2. Endymion - Headroom (ft. meagashira).mp3 |
6.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/a1_mindustries_-_facerocker-klf.mp3 |
6.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/a2_mindustries_-_struck_a_nerve-klf.mp3 |
8.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/b1_mindustries_-_mindustrial-klf.mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/b2_mindustries_-_throes_of_rejection-klf.mp3 |
6.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/b3_mindustries_-_opus_mechanica-klf.mp3 |
8.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/c1_mindustries_-_playing_the_game-klf.mp3 |
7.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/c2_mindustries_-_deux_ex_machina-klf.mp3 |
7.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/d1_mindustries_-_corpse_candle-klf.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/d2_mindustries_-_breaching_the_barriers-klf.mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme014/d3_mindustries_-_ode_to_the_dreamers-klf.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme015/a1_meagashira_-_e.g.o._feat._jay_capone-klf.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme015/a2_meagashira_-_e.g.o._feat._jay_capone_(acapella)-klf.mp3 |
1.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme015/b1_meagashira_-_we_are_outsiders-klf.mp3 |
7.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme015/b2_meagashira_-_miss_parkinson-klf.mp3 |
6.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme016/a1_dj_nosferatu_-_have_it_your_way-sq.mp3 |
11.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme016/b1_dj_nosferatu_-_cameltoe-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme016/b2_dj_nosferatu_-_loose_canon-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme017/03-weapon_x-comin_down-twc.mp3 |
7.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme017/04-weapon_x-facing_the_gates_of_oblivion-twc.mp3 |
8.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme017/A1 Weapon X - Hate Me!.mp3 |
7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme017/a2_weapon_x_-_get_the_fuck_out_my_way.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018x/a1-raziel - to destroy what is broken.mp3 |
5.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018x/a2-ophidian - crime passionelle.mp3 |
7.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018x/a3-meander - 813 mixdown.mp3 |
2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018x/b1-ophidian - angel.mp3 |
9.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018x/b2-ophidian - disrespected intervention.mp3 |
6.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018y/a1-ophidian - the middle children.mp3 |
10.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018y/a2-ophidian - skinbitten.mp3 |
7.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018y/b1-ophidian - sleepwalking.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018y/b2-ophidian - mako.mp3 |
5.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018y/b3-meander - kristanna.mp3 |
2.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018z/a1-ophidian - formshift.mp3 |
7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018z/a2-ophidian vs. raziel - to punish the weak.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018z/a3-meander - stick.mp3 |
5.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018z/b1-ophidian - pepperspray.mp3 |
5.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018z/b2-ophidian - lynched.mp3 |
6.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme018z/b3-meander - ghosting.mp3 |
6.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme019/a1-mindustries - massdriver.mp3 |
8.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme019/a2-mindustries - deus ex machina (producer adrenaline inject.mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme019/b1-mindustries - translated visions.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme019/b2-mindustries - instru mental disorder.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/a1_dj_nosferatu_-_frustrated_m.f.s.-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/a2_hamunaptra_and_endymion_-_sence_of_another_world-sq.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/b1_endymion_and_d_spyre_-_original_sin-sq.mp3 |
8.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/b2_nexes_-_zwalgertozer-sq.mp3 |
5.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/c1_ophidian_-_predator_and_prey-sq.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/c2_sei2ure_-_piledriver-sq.mp3 |
8.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/d1_ruffneck_and_endymion_-_masenka-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/d2_mindustries_-_beat_the_system-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/e1_synapse_-_nifty_tick-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/e2_d-drive_-_versus-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/f1_dj_nosferatu_and_endymion_-_nothing_is_what_it_seems-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme020/f2_project_omeaga_-_valium_attack-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme021/a1_nosferatu_-_beaver_cleaver-sq.mp3 |
10.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme021/a2_nosferatu_-_knock_out-sq.mp3 |
9.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme021/b1_nosferatu_-_disorder_of_the_mind-sq.mp3 |
10.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme/enzyme021/b2_nosferatu_-_underground_stream_(dione_remix)-sq.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd01/a1-project omeaga - prelipsis.mp3 |
3.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd01/a2-project omeaga - extermination.mp3 |
6.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd01/b1-project omeaga - we knew you'd fade up.mp3 |
4.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd01/b2-project omeaga - prozac attack (original).mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd02/a1-daryll bayes - s.y.n.e..mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd02/a2-daryll bayes - eggs the flex morningsex.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd02/b1-ophidian - thresher (project omeaga remix).mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme Black Limited/bltd02/b2-project omeaga - antisound1.mp3 |
7.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-1/a1_knightvision_and_dspyre_-_apocalypse_(vip_edit_by_dj_nosf.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-1/a2_knightvision_and_dspyre_-_apocalyptic_intro_(by_dj_nosfer.mp3 |
3.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-1/b1_knightvision_and_dspyre_-_apocalypse_(original_version)-s.mp3 |
6.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-1/b2_knightvision_and_dspyre_-_apocalyptic_intro_(by_ophidian).mp3 |
4.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-2/a1-nightvision & d' spyre - punishment beyond death.mp3 |
8.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-2/b1-nosferatu & ophidian - psychiatric ass.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-3/A1. Nexes - X-plore.mp3 |
10.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-3/B1. Nexes - Futuristic elements.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-4/a1_hamunaptra_-_neon_genesis_part_i_(yataaah)-hsa.mp3 |
7.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-4/b1_hamunaptra_-_the_art_of_suffering-hsa.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-5/a1_synapse_-_renoised_sine-sq.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-5/b1_seizure_-_pneumatic_transmission-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-6/a1 synapse - crispy kick.mp3 |
8.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme K7/enzyme k7-6/b1 nosferatu - disease.mp3 |
9 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ek7v001/KNIGHTVISION & D'SPYRE - A1 - Apocalypse (VIP Edit By Nosfer.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ek7v001/KNIGHTVISION & D'SPYRE - A2 - Apocalyptic Intro (By Nosferat.mp3 |
3.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ek7v001/KNIGHTVISION & D'SPYRE - B1 - Apocalypse (Original).mp3 |
6.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ek7v001/KNIGHTVISION & D'SPYRE - B2 - Apocalyptic Intro (By Ophidian.mp3 |
4.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/eov005/a1_the_outside_agency_-_screaming_vip-sq.mp3 |
9.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/eov005/a2_the_outside_agency_-_screaming_remake-sq.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/eov005/b1_the_outside_agency_-_screaming_bootleg-sq.mp3 |
10.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ev004/a1-project omeaga - morphine attack.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ev004/a2-project omeaga - prednison attack.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ev004/b1-project omeaga - protusan attack.mp3 |
6.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/ev004/b2-project omeaga - methadon attack.mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv002/a1_ophidian_-_butterfly_(vip_edit_by_ophidian)-klf.mp3 |
9.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv002/a2_ophidian_-_butterfly_(interlude_by_cubist_boy_and_tapage).mp3 |
1.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv002/a3_ophidian_-_butterfly_(original)-klf.mp3 |
6.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv002/b1_ophidian_-_hammerhead_(vip_edit_by_ophidian)-klf.mp3 |
7.7 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv002/b2_ophidian_-_hammerhead_(interlude_by_cubist_boy_and_tapage.mp3 |
1.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv002/b3_ophidian_-_hammerhead_(original)-klf.mp3 |
4.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv003/a1 enzyme x - kapotnaaien (spunkbucket mix by dj nosferatu a.mp3 |
8.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv003/a2 enzyme x - kapotnaaien (original mix).mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv003/b1 enzyme x - kapotnaaien (fotzelegger mix by d spyre).mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme VIP/exv003/b2 enzyme x - kapotnaaien (bukake mix by d spyre).mp3 |
4.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x001/A1 - Poison.mp3 |
4.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x001/B1 - Doorbanen.mp3 |
4.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x002/a1 - Ophidian - Bells.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x002/b1 - Ophidian - The Dark.mp3 |
6.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x003/a1 - Knightvision - Travellers Of The Mind.mp3 |
10.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x003/b1 - Knightvision - Syskwahor.mp3 |
10.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x004/a1 - Project Omeaga - Opbokken.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x004/b1 - Endymion & Nosferatu - Post Traumatic Fuckup.mp3 |
6.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x005/a1 - Ophidian - Parasomnia.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x005/b1 - Ophidian - Traces Of Insanity.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x006/a1 - Ophidian - Hammerhead.mp3 |
6 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x006/b1 - Endymion & Nosferatu - Kapotnaaien.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x007/a1 - Ophidian - Nurse.mp3 |
5.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x007/b1 - Ophidian - Friction.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x008/A1-Thresher.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x008/B1-Noisefloor.mp3 |
5.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x009/a1 - Ophidian - Mantaray.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x009/ophidian - nentisys.mp3 |
4.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x010/a1 - Ophidian - Helicoil.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x010/b1 - Ophidian - Answers.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x011/a1 - Ophidian - Blind.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x011/ophidian - strychnine.mp3 |
5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x012/a1 - Ophidian - Kissing the Enemy.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x012/b1 - Hamunaptra - Clonewave.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x013/a1 - Ophidian - Phaseshift.mp3 |
5.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x013/a2 - Ophidian & D'spyre - Reminiscence Of A Future War.mp3 |
7.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x013/b1 - Nosferatu - Rattlesnake.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x013/b2 - Nosferatu - Nzmdfc 1.mp3 |
5.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x014/a1 - D'Spyre & Endymion - Skummes.mp3 |
5.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x014/b1 - D'Spyre & Endymion - Optjenkere.mp3 |
4.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x015/a1 - Nosferatu - Nightbreed.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x015/b1 - Endymion - Thou Shalt Consume Thyself.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x016/a1_enzyme_x_-_dissonant_poetry-hsa.mp3 |
5.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x016/b1_enzyme_x_-_rauwkost-hsa.mp3 |
5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x017/a1_enzyme_x_-_memento_mori-sq.mp3 |
5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x017/b1_enzyme_x_-_tsui_pa_shien-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x018/a1_enzyme_x_-_prankster-sq.mp3 |
4.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x018/b1_enzyme_x_-_problem_child-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x019/a1 dissimulation.mp3 |
5.3 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x019/b1 fytoftora.mp3 |
4.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x020/a1 g-strike.mp3 |
5.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x020/b1 gods child.mp3 |
5.2 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x021/a1_enzyme_x_-_illuminati-sq.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x021/b1_enzyme_x_-_hypothermia-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X07A - Ophidian - Nurse.mp3 |
5.5 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X07B - Ophidian - Friction.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X08A - Ophidian - Thresher.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X08B - Ophidian - Noisefloor.mp3 |
5.6 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X09A - Ophidian - Mantaray.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X09B - Ophidian - Nentisys.mp3 |
4.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X10A - Ophidian - Helicoil.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X10B - Ophidian - Answers.mp3 |
5.8 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X11A - Ophidian - Blind.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme/Enzyme X/enzyme x07891011/X11B - Ophidian - Strychnine.mp3 |
5 MB |
| Hardcore, Gabber/Enzyme/enzyme021/a1_nosferatu_-_beaver_cleaver-sq.mp3 |
10.6 MB |
| Hardcore, Gabber/Enzyme/enzyme021/a1_nosferatu_-_beaver_cleaver-sq.mp3.asd |
437 KB |
| Hardcore, Gabber/Enzyme/enzyme021/a2_nosferatu_-_knock_out-sq.mp3 |
9.7 MB |
| Hardcore, Gabber/Enzyme/enzyme021/a2_nosferatu_-_knock_out-sq.mp3.asd |
422 KB |
| Hardcore, Gabber/Enzyme/enzyme021/b1_nosferatu_-_disorder_of_the_mind-sq.mp3 |
10.8 MB |
| Hardcore, Gabber/Enzyme/enzyme021/b2_nosferatu_-_underground_stream_(dione_remix)-sq.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/enzyme022/A2 - ENDYMION - Paranoid.mp3 |
8.7 MB |
| Hardcore, Gabber/Enzyme/enzyme022/Endymion & Ophidian - Petrifaction.mp3 |
10.2 MB |
| Hardcore, Gabber/Enzyme/enzyme022/Endymion - Causing confusion.mp3 |
9.9 MB |
| Hardcore, Gabber/Enzyme/enzyme022/Endymion - Causing confusion.mp3.asd |
402 KB |
| Hardcore, Gabber/Enzyme/enzyme022/Endymion - Hybrids.mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme/enzyme022/INCOMPLETE~Endymion - Paranoid.mp3 |
5.3 MB |
| Hardcore, Gabber/Enzyme/enzyme024/00_sei2ure_-_illusion_of_safety-(enzyme024)-vinyl-2007.m3u |
119 B |
| Hardcore, Gabber/Enzyme/enzyme024/00_sei2ure_-_illusion_of_safety-(enzyme024)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Enzyme/enzyme024/00_sei2ure_-_illusion_of_safety-(enzyme024)-vinyl-2007.sfv |
159 B |
| Hardcore, Gabber/Enzyme/enzyme024/a1_sei2ure_-_the_sleepwalker.mp3 |
10.1 MB |
| Hardcore, Gabber/Enzyme/enzyme024/a2_sei2ure_-_zinc.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/enzyme024/b1_sei2ure_-_geiger_counter.mp3 |
5.3 MB |
| Hardcore, Gabber/Enzyme/enzyme024/b2_sei2ure_-_visual_contact.mp3 |
9.5 MB |
| Hardcore, Gabber/Enzyme/enzyme025/a1_ruffneck_and_ophidian_-_all_the_way_down.mp3 |
10.8 MB |
| Hardcore, Gabber/Enzyme/enzyme025/a2_ruffneck_and_ophidian_-_all_the_way_down_(mangled_by_nosf.mp3 |
9.5 MB |
| Hardcore, Gabber/Enzyme/enzyme025/b1_nosferatu_and_endymion_-_victorious.mp3 |
9.6 MB |
| Hardcore, Gabber/Enzyme/enzyme025/b2_nosferatu_and_endymion_-_victorious_(mangled_by_ruffneck_.mp3 |
8.9 MB |
| Hardcore, Gabber/Enzyme/enzyme026/00_weapon_x_-_money_is_power-(enzyme026)-vinyl-2007.m3u |
138 B |
| Hardcore, Gabber/Enzyme/enzyme026/00_weapon_x_-_money_is_power-(enzyme026)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Enzyme/enzyme026/00_weapon_x_-_money_is_power-(enzyme026)-vinyl-2007.sfv |
174 B |
| Hardcore, Gabber/Enzyme/enzyme026/a1_weapon_x_-_back_to_life.mp3 |
8.4 MB |
| Hardcore, Gabber/Enzyme/enzyme026/a2_weapon_x_-_take_that_shit_back.mp3 |
10 MB |
| Hardcore, Gabber/Enzyme/enzyme026/b1_weapon_x_-_coke_sniffer.mp3 |
8 MB |
| Hardcore, Gabber/Enzyme/enzyme026/b2_weapon_x_-_we_dont_give_a_fuck.mp3 |
9 MB |
| Hardcore, Gabber/Enzyme/enzyme027/a1_so many sacrifices.mp3 |
9.2 MB |
| Hardcore, Gabber/Enzyme/enzyme027/a2_so many sacrifices (intro-spective).mp3 |
2.3 MB |
| Hardcore, Gabber/Enzyme/enzyme027/b1_the chosen.mp3 |
9.6 MB |
| Hardcore, Gabber/Enzyme/enzyme027/b2_karmalucinogenicfx.mp3 |
8.4 MB |
| Hardcore, Gabber/Enzyme/enzyme028/a1_nosferatu-system_5601.mp3 |
10.7 MB |
| Hardcore, Gabber/Enzyme/enzyme028/a2_nosferatu-outshine_any_competition.mp3 |
8.2 MB |
| Hardcore, Gabber/Enzyme/enzyme028/b1_nosferatu-chronicles_of_a_freak.mp3 |
9 MB |
| Hardcore, Gabber/Enzyme/enzyme028/b2_nosferatu-running_interference.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/enzyme028/c1_nosferatu-bustin_the_crowd.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/enzyme028/c2_nosferatu-enemigo_del_estado.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme/enzyme028/d1_nosferatu-the_flames_of_your_righteous_anger.mp3 |
9.8 MB |
| Hardcore, Gabber/Enzyme/enzyme028/d2_nosferatu-outta_control.mp3 |
8.4 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd01/a1-project omeaga - prelipsis.mp3 |
3.9 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd01/a2-project omeaga - extermination.mp3 |
6.5 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd01/b1-project omeaga - we knew you'd fade up.mp3 |
4.8 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd01/b2-project omeaga - prozac attack (original).mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd02/a1-daryll bayes - s.y.n.e..mp3 |
7.2 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd02/a2-daryll bayes - eggs the flex morningsex.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd02/b1-ophidian - thresher (project omeaga remix).mp3 |
8.8 MB |
| Hardcore, Gabber/Enzyme Black Limited/bltd02/b2-project omeaga - antisound1.mp3 |
7.3 MB |
| Hardcore, Gabber/Enzyme K7/enzyme k7-7/a1_ruffneck_and_ophidian_-_fall_of_technarchy-sq.mp3 |
9.1 MB |
| Hardcore, Gabber/Enzyme K7/enzyme k7-7/b1_sei2ure_-_kaos_communication-sq.mp3 |
11.3 MB |
| Hardcore, Gabber/Enzyme VIP/exv007/00-enzyme_x-dissonant_poetry_vip-vinyl-2008-1real.m3u |
305 B |
| Hardcore, Gabber/Enzyme VIP/exv007/00-enzyme_x-dissonant_poetry_vip-vinyl-2008-1real.nfo |
9 KB |
| Hardcore, Gabber/Enzyme VIP/exv007/00-enzyme_x-dissonant_poetry_vip-vinyl-2008-1real.sfv |
339 B |
| Hardcore, Gabber/Enzyme VIP/exv007/a1-enzyme_x-dissonant_poetry_(second_verse_by_ophidian_and_ruffneck)-1real.mp3 |
8.6 MB |
| Hardcore, Gabber/Enzyme VIP/exv007/a2-enzyme_x-dissonant_poetry_(original_verse_by_enzyme_x)-1real.mp3 |
6 MB |
| Hardcore, Gabber/Enzyme VIP/exv007/b1-enzyme_x-dissonant_poetry_(third_verse_by_synapse_and_sei2ure)-1real.mp3 |
8.5 MB |
| Hardcore, Gabber/Enzyme VIP/exv007/b2-enzyme_x-dissonant_poetry_(fourth_verse_by_the_outside_agency)-1real.mp3 |
9.3 MB |
| Hardcore, Gabber/Enzyme X/enzyme x021/a1_enzyme_x_-_illuminati-sq.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme X/enzyme x021/b1_enzyme_x_-_hypothermia-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Enzyme X/enzyme x022/a1_enzyme_x_-_mastodont-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Enzyme X/enzyme x022/b1_enzyme_x_-_safelight-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Enzyme X/enzyme x023/Enzyme_X_-_Dreadlock__Sideburn-(ENZYME_X_23)-Vinyl-2006-SQ/00_enzyme_x_-_dreadlock__sideburn-(enzyme_x_23)-vinyl-2006.m3u |
55 B |
| Hardcore, Gabber/Enzyme X/enzyme x023/Enzyme_X_-_Dreadlock__Sideburn-(ENZYME_X_23)-Vinyl-2006-SQ/00_enzyme_x_-_dreadlock__sideburn-(enzyme_x_23)-vinyl-2006.nfo |
8 KB |
| Hardcore, Gabber/Enzyme X/enzyme x023/Enzyme_X_-_Dreadlock__Sideburn-(ENZYME_X_23)-Vinyl-2006-SQ/00_enzyme_x_-_dreadlock__sideburn-(enzyme_x_23)-vinyl-2006.sfv |
73 B |
| Hardcore, Gabber/Enzyme X/enzyme x023/Enzyme_X_-_Dreadlock__Sideburn-(ENZYME_X_23)-Vinyl-2006-SQ/a1_enzyme_x_-_dreadlock.mp3 |
6.1 MB |
| Hardcore, Gabber/Enzyme X/enzyme x023/Enzyme_X_-_Dreadlock__Sideburn-(ENZYME_X_23)-Vinyl-2006-SQ/b1_enzyme_x_-_sideburn.mp3 |
5.9 MB |
| Hardcore, Gabber/Enzyme X/enzyme x024/a1_enzyme_x_-_seconds_from_disaster.mp3 |
6.2 MB |
| Hardcore, Gabber/Enzyme X/enzyme x024/b1_enzyme_x_-_slurfdieren.mp3 |
6.9 MB |
| Hardcore, Gabber/Epileptik/epk001/A1 - Chappy Vs. Le Zinger - The Hard Disc Plumber.mp3 |
5 MB |
| Hardcore, Gabber/Epileptik/epk001/A2 - Chappy Vs. Le Zinger - Joint-Venture.mp3 |
5.2 MB |
| Hardcore, Gabber/Epileptik/epk001/B1 - Chappy Vs. Le Zinger - Degats Des Eaux.mp3 |
6.9 MB |
| Hardcore, Gabber/Epileptik/epk002/A1 - Al Tatone.mp3 |
6.1 MB |
| Hardcore, Gabber/Epileptik/epk002/A2 - Real Gore.mp3 |
5.2 MB |
| Hardcore, Gabber/Epileptik/epk002/B1 - Locked In Darkness.mp3 |
7.6 MB |
| Hardcore, Gabber/Epileptik/epk003/A1 - Radium - Epileptik Room.mp3 |
3.6 MB |
| Hardcore, Gabber/Epileptik/epk003/A2 - Radium - (We Live In) The Pit.mp3 |
4.6 MB |
| Hardcore, Gabber/Epileptik/epk003/B1 - Radium - Smiley Lsd.mp3 |
7.5 MB |
| Hardcore, Gabber/Epileptik/epk004/A1 - Laurent Charnier - Zozon Power.mp3 |
8.1 MB |
| Hardcore, Gabber/Epileptik/epk004/A2 - Laurent Charnier - Vip Land.mp3 |
7.7 MB |
| Hardcore, Gabber/Epileptik/epk004/B1 - Laurent Charnier - Masque De Fer.mp3 |
13.7 MB |
| Hardcore, Gabber/Epileptik/epk005/A1 - Sammy - Japstyle.mp3 |
10.9 MB |
| Hardcore, Gabber/Epileptik/epk005/A2 - Sammy - Follow Me.mp3 |
9.3 MB |
| Hardcore, Gabber/Epileptik/epk005/B1 - Sammy - Hooligan.mp3 |
16.8 MB |
| Hardcore, Gabber/Epileptik/epk006/A1 - Sarin Assault - Outer Limit.mp3 |
7.7 MB |
| Hardcore, Gabber/Epileptik/epk006/A2 - Sarin Assault - Crossover.mp3 |
8 MB |
| Hardcore, Gabber/Epileptik/epk006/B1 - Sarin Assault - Battle Of The Ukon Part 1 - The Attack.mp3 |
11.3 MB |
| Hardcore, Gabber/Epileptik/epk006/B2 - Sarin Assault - Ten.mp3 |
2.6 MB |
| Hardcore, Gabber/Epileptik/epk007/A1 - Dub Kamikaze Party - La Vanche Cui Tache.mp3 |
4.8 MB |
| Hardcore, Gabber/Epileptik/epk007/A2 - Dub Kamikaze Party - Sensi & Co.mp3 |
6 MB |
| Hardcore, Gabber/Epileptik/epk007/B1 - Dub Kamikaze Party - Electro Ganja.mp3 |
10.1 MB |
| Hardcore, Gabber/Epileptik/epk008/A1 - Art Is Anal - No Issue.mp3 |
3.9 MB |
| Hardcore, Gabber/Epileptik/epk008/A2 - Art Is Anal - Evacuation.mp3 |
4.9 MB |
| Hardcore, Gabber/Epileptik/epk008/B1 - Art Is Anal - New Tangor.mp3 |
8.3 MB |
| Hardcore, Gabber/Epileptik/epk010/A1 - Matt Green - Vhs.mp3 |
8.4 MB |
| Hardcore, Gabber/Epileptik/epk010/A2 - Matt Green - Retribution.mp3 |
8.1 MB |
| Hardcore, Gabber/Epileptik/epk010/B1 - Matt Green - Remind.mp3 |
15 MB |
| Hardcore, Gabber/Epileptik/epk011/A1 - Traffik - The Garden Of Flesh.mp3 |
2.1 MB |
| Hardcore, Gabber/Epileptik/epk011/A2 - Traffik - Resistance.mp3 |
7.3 MB |
| Hardcore, Gabber/Epileptik/epk011/B1 - Traffik - Jansky Noise.mp3 |
7.8 MB |
| Hardcore, Gabber/Epileptik/epk011/B2 - Traffik - Acidz.mp3 |
5.1 MB |
| Hardcore, Gabber/Epileptik/epk035/a1_doormouse_-_twelve_ft._shapeshifting_lizards_decending_from_outer_space-sq.mp3 |
8.8 MB |
| Hardcore, Gabber/Epileptik/epk035/b1_doormouse_-_waking_the_pig-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Epileptik/epk035/b2_doormouse_-_the_unbrakeable_breaks-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Epileptik/epk036/a1_al_core_feat._chappy_the_plumber_-_laisse_couler-sq.mp3 |
12 MB |
| Hardcore, Gabber/Epileptik/epk036/b1_al_core_feat._chappy_the_plumber_-_faux_contact-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Epileptik/epk036/b2_al_core_feat._chappy_the_plumber_-_joint_venture_2_eme_couche-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Epiteth/pth012/a1-radium-slave_(205bpm)-trt.mp3 |
7.2 MB |
| Hardcore, Gabber/Epiteth/pth012/a2-radium-cavern_(190bpm)-trt.mp3 |
9.6 MB |
| Hardcore, Gabber/Epiteth/pth012/b1-radium-disease_(224bpm)-trt.mp3 |
8.2 MB |
| Hardcore, Gabber/Epiteth/pth012/b2-radium-hlm_industries_(227bpm)-trt.mp3 |
7 MB |
| Hardcore, Gabber/f.o.g. records/f.o.g. 01 billy the kid 20000 tons hardcore obsession (12)/a1. billy the kid - 20000 tons.mp3 |
7.8 MB |
| Hardcore, Gabber/f.o.g. records/f.o.g. 01 billy the kid 20000 tons hardcore obsession (12)/b1. billy the kid - hardcore obsession.mp3 |
6.8 MB |
| Hardcore, Gabber/f.o.g. records/f.o.g. 02 billy the kid can u do it (12)/a1. billy the kid - can u do it.mp3 |
5.4 MB |
| Hardcore, Gabber/f.o.g. records/f.o.g. 02 billy the kid can u do it (12)/b1. billy the kid - clappin' your hands.mp3 |
4.8 MB |
| Hardcore, Gabber/Fifth Era/fe16/00_darkside_vs_fifth_era_-_no_quarter-(fe16)-vinyl-2006.m3u |
164 B |
| Hardcore, Gabber/Fifth Era/fe16/00_darkside_vs_fifth_era_-_no_quarter-(fe16)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Fifth Era/fe16/00_darkside_vs_fifth_era_-_no_quarter-(fe16)-vinyl-2006.sfv |
200 B |
| Hardcore, Gabber/Fifth Era/fe16/a1_darkside_vs_fifth_era_-_side_effect.mp3 |
5.4 MB |
| Hardcore, Gabber/Fifth Era/fe16/a2_darkside_vs_fifth_era_-_trouble.mp3 |
6 MB |
| Hardcore, Gabber/Fifth Era/fe16/b1_darkside_vs_fifth_era_-_war.mp3 |
6.6 MB |
| Hardcore, Gabber/Fifth Era/fe16/b2_darkside_vs_fifth_era_-_kill_to_protect.mp3 |
5.6 MB |
| Hardcore, Gabber/Fix Party/001/a1 - dj or-beat - world of terror.mp3 |
5.4 MB |
| Hardcore, Gabber/Fix Party/001/a2 - dj or-beat - life-repercussions.mp3 |
5 MB |
| Hardcore, Gabber/Fix Party/001/b1 - dj or-beat - fuck off pidoras.mp3 |
3.3 MB |
| Hardcore, Gabber/Fix Party/001/b2 - dj or-beat - pull da trigger.mp3 |
5.3 MB |
| Hardcore, Gabber/Fix Party/003/a1 - dj or-beat - low motherfucker [original mix].mp3 |
4.8 MB |
| Hardcore, Gabber/Fix Party/003/A2 - DJ Or-Beat - Low Motherfucker (Remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Fix Party/003/b1 - dj or-beat - world of terror [dj mon-e remix].mp3 |
5 MB |
| Hardcore, Gabber/Fix Party/003/b2 - dj or-beat - party.mp3 |
4.8 MB |
| Hardcore, Gabber/Fix Party/005/a1 - dj delirium - real raw underground (the blaster rmx) (f.mp3 |
5.9 MB |
| Hardcore, Gabber/Fix Party/005/b1 - dj delirium - this is not a game (the headbanger rmx) (.mp3 |
5.9 MB |
| Hardcore, Gabber/Fix Party/005/b2 - dj delirium - this is not a game (fixparty 005).mp3 |
4.7 MB |
| Hardcore, Gabber/Fix Party/008/a1_link_-_headnod_delivery-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Fix Party/008/a2_impulze_connection_and_hippy_-_greed-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Fix Party/008/b1_delta_9_-_stomp_your_feet-sq.mp3 |
5.7 MB |
| Hardcore, Gabber/Fix Party/008/b2_delirium_-_coming_out_your_speaker-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Forze/forze001/Forze DJ Team - Do It.mp3 |
1.8 MB |
| Hardcore, Gabber/Forze/forze001/Forze DJ Team - Get The Fuck Outta My Face.mp3 |
4.5 MB |
| Hardcore, Gabber/Forze/forze001/Forze DJ Team - Now Hear This.mp3 |
3.1 MB |
| Hardcore, Gabber/Forze/forze001/Forze DJ Team - Step The Fuck Off.mp3 |
3.1 MB |
| Hardcore, Gabber/Forze/forze001/Forze DJ Team - Sweat On My Balls.mp3 |
6.1 MB |
| Hardcore, Gabber/Forze/forze002/A1 - Eraserhead - Life Is A Mystery (Forze DJ Team Remix).mp3 |
2.9 MB |
| Hardcore, Gabber/Forze/forze002/B1 - Eraserhead - Life Is A Mystery (Neophyte Remix).mp3 |
4 MB |
| Hardcore, Gabber/Forze/forze003/a1-scott brown & dj paul - feel the music (original mix).mp3 |
6.3 MB |
| Hardcore, Gabber/Forze/forze003/b1-scott brown & dj paul - cheese 'n beats.mp3 |
3.7 MB |
| Hardcore, Gabber/Forze/forze003/b2-scott brown & dj paul - smoke this motherfucker.mp3 |
2.1 MB |
| Hardcore, Gabber/Forze/forze004/a1-rave nation - going crazy (forze dj team mix).mp3 |
4.7 MB |
| Hardcore, Gabber/Forze/forze004/b2-rave nation - going crazy (extended mix).mp3 |
3.3 MB |
| Hardcore, Gabber/Forze/forze005/a1-the nightraver & dj trevor - around the world (extended v.mp3 |
7.3 MB |
| Hardcore, Gabber/Forze/forze005/b1-the nightraver & dj trevor - around the world (radio vers.mp3 |
2.8 MB |
| Hardcore, Gabber/Forze/forze005/b2-the nightraver & dj trevor - the piano anthem (original v.mp3 |
3.9 MB |
| Hardcore, Gabber/Forze/forze006/a1-general noise - dance till i drop.mp3 |
6 MB |
| Hardcore, Gabber/Forze/forze006/a2-general noise - pump this groove.mp3 |
6.1 MB |
| Hardcore, Gabber/Forze/forze006/b1-general noise - wanna rock your body.mp3 |
6 MB |
| Hardcore, Gabber/Forze/forze006/b2-general noise - jump + go.mp3 |
6.4 MB |
| Hardcore, Gabber/Forze/forze007/b1-big deal - a chance to dance.mp3 |
5.3 MB |
| Hardcore, Gabber/Forze/forze007/b2-big deal - (better start to) move!.mp3 |
5.5 MB |
| Hardcore, Gabber/Forze/forze007/b3-big deal - a better way.mp3 |
5.4 MB |
| Hardcore, Gabber/Forze/forze008/a1-forze dj team - move.mp3 |
4.7 MB |
| Hardcore, Gabber/Forze/forze008/a2-forze dj team - fresh song.mp3 |
4.5 MB |
| Hardcore, Gabber/Forze/forze008/a3-forze dj team - one of the two.mp3 |
5.1 MB |
| Hardcore, Gabber/Forze/forze008/b1-forze dj team - dope jam.mp3 |
4.8 MB |
| Hardcore, Gabber/Forze/forze009/a2-hard creation - bust this beat.mp3 |
2.5 MB |
| Hardcore, Gabber/Forze/forze020/a1-dj paul & urban menace - blackout.mp3 |
5.5 MB |
| Hardcore, Gabber/Forze/forze020/a2-dj paul & urban menace - blackout (acapella).mp3 |
2.4 MB |
| Hardcore, Gabber/Forze/forze020/b1-dj paul & urban menace - psycho killer.mp3 |
8.8 MB |
| Hardcore, Gabber/Forze/forze020/b2-dj paul & urban menace - trick or treath.mp3 |
5.1 MB |
| Hardcore, Gabber/Forze/forze021/A1 - Dj Paul Vs. Dj Panic - Hate!.mp3 |
5.4 MB |
| Hardcore, Gabber/Forze/forze023/A1- DJ Paul & Teenage Warning - If da Kidz are United (DJ Pa.mp3 |
6.9 MB |
| Hardcore, Gabber/Forze/forze023/A2- DJ Paul & Teenage Warning - If da Kidz are United (DJ Is.MP3 |
4.2 MB |
| Hardcore, Gabber/Forze/forze023/B1- DJ Paul & Teenage Warning - Brohymn.mp3 |
7.9 MB |
| Hardcore, Gabber/Forze/forze023/B2- DJ Paul - Rockin' Beats.mp3 |
7.8 MB |
| Hardcore, Gabber/Forze/forze024/A1 - Hard Creation - Bastard Asshole.mp3 |
5.7 MB |
| Hardcore, Gabber/Forze/forze024/B1 - Hard Creation - Lets Get The All.mp3 |
3.6 MB |
| Hardcore, Gabber/Forze/forze024/B2 - Hard Creation - Rulers Of The Underground.mp3 |
4.3 MB |
| Hardcore, Gabber/Forze/forze025/(FORZE025-a2) Scott Brown - Do You Want It.mp3 |
7.8 MB |
| Hardcore, Gabber/Forze/forze025/A1 Scott Brown - King of the Beatz.mp3 |
7.2 MB |
| Hardcore, Gabber/Forze/forze025/B1 Scott Brown - Turn The Bass Up.mp3 |
5.4 MB |
| Hardcore, Gabber/Forze/forze025/B2 Scott Brown - They Know What is What.mp3 |
5.5 MB |
| Hardcore, Gabber/Forze/forze026/a1_DJ_Ruboy_Vs_Markos_13_-_DJ_Ruboy_Vs_Markos_13_-_Distort_O.mp3 |
6.9 MB |
| Hardcore, Gabber/Forze/forze026/b2_DJ_Ruboy_Vs_Markos_13_-_DJ_Ruboy_Vs_Markos_13_-_Nothing_C.mp3 |
7.8 MB |
| Hardcore, Gabber/Forze/forze027/(FORZE027-a1) Scott Brown - Joints to Rock.mp3 |
6.6 MB |
| Hardcore, Gabber/Forze/forze027/(FORZE027-a2) Scott Brown - Blow Ya To Pieces.mp3 |
7.2 MB |
| Hardcore, Gabber/Forze/forze027/(FORZE027-b1) Scott Brown - Live Forever.mp3 |
7 MB |
| Hardcore, Gabber/Forze/forze027/(FORZE027-b2) Scott Brown - May Your Mother Die (Feat. DJ Pa.mp3 |
6.6 MB |
| Hardcore, Gabber/Forze/forze028/a1 fear of death.mp3 |
7.8 MB |
| Hardcore, Gabber/Forze/forze028/a2 hardcore worldwide.mp3 |
5.6 MB |
| Hardcore, Gabber/Forze/forze028/b1 pussy ass punks.mp3 |
8 MB |
| Hardcore, Gabber/Forze/forze028/b2 pump up the bass.mp3 |
7.6 MB |
| Hardcore, Gabber/Forze/forze028/b3 d.i.e..mp3 |
7.5 MB |
| Hardcore, Gabber/Forze/forze029/a1-baco brothers - cant stop (the viper & reactor remix).mp3 |
7 MB |
| Hardcore, Gabber/Forze/forze029/b1-baco brothers - cant stop (original mix).mp3 |
7.5 MB |
| Hardcore, Gabber/Forze/forze029/b2-baco brothers - bounce.mp3 |
7.4 MB |
| Hardcore, Gabber/Forze/forze030/a1-elite forces - stress your brain.mp3 |
7.6 MB |
| Hardcore, Gabber/Forze/forze030/a2-elite forces - eternal battle.mp3 |
8.3 MB |
| Hardcore, Gabber/Forze/forze030/b1-elite forces - retaliate with hate.mp3 |
7.9 MB |
| Hardcore, Gabber/Forze/forze030/b2-elite forces - time.mp3 |
6.9 MB |
| Hardcore, Gabber/Forze/forze031/a1-scott brown - the old to the new.mp3 |
8.8 MB |
| Hardcore, Gabber/Forze/forze031/b1-scott brown - rock the house.mp3 |
7.9 MB |
| Hardcore, Gabber/Forze/forze031/b2-scott brown - fuck you up.mp3 |
8.7 MB |
| Hardcore, Gabber/Fuck Off/fk003/a1 Out of mind.mp3 |
9.1 MB |
| Hardcore, Gabber/Fuck Off/fk003/Cheepers Creepers - Gabber Coming Up.mp3 |
5 MB |
| Hardcore, Gabber/Fuck Off/fk010/a1-maken_clap_to_this-doc.mp3 |
8.9 MB |
| Hardcore, Gabber/Fuck Off/fk010/a2-dragon_x-doc.mp3 |
7.2 MB |
| Hardcore, Gabber/Fuck Off/fk010/b1-fuck_off_theme-doc.mp3 |
8 MB |
| Hardcore, Gabber/Fuck Off/fk010/b2-drum_control-doc.mp3 |
7 MB |
| Hardcore, Gabber/Fuck Off/fk018/00-dj_thunder-thunder_e.p._(fk018)-vinyl-2008.m3u |
140 B |
| Hardcore, Gabber/Fuck Off/fk018/00-dj_thunder-thunder_e.p._(fk018)-vinyl-2008.nfo |
713 B |
| Hardcore, Gabber/Fuck Off/fk018/00-dj_thunder-thunder_e.p._(fk018)-vinyl-2008.sfv |
176 B |
| Hardcore, Gabber/Fuck Off/fk018/01-dj_thunder-gimme_a_fat_beat.mp3 |
7.8 MB |
| Hardcore, Gabber/Fuck Off/fk018/02-dj_thunder-under_violence.mp3 |
7.5 MB |
| Hardcore, Gabber/Fuck Off/fk018/03-dj_thunder-deep_got_it.mp3 |
7.4 MB |
| Hardcore, Gabber/Fuck Off/fk018/04-dj_thunder-back_to_the_drop_up.mp3 |
8.8 MB |
| Hardcore, Gabber/Furious Vinyl/fv004/Hocus Pocus - Bow Chi Bow (Chopped up Dummydoll).mp3 |
9.5 MB |
| Hardcore, Gabber/Furious Vinyl/fv004/Hocus Pocus - Bow Chi Bow (Fossil File 1632).mp3 |
8.8 MB |
| Hardcore, Gabber/Furious Vinyl/fv004/Hocus Pocus - Bow Chi Bow (Vicious Butterdrops).mp3 |
8 MB |
| Hardcore, Gabber/G-Net/gn014/00-the_genesis_projection-the_secret_doctrine_ep_(gn014)-vinyl-2007-front.jpg |
394 KB |
| Hardcore, Gabber/G-Net/gn014/00-the_genesis_projection-the_secret_doctrine_ep_(gn014)-vinyl-2007.m3u |
190 B |
| Hardcore, Gabber/G-Net/gn014/00-the_genesis_projection-the_secret_doctrine_ep_(gn014)-vinyl-2007.nfo |
987 B |
| Hardcore, Gabber/G-Net/gn014/00-the_genesis_projection-the_secret_doctrine_ep_(gn014)-vinyl-2007.sfv |
226 B |
| Hardcore, Gabber/G-Net/gn014/01-a1_the_genesis_projection-original_crime.mp3 |
6.6 MB |
| Hardcore, Gabber/G-Net/gn014/02-a2_the_genesis_projection-pump_please.mp3 |
7.2 MB |
| Hardcore, Gabber/G-Net/gn014/03-b1_the_genesis_projection-sdl_inspiration.mp3 |
7.4 MB |
| Hardcore, Gabber/G-Net/gn014/04-b2_the_genesis_projection-brain_insanity.mp3 |
7.1 MB |
| Hardcore, Gabber/G-Net/gn015/00-braincrushers-little_asses_(gn015)-vinyl-2007.m3u |
150 B |
| Hardcore, Gabber/G-Net/gn015/00-braincrushers-little_asses_(gn015)-vinyl-2007.nfo |
966 B |
| Hardcore, Gabber/G-Net/gn015/00-braincrushers-little_asses_(gn015)-vinyl-2007.sfv |
190 B |
| Hardcore, Gabber/G-Net/gn015/01-a1_braincrushers-little_asses.mp3 |
5.6 MB |
| Hardcore, Gabber/G-Net/gn015/02-a2_braincrushers-you_can_call_me_hardcore.mp3 |
8.2 MB |
| Hardcore, Gabber/G-Net/gn015/03-b1_braincrushers-auflegen.mp3 |
6.1 MB |
| Hardcore, Gabber/G-Net/gn015/04-b2_braincrushers-diieee.mp3 |
7.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/a1 - Dj Ruffneck - The Enemy.mp3 |
9.5 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/a2 - Hyperion - Voodoo Magic.mp3 |
6.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/b1 - Trickster - Express My Soul.mp3 |
6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/b2 - Myztic Vs. Myrmidon - Pop Goes Da Pistol.mp3 |
6.8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/c1 - Knightvision - Mindwar.mp3 |
7.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/c2 - Syphax - The Signal.mp3 |
6.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/d1 - Nosferatu - Karma.mp3 |
5.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g050-5/d2 - D'Spyre - Frightnight.mp3 |
9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g052-5l/a1 - Comababy - Soul Eater Lvl. 13.mp3 |
5.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g052-5l/a2 - Comababy - Rave Racer.mp3 |
5.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g052-5l/b1 - Myztic - Unacceptable.mp3 |
6.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g052-5l/b2 - Dj Ruffneck - So Bright.mp3 |
6.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g053-5/a1 - Nosferatu - The Essence.mp3 |
6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g053-5/a2 - Nosferatu - Eternal Life.mp3 |
3.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g053-5/b1 - Nosferatu - Turntable Action.mp3 |
6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g053-5/b2 - Nosferatu - Ruff Destruction.mp3 |
4.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g054-5/a1 - Hyperion - Always Respec' !.mp3 |
4.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g054-5/a2 - Hyperion - Danger Zone.mp3 |
1.4 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g054-5/b1 - Hyperion - Ruffneck Reality.mp3 |
4.3 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g054-5/b2 - Hyperion - Gunshot Maniac.mp3 |
5.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g055-5/a1 - Wedlock - Evolution Theory.mp3 |
7.8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g055-5/a2 - Wedlock - My Mind Exposed....mp3 |
2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g055-5/b1 - Wedlock - The Genesis!.mp3 |
8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g055-5/b2 - Wedlock - Circuit.mp3 |
10.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g056-5/a1 - Syphax - Peaceful Mind.mp3 |
4.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g056-5/a2 - Syphax - Surrondings In Blue.mp3 |
2.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g056-5/b1 - Syphax - Autosequence.mp3 |
6.8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g056-5/b2 - Syphax - Black Fog.mp3 |
6.4 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g058-5/a1 - Trypticon - Soul Reaver.mp3 |
4.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g058-5/a2 - Trypticon - Sumtimez.mp3 |
2.5 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g058-5/b1 - Trypticon - Mixmasta.mp3 |
4.3 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g058-5/b2 - Trypticon - Step Aside!.mp3 |
7.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g059-5/a1 - Knightvision Vs. Wedlock - The Holy Kingdom.mp3 |
5.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g059-5/a2 - Knightvision Vs. Wedlock - Wayz Of The Core (Preparation).mp3 |
2.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g059-5/b1 - Knightvision Vs. Wedlock - Wayz Of The Core (Teaching).mp3 |
5.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g059-5/b2 - Knightvision Vs. Wedlock - Territorial Rape.mp3 |
7.3 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g060-5/a1 - Trypticon - Shotz On Five.mp3 |
6.5 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g060-5/a2 - Trypticon - Nocturnal.mp3 |
3.3 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g060-5/b1 - Trypitcon - The Universe.mp3 |
7.8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g060-5/b2 - Trypticon - Industrial Evolution.mp3 |
7.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/a1 - Wedlock & Nosferatu - Bullitproof.mp3 |
4.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/a2 - Wedlock & Nosferatu - Fingerprintz.mp3 |
4.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/b1 - Endymion - The Power To Forget.mp3 |
4.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/b2 - Endymion - In The Year 2003.mp3 |
6.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/c1 - Freax - U'll Never Be.mp3 |
7.4 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/c2 - Freax - Behold My Soul.mp3 |
5.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/d1 - Trypticon - Tryp To Da Sub.mp3 |
4.5 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g061/d2 - Trypticon - (There Is No) Me & You.mp3 |
4.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/01 - Knighvision Vs. Wedlock - The Holy Kingdom.mp3 |
8.5 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/02 - Trypticon - Soul Reaver.mp3 |
7.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/03 - Trypticon - (There Is No) Me & You.mp3 |
5.4 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/04 - Freax - Behold My Soul.mp3 |
8.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/05 - Endymion - In The Year 2003.mp3 |
8.3 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/06 - Knighvision Vs. Wedlock - Fingerprintz.mp3 |
7.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/07 - Trypticon - Mixmasta.mp3 |
6.4 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/08 - Knighvision Vs. Wedlock - Ways Of The Core.mp3 |
7.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/09 - Freax - U'll Never Be.mp3 |
8.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/10 - Trypticon - Tryp To The Sub.mp3 |
8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/11 - Trypticon - The Universe (Core Edit).mp3 |
6.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/12 - Endymion - The Power To Forget.mp3 |
6.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/13 - Knighvision Vs. Wedlock - Bullitproof.mp3 |
6.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g062/14 - Trypticon - Shotz On Five (Core Edit).mp3 |
5.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g063/a1 - Wedlock & Nosferatu - Fingerprintz (Nosferatu Remix).mp3 |
7.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g063/a2 - Wedlock & Nosferatu - Fingerprintz (Freax Remix).mp3 |
6.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g063/b1 - Wedlock & Nosferatu - Fingerprintz (Endymion Remix).mp3 |
8.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g063/b2 - Wedlock & Nosferatu - Fingerprintz (Original Mix).mp3 |
3.4 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/a1 - Nosferatu - The Prayer.mp3 |
9.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/a2 - D'Spyre & Nosferatu - Bitstream.mp3 |
6.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/b1 - Nosferatu - Up The Drumz.mp3 |
7.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/b2 - Myztic - Unacceptable (Endymion Remix).mp3 |
8.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/c1 - Nosferatu - Human Experiments.mp3 |
8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/c2 - Nosferatu - Language Of Rhythm.mp3 |
9.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/d1 - Nosferatu - The Desolate One.mp3 |
8.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g064/d2 - Myztic & Myrmidon - Pop Goes Da Pistol (J.D.A. Remix).mp3 |
7.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/01 - Nosferatu - Human Experiments.mp3 |
8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/02 - Nosferatu - The Desolate One.mp3 |
8.7 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/03 - Wedlock & Nosferatu - Fingerprintz (Remix).mp3 |
8.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/04 - Nosferatu - Pop Goes The Pistol (J.D.A. Remix).mp3 |
7.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/05 - Nnosferatu - Fuck The Prejudice.mp3 |
11.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/06 - Nosferatu - The Prayer.mp3 |
9.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/07 - Nosferatu - Unacceptable (Endymion Remix).mp3 |
8.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/08 - Nosferatu - Up The Drumz.mp3 |
7.9 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/09 - D'Spyre & Nosferatu - Bitstream.mp3 |
6.6 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/10 - Nosferatu - Unleash The Fury.mp3 |
9.3 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/11 - Nosferatu - The Future (Evil Activities Remix).mp3 |
7.8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g065/12 - Nosferatu - Language Of Rhythm.mp3 |
9.1 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g066/a1 - Nosferatu - Fuck The Prejudice.mp3 |
11.2 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g066/b1 - Nosferatu - The Future (Evil Activities Remix).mp3 |
7.8 MB |
| Hardcore, Gabber/Gangsta Audiovisuals/g066/b2 - Nosferatu - Unleash The Fury.mp3 |
9.3 MB |
| Hardcore, Gabber/Genosha/gen004/[a1] the enticer - strengthening hate.mp3 |
7.8 MB |
| Hardcore, Gabber/Genosha/gen004/[a2] the enticer - self analysis (the outside agency remix).mp3 |
9.8 MB |
| Hardcore, Gabber/Genosha/gen004/[b1] the enticer - self analysis.mp3 |
8.9 MB |
| Hardcore, Gabber/Genosha/gen004/[b2] the enticer - show no remorse.mp3 |
8.9 MB |
| Hardcore, Gabber/Genosha/gen012/a1_the_outside_agency_-_pure_darkness-sq.mp3 |
10.6 MB |
| Hardcore, Gabber/Genosha/gen012/a2_the_outside_agency_-_the_smog_sin_and_the_omen_sights-sq.mp3 |
11 MB |
| Hardcore, Gabber/Genosha/gen012/b1_the_outside_agency_-_the_new_master-sq.mp3 |
10.4 MB |
| Hardcore, Gabber/Genosha/gen012/b2_the_outside_agency_-_sithspawn-sq.mp3 |
11.2 MB |
| Hardcore, Gabber/Genosha/gen013/00_the_outside_agency_-_the_easy_money_remix_ep-(gen013)-vinyl-2007.m3u |
528 B |
| Hardcore, Gabber/Genosha/gen013/00_the_outside_agency_-_the_easy_money_remix_ep-(gen013)-vinyl-2007.nfo |
8 KB |
| Hardcore, Gabber/Genosha/gen013/00_the_outside_agency_-_the_easy_money_remix_ep-(gen013)-vinyl-2007.sfv |
600 B |
| Hardcore, Gabber/Genosha/gen013/a1_the_outside_agency_-_machine_slavery_(chaosbringer_remix).mp3 |
9.9 MB |
| Hardcore, Gabber/Genosha/gen013/a2_the_outside_agency_-_the_prophet_of_rage_(fracture_4_remix).mp3 |
7.8 MB |
| Hardcore, Gabber/Genosha/gen013/b1_the_outside_agency_-_antichrist_rip_(the_dj_producers_visions_of_angels_remix).mp3 |
10.2 MB |
| Hardcore, Gabber/Genosha/gen013/b2_the_outside_agency_-_frack_(ophidian_refrack).mp3 |
10.1 MB |
| Hardcore, Gabber/Genosha/gen013/c1_the_outside_agency_-_black_lectroid_(nosferatus_tasteful_grey_remix).mp3 |
10.4 MB |
| Hardcore, Gabber/Genosha/gen013/c2_the_outside_agency_-_dirty_(perverted_mindustries_remix).mp3 |
8.1 MB |
| Hardcore, Gabber/Genosha/gen013/d1_the_outside_agency_-_sithspawn_(petrochemical_remix).mp3 |
10.5 MB |
| Hardcore, Gabber/Genosha/gen013/d2_the_outside_agency_-_submerger_(dr_strange_remix).mp3 |
9.5 MB |
| Hardcore, Gabber/Genosha/gen014/a1-the_outside_agency-the_alchemists-1real.mp3 |
9.5 MB |
| Hardcore, Gabber/Genosha/gen014/a2-the_outside_agency-alchemy-1real.mp3 |
2.6 MB |
| Hardcore, Gabber/Genosha/gen014/b-the_outside_agency-the_spooks-1real.mp3 |
12.7 MB |
| Hardcore, Gabber/Goddess Of Disaster/god006/00-noizefucker-clean_the_electric_oceaan-(god006)-vinyl-2006-1real.m3u |
249 B |
| Hardcore, Gabber/Goddess Of Disaster/god006/00-noizefucker-clean_the_electric_oceaan-(god006)-vinyl-2006-1real.nfo |
7 KB |
| Hardcore, Gabber/Goddess Of Disaster/god006/00-noizefucker-clean_the_electric_oceaan-(god006)-vinyl-2006-1real.sfv |
303 B |
| Hardcore, Gabber/Goddess Of Disaster/god006/a1-noizefucker-le_contact-1real.mp3 |
10 MB |
| Hardcore, Gabber/Goddess Of Disaster/god006/a2-noizefucker-electric_waves-1real.mp3 |
6.8 MB |
| Hardcore, Gabber/Goddess Of Disaster/god006/a3-noizefucker_and_hellseeker-ardweez-1real.mp3 |
7.2 MB |
| Hardcore, Gabber/Goddess Of Disaster/god006/b1-noizefucker-ergens_in_de_oceaan-1real.mp3 |
9.4 MB |
| Hardcore, Gabber/Goddess Of Disaster/god006/b2-noizefucker-clean_the_lines-1real.mp3 |
8.7 MB |
| Hardcore, Gabber/Goddess Of Disaster/god006/b3-noizefucker-dodge_bullets-1real.mp3 |
7.9 MB |
| Hardcore, Gabber/Goddess Of Disaster/god007/00_va-masters_of_disaster-(god007)-vinyl-2007-ct.m3u |
147 B |
| Hardcore, Gabber/Goddess Of Disaster/god007/00_va-masters_of_disaster-(god007)-vinyl-2007-ct.nfo |
10 KB |
| Hardcore, Gabber/Goddess Of Disaster/god007/00_va-masters_of_disaster-(god007)-vinyl-2007-ct.sfv |
183 B |
| Hardcore, Gabber/Goddess Of Disaster/god007/a1_fabio-under_wave-ct.mp3 |
9.8 MB |
| Hardcore, Gabber/Goddess Of Disaster/god007/a2_angeroid-coming_on_strong-ct.mp3 |
7.4 MB |
| Hardcore, Gabber/Goddess Of Disaster/god007/b1_the_hardcoholics_vs_tmlp-you_stink-ct.mp3 |
11.4 MB |
| Hardcore, Gabber/Goddess Of Disaster/god007/b2_the_hardcoholics-no_mistakes-ct.mp3 |
12.6 MB |
| Hardcore, Gabber/Goddess Of Disaster/god008/00_moleculez_-_made_4_air_guitar_contests-(god008)-vinyl-2008.m3u |
126 B |
| Hardcore, Gabber/Goddess Of Disaster/god008/00_moleculez_-_made_4_air_guitar_contests-(god008)-vinyl-2008.nfo |
7 KB |
| Hardcore, Gabber/Goddess Of Disaster/god008/00_moleculez_-_made_4_air_guitar_contests-(god008)-vinyl-2008.sfv |
162 B |
| Hardcore, Gabber/Goddess Of Disaster/god008/a1_moleculez_-_hell_machine.mp3 |
13.5 MB |
| Hardcore, Gabber/Goddess Of Disaster/god008/a2_moleculez_-_klingon.mp3 |
9.7 MB |
| Hardcore, Gabber/Goddess Of Disaster/god008/b1_moleculez_-_powerplay.mp3 |
11.7 MB |
| Hardcore, Gabber/Goddess Of Disaster/god008/b2_moleculez_-_machine_glitch.mp3 |
9.6 MB |
| Hardcore, Gabber/Gunpowder/gpw005/00-coresickness_-_your_sickness_not_mine_(gpw005)_proper-vinyl-2007-nbd.m3u |
253 B |
| Hardcore, Gabber/Gunpowder/gpw005/00-coresickness_-_your_sickness_not_mine_(gpw005)_proper-vinyl-2007-nbd.nfo |
10 KB |
| Hardcore, Gabber/Gunpowder/gpw005/00-coresickness_-_your_sickness_not_mine_(gpw005)_proper-vinyl-2007-nbd.sfv |
303 B |
| Hardcore, Gabber/Gunpowder/gpw005/00-coresickness_-_your_sickness_not_mine_(gpw005)_proper-vinyl-2007-proof-nbd.jpg |
239 KB |
| Hardcore, Gabber/Gunpowder/gpw005/01-coresickness_-_the_blackmailing_process-nbd.mp3 |
7.3 MB |
| Hardcore, Gabber/Gunpowder/gpw005/02-coresickness_-_the_other_side-nbd.mp3 |
10.1 MB |
| Hardcore, Gabber/Gunpowder/gpw005/03-coresickness_-_d.e.u.s._(featuring_wasted_audio)-nbd.mp3 |
8.8 MB |
| Hardcore, Gabber/Gunpowder/gpw005/04-coresickness_-_no_longer_among_us_(dedicated_to_svdd)-nbd.mp3 |
7.1 MB |
| Hardcore, Gabber/Gunpowder/gpw005/05-coresickness_-_das_engel-nbd.mp3 |
8 MB |
| Hardcore, Gabber/Gunpowder/Techmaticore/tmc001/00_va_-_techmaticore-(tmc001)-vinyl-2007.m3u |
148 B |
| Hardcore, Gabber/Gunpowder/Techmaticore/tmc001/00_va_-_techmaticore-(tmc001)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Gunpowder/Techmaticore/tmc001/00_va_-_techmaticore-(tmc001)-vinyl-2007.sfv |
184 B |
| Hardcore, Gabber/Gunpowder/Techmaticore/tmc001/a1_sarin_assault_-_the_4_shadows.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/(h2o 08) - queens boro crew - drop da noise/_h2o 08 (front).jpg |
38 KB |
| Hardcore, Gabber/H2oH/(h2o 08) - queens boro crew - drop da noise/a1 - queens boro crew - drop da noise.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/(h2o 08) - queens boro crew - drop da noise/a2 - queens boro crew - criminal minded.mp3 |
4.6 MB |
| Hardcore, Gabber/H2oH/(h2o 08) - queens boro crew - drop da noise/b1 - queens boro crew - hype the funk.mp3 |
4.4 MB |
| Hardcore, Gabber/H2oH/(h2o 08) - queens boro crew - drop da noise/b2 - queens boro crew - the paradox.mp3 |
3.4 MB |
| Hardcore, Gabber/H2oH/h2o 72 - nyocore vs the guardian - the world has changed/a1 - nyocore vs the guardian - the world has changed.mp3 |
9 MB |
| Hardcore, Gabber/H2oH/h2o 72 - nyocore vs the guardian - the world has changed/a2 - nyocore vs the guardian - nail at your door.mp3 |
9.6 MB |
| Hardcore, Gabber/H2oH/h2o 72 - nyocore vs the guardian - the world has changed/b1 - nyocore vs the guardian - new line.mp3 |
10.2 MB |
| Hardcore, Gabber/H2oH/h2o 72 - nyocore vs the guardian - the world has changed/b2 - nyocore vs the guardian - brutal death.mp3 |
8.9 MB |
| Hardcore, Gabber/H2oH/h2o 76 - omar santana vs nyocore - don't lie to me/a1 - omar santana vs nyocore - don't lie to me.mp3 |
8.7 MB |
| Hardcore, Gabber/H2oH/h2o 76 - omar santana vs nyocore - don't lie to me/b1 - omar santana vs nyocore - no mercy.mp3 |
8.4 MB |
| Hardcore, Gabber/H2oH/h2o 76 - omar santana vs nyocore - don't lie to me/b2 - omar santana vs nyocore - toe tappin' muther fucker.mp3 |
9 MB |
| Hardcore, Gabber/H2oH/h2oh002/(a1) omar santana - mind bender.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/h2oh002/(a2) omar santana - edit madness.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/h2oh002/(a3) omar santana - downtime.mp3 |
6 MB |
| Hardcore, Gabber/H2oH/h2oh002/(b1) omar santana - synth tox.mp3 |
6.8 MB |
| Hardcore, Gabber/H2oH/h2oh002/(b2) omar santana - vibin'.mp3 |
6.3 MB |
| Hardcore, Gabber/H2oH/h2oh002/(b3) omar santana - da dope riddim.mp3 |
8.3 MB |
| Hardcore, Gabber/H2oH/h2oh004/a1 omar santana - oh fuc he's back mix.mp3 |
11.8 MB |
| Hardcore, Gabber/H2oH/h2oh004/a2 omar santana - lenny's demonic dee mix.mp3 |
10.7 MB |
| Hardcore, Gabber/H2oH/h2oh004/b1 omar santana - brooklyn bound mix.mp3 |
9 MB |
| Hardcore, Gabber/H2oH/h2oh004/b2 omar santana - the fuc'd up mix.mp3 |
9.7 MB |
| Hardcore, Gabber/H2oH/h2oh005/a1.oh bonic - respeck da tec.mp3 |
6.6 MB |
| Hardcore, Gabber/H2oH/h2oh008/A1.Queens Boro Crew - Drop Da Noise.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh008/A2.Queens Boro Crew - Criminal Minded.mp3 |
4.6 MB |
| Hardcore, Gabber/H2oH/h2oh008/B1.Queens Boro Crew - Hype the Funk.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh008/B2.Queens Boro Crew - The Paradox.mp3 |
3.4 MB |
| Hardcore, Gabber/H2oH/h2oh009/a1 Wizard Of Oh.mp3 |
7.1 MB |
| Hardcore, Gabber/H2oH/h2oh009/a2 Boy Is Banging.mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh009/b1 Bass Keeps Pumping.mp3 |
6.8 MB |
| Hardcore, Gabber/H2oH/h2oh009/b2 Bass Keeps Pumping (Pump It Harder Remix).mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh011/A1-Short Fuse.mp3 |
4.1 MB |
| Hardcore, Gabber/H2oH/h2oh011/A2-The Beast.mp3 |
4 MB |
| Hardcore, Gabber/H2oH/h2oh011/B1-Hellbound Terror.mp3 |
4.3 MB |
| Hardcore, Gabber/H2oH/h2oh011/B2-Just Buggin'.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh014/A1 -Omar Santana - You Shall Die.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh014/A2 - Omar Santana - Rebel To The Cause.mp3 |
4.7 MB |
| Hardcore, Gabber/H2oH/h2oh014/B1 - Omar Santana - Vitamin Oh.mp3 |
4.6 MB |
| Hardcore, Gabber/H2oH/h2oh014/B2 - Omar Santana - The Vulture.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh016/a1-bone bastik.mp3 |
4.9 MB |
| Hardcore, Gabber/H2oH/h2oh016/a2-ready to brain bash.mp3 |
3.1 MB |
| Hardcore, Gabber/H2oH/h2oh017/a1 how it sounds (oh oh omar mix).mp3 |
6.6 MB |
| Hardcore, Gabber/H2oH/h2oh017/a2 how it sounds.mp3 |
5.3 MB |
| Hardcore, Gabber/H2oH/h2oh017/b1 destroy your mind.mp3 |
6 MB |
| Hardcore, Gabber/H2oH/h2oh017/b2 rockin again.mp3 |
5.6 MB |
| Hardcore, Gabber/H2oH/h2oh018/(a1) omar santana - mind ripper.mp3 |
6.6 MB |
| Hardcore, Gabber/H2oH/h2oh018/(a2) omar santana - brute force.mp3 |
5.5 MB |
| Hardcore, Gabber/H2oH/h2oh018/(b1) omar santana - oh bad boy.mp3 |
5.9 MB |
| Hardcore, Gabber/H2oH/h2oh018/(b2) omar santana - hardcore moederneuker.mp3 |
5.2 MB |
| Hardcore, Gabber/H2oH/h2oh019/omar santana - bass keeps pumpin' (the scrumbleheads remix).mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh019/omar santana - da joint (oh oh omar santana remix).mp3 |
4.9 MB |
| Hardcore, Gabber/H2oH/h2oh019/omar santana - quick fix (dj jokey remix).mp3 |
4.1 MB |
| Hardcore, Gabber/H2oH/h2oh019/omar santana - quick fix (original mix).mp3 |
3.8 MB |
| Hardcore, Gabber/H2oH/h2oh019/omar santana - quick fix (the horrorist remix).mp3 |
4 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (darrien kelly mix).mp3 |
6.6 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (dj paul mix).mp3 |
6.6 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (frankie bones mix).mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (lenny dee mix).mp3 |
7 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (oh oh's fuked up mix).mp3 |
8.1 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (original '94 mix).mp3 |
7.5 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (rob gee mix).mp3 |
6.2 MB |
| Hardcore, Gabber/H2oH/h2oh020/00 - omar santana - step the fuk back (the prophet mix).mp3 |
5.9 MB |
| Hardcore, Gabber/H2oH/h2oh021/(a1) the prophet, omar santana - power pill.mp3 |
7.1 MB |
| Hardcore, Gabber/H2oH/h2oh021/(a2) the prophet, omar santana - masterminds.mp3 |
6.6 MB |
| Hardcore, Gabber/H2oH/h2oh021/(b1) the prophet, omar santana - old to da new (the prophet remix).mp3 |
8 MB |
| Hardcore, Gabber/H2oH/h2oh021/(b2) the prophet, omar santana - old to da new (oh oh mar remix).mp3 |
7.5 MB |
| Hardcore, Gabber/H2oH/h2oh025/h2oh 027 - da predator - elementz of danger/A1. Da Predator - Elementz of Danger.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/h2oh025/h2oh 027 - da predator - elementz of danger/A2. Da Predator - 20000 Hardcore Members.mp3 |
11.1 MB |
| Hardcore, Gabber/H2oH/h2oh025/h2oh 027 - da predator - elementz of danger/B1. Da Predator - Wild Stylz.mp3 |
9.3 MB |
| Hardcore, Gabber/H2oH/h2oh025/(a1) the thundergods - intro.mp3 |
1.2 MB |
| Hardcore, Gabber/H2oH/h2oh025/(a2) the thundergods - my dj.mp3 |
5 MB |
| Hardcore, Gabber/H2oH/h2oh025/(a3) the thundergods - frequency.mp3 |
5.3 MB |
| Hardcore, Gabber/H2oH/h2oh025/(b1) the thundergods - injeckted.mp3 |
5.5 MB |
| Hardcore, Gabber/H2oH/h2oh025/(b2) the thundergods - dominate.mp3 |
5.6 MB |
| Hardcore, Gabber/H2oH/h2oh026/Omar Santana - Audio Warfare.mp3 |
7.4 MB |
| Hardcore, Gabber/H2oH/h2oh026/Omar Santana - Brute Force.mp3 |
7.4 MB |
| Hardcore, Gabber/H2oH/h2oh026/Omar Santana - Bum Rush Da Sound.mp3 |
6.9 MB |
| Hardcore, Gabber/H2oH/h2oh027/a1. da predator - elementz of danger.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/h2oh027/a2. da predator - 20000 hardcore members.mp3 |
11.1 MB |
| Hardcore, Gabber/H2oH/h2oh027/b1. da predator - wild stylz.mp3 |
9.3 MB |
| Hardcore, Gabber/H2oH/h2oh028/innerchild - overcome (slow mix).mp3 |
5.7 MB |
| Hardcore, Gabber/H2oH/h2oh028/innerchild - the party zone (dj jokey mix).mp3 |
5.8 MB |
| Hardcore, Gabber/H2oH/h2oh028/innerchild - the party zone.mp3 |
6 MB |
| Hardcore, Gabber/H2oH/h2oh028/innerchild - we shall overcome.mp3 |
5.9 MB |
| Hardcore, Gabber/H2oH/h2oh029/(a1) omar santana - necronomicon (neophyte remix).mp3 |
4.3 MB |
| Hardcore, Gabber/H2oH/h2oh029/(a2) omar santana - necronomicon (omar santana remix).mp3 |
4.8 MB |
| Hardcore, Gabber/H2oH/h2oh029/(b1) omar santana - necronomicon (the stunned guys remix).mp3 |
4.3 MB |
| Hardcore, Gabber/H2oH/h2oh029/(b2) omar santana - necronomicon.mp3 |
5.4 MB |
| Hardcore, Gabber/H2oH/h2oh030/a1 vortex.mp3 |
9.9 MB |
| Hardcore, Gabber/H2oH/h2oh030/b1 rock da rock.mp3 |
8.7 MB |
| Hardcore, Gabber/H2oH/h2oh030/b2 da baddest.mp3 |
9 MB |
| Hardcore, Gabber/H2oH/h2oh033/A1 - Omar Santana - Kick Some Shit (Lenny Dee & Skinhead).mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh033/A2 - Omar Santana - Kick Some Shit [Buzz Fuzz Remix].mp3 |
6.2 MB |
| Hardcore, Gabber/H2oH/h2oh033/B1 - Omar Santana - Kick Some Shit [Original Mix].mp3 |
5.7 MB |
| Hardcore, Gabber/H2oH/h2oh033/B2 - Omar Santana - Bone Bastik [Cali's Wall Of Sound Remix].mp3 |
6.1 MB |
| Hardcore, Gabber/H2oH/h2oh034/A1 Chosen Few - I Refuze 2 Looze.mp3 |
4.4 MB |
| Hardcore, Gabber/H2oH/h2oh034/B1 Chosen Few - Angel Of Death.mp3 |
4.3 MB |
| Hardcore, Gabber/H2oH/h2oh034/B2 Chosen Few feat. Da Menace - Hardcore Gangsta.mp3 |
4.2 MB |
| Hardcore, Gabber/H2oH/h2oh035/A1 - Omar santana - Bigger & Bolder.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh035/A2 - Omar santana - Forbidden Planet.mp3 |
5.1 MB |
| Hardcore, Gabber/H2oH/h2oh035/B1 - Omar santana - Sinister.mp3 |
3.5 MB |
| Hardcore, Gabber/H2oH/h2oh035/B2 - Omar santana - The Need For Speed.mp3 |
3.6 MB |
| Hardcore, Gabber/H2oH/h2oh035/B3 - Omar santana - The Terrorist Speaks.mp3 |
346 KB |
| Hardcore, Gabber/H2oH/h2oh036/A1 - Da Predator - Out Of Control.mp3 |
4.8 MB |
| Hardcore, Gabber/H2oH/h2oh036/A2 - Da Predator - Da Way We Rock.mp3 |
4.1 MB |
| Hardcore, Gabber/H2oH/h2oh036/B1 - Da Predator - Final Confrontation.mp3 |
4.4 MB |
| Hardcore, Gabber/H2oH/h2oh036/B2 - Da Predator - Turbulence.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh037/A1 - Da Police Da Beast.mp3 |
5.1 MB |
| Hardcore, Gabber/H2oH/h2oh037/A2 - The Future.mp3 |
5 MB |
| Hardcore, Gabber/H2oH/h2oh037/B1 - Hell A Destruction.mp3 |
5 MB |
| Hardcore, Gabber/H2oH/h2oh037/B2 - Genvadaar.mp3 |
5.3 MB |
| Hardcore, Gabber/H2oH/h2oh038/A1 - Omar Santana - You Shall Die.mp3 |
4.1 MB |
| Hardcore, Gabber/H2oH/h2oh038/A2 - Omar Santana - Brain Damage.mp3 |
4.8 MB |
| Hardcore, Gabber/H2oH/h2oh038/B1 - Omar Santana - Boy Is Bangin'.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh038/B2 - Omar Santana - Hole Shot.mp3 |
5.6 MB |
| Hardcore, Gabber/H2oH/h2oh039/3 da hard way - low tek (chosen few's remix).mp3 |
4.2 MB |
| Hardcore, Gabber/H2oH/h2oh039/3 da hard way - low tek (house o'holic's mix).mp3 |
5.1 MB |
| Hardcore, Gabber/H2oH/h2oh039/3 da hard way - low tek (la's fallen one's mix).mp3 |
3.7 MB |
| Hardcore, Gabber/H2oH/h2oh039/3 da hard way - low tek (the horrorist's mix).mp3 |
4 MB |
| Hardcore, Gabber/H2oH/h2oh040/(a1) la's fallen ones - target la.mp3 |
8.1 MB |
| Hardcore, Gabber/H2oH/h2oh040/(a2) la's fallen ones - gabba dj.mp3 |
6.8 MB |
| Hardcore, Gabber/H2oH/h2oh040/(b1) la's fallen ones - target la (slow as fuk remix).mp3 |
5.5 MB |
| Hardcore, Gabber/H2oH/h2oh040/INCOMPLETE~(b2) la's fallen ones - gabba dj (dtm remix).mp3 |
8 MB |
| Hardcore, Gabber/H2oH/h2oh041/A1 - Omar Santana - Get Ready Mothafukas!.mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh041/A2 - Omar Santana - Hardcore Eternal.mp3 |
7.5 MB |
| Hardcore, Gabber/H2oH/h2oh042/a1_human_blood.mp3 |
6.4 MB |
| Hardcore, Gabber/H2oH/h2oh042/a2_human_blood_(omar_santana_remix).mp3 |
5.8 MB |
| Hardcore, Gabber/H2oH/h2oh042/b1_knuckleheadz.mp3 |
7.2 MB |
| Hardcore, Gabber/H2oH/h2oh042/b2_electric_d-mention.mp3 |
6.5 MB |
| Hardcore, Gabber/H2oH/h2oh043/A1 - Rob Gee [Riot Squad] - Nonshlentustokken [Ode To Vortex].mp3 |
3.7 MB |
| Hardcore, Gabber/H2oH/h2oh043/A2 - Rob Gee [Riot Squad] - Nonshlentustokken [Neophyte Remix].mp3 |
4.2 MB |
| Hardcore, Gabber/H2oH/h2oh043/A3 - Rob Gee [Riot Squad] - Gabber Is The Sport.mp3 |
3.6 MB |
| Hardcore, Gabber/H2oH/h2oh043/B1 - Rob Gee [Riot Squad] - Boriqua Bitch [Original Mix].mp3 |
3 MB |
| Hardcore, Gabber/H2oH/h2oh043/B2 - Rob Gee [Riot Squad] - Boriqua Bitch [Buzz Fuzz Remix].mp3 |
5.3 MB |
| Hardcore, Gabber/H2oH/h2oh043/B3 - Rob Gee [Riot Squad] - Boriqua Bitch [Gracias Remix].mp3 |
4.8 MB |
| Hardcore, Gabber/H2oH/h2oh044/(a1) dj delirium - new jersey 2001.mp3 |
4.6 MB |
| Hardcore, Gabber/H2oH/h2oh044/(a2) dj delirium - do it like this.mp3 |
4.3 MB |
| Hardcore, Gabber/H2oH/h2oh044/(b1) dj delirium - gettin' high.mp3 |
4 MB |
| Hardcore, Gabber/H2oH/h2oh044/(b2) dj delirium - welcome to my terrordome.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/h2oh045/A1 - Omar Santana - World Domination.mp3 |
6.8 MB |
| Hardcore, Gabber/H2oH/h2oh045/A2 - Omar Santana - Lethal Weapon.mp3 |
6.1 MB |
| Hardcore, Gabber/H2oH/h2oh045/B1 - Omar Santana - Prime Evil.mp3 |
7 MB |
| Hardcore, Gabber/H2oH/h2oh046/A1. DJ Anas - Teknocore.mp3 |
9.7 MB |
| Hardcore, Gabber/H2oH/h2oh046/A2. DJ Anas - 1961.mp3 |
9.7 MB |
| Hardcore, Gabber/H2oH/h2oh046/B1. DJ Anas - Ex Rap.mp3 |
9 MB |
| Hardcore, Gabber/H2oH/h2oh046/B2. DJ Anas - For The Anger.mp3 |
9.6 MB |
| Hardcore, Gabber/H2oH/h2oh051/[A1] Dre-hectik - Let's get hectik.mp3 |
9.9 MB |
| Hardcore, Gabber/H2oH/h2oh051/[A2] Dre-hectik - House of pain.mp3 |
9.4 MB |
| Hardcore, Gabber/H2oH/h2oh051/[B1] Dre-hectik - The dark.mp3 |
10.3 MB |
| Hardcore, Gabber/H2oH/h2oh051/[B2] Dre-hectik - Brain damage.mp3 |
9.1 MB |
| Hardcore, Gabber/H2oH/h2oh053/a1 - Omar Santana - Stab Your Brain (Dj Sabotage Mix).mp3 |
7.4 MB |
| Hardcore, Gabber/H2oH/h2oh053/b1 - Omar Santana - Stab Your Brain (Dj Anas Mix).mp3 |
7 MB |
| Hardcore, Gabber/H2oH/h2oh053/b2 - Omar Santana - Stab Your Brain (Original Mix).mp3 |
8.1 MB |
| Hardcore, Gabber/H2oH/h2oh054/a1 - Omar Santana & Dj Sabotage - Fuck Em All.mp3 |
356 KB |
| Hardcore, Gabber/H2oH/h2oh054/a2 - Omar Santana & Dj Sabotage - Smash The Walls.mp3 |
8.1 MB |
| Hardcore, Gabber/H2oH/h2oh054/b1 - Omar Santana & Dj Sabotage - This Shit Is Mine.mp3 |
8 MB |
| Hardcore, Gabber/H2oH/h2oh054/b2 - Omar Santana & Dj Sabotage - Diabolical.mp3 |
6.9 MB |
| Hardcore, Gabber/H2oH/h2oh055/a1 - Hardcore Masterz Vienna - World Of Core.mp3 |
6.9 MB |
| Hardcore, Gabber/H2oH/h2oh055/a2 - Hardcore Masterz Vienna - Come To Our Side.mp3 |
6.9 MB |
| Hardcore, Gabber/H2oH/h2oh055/b1 - Hardcore Masterz Vienna - My Style.mp3 |
6 MB |
| Hardcore, Gabber/H2oH/h2oh055/b2 - Hardcore Masterz Vienna - Blow Your Mind.mp3 |
6.4 MB |
| Hardcore, Gabber/H2oH/h2oh056/a1 - The Scrumblehead - True Skool Gangsta.mp3 |
8 MB |
| Hardcore, Gabber/H2oH/h2oh056/b1 - The Scrumblehead - Take That.mp3 |
7.3 MB |
| Hardcore, Gabber/H2oH/h2oh056/b2 - The Scrumblehead - Come With The Hardcore.mp3 |
7.7 MB |
| Hardcore, Gabber/H2oH/h2oh057/a1 - Quaternion - I Shall See You Dead.mp3 |
7.3 MB |
| Hardcore, Gabber/H2oH/h2oh057/a2 - Quaternion - Sanctioned Areas.mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh057/b1 - Quaternion - You Shut The Fuk Up.mp3 |
5.2 MB |
| Hardcore, Gabber/H2oH/h2oh057/b2 - Quaternion - No Fucking Reason.mp3 |
6.5 MB |
| Hardcore, Gabber/H2oH/h2oh058/A2 Omar Santana vs Javi Boss - Play it One More Time.mp3 |
4.6 MB |
| Hardcore, Gabber/H2oH/h2oh059/01_american_hardcore_alliance_ii_-_commander_in_chief-intro-.mp3 |
800 KB |
| Hardcore, Gabber/H2oH/h2oh059/03_american_hardcore_alliance_ii_-_nowhere_to_hide_(dj_exodu.mp3 |
7.6 MB |
| Hardcore, Gabber/H2oH/h2oh059/07_american_hardcore_alliance_ii_-_nowhere_to_hide_(dj_troni.mp3 |
7.9 MB |
| Hardcore, Gabber/H2oH/h2oh059/08_american_hardcore_alliance_ii_-_moment_of_truth.mp3 |
1.7 MB |
| Hardcore, Gabber/H2oH/h2oh059/american hardcore alliance 2 - nowhere to hide (omar santana.mp3 |
8.4 MB |
| Hardcore, Gabber/H2oH/h2oh059/american hardcore alliance ii - nowhere to hide (dj delirium.mp3 |
8.1 MB |
| Hardcore, Gabber/H2oH/h2oh059/american hardcore alliance ii - nowhere to hide (dre hectik .mp3 |
7.4 MB |
| Hardcore, Gabber/H2oH/h2oh059/c1_american_hardcore_alliance_ii_-_nowhere_to_hide_(dj_sabot.mp3 |
7.7 MB |
| Hardcore, Gabber/H2oH/h2oh060/A1 Omar Santana feat. DJ Squad - Mosh Pit (Orginal Mix).mp3 |
8.2 MB |
| Hardcore, Gabber/H2oH/h2oh061/a1_dre_hectik_-_knock_something_outcha-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/h2oh061/a2_dre_hectik_-_ready_2_die-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/H2oH/h2oh061/b1_dre_hectik_-_handz_in_thee_air-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/H2oH/h2oh061/b2_dre_hectik_-_cant_mess-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/H2oH/h2oh064/a1 - Omar Santana, Mike Hemp & Dope-E - Take Em Out.mp3 |
8.1 MB |
| Hardcore, Gabber/H2oH/h2oh064/a2 - Omar Santana, Mike Hemp & Dope-E - Psycho Beatdown.mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh064/a3 - Omar Santana, Mike Hemp & Dope-E - Bonus Beatdown.mp3 |
2.8 MB |
| Hardcore, Gabber/H2oH/h2oh064/a4 - Omar Santana, Mike Hemp & Dope-E - Goodnight.mp3 |
692 KB |
| Hardcore, Gabber/H2oH/h2oh064/b1 - Omar Santana, Mike Hemp & Dope-E - Ultimate Intro.mp3 |
1.8 MB |
| Hardcore, Gabber/H2oH/h2oh064/b10 - Omar Santana, Mike Hemp & Dope-E - Still MF'n Hardcore.mp3 |
1.4 MB |
| Hardcore, Gabber/H2oH/h2oh064/b11 - Omar Santana, Mike Hemp & Dope-E - I'm Out.mp3 |
296 KB |
| Hardcore, Gabber/H2oH/h2oh064/b2 - Omar Santana, Mike Hemp & Dope-E - Maniac Djs.mp3 |
1.1 MB |
| Hardcore, Gabber/H2oH/h2oh064/b3 - Omar Santana, Mike Hemp & Dope-E - Fuck You (Sentence 1).mp3 |
1.9 MB |
| Hardcore, Gabber/H2oH/h2oh064/b4 - Omar Santana, Mike Hemp & Dope-E - Fugly Bass.mp3 |
1.4 MB |
| Hardcore, Gabber/H2oH/h2oh064/b5 - Omar Santana, Mike Hemp & Dope-E - Sucka With Static (Sentence 2).mp3 |
2.5 MB |
| Hardcore, Gabber/H2oH/h2oh064/b6 - Omar Santana, Mike Hemp & Dope-E - LFO Love.mp3 |
1.1 MB |
| Hardcore, Gabber/H2oH/h2oh064/b7 - Omar Santana, Mike Hemp & Dope-E - Step Up (Sentence 3).mp3 |
1.6 MB |
| Hardcore, Gabber/H2oH/h2oh064/b8 - Omar Santana, Mike Hemp & Dope-E - Take M Out - Vocal Tool.mp3 |
2.8 MB |
| Hardcore, Gabber/H2oH/h2oh064/b9 - Omar Santana, Mike Hemp & Dope-E - MF'n Hardcore.mp3 |
1.5 MB |
| Hardcore, Gabber/H2oH/h2oh065/a1 - Angels Of Death - The Lyuan.mp3 |
7.9 MB |
| Hardcore, Gabber/H2oH/h2oh065/a2 - Angels Of Death - West Coast Gabberkore.mp3 |
7.1 MB |
| Hardcore, Gabber/H2oH/h2oh065/b1 - Angels Of Death - The Ghost Of Mars.mp3 |
7.3 MB |
| Hardcore, Gabber/H2oH/h2oh065/b2 - Angels Of Death - The Lyuan Mind Fuck.mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/h2oh066/a1 - Omar Santana - Hardcore Revival.mp3 |
9.6 MB |
| Hardcore, Gabber/H2oH/h2oh066/b1 - Omar Santana - Break It Down.mp3 |
7.1 MB |
| Hardcore, Gabber/H2oH/h2oh066/b2 - Omar Santana - Gutless.mp3 |
7.7 MB |
| Hardcore, Gabber/H2oH/h2oh069/00_omar_santana_-_mind_ripper_(the_remixes)-(h2o69)-vinyl-2006.m3u |
211 B |
| Hardcore, Gabber/H2oH/h2oh069/00_omar_santana_-_mind_ripper_(the_remixes)-(h2o69)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/H2oH/h2oh069/00_omar_santana_-_mind_ripper_(the_remixes)-(h2o69)-vinyl-2006.sfv |
275 B |
| Hardcore, Gabber/H2oH/h2oh069/a1_omar_santana_-_mind_ripper_(dione_remix).mp3 |
8.8 MB |
| Hardcore, Gabber/H2oH/h2oh069/a2_omar_santana_-_mind_ripper_(mind_control_society_remix).mp3 |
9.2 MB |
| Hardcore, Gabber/H2oH/h2oh069/b1_omar_santana_-_mind_ripper_(out-back_remix).mp3 |
8.9 MB |
| Hardcore, Gabber/H2oH/h2oh069/b2_omar_santana_-_mind_ripper_(original_mix).mp3 |
9.4 MB |
| Hardcore, Gabber/H2oH/h2oh070/a1_out-back_-_our_way_of_life.mp3 |
10.3 MB |
| Hardcore, Gabber/H2oH/h2oh070/b1_out-back_and_serial_killaz_-_little_something.mp3 |
8.2 MB |
| Hardcore, Gabber/H2oH/h2oh070/b2_out-back_-_taking_off.mp3 |
11.2 MB |
| Hardcore, Gabber/H2oH/h2oh073/00_omar_santana-hard_street_shit-(h2o73)-vinyl-2006.m3u |
69 B |
| Hardcore, Gabber/H2oH/h2oh073/00_omar_santana-hard_street_shit-(h2o73)-vinyl-2006.nfo |
615 B |
| Hardcore, Gabber/H2oH/h2oh073/00_omar_santana-hard_street_shit-(h2o73)-vinyl-2006.sfv |
87 B |
| Hardcore, Gabber/H2oH/h2oh073/01_omar_santana-hard_street_shit.mp3 |
10 MB |
| Hardcore, Gabber/H2oH/h2oh073/02_omar_santana-see_no_evil.mp3 |
10.2 MB |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/00-nyocore-mister_blue-(h2o74)-vinyl-2007-qtxmp3.m3u |
140 B |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/00-nyocore-mister_blue-(h2o74)-vinyl-2007-qtxmp3.nfo |
9 KB |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/00-nyocore-mister_blue-(h2o74)-vinyl-2007-qtxmp3.sfv |
222 B |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/a1-nyocore-misterblue-qtxmp3.mp3 |
6.8 MB |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/a2-nyocore-mechanical_warrior-qtxmp3.mp3 |
9.1 MB |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/b1-nyocore-ravers_area-qtxmp3.mp3 |
9.6 MB |
| Hardcore, Gabber/H2oH/h2oh074/Nyocore-Mister_Blue-(H2O74)-Vinyl-2007-QTXMp3/b2-nyocore-supernova-qtxmp3.mp3 |
9.5 MB |
| Hardcore, Gabber/H2oH/[h2o 001] omar santana - slave invaders ep (1993)/a1.omar santana - slave invaders.mp3 |
5.3 MB |
| Hardcore, Gabber/H2oH/[h2o 001] omar santana - slave invaders ep (1993)/a2.omar santana - step the fuc back.mp3 |
5.1 MB |
| Hardcore, Gabber/H2oH/[h2o 001] omar santana - slave invaders ep (1993)/b1.omar santana - oh yeah.mp3 |
5 MB |
| Hardcore, Gabber/H2oH/[h2o 001] omar santana - slave invaders ep (1993)/b2.omar santana - speed freak.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/[h2o 003] omar santana - oh-mega ep (1993)/[H2O 03] Oh-Mega EP - A1 - Omar Santana - Go Oh.mp3 |
8.6 MB |
| Hardcore, Gabber/H2oH/[h2o 003] omar santana - oh-mega ep (1993)/[H2O 03] Oh-Mega EP - A2 - Omar Santana - Beat Down.mp3 |
7.8 MB |
| Hardcore, Gabber/H2oH/[h2o 003] omar santana - oh-mega ep (1993)/[H2O 03] Oh-Mega EP - B1 - Omar Santana - Rude Tudah Core.mp3 |
10.4 MB |
| Hardcore, Gabber/H2oH/[h2o 003] omar santana - oh-mega ep (1993)/[H2O 03] Oh-Mega EP - B2 - Omar Santana - Soundwave.mp3 |
7.2 MB |
| Hardcore, Gabber/H2oH/[h2o 006] omar santana - the new york terrorist/h2oh rec 006 omar santana the new york terrorist da joint.mp3 |
7.1 MB |
| Hardcore, Gabber/H2oH/[h2o 006] omar santana - the new york terrorist/h2oh rec 006 omar santana the new york terrorist hight is long on lsd.mp3 |
9.8 MB |
| Hardcore, Gabber/H2oH/[h2o 006] omar santana - the new york terrorist/h2oh rec 006 omar santana the new york terrorist synester.mp3 |
6.7 MB |
| Hardcore, Gabber/H2oH/[h2o 006] omar santana - the new york terrorist/h2oh rec 006 omar santana the new york terrorist the need for speed.mp3 |
6.8 MB |
| Hardcore, Gabber/H2oH/[h2o 006] omar santana - the new york terrorist/h2oh rec 006 omar santana the new york terrorist the terrorist speaks accapela.mp3 |
699 KB |
| Hardcore, Gabber/H2oH/[h2o 006] omar santana - the new york terrorist/h2oh rec 006 omar santana the new york terrorist verbal assassin.mp3 |
8.4 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - A1 - Omar Santana - Disturbed Mind.mp3 |
7.3 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - A2 - Omar Santana - Phat Beats.mp3 |
8 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - A3 - Omar Santana - Shake Dat Ass.mp3 |
7.6 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - B1 - Omar Santana - Cologned.mp3 |
7.9 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - B2 - Omar Santana - Quick Fix.mp3 |
7.3 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - B3 - Omar Santana - Hell's Kitchen.mp3 |
6.5 MB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - B4 - Omar Santana - Untitled (played reverse).mp3 |
496 KB |
| Hardcore, Gabber/H2oH/[h2o 007] omar santana - car jacker (1995)/[H2O 07] Car Jacker - B4 - Omar Santana - Untitled.mp3 |
499 KB |
| Hardcore, Gabber/H2oH/[h2o 010] omar santana - slamma jamma (1996)/omar santana - kick some shit (original mix).mp3 |
5.7 MB |
| Hardcore, Gabber/H2oH/[h2o 010] omar santana - slamma jamma (1996)/omar santana - slamma jamma.mp3 |
3.6 MB |
| Hardcore, Gabber/H2oH/[h2o 010] omar santana - slamma jamma (1996)/omar santana - time to motivate.mp3 |
4.4 MB |
| Hardcore, Gabber/H2oH/[h2o 012] the scrumbleheads - unbelievable/[A1] The Scrumbleheads - Unbelievable (Oh Oh Omar Mix).mp3 |
5.6 MB |
| Hardcore, Gabber/H2oH/[h2o 012] the scrumbleheads - unbelievable/[B1] The Scrumblehead - Let's Rock.mp3 |
3.5 MB |
| Hardcore, Gabber/H2oH/[h2o 013] 3 da hard way - 3 da hard way/A1.3 Da Hard Way - Original Rude Boyz.mp3 |
4.5 MB |
| Hardcore, Gabber/H2oH/[h2o 013] 3 da hard way - 3 da hard way/A2.3 Da Hard Way - 3 Da Hard Way.mp3 |
4.9 MB |
| Hardcore, Gabber/H2oH/[h2o 013] 3 da hard way - 3 da hard way/A3.3 Da Hard Way - Bam.mp3 |
1.3 MB |
| Hardcore, Gabber/H2oH/[h2o 013] 3 da hard way - 3 da hard way/B1.3 Da Hard Way - Funky Ass Track.mp3 |
4.1 MB |
| Hardcore, Gabber/H2oH/[h2o 013] 3 da hard way - 3 da hard way/B2.3 Da Hard Way - Mix Of Trixx.mp3 |
3.9 MB |
| Hardcore, Gabber/H2oH/[h2o 015] 3 da hard way - original rude boyz/A1.3 Da Hard Way - Original Rude Boyz (Oh Oh Omar's Mix).mp3 |
6.4 MB |
| Hardcore, Gabber/H2oH/[h2o 031] omar santana - morpheus/a1 - omar santana - morpheus.mp3 |
5.1 MB |
| Hardcore, Gabber/H2oH/[h2o 031] omar santana - morpheus/b1 - omar santana - terminal terror.mp3 |
5.2 MB |
| Hardcore, Gabber/H2oH/[h2o 031] omar santana - morpheus/b2 - omar santana - rebel in his own mide.mp3 |
5.1 MB |
| Hardcore, Gabber/Hard Attack/ha004/00_simtec_vs._slamdog-100_percent_approved-(ha004)-vinyl-1997-hm.m3u |
269 B |
| Hardcore, Gabber/Hard Attack/ha004/00_simtec_vs._slamdog-100_percent_approved-(ha004)-vinyl-1997-hm.nfo |
2 KB |
| Hardcore, Gabber/Hard Attack/ha004/00_simtec_vs._slamdog-100_percent_approved-(ha004)-vinyl-1997-hm.sfv |
323 B |
| Hardcore, Gabber/Hard Attack/ha004/a1_simtec_vs._slamdog-this_record-hm.mp3 |
6.3 MB |
| Hardcore, Gabber/Hard Attack/ha004/a2_simtec_vs._slamdog-this_one_goes_out_to_you-hm.mp3 |
7 MB |
| Hardcore, Gabber/Hard Attack/ha004/a3_simtec_vs._slamdog-the_truth-hm.mp3 |
7.1 MB |
| Hardcore, Gabber/Hard Attack/ha004/b1_simtec_vs._slamdog-all_played_out-hm.mp3 |
7.2 MB |
| Hardcore, Gabber/Hard Attack/ha004/b2_simtec_vs._slamdog-happy_sampling-hm.mp3 |
7.7 MB |
| Hardcore, Gabber/Hard Attack/ha004/b3_simtec_vs._slamdog-point_blank-hm.mp3 |
5.9 MB |
| Hardcore, Gabber/Hard Drugz/harddrugz001/a1_luciano_gambino_-_floral_tribute_(holland_murder_1)-sq.mp3 |
8 MB |
| Hardcore, Gabber/Hard Drugz/harddrugz001/a2_drokz_and_tafkat_-_unidentified_frequencies-sq.mp3 |
5.8 MB |
| Hardcore, Gabber/Hard Drugz/harddrugz001/b1_noisekick_-_koffie_met_een_smaakje-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Hard Drugz/harddrugz001/b2_no_mercy_feat._drokz_-_cunt_records_is_dead-sq.mp3 |
6.2 MB |
| Hardcore, Gabber/Hard Floor/hardfloor009/00_va-hard_floor_09-(hardfloor09)-vinyl-2008-ct.m3u |
106 B |
| Hardcore, Gabber/Hard Floor/hardfloor009/00_va-hard_floor_09-(hardfloor09)-vinyl-2008-ct.nfo |
11 KB |
| Hardcore, Gabber/Hard Floor/hardfloor009/00_va-hard_floor_09-(hardfloor09)-vinyl-2008-ct.sfv |
142 B |
| Hardcore, Gabber/Hard Floor/hardfloor009/a1_k-plan-green-ct.mp3 |
8.6 MB |
| Hardcore, Gabber/Hard Floor/hardfloor009/a2_frv100-vitamine_c-ct.mp3 |
7.9 MB |
| Hardcore, Gabber/Hard Floor/hardfloor009/b1_franka-nitros-ct.mp3 |
8.3 MB |
| Hardcore, Gabber/Hard Floor/hardfloor009/b2_talasemik-rustik-ct.mp3 |
7.8 MB |
| Hardcore, Gabber/Hard Stuff/hard004/a1 - Charly Lownoise & Mental Theo - The Bird.mp3 |
4.4 MB |
| Hardcore, Gabber/Hard Stuff/hard011/Cellblock X (Hard Stuff Records 011) - Jurassic Darkness (b2.mp3 |
4.2 MB |
| Hardcore, Gabber/Hard Stuff/hard011/Cellblock X (Hard Stuff Records 011) - Kolikalv (a1).mp3 |
6.4 MB |
| Hardcore, Gabber/Hard Stuff/hard011/Cellblock X (Hard Stuff Records 011) - Roberto Ritzehue (a2).mp3 |
4.3 MB |
| Hardcore, Gabber/Hard Stuff/hard011/Cellblock X (Hard Stuff Records 011) - Stimuli (b1).mp3 |
5.7 MB |
| Hardcore, Gabber/Hardcore Blasters/Angels_of_Darkness-Evil_Inside-(HM2757)/Angels_of_Darkness-Evil_Inside-(HM2757)-Vinyl-2007-1REAL/00-angels_of_darkness-evil_inside-(hm2757)-vinyl-2007-1real.m3u |
90 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_of_Darkness-Evil_Inside-(HM2757)/Angels_of_Darkness-Evil_Inside-(HM2757)-Vinyl-2007-1REAL/00-angels_of_darkness-evil_inside-(hm2757)-vinyl-2007-1real.nfo |
7 KB |
| Hardcore, Gabber/Hardcore Blasters/Angels_of_Darkness-Evil_Inside-(HM2757)/Angels_of_Darkness-Evil_Inside-(HM2757)-Vinyl-2007-1REAL/00-angels_of_darkness-evil_inside-(hm2757)-vinyl-2007-1real.sfv |
108 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_of_Darkness-Evil_Inside-(HM2757)/Angels_of_Darkness-Evil_Inside-(HM2757)-Vinyl-2007-1REAL/a1-angels_of_darkness-evil_inside-1real.mp3 |
6.9 MB |
| Hardcore, Gabber/Hardcore Blasters/Angels_of_Darkness-Evil_Inside-(HM2757)/Angels_of_Darkness-Evil_Inside-(HM2757)-Vinyl-2007-1REAL/b1-angels_of_darkness-noize_talking-1real.mp3 |
5.8 MB |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/Brisk_And_Vagabond_Feat_DMO-Away_From_Here__In_Control-Vinyl-2008-SDS/00-brisk_and_vagabond_feat_dmo-away_from_here__in_control-vinyl-2008-sds.m3u |
97 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/Brisk_And_Vagabond_Feat_DMO-Away_From_Here__In_Control-Vinyl-2008-SDS/00-brisk_and_vagabond_feat_dmo-away_from_here__in_control-vinyl-2008-sds.nfo |
670 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/Brisk_And_Vagabond_Feat_DMO-Away_From_Here__In_Control-Vinyl-2008-SDS/00-brisk_and_vagabond_feat_dmo-away_from_here__in_control-vinyl-2008-sds.sfv |
115 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/Brisk_And_Vagabond_Feat_DMO-Away_From_Here__In_Control-Vinyl-2008-SDS/01-brisk_and_vagabond_feat_dmo-away_from_here-sds.mp3 |
8.5 MB |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/Brisk_And_Vagabond_Feat_DMO-Away_From_Here__In_Control-Vinyl-2008-SDS/02-brisk_and_vagabond-in_control-sds.mp3 |
9.2 MB |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/00-angels_of_darkness-theyre_comin-(hm2762)-web-2008.m3u |
89 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/00-angels_of_darkness-theyre_comin-(hm2762)-web-2008.nfo |
30 KB |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/00-angels_of_darkness-theyre_comin-(hm2762)-web-2008.sfv |
107 B |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/01-angels_of_darkness-theyre_comin.mp3 |
12 MB |
| Hardcore, Gabber/Hardcore Blasters/Angels_Of_Darkness-Theyre_Comin-(HM2762)-WEB-2008-1KING/02-angels_of_darkness-worst_thing_ever_done.mp3 |
11.9 MB |
| Hardcore, Gabber/Hardcore Blasters/hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008-hm/00_hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008.m3u |
89 B |
| Hardcore, Gabber/Hardcore Blasters/hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008-hm/00_hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Hardcore Blasters/hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008-hm/00_hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008.sfv |
119 B |
| Hardcore, Gabber/Hardcore Blasters/hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008-hm/A1_hellsystem-the_executioner.mp3 |
7.7 MB |
| Hardcore, Gabber/Hardcore Blasters/hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008-hm/B1_hellsystem-pray.mp3 |
7.8 MB |
| Hardcore, Gabber/Hardcore Blasters/hellsystem-the_executioner_e.p.-(hm2761)-vinyl-2008-hm/B2_hellsystem-dark_and_deep.mp3 |
8 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2751/01-angels_of_darkness-a1_cold_as_ice-1real.mp3 |
7.9 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2751/02-angels_of_darkness-b1_tbmf-1real.mp3 |
7.9 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2757/00-angels_of_darkness-evil_inside-(hm2757)-vinyl-2007-1real.m3u |
90 B |
| Hardcore, Gabber/Hardcore Blasters/hm2757/00-angels_of_darkness-evil_inside-(hm2757)-vinyl-2007-1real.nfo |
7 KB |
| Hardcore, Gabber/Hardcore Blasters/hm2757/00-angels_of_darkness-evil_inside-(hm2757)-vinyl-2007-1real.sfv |
108 B |
| Hardcore, Gabber/Hardcore Blasters/hm2757/a1-angels_of_darkness-evil_inside-1real.mp3 |
6.9 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2757/b1-angels_of_darkness-noize_talking-1real.mp3 |
5.8 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2760/00-nitrogenetics_and_dj_d-party_down-(hm2760)-vinyl-2007-1real.m3u |
185 B |
| Hardcore, Gabber/Hardcore Blasters/hm2760/00-nitrogenetics_and_dj_d-party_down-(hm2760)-vinyl-2007-1real.sfv |
212 B |
| Hardcore, Gabber/Hardcore Blasters/hm2760/a1-nitrogenetics_and_dj_d_feat_hellsystem-party_down-1real.mp3 |
6 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2760/b1-dj_d_and_nitrogenetics-raise_and_blaze-1real.mp3 |
7.8 MB |
| Hardcore, Gabber/Hardcore Blasters/hm2760/b2-nitrogenetics-shocking_and_stunning_(javi_boss_remix)-1real.mp3 |
9.5 MB |
| Hardcore, Gabber/Hardcore Blasters/hmg004/00_va-gold_-_greatest_oldiez_volume_4-(hmg04)-vinyl-2008.m3u |
166 B |
| Hardcore, Gabber/Hardcore Blasters/hmg004/00_va-gold_-_greatest_oldiez_volume_4-(hmg04)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Hardcore Blasters/hmg004/00_va-gold_-_greatest_oldiez_volume_4-(hmg04)-vinyl-2008.sfv |
202 B |
| Hardcore, Gabber/Hardcore Blasters/hmg004/a1_the_blaster-the_blaster_-_face_of_pain_(dj_d_rmx).mp3 |
7 MB |
| Hardcore, Gabber/Hardcore Blasters/hmg004/a2_the_blaster-listen_up_sista.mp3 |
9.7 MB |
| Hardcore, Gabber/Hardcore Blasters/hmg004/b1_q-antize-blow_your_whistle_(dj_d_rmx).mp3 |
6.6 MB |
| Hardcore, Gabber/Hardcore Blasters/hmg004/b2_psychorudes-xtc_is_up.mp3 |
8 MB |
| Hardcore, Gabber/Hardcore Mafia/hm006/00-the_connoisseur-new_breed_anthem_and_ardkore_fever-(hm06)-10inch-1997-def.m3u |
83 B |
| Hardcore, Gabber/Hardcore Mafia/hm006/00-the_connoisseur-new_breed_anthem_and_ardkore_fever-(hm06)-10inch-1997-def.nfo |
3 KB |
| Hardcore, Gabber/Hardcore Mafia/hm006/00-the_connoisseur-new_breed_anthem_and_ardkore_fever-(hm06)-10inch-1997-def.sfv |
129 B |
| Hardcore, Gabber/Hardcore Mafia/hm006/00-the_connoisseur-new_breed_anthem_and_ardkore_fever-(hm06)-10inch-1997-side_a-def.jpg |
67 KB |
| Hardcore, Gabber/Hardcore Mafia/hm006/00-the_connoisseur-new_breed_anthem_and_ardkore_fever-(hm06)-10inch-1997-side_b-def.jpg |
58 KB |
| Hardcore, Gabber/Hardcore Mafia/hm006/a-the_connoisseur-new_breed_anthem-def.mp3 |
7.2 MB |
| Hardcore, Gabber/Hardcore Mafia/hm006/b-the_connoisseur-ardkore_fever-def.mp3 |
7.9 MB |
| Hardcore, Gabber/Hardcore Mafia Revenge/hmr002/00_the_dj_producer_-_untitled-(hmr02)-vinyl-2007.m3u |
187 B |
| Hardcore, Gabber/Hardcore Mafia Revenge/hmr002/00_the_dj_producer_-_untitled-(hmr02)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Hardcore Mafia Revenge/hmr002/00_the_dj_producer_-_untitled-(hmr02)-vinyl-2007.sfv |
214 B |
| Hardcore, Gabber/Hardcore Mafia Revenge/hmr002/a1_the_dj_producer_-_out_of_control_(huge_space_arena_remix).mp3 |
12.7 MB |
| Hardcore, Gabber/Hardcore Mafia Revenge/hmr002/b1_the_dj_producer_-_defending_the_title_(mad_bomb_missile).mp3 |
9.8 MB |
| Hardcore, Gabber/Hardcore Mafia Revenge/hmr002/b2_the_dj_producer_-_out_of_control_(get_em_going).mp3 |
8.4 MB |
| Hardcore, Gabber/HardDrugz/harddrugz004/00_rehab_clinic_-_useless_school-(hd004)-vinyl-2007.m3u |
139 B |
| Hardcore, Gabber/HardDrugz/harddrugz004/00_rehab_clinic_-_useless_school-(hd004)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/HardDrugz/harddrugz004/00_rehab_clinic_-_useless_school-(hd004)-vinyl-2007.sfv |
166 B |
| Hardcore, Gabber/HardDrugz/harddrugz004/01_rehab_clinic_-_useless_school.mp3 |
6.5 MB |
| Hardcore, Gabber/HardDrugz/harddrugz004/02_rehab_clinic_-_piss_off.mp3 |
6.6 MB |
| Hardcore, Gabber/HardDrugz/harddrugz004/03_rehab_clinic_-_useless_school_remix_by_c.orp_and_the_vizitor.mp3 |
6.6 MB |
| Hardcore, Gabber/Haunted House/hhr002/00_dr_macabre-classics_from_the_attic_-_volume_1-(hhr002)-vinyl-2007.m3u |
130 B |
| Hardcore, Gabber/Haunted House/hhr002/00_dr_macabre-classics_from_the_attic_-_volume_1-(hhr002)-vinyl-2007.nfo |
1 KB |
| Hardcore, Gabber/Haunted House/hhr002/00_dr_macabre-classics_from_the_attic_-_volume_1-(hhr002)-vinyl-2007.sfv |
166 B |
| Hardcore, Gabber/Haunted House/hhr002/a1_dr_macabre-chaos_effect.mp3 |
9.2 MB |
| Hardcore, Gabber/Haunted House/hhr002/a2_dr_macabre-my_beat.mp3 |
8.6 MB |
| Hardcore, Gabber/Haunted House/hhr002/b1_dr_macabre-shut_the_fuck_up.mp3 |
8 MB |
| Hardcore, Gabber/Haunted House/hhr002/b2_dr_macabre-gates_of_heaven.mp3 |
10.7 MB |
| Hardcore, Gabber/haunted house records/(hhr 000) - dr. macabre - ghost stories chapter ii/_HHR 000 (front).gif |
14 KB |
| Hardcore, Gabber/haunted house records/(hhr 000) - dr. macabre - ghost stories chapter ii/A1 - DR. MACABRE - You Must Die (Cannelleni Mix 135 BPM).mp3 |
8.6 MB |
| Hardcore, Gabber/haunted house records/(hhr 000) - dr. macabre - ghost stories chapter ii/A2 - DR. MACABRE - You Must Die (Cannelleni Mix 145 BPM).mp3 |
8 MB |
| Hardcore, Gabber/haunted house records/(hhr 000) - dr. macabre - ghost stories chapter ii/B1 - DR. MACABRE - Poltergeist (Remastered).mp3 |
8.5 MB |
| Hardcore, Gabber/haunted house records/(hhr 000) - dr. macabre - ghost stories chapter ii/B2 - DR. MACABRE - You Must Die (Spaghetti Mix).mp3 |
6.5 MB |
| Hardcore, Gabber/haunted house records/(hhr 000) - dr. macabre - ghost stories chapter ii/B3 - DR. MACABRE - Bonus Samples (You Must Die).mp3 |
3.4 MB |
| Hardcore, Gabber/haunted house records/(hhr 001) - dr. macabre - the brain eater/A1 - DR. MACABRE - One Two Three Four.mp3 |
10.1 MB |
| Hardcore, Gabber/haunted house records/(hhr 001) - dr. macabre - the brain eater/B1 - DR. MACABRE - Night Of The Living Dead.mp3 |
8.2 MB |
| Hardcore, Gabber/haunted house records/(hhr 001) - dr. macabre - the brain eater/B2 - DR. MACABRE - French Connection.mp3 |
8 MB |
| Hardcore, Gabber/Head Fuck/hdf003/a1-noize_creator_-_dreckfresse.mp3 |
5.9 MB |
| Hardcore, Gabber/Head Fuck/hdf003/a2-noize_creator_-_snowball.mp3 |
4.4 MB |
| Hardcore, Gabber/Head Fuck/hdf003/b1-dj_freak_-_rock_against_drugs.mp3 |
5.6 MB |
| Hardcore, Gabber/Head Fuck/hdf003/b2-dj_freak_-_bastardized.mp3 |
6.1 MB |
| Hardcore, Gabber/Head Fuck/hdf005/a1-doom_(deathcore_mix).mp3 |
8.2 MB |
| Hardcore, Gabber/Head Fuck/hdf005/a2-death_(doomcore_mix).mp3 |
9.5 MB |
| Hardcore, Gabber/Head Fuck/hdf005/a3-skullkrusher.mp3 |
2.3 MB |
| Hardcore, Gabber/Head Fuck/hdf005/b1-demon.mp3 |
8.2 MB |
| Hardcore, Gabber/Head Fuck/hdf005/b2-achluophobia.mp3 |
8.5 MB |
| Hardcore, Gabber/Head Fuck/hdf005/b3-purgatory.mp3 |
2.8 MB |
| Hardcore, Gabber/Head Fuck/hdf007/[a1] armageddon project - elektrokution.mp3 |
5.2 MB |
| Hardcore, Gabber/Head Fuck/hdf007/[a2] armageddon project - everlasting sorrow.mp3 |
5.4 MB |
| Hardcore, Gabber/Head Fuck/hdf007/[b1] armageddon project - lo-fi headache.mp3 |
5.4 MB |
| Hardcore, Gabber/Head Fuck/hdf007/[b2] armageddon project - freak up.mp3 |
6.9 MB |
| Hardcore, Gabber/Head Fuck/hdf009/a1 rebellion.mp3 |
3.3 MB |
| Hardcore, Gabber/Head Fuck/hdf009/a2 the church of pentagram.mp3 |
3.1 MB |
| Hardcore, Gabber/Head Fuck/hdf009/b1 chaotik.mp3 |
4.2 MB |
| Hardcore, Gabber/Head Fuck/hdf009/b2 downfall part i.mp3 |
4 MB |
| Hardcore, Gabber/Head Fuck/hdf014/INCOMPLETE~A2-EVO.MP3 |
2.3 MB |
| Hardcore, Gabber/Head Fuck/hdf016/a1-soundz_form_drokz.mp3 |
5.5 MB |
| Hardcore, Gabber/Head Fuck/hdf016/a2-digital_funeral_theme.mp3 |
6.1 MB |
| Hardcore, Gabber/Head Fuck/hdf016/b1-f.g.d._money.mp3 |
5.1 MB |
| Hardcore, Gabber/Head Fuck/hdf016/b2-costruction.mp3 |
5.5 MB |
| Hardcore, Gabber/Head Fuck/hdf020/A - Faytinc.mp3 |
9.9 MB |
| Hardcore, Gabber/Head Fuck/hdf020/B1 - Genetic.mp3 |
6 MB |
| Hardcore, Gabber/Head Fuck/hdf020/B2 - Sodamix.mp3 |
8 MB |
| Hardcore, Gabber/Head Fuck/hdf021/A1 - Drokz Tails & The Destroyer - Aggression (Drokz & Tails Mix).mp3 |
5.5 MB |
| Hardcore, Gabber/Head Fuck/hdf021/A2 - Drokz - Fgd Money (Destroyer Mix).mp3 |
7.8 MB |
| Hardcore, Gabber/Head Fuck/hdf021/B1 - Drokz Tails & The Destroyer - Aggression (Destroyer Mix).mp3 |
7.4 MB |
| Hardcore, Gabber/Head Fuck/hdf021/B2 - The Destroyer - Street Fuckers '03 (Drokz & Tails Old School Terror Mix).mp3 |
5.5 MB |
| Hardcore, Gabber/Head Fuck/hdf022/A1 - Mastermind - Alternative.mp3 |
7.5 MB |
| Hardcore, Gabber/Head Fuck/hdf022/B1 - Mastermind - Battle Record.mp3 |
5.2 MB |
| Hardcore, Gabber/Head Fuck/hdf022/B2 - Mastermind - Subway Drum.mp3 |
6.8 MB |
| Hardcore, Gabber/Head Fuck/hdf023/00-x-fly_aka_master_mind-headfuck_reloade_ep-(hdf023)-vinyl-2007-1king.m3u |
141 B |
| Hardcore, Gabber/Head Fuck/hdf023/00-x-fly_aka_master_mind-headfuck_reloade_ep-(hdf023)-vinyl-2007-1king.nfo |
9 KB |
| Hardcore, Gabber/Head Fuck/hdf023/00-x-fly_aka_master_mind-headfuck_reloade_ep-(hdf023)-vinyl-2007-1king.sfv |
3 KB |
| Hardcore, Gabber/Head Fuck/hdf023/a1-x-fly_aka_master_mind-headfuck_is_back.mp3 |
10.2 MB |
| Hardcore, Gabber/Head Fuck/hdf023/b1-x-fly_aka_master_mind-frequency_test-1king.mp3 |
7.9 MB |
| Hardcore, Gabber/Head Fuck/hdf023/b2-x-fly_aka_master_mind-u_want_terror.mp3 |
5.2 MB |
| Hardcore, Gabber/Headfuk/fuk007/A1 - Hue Jah Fink - Pijinpi.mp3 |
5.2 MB |
| Hardcore, Gabber/Headfuk/fuk007/A2 - Ely Muff - We're Musicians.mp3 |
5 MB |
| Hardcore, Gabber/Hellraiser/20012/00-2h2h_crew-ich_bin_ein_berliner-(20012)-vinyl-1997-doc.m3u |
209 B |
| Hardcore, Gabber/Hellraiser/20012/00-2h2h_crew-ich_bin_ein_berliner-(20012)-vinyl-1997-doc.nfo |
13 KB |
| Hardcore, Gabber/Hellraiser/20012/00-2h2h_crew-ich_bin_ein_berliner-(20012)-vinyl-1997-doc.sfv |
305 B |
| Hardcore, Gabber/Hellraiser/20012/01-a1_2h2h_crew-ich_bin_ein_berliner-doc.mp3 |
6.5 MB |
| Hardcore, Gabber/Hellraiser/20012/02-a2_2h2h_crew-ich_bin_ein_berliner_(area_51_mix)-doc.mp3 |
5.4 MB |
| Hardcore, Gabber/Hellraiser/20012/03-b1_2h2h_crew-faith-doc.mp3 |
4.2 MB |
| Hardcore, Gabber/Hellraiser/20012/04-b2_2h2h_crew-4_3_2_1-doc.mp3 |
4.9 MB |
| Hardcore, Gabber/Hellraiser/20012/05-b3_2h2h_crew-and_i_like_it-doc.mp3 |
8.1 MB |
| Hardcore, Gabber/Hong Kong Violence/hkv009/00-the_outside_agency-the_way_of_the_exploding_fist-(hkv009pd)-vinyl-2007-1real.m3u |
231 B |
| Hardcore, Gabber/Hong Kong Violence/hkv009/00-the_outside_agency-the_way_of_the_exploding_fist-(hkv009pd)-vinyl-2007-1real.nfo |
8 KB |
| Hardcore, Gabber/Hong Kong Violence/hkv009/00-the_outside_agency-the_way_of_the_exploding_fist-(hkv009pd)-vinyl-2007-1real.sfv |
322 B |
| Hardcore, Gabber/Hong Kong Violence/hkv009/a1-the_outside_agency-garou_densetsu_(the_broken)-1real.mp3 |
11 MB |
| Hardcore, Gabber/Hong Kong Violence/hkv009/a2-the_outside_agency-the_kid_with_the_golden_axe-1real.mp3 |
9.9 MB |
| Hardcore, Gabber/Hong Kong Violence/hkv009/b1-the_outside_agency-international_karate_knightmare-1real.mp3 |
9.6 MB |
| Hardcore, Gabber/Hong Kong Violence/hkv009/b2-the_outside_agency-yie_ar_kung-fu-1real.mp3 |
10.5 MB |
| Hardcore, Gabber/Hotcore/hot002/a1_dj_japan_and_al_core_-_old_dirty_bastard-sq.mp3 |
9.2 MB |
| Hardcore, Gabber/Hotcore/hot002/a2_dj_japan_and_al_core_-_hardcore_swindle-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Hotcore/hot002/b1_dj_japan_and_al_core_-_our_way-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Hotcore/hot002/b2_dj_japan_and_al_core_-_shit_head-sq.mp3 |
6.8 MB |
| Hardcore, Gabber/Hotcore/htc003/00_the_sickest_squad_-_really_hot-(htc003)-vinyl-2007.m3u |
158 B |
| Hardcore, Gabber/Hotcore/htc003/00_the_sickest_squad_-_really_hot-(htc003)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Hotcore/htc003/00_the_sickest_squad_-_really_hot-(htc003)-vinyl-2007.sfv |
194 B |
| Hardcore, Gabber/Hotcore/htc003/a1_the_sickest_squad_-_scratch_my_cock.mp3 |
7.9 MB |
| Hardcore, Gabber/Hotcore/htc003/a2_the_sickest_squad_-_really_hot.mp3 |
8.4 MB |
| Hardcore, Gabber/Hotcore/htc003/b1_the_sickest_squad_-_in53.mp3 |
7 MB |
| Hardcore, Gabber/Hotcore/htc003/b2_the_sickest_squad_-_music_emotion.mp3 |
7.8 MB |
| Hardcore, Gabber/Hullabaloo/hul70005/00-kosmik_nation_-_hullabaloo-(hul70005)-vinyl-1994-emp.m3u |
86 B |
| Hardcore, Gabber/Hullabaloo/hul70005/00-kosmik_nation_-_hullabaloo-(hul70005)-vinyl-1994-emp.nfo |
9 KB |
| Hardcore, Gabber/Hullabaloo/hul70005/00-kosmik_nation_-_hullabaloo-(hul70005)-vinyl-1994-emp.sfv |
104 B |
| Hardcore, Gabber/Hullabaloo/hul70005/a1-kosmik_nation_-_excited_bells-emp.mp3 |
7.3 MB |
| Hardcore, Gabber/Hullabaloo/hul70005/b1-kosmik_nation_-_the_cry_of_acid-emp.mp3 |
9 MB |
| Hardcore, Gabber/ID&T/001628/Track Listing.txt |
1 KB |
| Hardcore, Gabber/ID&T/001628/track01.mp3 |
5.3 MB |
| Hardcore, Gabber/ID&T/001628/track02.mp3 |
20.6 MB |
| Hardcore, Gabber/ID&T/7001625/DJ Promo - A1 Dancefloor Hardcore.mp3 |
3.5 MB |
| Hardcore, Gabber/ID&T/7001625/DJ Promo - A2 Dancefloor Hardcore (Hard Anthem Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/ID&T/7001625/DJ Promo - B1 X-Termination.mp3 |
3.4 MB |
| Hardcore, Gabber/ID&T/7001625/Innerdrive - B2 Random Response.mp3 |
6.4 MB |
| Hardcore, Gabber/ID&T/7001635/A1 DJ Promo - What The Fuck.mp3 |
6.8 MB |
| Hardcore, Gabber/ID&T/7001635/A2 DJ Promo - Metal Warfare.mp3 |
7.4 MB |
| Hardcore, Gabber/ID&T/7001635/B1 DJ Promo - 20.000 Freaks.mp3 |
6.6 MB |
| Hardcore, Gabber/ID&T/7001635/B2 DJ Promo - Back In Time.mp3 |
8.2 MB |
| Hardcore, Gabber/ID&T/7001645/DJ Promo - Emotions Over Anger.mp3 |
4.5 MB |
| Hardcore, Gabber/ID&T/7001645/DJ Promo - System Feedback.mp3 |
5.2 MB |
| Hardcore, Gabber/ID&T/7001645/DJ Promo featuring X-Ess - Vicious Circle.mp3 |
3.7 MB |
| Hardcore, Gabber/ID&T/7001645/Innerdrive - B2 Going Mental.mp3 |
7.4 MB |
| Hardcore, Gabber/ID&T/7001655/DJ Promo - A1 Guns 'N Ammo (Under Construction Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/ID&T/7001655/DJ Promo - A2 Driven By Instinct.mp3 |
5 MB |
| Hardcore, Gabber/ID&T/7001655/DJ Promo - B1 Up Yours.mp3 |
4.5 MB |
| Hardcore, Gabber/ID&T/7001655/Innerdrive - B2 First Pulse.mp3 |
5.7 MB |
| Hardcore, Gabber/ID&T/7001665/DJ Promo - A1 The Darkness (Intro).mp3 |
2.3 MB |
| Hardcore, Gabber/ID&T/7001665/DJ Promo - A2 Broaden Our Minds.mp3 |
6 MB |
| Hardcore, Gabber/ID&T/7001665/DJ Promo - A3 Patterns In Chaos.mp3 |
5.2 MB |
| Hardcore, Gabber/ID&T/7001665/DJ Promo - B2 Counter Attack.mp3 |
8.7 MB |
| Hardcore, Gabber/ID&T/7001665/DJ Promo vs Catscan - B1 Midnight Impact.mp3 |
6.9 MB |
| Hardcore, Gabber/ID&T/7001675/A1 DJ Promo - The Industry Can't Stop Me.mp3 |
7.2 MB |
| Hardcore, Gabber/ID&T/7001675/A2 DJ Promo - The Bad Guy.mp3 |
5.9 MB |
| Hardcore, Gabber/ID&T/7001675/B1 DJ Promo & Catscan - Battle Of Sexes.mp3 |
7.7 MB |
| Hardcore, Gabber/ID&T/7001675/B2 DJ Promo & Trickstyle - What U Want.mp3 |
6.7 MB |
| Hardcore, Gabber/ID&T/7003155/A1. Catscan - Wo III.mp3 |
5.6 MB |
| Hardcore, Gabber/ID&T/7003155/B1. Catscan - Still dead.mp3 |
6.1 MB |
| Hardcore, Gabber/ID&T/8800915/01-AudioTrack 01.mp3 |
6.6 MB |
| Hardcore, Gabber/ID&T/8800915/02-AudioTrack 02.mp3 |
26.5 MB |
| Hardcore, Gabber/ID&T/8800915/Tracklisting.txt |
831 B |
| Hardcore, Gabber/ID&T/ID&T 96-1/01 3 Steps Ahead Intro - The Thunder Anthem.mp3 |
1.3 MB |
| Hardcore, Gabber/ID&T/ID&T 96-1/02 3 Steps Ahead & DJ Weirdo & Prophet - Thunderdome 96 Live Dance Or Die !.mp3 |
12.4 MB |
| Hardcore, Gabber/ID&T/nl9020/a1 - Promo - Cold As Stone.mp3 |
9.3 MB |
| Hardcore, Gabber/ID&T/nl9020/a2 - Brian Acardy - Let Da Bass Boom.mp3 |
5.2 MB |
| Hardcore, Gabber/ID&T/nl9020/b1 - Brian Acardy - Ya Gangsta Music.mp3 |
7.1 MB |
| Hardcore, Gabber/ID&T/nl9020/b2 - Promo - Shit To Die For.mp3 |
5.5 MB |
| Hardcore, Gabber/ID&T/nl9594/a1 - buzz fuzz - fuck happy (it's bullshit).mp3 |
8 MB |
| Hardcore, Gabber/ID&T/nl9594/a2 - buzz fuzz - dreamteam's back.mp3 |
8.3 MB |
| Hardcore, Gabber/ID&T/nl9594/b1 - buzz fuzz - trippin'.mp3 |
9 MB |
| Hardcore, Gabber/ID&T/nl9594/b2 - buzz fuzz - the lighthousekeeper.mp3 |
7.3 MB |
| Hardcore, Gabber/ID&T/thunder12mix/01_radio_version-hm.mp3 |
5.6 MB |
| Hardcore, Gabber/ID&T/thunder12mix/New Text Document.txt |
185 B |
| Hardcore, Gabber/ID&T/thunder12mix/Track Listing.txt |
185 B |
| Hardcore, Gabber/ID&T/[id&t mas 001] - the masochist - masochizm/A1 - The Masochist - Masochizm.MP3 |
3.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 001] - the masochist - masochizm/A2 - The Masochist - Something Like This.mp3 |
4.6 MB |
| Hardcore, Gabber/ID&T/[id&t mas 001] - the masochist - masochizm/B1 - The Masochist - Mechanism In Da Brain.mp3 |
6.3 MB |
| Hardcore, Gabber/ID&T/[id&t mas 001] - the masochist - masochizm/B2 - The Masochist - Whores In Da House.mp3 |
4.7 MB |
| Hardcore, Gabber/ID&T/[id&t mas 002] - the masochist - the 2nd strike/A1 - The Masochist - Killing Scum.MP3 |
3.6 MB |
| Hardcore, Gabber/ID&T/[id&t mas 002] - the masochist - the 2nd strike/A2 - The Masochist - No Newstyle.MP3 |
3.1 MB |
| Hardcore, Gabber/ID&T/[id&t mas 002] - the masochist - the 2nd strike/B1 - The Masochist - Planet Shock.mp3 |
4.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 002] - the masochist - the 2nd strike/B2 - The Masochist - That's Fresh.mp3 |
6.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 002] - the masochist - the 2nd strike/B3 - The Masochist - Bad Girls.mp3 |
4.1 MB |
| Hardcore, Gabber/ID&T/[id&t mas 003] - the masochist - volume 3/A1 - The Masochist - Cold Cage.mp3 |
4.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 003] - the masochist - volume 3/A2 - The Masochist - Can't Hold Back.mp3 |
4.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 003] - the masochist - volume 3/B1 - The Masochist - Over Dose.MP3 |
2.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 003] - the masochist - volume 3/B2 - The Masochist - Let's Go.mp3 |
4.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 004] - the masochist - the remixes/A1 - The Masochist - No Newstyle [Buzz Fuzz Remix].mp3 |
3.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 004] - the masochist - the remixes/A2 - The Masochist - No Newstyle [Dj Paul's Hardhouse Remix].MP3 |
2.7 MB |
| Hardcore, Gabber/ID&T/[id&t mas 004] - the masochist - the remixes/B1 - The Masochist - Killing Scum [Dj Promo Meets Shaolin Remix].mp3 |
5.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 004] - the masochist - the remixes/B2 - The Masochist - Killing Scum [Sound Enhancers Remix].mp3 |
4.3 MB |
| Hardcore, Gabber/ID&T/[id&t mas 005] - the masochist - the fifth edition/A1 - The Masochist - MzKzM.MP3 |
3.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 005] - the masochist - the fifth edition/A2 - The Masochist - Hitsound.mp3 |
5.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 005] - the masochist - the fifth edition/B1 - The Masochist - Pump Me What.MP3 |
3.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 005] - the masochist - the fifth edition/B2 - The Masochist - Re-Incarnation.mp3 |
4.4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 006] - the masochist - 6/A1 - The Masochist - Funky Dope.mp3 |
4.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 006] - the masochist - 6/A2 - The Masochist - Won't Love 'Em.mp3 |
4 MB |
| Hardcore, Gabber/ID&T/[id&t mas 006] - the masochist - 6/B1 - The Masochist - Maso Feelings.mp3 |
4.7 MB |
| Hardcore, Gabber/ID&T/[id&t mas 006] - the masochist - 6/B2 - The Masochist - Bad 2 Da Bone.mp3 |
5.3 MB |
| Hardcore, Gabber/ID&T/[id&t mas 007] - the masochist - the seventh religion/A1 - The Masochist - Anticipation .MP3 |
3.5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 007] - the masochist - the seventh religion/A2 - The Masochist - Chant.mp3 |
3.9 MB |
| Hardcore, Gabber/ID&T/[id&t mas 007] - the masochist - the seventh religion/B1 - The Masochist - Don't Give A Shit.mp3 |
5 MB |
| Hardcore, Gabber/ID&T/[id&t mas 007] - the masochist - the seventh religion/B2 - The Masochist - Da Damn Record.mp3 |
6.4 MB |
| Hardcore, Gabber/Impulse/ir004/A1 Tommyknocker - Fuck This Track Up (Tommy Mix).mp3 |
7.4 MB |
| Hardcore, Gabber/Independance/ir 0221 promo up yours (12)/a1-dj_promo_-_up_yours_(2002_remix)-hb.mp3 |
6.8 MB |
| Hardcore, Gabber/Independance/ir 0221 promo up yours (12)/b1-dj_promo_-_up_yours_(original_mix)-hb.mp3 |
8.9 MB |
| Hardcore, Gabber/Industrial Movement/im001/a1_terrorfakt_-_spineless-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Movement/im001/a2_terrorfakt_-_no_mercy-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Industrial Movement/im001/b1_terrorfakt_-_malice-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Movement/im001/b2_terrorfakt_-_furak-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Movement/im002/a1_d-passion_-_kind_of_rude-sq.mp3 |
9.5 MB |
| Hardcore, Gabber/Industrial Movement/im002/a2_d-passion_-_a_promise_to_keep-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Industrial Movement/im002/b1_d-passion_-_blacklist_amok-sq.mp3 |
9.8 MB |
| Hardcore, Gabber/Industrial Movement/im002/b2_d-passion_-_blacklist_amok_(im_break_mix)-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Industrial Movement/im003/a1_acrosome_-_for_a_master-sq.mp3 |
4.9 MB |
| Hardcore, Gabber/Industrial Movement/im003/a2_acrosome_-_wake_up_america-sq.mp3 |
5.9 MB |
| Hardcore, Gabber/Industrial Movement/im003/b1_acrosome_-_unstoppable_lies-sq.mp3 |
4.5 MB |
| Hardcore, Gabber/Industrial Movement/im003/b2_acrosome_-_running_on_the_wheels-sq.mp3 |
4.7 MB |
| Hardcore, Gabber/Industrial Movement/im004/a1 Hexadecimal Bad Mood.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Movement/im004/b1 the world has changed.mp3 |
7.2 MB |
| Hardcore, Gabber/Industrial Movement/im004/b2 nemesis 2k4.mp3 |
7.5 MB |
| Hardcore, Gabber/Industrial Movement/im005/a1 electronic pig.mp3 |
7 MB |
| Hardcore, Gabber/Industrial Movement/im005/a2 the boars interlude.mp3 |
632 KB |
| Hardcore, Gabber/Industrial Movement/im005/a3 electro nicpig.mp3 |
4.9 MB |
| Hardcore, Gabber/Industrial Movement/im005/a4 whitest tightest.mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Movement/im005/b1 pigue belgique.mp3 |
885 KB |
| Hardcore, Gabber/Industrial Movement/im005/b2 deep as dark.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Movement/im005/b3 pig-a-pella.mp3 |
1.9 MB |
| Hardcore, Gabber/Industrial Movement/im005/b4 deep as dark (torgull remix).mp3 |
7.5 MB |
| Hardcore, Gabber/Industrial Movement/im006/a1 hypersensitive.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Movement/im006/a2 thorazine.mp3 |
8 MB |
| Hardcore, Gabber/Industrial Movement/im006/b1 pain forever.mp3 |
7.3 MB |
| Hardcore, Gabber/Industrial Movement/im006/b2 erotomechanical mania.mp3 |
7.4 MB |
| Hardcore, Gabber/Industrial Movement/im008/a1_life_runs_red_-_veleno-sq.mp3 |
8 MB |
| Hardcore, Gabber/Industrial Movement/im008/a2_life_runs_red_-_evolution_4_am-sq.mp3 |
8.8 MB |
| Hardcore, Gabber/Industrial Movement/im008/b1_life_runs_red_-_soul_scars-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Industrial Movement/im008/b2_life_runs_red_-_dawn_of_a_new_era-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Industrial Movement/im009/a1_d-passion_-_twist_your_brain.mp3 |
9 MB |
| Hardcore, Gabber/Industrial Movement/im009/a2_d-passion_-_missing_in_action.mp3 |
6.8 MB |
| Hardcore, Gabber/Industrial Movement/im009/b1_d-passion_-_0_percent_fat.mp3 |
9.4 MB |
| Hardcore, Gabber/Industrial Movement/im009/b2_d-passion_-_possessed.mp3 |
11.6 MB |
| Hardcore, Gabber/Industrial Movement/im011/00_broken_rules_-_put_your_back_into_it-(im011)-vinyl-2007.m3u |
150 B |
| Hardcore, Gabber/Industrial Movement/im011/00_broken_rules_-_put_your_back_into_it-(im011)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Industrial Movement/im011/00_broken_rules_-_put_your_back_into_it-(im011)-vinyl-2007.sfv |
186 B |
| Hardcore, Gabber/Industrial Movement/im011/a1_broken_rules_-_put_your_back_into_it.mp3 |
9 MB |
| Hardcore, Gabber/Industrial Movement/im011/a2_broken_rules_-_jackin_moves.mp3 |
9.4 MB |
| Hardcore, Gabber/Industrial Movement/im011/b1_broken_rules_-_4_walls.mp3 |
7.5 MB |
| Hardcore, Gabber/Industrial Movement/im011/b2_broken_rules_-_going_with_feeling.mp3 |
8.7 MB |
| Hardcore, Gabber/Industrial Movement/im012/00_dep_affect_-_we_who_dont_exist-(im012)-vinyl-2007.m3u |
149 B |
| Hardcore, Gabber/Industrial Movement/im012/00_dep_affect_-_we_who_dont_exist-(im012)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Industrial Movement/im012/00_dep_affect_-_we_who_dont_exist-(im012)-vinyl-2007.sfv |
185 B |
| Hardcore, Gabber/Industrial Movement/im012/a1_dep_affect_-_we_who_dont_exist.mp3 |
10.1 MB |
| Hardcore, Gabber/Industrial Movement/im012/a2_dep_affect_-_behind_my_mind.mp3 |
10.5 MB |
| Hardcore, Gabber/Industrial Movement/im012/b1_dep_affect_-_demonstration_of_denial.mp3 |
9.8 MB |
| Hardcore, Gabber/Industrial Movement/im012/b2_dep_affect_-_walrus_worm.mp3 |
9.2 MB |
| Hardcore, Gabber/Industrial Strength/is001/(aa2) the mover - nightflight.mp3 |
7.4 MB |
| Hardcore, Gabber/Industrial Strength/is002/a1.turbulence - whurlwind.mp3 |
5.1 MB |
| Hardcore, Gabber/Industrial Strength/is002/b1.turbulence - whurlstorm (the mover remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Industrial Strength/is004/a2.industrial high - militant core (loud mix).mp3 |
5.1 MB |
| Hardcore, Gabber/Industrial Strength/is004/b1.industrial high - what the fuck.mp3 |
4.6 MB |
| Hardcore, Gabber/Industrial Strength/is004/b2.industrial high - rotation.mp3 |
5.2 MB |
| Hardcore, Gabber/Industrial Strength/is005/(a1) glitch - brain circuit surgery (circuit breaker remix).mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Strength/is005/(b1) glitch - brain circuit surgery (second opinion).mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is005/(b2) glitch - brain circuit surgery (initial incision).mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is006/(a1) english muffin - ride.mp3 |
7 MB |
| Hardcore, Gabber/Industrial Strength/is006/(a2) english muffin - dust muffin (toasted remix).mp3 |
6.4 MB |
| Hardcore, Gabber/Industrial Strength/is006/(b1) crowd control - robots.mp3 |
7.5 MB |
| Hardcore, Gabber/Industrial Strength/is006/(b2) crowd control - tranzformer (frankfurt remix).mp3 |
5.7 MB |
| Hardcore, Gabber/Industrial Strength/is007/(a1) disintegrator - locked on target.mp3 |
5.2 MB |
| Hardcore, Gabber/Industrial Strength/is007/(a2) disintegrator - 99.9.mp3 |
5 MB |
| Hardcore, Gabber/Industrial Strength/is007/(b1) disintegrator - dark black ominous clouds.mp3 |
6.8 MB |
| Hardcore, Gabber/Industrial Strength/is007/(b2) disintegrator - in the sun.mp3 |
5.9 MB |
| Hardcore, Gabber/Industrial Strength/is008/(a1) amiga trax - terrorists.mp3 |
2.8 MB |
| Hardcore, Gabber/Industrial Strength/is008/(a2) amiga trax - hummel.mp3 |
3.2 MB |
| Hardcore, Gabber/Industrial Strength/is008/(a3) amiga trax - that energy.mp3 |
2.5 MB |
| Hardcore, Gabber/Industrial Strength/is008/(b1) amiga trax - hardcore.mp3 |
2.7 MB |
| Hardcore, Gabber/Industrial Strength/is008/(b2) amiga trax - shot this motherfucker.mp3 |
3.5 MB |
| Hardcore, Gabber/Industrial Strength/is008/(b3) amiga trax - mullah.mp3 |
3.5 MB |
| Hardcore, Gabber/Industrial Strength/is009/(a1) disintegrator - disintegrated.mp3 |
3.6 MB |
| Hardcore, Gabber/Industrial Strength/is009/(b1) dX-13 - decimate intensity.mp3 |
5.6 MB |
| Hardcore, Gabber/Industrial Strength/is010/(a1) glitch - warpath.mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Strength/is010/(b1) glitch - heavy metal.mp3 |
6.4 MB |
| Hardcore, Gabber/Industrial Strength/is011/(b1) english muffin - you should have been smarter.mp3 |
4.4 MB |
| Hardcore, Gabber/Industrial Strength/is011/(b2) english muffin - follow the leader.mp3 |
2.5 MB |
| Hardcore, Gabber/Industrial Strength/is012/(a1) dx-13 - sistem hard.mp3 |
4.4 MB |
| Hardcore, Gabber/Industrial Strength/is012/(a2) dx-13 - illuminatous.mp3 |
5.8 MB |
| Hardcore, Gabber/Industrial Strength/is012/(b1) dx-13 - no1.mp3 |
5.2 MB |
| Hardcore, Gabber/Industrial Strength/is012/(b2) dx-13 - x-oudus.mp3 |
4.6 MB |
| Hardcore, Gabber/Industrial Strength/is012/(b3) dx-13 - strength.mp3 |
744 KB |
| Hardcore, Gabber/Industrial Strength/is013/(a1) dj delirium - underground.mp3 |
10.8 MB |
| Hardcore, Gabber/Industrial Strength/is013/(a2) dj delirium - shnoze berry.mp3 |
3.7 MB |
| Hardcore, Gabber/Industrial Strength/is013/(b1) dj delirium - feelin' unnecessary.mp3 |
7.8 MB |
| Hardcore, Gabber/Industrial Strength/is013/(b2) dj delirium - i'm going mad.mp3 |
9.4 MB |
| Hardcore, Gabber/Industrial Strength/is014/(a1) caustic visions - purple microdots.mp3 |
5.6 MB |
| Hardcore, Gabber/Industrial Strength/is014/(a2) caustic visions - volatile surge.mp3 |
4.4 MB |
| Hardcore, Gabber/Industrial Strength/is014/(a3) caustic visions - needle damage.mp3 |
3 MB |
| Hardcore, Gabber/Industrial Strength/is014/(b1) caustic visions - malignity.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is014/(b2) caustic visions - compression.mp3 |
4.5 MB |
| Hardcore, Gabber/Industrial Strength/is014/(b3) caustic visions - adrenal cortex abuse.mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is015/(a1) mind candy - u trippin.mp3 |
8.1 MB |
| Hardcore, Gabber/Industrial Strength/is015/(a2) mind candy - mind destroyer.mp3 |
8.3 MB |
| Hardcore, Gabber/Industrial Strength/is015/(b1) mind candy - captured moment.mp3 |
7.7 MB |
| Hardcore, Gabber/Industrial Strength/is015/(b2) mind candy - hard core.mp3 |
5.3 MB |
| Hardcore, Gabber/Industrial Strength/is017/(a1) lenny dee - fuckin hostile (disintegrator remix).mp3 |
5.8 MB |
| Hardcore, Gabber/Industrial Strength/is017/(a2) lenny dee - i don't understand this.mp3 |
5.2 MB |
| Hardcore, Gabber/Industrial Strength/is017/(b1) lenny dee - fuckin hostile.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is017/(b2) lenny dee - fuckin hostile (brooklyn remix).mp3 |
4.3 MB |
| Hardcore, Gabber/Industrial Strength/is018/a1.spy - pathogen.mp3 |
4.6 MB |
| Hardcore, Gabber/Industrial Strength/is018/b1.spy - bloodstrike.mp3 |
7.1 MB |
| Hardcore, Gabber/Industrial Strength/is019/a1.laura grabb - 1k.mp3 |
5.3 MB |
| Hardcore, Gabber/Industrial Strength/is019/a2.laura grabb - force factor.mp3 |
4.6 MB |
| Hardcore, Gabber/Industrial Strength/is019/b1.laura grabb - ion spot.mp3 |
4.8 MB |
| Hardcore, Gabber/Industrial Strength/is019/b2.laura grabb - dark space.mp3 |
4.6 MB |
| Hardcore, Gabber/Industrial Strength/is020/(a1) dx 13 - mother fucking new york.mp3 |
3.6 MB |
| Hardcore, Gabber/Industrial Strength/is020/(a2) dx 13 - digital transfer.mp3 |
4.5 MB |
| Hardcore, Gabber/Industrial Strength/is020/(b1) dx 13 - electro comp.mp3 |
4.8 MB |
| Hardcore, Gabber/Industrial Strength/is020/(b2) dx 13 - atomic age imagination.mp3 |
3.3 MB |
| Hardcore, Gabber/Industrial Strength/is021/(a1) caustic visions - distrought.mp3 |
6.3 MB |
| Hardcore, Gabber/Industrial Strength/is021/(a2) caustic visions - abrasion.mp3 |
6.8 MB |
| Hardcore, Gabber/Industrial Strength/is021/(a3) caustic visions - amphetamines.mp3 |
6.8 MB |
| Hardcore, Gabber/Industrial Strength/is021/(b1) caustic visions - decimate humanity.mp3 |
8.3 MB |
| Hardcore, Gabber/Industrial Strength/is021/(b2) caustic visions - circuit abuse.mp3 |
6.9 MB |
| Hardcore, Gabber/Industrial Strength/is021/(b3) caustic visions - train of thought.mp3 |
4.7 MB |
| Hardcore, Gabber/Industrial Strength/is023/(a1) temper tantrum - industrial strength.mp3 |
7 MB |
| Hardcore, Gabber/Industrial Strength/is023/(a2) temper tantrum - africa 4010.mp3 |
6.1 MB |
| Hardcore, Gabber/Industrial Strength/is023/(b1) temper tantrum - you're going down.mp3 |
6 MB |
| Hardcore, Gabber/Industrial Strength/is023/(b2) temper tantrum - hardcore 94.mp3 |
5.1 MB |
| Hardcore, Gabber/Industrial Strength/is023/(b3) temper tantrum - we are us.mp3 |
1.6 MB |
| Hardcore, Gabber/Industrial Strength/is024/(a1) d.o.a. - wanna be a gangsta.mp3 |
2.4 MB |
| Hardcore, Gabber/Industrial Strength/is024/(a2) doa - zu leiten.mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is024/(b1) doa - ya mutha.mp3 |
4.8 MB |
| Hardcore, Gabber/Industrial Strength/is024/(b2) d.o.a. - dance with me (remix).mp3 |
1.8 MB |
| Hardcore, Gabber/Industrial Strength/is024/(b3) d.o.a. - chemical warfare.mp3 |
3.4 MB |
| Hardcore, Gabber/Industrial Strength/is024/(c1) d.o.a. - poisoned with strychnine.mp3 |
4.3 MB |
| Hardcore, Gabber/Industrial Strength/is024/(c2) d.o.a. - my house.mp3 |
3.6 MB |
| Hardcore, Gabber/Industrial Strength/is024/(d1) d.o.a. - upon the power.mp3 |
3.5 MB |
| Hardcore, Gabber/Industrial Strength/is024/(d2) doa - ya mutha (part 2).mp3 |
2.1 MB |
| Hardcore, Gabber/Industrial Strength/is024/(d3) d.o.a. - hardcore kidz.mp3 |
3.6 MB |
| Hardcore, Gabber/Industrial Strength/is025/(a2) john selway - in the machine (dj dano remix).mp3 |
6 MB |
| Hardcore, Gabber/Industrial Strength/is026/(a1) dj skinhead - remixen.mp3 |
2.4 MB |
| Hardcore, Gabber/Industrial Strength/is026/(a2) dj skinhead - extreme terror (the gangster remix).mp3 |
3.5 MB |
| Hardcore, Gabber/Industrial Strength/is026/(a3) dj skinhead - extreme terror (strenght of terror remix).mp3 |
4 MB |
| Hardcore, Gabber/Industrial Strength/is026/(b1) dj skinhead - extreme terror (n.y. speedcore remix).mp3 |
3.3 MB |
| Hardcore, Gabber/Industrial Strength/is026/(b2) dj skinhead - extreme terror (the pain remix).mp3 |
4.3 MB |
| Hardcore, Gabber/Industrial Strength/is026/(b3) dj skinhead - extreme terror (disciples of annihilation remix).mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Strength/is027/a1.strychnine - utopia.mp3 |
5 MB |
| Hardcore, Gabber/Industrial Strength/is027/a2.strychnine - utopia (trance mix).mp3 |
5.1 MB |
| Hardcore, Gabber/Industrial Strength/is027/b1.strychnine - the sacrafice.mp3 |
5.6 MB |
| Hardcore, Gabber/Industrial Strength/is027/b2.strychnine - the sacrafice (dissonant energy mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Industrial Strength/is028/a1.rob gee - gabber up your ass.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is028/b1.rob gee - eeg bor.mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is028/b2.rob gee - 909 hit me 1 time.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is029/(a1) ralphie dee - mad as hell.mp3 |
6.9 MB |
| Hardcore, Gabber/Industrial Strength/is029/(a2) ralphie dee - ruffneck.mp3 |
7.5 MB |
| Hardcore, Gabber/Industrial Strength/is029/(b1) ralphie dee - dance now.mp3 |
6.8 MB |
| Hardcore, Gabber/Industrial Strength/is029/(b2) ralphie dee - oh yea.mp3 |
6.6 MB |
| Hardcore, Gabber/Industrial Strength/is030/A1 - Nasenbluten - Feeling Shit.mp3 |
3.3 MB |
| Hardcore, Gabber/Industrial Strength/is030/A2 - Nasenbluten - Dirty Rotten Bastard.mp3 |
1.1 MB |
| Hardcore, Gabber/Industrial Strength/is030/B1 - Nasenbluten - No More Fuckin Soul.mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is030/B2 - Nasenbluten - Cunt Face.mp3 |
4 MB |
| Hardcore, Gabber/Industrial Strength/is030/C1 - Nasenbluten - Concrete Compressor.mp3 |
4.3 MB |
| Hardcore, Gabber/Industrial Strength/is030/C2 - Nasenbluten - Blowf T' The Nose.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is030/D1 - Nasenbluten - Kill More People.mp3 |
2.2 MB |
| Hardcore, Gabber/Industrial Strength/is030/D2 - Nasenbluten - Cock Sucker.mp3 |
4 MB |
| Hardcore, Gabber/Industrial Strength/is030/D3 - Nasenbluten - Fuck S.F..mp3 |
3.7 MB |
| Hardcore, Gabber/Industrial Strength/is031/a1 - Delta 9 - Never Stop.mp3 |
4.3 MB |
| Hardcore, Gabber/Industrial Strength/is031/b1 - Delta 9 - Real Hardcore.mp3 |
4.2 MB |
| Hardcore, Gabber/Industrial Strength/is031/b2 - Delta 9 - 246.mp3 |
4.7 MB |
| Hardcore, Gabber/Industrial Strength/is036/a1 - Delta 9 - No More Regrets.mp3 |
6.2 MB |
| Hardcore, Gabber/Industrial Strength/is036/a2 - Delta 9 - Son Of A Bitch.mp3 |
7 MB |
| Hardcore, Gabber/Industrial Strength/is036/b1 - Delta 9 - Atomizer.mp3 |
4.4 MB |
| Hardcore, Gabber/Industrial Strength/is036/b2 - Delta 9 - Watch Yer Back.mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - 7 dont fuck around.mp3 |
4.6 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - airstrikes.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - beer beer beer.mp3 |
1.3 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - big gonads.mp3 |
2.2 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - bloody hell.mp3 |
703 KB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - enema bandit.mp3 |
2.4 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - greedy bitch.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - knobs & knockers.mp3 |
4.3 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - lurid.mp3 |
3.9 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - machette.mp3 |
4.7 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - punks jump up to get beat down.mp3 |
4.1 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - sex in a trench.mp3 |
176 KB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - sex referances.mp3 |
718 KB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - the lassie feeling.mp3 |
3.7 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - there it is.mp3 |
590 KB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - wagga wagga wagga is wrong.mp3 |
1.6 MB |
| Hardcore, Gabber/Industrial Strength/is044/nasenbluten - wallsend police.mp3 |
1 MB |
| Hardcore, Gabber/Industrial Strength/is050/B2. Belladonnakillz - Hektik.mp3 |
6.8 MB |
| Hardcore, Gabber/Industrial Strength/is053/a1 - stormtrooper - headline deadline.mp3 |
6.1 MB |
| Hardcore, Gabber/Industrial Strength/is053/a2 - stormtrooper - kollateralschaden.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Strength/is053/b1 - stormtrooper - todesvoegel.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Strength/is053/b2 - stormtrooper - chloe gets it.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Strength/is057/a1_stormtrooper_-_hatred-sq.mp3 |
6.2 MB |
| Hardcore, Gabber/Industrial Strength/is057/a2_stormtrooper_-_beg_4_it-sq.mp3 |
6.4 MB |
| Hardcore, Gabber/Industrial Strength/is057/b1_stormtrooper_-_existenz-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Industrial Strength/is057/b2_stormtrooper_-_for_cw-sq.mp3 |
6.2 MB |
| Hardcore, Gabber/Industrial Strength/is058/01_dj_skinhead-the_ultimate_cumshot.mp3 |
6.4 MB |
| Hardcore, Gabber/Industrial Strength/is058/02_dj_skinhead-at_war_again_(promo_remix).mp3 |
8.8 MB |
| Hardcore, Gabber/Industrial Strength/is058/03_dj_skinhead-at_war_again_(unexist_and_lenny_dee_remix).mp3 |
6.4 MB |
| Hardcore, Gabber/Industrial Strength/is062/00_stormtrooper_-_operation_destruction-(isr062)-vinyl-2006.m3u |
151 B |
| Hardcore, Gabber/Industrial Strength/is062/00_stormtrooper_-_operation_destruction-(isr062)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Industrial Strength/is062/00_stormtrooper_-_operation_destruction-(isr062)-vinyl-2006.sfv |
191 B |
| Hardcore, Gabber/Industrial Strength/is062/a1_stormtrooper_-_operation_destruction.mp3 |
9.7 MB |
| Hardcore, Gabber/Industrial Strength/is062/a2_stormtrooper_-_and_a_storm_arose.mp3 |
11 MB |
| Hardcore, Gabber/Industrial Strength/is062/b1_stormtrooper_-_re-choir-ed.mp3 |
12.5 MB |
| Hardcore, Gabber/Industrial Strength/is062/b2_stormtrooper_-_eisenfaust.mp3 |
9 MB |
| Hardcore, Gabber/Industrial Strength/is063/a1_tymon_-_kickn_da_flow.mp3 |
12 MB |
| Hardcore, Gabber/Industrial Strength/is063/a2_audiosex_-_better_kill_others_than_yourself.mp3 |
7.5 MB |
| Hardcore, Gabber/Industrial Strength/is063/b1_messiahcorps_-_wmd.mp3 |
8.8 MB |
| Hardcore, Gabber/Industrial Strength/is063/b2_dj_partyraiser_and_the_negotiator_-_no_negotiations.mp3 |
8.1 MB |
| Hardcore, Gabber/Industrial Strength/is064/00_tieum_and_ophidian_-_nothing_i_cant_handle-(isr064)-vinyl-2006.m3u |
168 B |
| Hardcore, Gabber/Industrial Strength/is064/00_tieum_and_ophidian_-_nothing_i_cant_handle-(isr064)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Industrial Strength/is064/00_tieum_and_ophidian_-_nothing_i_cant_handle-(isr064)-vinyl-2006.sfv |
204 B |
| Hardcore, Gabber/Industrial Strength/is064/a1_tieum_and_ophidian_-_nothing_i_cant_handle.mp3 |
8.2 MB |
| Hardcore, Gabber/Industrial Strength/is064/a2_tieum_and_ophidian_-_not_in_kansas.mp3 |
6.6 MB |
| Hardcore, Gabber/Industrial Strength/is064/b1_tieum_and_ophidian_-_be_careful.mp3 |
6.9 MB |
| Hardcore, Gabber/Industrial Strength/is064/b2_tieum_and_ophidian_-_touch_it.mp3 |
8 MB |
| Hardcore, Gabber/Industrial Strength/is065/00_tymon_-_distort_reality-(isr065)-vinyl-2006.m3u |
208 B |
| Hardcore, Gabber/Industrial Strength/is065/00_tymon_-_distort_reality-(isr065)-vinyl-2006.nfo |
8 KB |
| Hardcore, Gabber/Industrial Strength/is065/00_tymon_-_distort_reality-(isr065)-vinyl-2006.sfv |
280 B |
| Hardcore, Gabber/Industrial Strength/is065/a1_tymon_-_now_whos_laughing.mp3 |
10.1 MB |
| Hardcore, Gabber/Industrial Strength/is065/a2_tymon_-_faith.mp3 |
10.2 MB |
| Hardcore, Gabber/Industrial Strength/is065/b1_tymon_-_gucci.mp3 |
9.1 MB |
| Hardcore, Gabber/Industrial Strength/is065/b2_tymon_-_freefalling.mp3 |
10.2 MB |
| Hardcore, Gabber/Industrial Strength/is065/c1_tymon_-_rockajam.mp3 |
10.6 MB |
| Hardcore, Gabber/Industrial Strength/is065/c2_tymon_-_passing_by.mp3 |
9.3 MB |
| Hardcore, Gabber/Industrial Strength/is065/d1_tymon_-_destroy_techno.mp3 |
8.8 MB |
| Hardcore, Gabber/Industrial Strength/is065/d2_tymon_-_redemption.mp3 |
10.3 MB |
| Hardcore, Gabber/Industrial Strength/is066/a1_the_speed_freak_-_cucumbah.mp3 |
8.7 MB |
| Hardcore, Gabber/Industrial Strength/is066/a2_the_speed_freak_-_give_me_a_call.mp3 |
6.7 MB |
| Hardcore, Gabber/Industrial Strength/is066/b1_the_speed_freak_-_(alt)and(ctrl)and(del)_(loopwars_01).mp3 |
9.1 MB |
| Hardcore, Gabber/Industrial Strength/is066/b2_the_speed_freak_-_the_final_truth.mp3 |
9 MB |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/00_daisy_and_stormtrooper_-_disturbing_creatures-(isr067)-vinyl-2006.m3u |
199 B |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/00_daisy_and_stormtrooper_-_disturbing_creatures-(isr067)-vinyl-2006.nfo |
8 KB |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/00_daisy_and_stormtrooper_-_disturbing_creatures-(isr067)-vinyl-2006.sfv |
235 B |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/a1_daisy_and_stormtrooper_-_disturbing_creatures.mp3 |
10.3 MB |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/a2_daisy_and_stormtrooper_-_santo_tiato.mp3 |
9.5 MB |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/b1_daisy_and_stormtrooper_-_mindwalkers.mp3 |
8.7 MB |
| Hardcore, Gabber/Industrial Strength/is067/Daisy_and_Stormtrooper_-_Disturbing_Creatures-(ISR067)-Vinyl-2006-SQ/b2_daisy_and_stormtrooper_-_mindwalkers_(tymon_remix).mp3 |
11.5 MB |
| Hardcore, Gabber/Industrial Strength/is069/00_satronica_-_last_caress-(isr069)-vinyl-2007.m3u |
132 B |
| Hardcore, Gabber/Industrial Strength/is069/00_satronica_-_last_caress-(isr069)-vinyl-2007.nfo |
7 KB |
| Hardcore, Gabber/Industrial Strength/is069/00_satronica_-_last_caress-(isr069)-vinyl-2007.sfv |
162 B |
| Hardcore, Gabber/Industrial Strength/is069/a1_satronica_-_last_caress_(the_revolution_theory_mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Industrial Strength/is069/b1_satronica_-_u.r.a._(the_joe_delph_song).mp3 |
4.7 MB |
| Hardcore, Gabber/Industrial Strength/is069/b2_satronica_-_filler.mp3 |
3.6 MB |
| Hardcore, Gabber/Industrial Strength/is070/a1_the_emperator_and_chromatic_-_mental_fear.mp3 |
8.1 MB |
| Hardcore, Gabber/Industrial Strength/is070/a2_koney_-_unregistered.mp3 |
8 MB |
| Hardcore, Gabber/Industrial Strength/is070/b1_stan_grewzell_-_das_grauen.mp3 |
7.8 MB |
| Hardcore, Gabber/Industrial Strength/is070/b2_timetwister_-_ancestral_recall.mp3 |
7.2 MB |
| Hardcore, Gabber/Industrial Strength/is074/00_tymon-feed-(isr74)-vinyl-2007.m3u |
111 B |
| Hardcore, Gabber/Industrial Strength/is074/00_tymon-feed-(isr74)-vinyl-2007.nfo |
1 KB |
| Hardcore, Gabber/Industrial Strength/is074/00_tymon-feed-(isr74)-vinyl-2007.sfv |
147 B |
| Hardcore, Gabber/Industrial Strength/is074/a1_tymon-rusted_nuts_and_bolts.mp3 |
10.1 MB |
| Hardcore, Gabber/Industrial Strength/is074/a2_tymon-rattle_brain.mp3 |
9.2 MB |
| Hardcore, Gabber/Industrial Strength/is074/b1_tymon-psycho_killer.mp3 |
8.8 MB |
| Hardcore, Gabber/Industrial Strength/is074/b2_tymon-vengeance.mp3 |
8.4 MB |
| Hardcore, Gabber/Industrial Strength/is076/00_sick_dj_team_-_untitled-(isr076-web)-2008-dd.m3u |
109 B |
| Hardcore, Gabber/Industrial Strength/is076/00_sick_dj_team_-_untitled-(isr076-web)-2008-dd.nfo |
6 KB |
| Hardcore, Gabber/Industrial Strength/is076/00_sick_dj_team_-_untitled-(isr076-web)-2008-dd.sfv |
145 B |
| Hardcore, Gabber/Industrial Strength/is076/01_ganja_machine-dd.mp3 |
13.2 MB |
| Hardcore, Gabber/Industrial Strength/is076/02_i_dont_understand_feat._julie_dee-dd.mp3 |
16.5 MB |
| Hardcore, Gabber/Industrial Strength/is076/03_sc01-dd.mp3 |
14.8 MB |
| Hardcore, Gabber/Industrial Strength/is076/04_youthanasia-dd.mp3 |
12.3 MB |
| Hardcore, Gabber/Industrial Strength/isr060/a1_tieum_and_lenny_dee_-_a_better_world-sq.mp3 |
5.7 MB |
| Hardcore, Gabber/Industrial Strength/isr060/b1_tieum_and_lenny_dee_-_i_dont_like_you_either-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/_is045 (a).jpg |
385 KB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/_is045 (b).jpg |
479 KB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/_is045 (front sticker).jpg |
448 KB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/a1 - siege & menace - the plague.mp3 |
6 MB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/a2 - siege & menace - i hate you.mp3 |
5.5 MB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/b1 - siege & menace - doin' that dust.mp3 |
6.3 MB |
| Hardcore, Gabber/Industrial Strength/[is 045] siege & menace - override the negative/b2 - siege & menace - warped.mp3 |
6.2 MB |
| Hardcore, Gabber/Industrial Strength Limited/isl013/01_delta_9_-_no_more_regrets_(delta_9_and_lenny_dee_chicago_remix).mp3 |
7 MB |
| Hardcore, Gabber/Industrial Strength Limited/isl013/02_delta_9_-_no_more_regrets_(wishmaster_remix).mp3 |
6.5 MB |
| Hardcore, Gabber/Industrial Strength Limited/isl013/03_delta_9_-_no_more_regrets_(unexist_brooklyn_remix).mp3 |
6.9 MB |
| Hardcore, Gabber/Industrial Strength Limited/isl013/04_delta_9_-_no_more_regrets_(dj_inyoung_and_static_remix).mp3 |
8.7 MB |
| Hardcore, Gabber/Inferno/inf004/Bass D & King Matthew - Damn The Deejay.mp3 |
5.8 MB |
| Hardcore, Gabber/Inferno/inf006/A1 - Highlander - Hold Me Now (I'm Sorry) (Bass D & King Matthew Remix) [INF006].mp3 |
4.7 MB |
| Hardcore, Gabber/Inferno/inf006/A2 - Highlander - I'm Sorry (Original Mix) [INF006].mp3 |
4.8 MB |
| Hardcore, Gabber/Inferno/inf006/B1 - Highlander - The Incredible Soundmachine [INF006].mp3 |
3.6 MB |
| Hardcore, Gabber/Inferno/inf006/B2 - Highlander - I'm Sorry (DJ Orson Remix) [INF006].mp3 |
5.4 MB |
| Hardcore, Gabber/Inferno/inf007/A1 - Bass D & King Matthew feat. XD - Like A Dream (Bass D & King Matthew Remix) [INF007].mp3 |
5 MB |
| Hardcore, Gabber/Inferno/inf007/A2 - Bass D & King Matthew feat. XD - Like A Dream (XD Remix) [INF007].mp3 |
5.6 MB |
| Hardcore, Gabber/Inferno/inf007/B1 - Bass D & King Matthew feat. XD - Suck This... [INF007].mp3 |
3.9 MB |
| Hardcore, Gabber/Inferno/inf007/B2 - Bass D & King Matthew feat. XD - Clap Your Hands [INF007].mp3 |
4.2 MB |
| Hardcore, Gabber/Inferno/inf008/A1 - Infernus - I Want Your Love (Bass D & King Matthew Remix) [INF008].mp3 |
4.3 MB |
| Hardcore, Gabber/Inferno/inf008/A2 - Infernus - I Want Your Love (Original Happy Hardcore Mix) [INF008].mp3 |
4.3 MB |
| Hardcore, Gabber/Inferno/inf008/B1 - Infernus - I Want Your Love (UK Breakbeat Mix) [INF008].mp3 |
5.2 MB |
| Hardcore, Gabber/Inferno/inf008/B2 - Infernus - I Want Your Love (Rave Mix) [INF008].mp3 |
3.8 MB |
| Hardcore, Gabber/Inferno/inf009/A1 - Highlander - Hardcore Paradise [INF009].mp3 |
4.5 MB |
| Hardcore, Gabber/Inferno/inf009/A2 - Highlander - Open Your Eyes [INF009].mp3 |
4.1 MB |
| Hardcore, Gabber/Inferno/inf009/B1 - Highlander - Boogie Bandit Bitch [INF009].mp3 |
4.3 MB |
| Hardcore, Gabber/Inferno/inf009/B2 - Highlander - You Don't Know [INF009].mp3 |
5.4 MB |
| Hardcore, Gabber/Inferno/inf009/Highlander - Boogie Bandit Bitch.mp3 |
4.3 MB |
| Hardcore, Gabber/Inferno/inf009/Highlander - Hardcore Paradise.mp3 |
4.5 MB |
| Hardcore, Gabber/Inferno/inf009/Highlander - Open Your Eyes.mp3 |
4.1 MB |
| Hardcore, Gabber/Inferno/inf009/Highlander - You Don't Know.mp3 |
5.4 MB |
| Hardcore, Gabber/Intensive Care/(ico 007) - intensive care - the remixes part 1/_ICO 007 (front).gif |
9 KB |
| Hardcore, Gabber/Intensive Care/(ico 007) - intensive care - the remixes part 1/A1 - THE D.O.C. - Hardcore To The Penis (DJ Promo Remix).mp3 |
8.1 MB |
| Hardcore, Gabber/Intensive Care/(ico 007) - intensive care - the remixes part 1/B1 - THE D.O.C. - Out There (Dr. Z-Vago & DJ Outblast Remix).mp3 |
8.2 MB |
| Hardcore, Gabber/Intensive Care/(ico 007) - intensive care - the remixes part 1/B2 - THE D.O.C. - Hardcore To The Penis (X-Rated Remix).mp3 |
7.1 MB |
| Hardcore, Gabber/K.N.O.R/kn0063/00-human_resource_vs_pitch_-_prepare_for_glory-vinyl-2007.m3u |
193 B |
| Hardcore, Gabber/K.N.O.R/kn0063/00-human_resource_vs_pitch_-_prepare_for_glory-vinyl-2007.nfo |
597 B |
| Hardcore, Gabber/K.N.O.R/kn0063/00-human_resource_vs_pitch_-_prepare_for_glory-vinyl-2007.sfv |
220 B |
| Hardcore, Gabber/K.N.O.R/kn0063/01-human_resource_vs_pitch_-_prepare_for_glory.mp3 |
10.7 MB |
| Hardcore, Gabber/K.N.O.R/kn0063/01-human_resource_vs_pitch_-_prepare_for_glory_(dj_tool).mp3 |
3.2 MB |
| Hardcore, Gabber/K.N.O.R/kn0063/02-human_resource_vs_pitch_-_prepare_for_glory_(dj_tool).mp3 |
2 MB |
| Hardcore, Gabber/K.N.O.R/kn0063/03humanresourcevpitch-dontbehalfassstupidsuperextended12mix.mp3 |
12.9 MB |
| Hardcore, Gabber/Kalibrate/kalibrateleft/a1-hellfish_and_producer_-_turn_it_in-hb.mp3 |
10.1 MB |
| Hardcore, Gabber/Kalibrate/kalibrateleft/b1-hellfish_and_producer_-_ba_goes_bananas-hb.mp3 |
8.1 MB |
| Hardcore, Gabber/Kaotik/ktk008/00_kevin_energy_-_message_mayhem-(ktk008)-promo_cdr-2007.jpg |
35 KB |
| Hardcore, Gabber/Kaotik/ktk008/00_kevin_energy_-_message_mayhem-(ktk008)-promo_cdr-2007.m3u |
124 B |
| Hardcore, Gabber/Kaotik/ktk008/00_kevin_energy_-_message_mayhem-(ktk008)-promo_cdr-2007.nfo |
7 KB |
| Hardcore, Gabber/Kaotik/ktk008/00_kevin_energy_-_message_mayhem-(ktk008)-promo_cdr-2007.sfv |
151 B |
| Hardcore, Gabber/Kaotik/ktk008/01_kevin_energy_-_message_mayhem.mp3 |
9.4 MB |
| Hardcore, Gabber/Kaotik/ktk008/02_kevin_energy_-_feel_the_heat.mp3 |
7.1 MB |
| Hardcore, Gabber/Kaotik/ktk008/03_social_outkast_-_freedom_(kevin_energy_rmx).mp3 |
6.4 MB |
| Hardcore, Gabber/Karnage/krg003/B - Next to reallity + The after world.mp3 |
18.1 MB |
| Hardcore, Gabber/Ketacore Records/keta002/01 Maladroit - Funky Parasite Riddim.mp3 |
6.1 MB |
| Hardcore, Gabber/Ketacore Records/keta002/02 Capslock - The Moving Finger.mp3 |
6.3 MB |
| Hardcore, Gabber/Ketacore Records/keta002/03 Bit Shifter - March of the Nucleotides.mp3 |
3.4 MB |
| Hardcore, Gabber/Kill Me Entertainment/km003/00_kombat_ki-insomnia_hurray-(km003)-vinyl-2006-front.jpg |
78 KB |
| Hardcore, Gabber/Kill Me Entertainment/km003/00_kombat_ki-insomnia_hurray-(km003)-vinyl-2006-side_a.jpg |
90 KB |
| Hardcore, Gabber/Kill Me Entertainment/km003/00_kombat_ki-insomnia_hurray-(km003)-vinyl-2006-side_b.jpg |
89 KB |
| Hardcore, Gabber/Kill Me Entertainment/km003/00_kombat_ki-insomnia_hurray-(km003)-vinyl-2006.m3u |
98 B |
| Hardcore, Gabber/Kill Me Entertainment/km003/00_kombat_ki-insomnia_hurray-(km003)-vinyl-2006.nfo |
986 B |
| Hardcore, Gabber/Kill Me Entertainment/km003/00_kombat_ki-insomnia_hurray-(km003)-vinyl-2006.sfv |
125 B |
| Hardcore, Gabber/Kill Me Entertainment/km003/a-kombat_ki-hairgel_baby.mp3 |
8.6 MB |
| Hardcore, Gabber/Kill Me Entertainment/km003/b1-kombat_ki-my_bottle_of_wine.mp3 |
7.6 MB |
| Hardcore, Gabber/Kill Me Entertainment/km003/b2-kombat_ki-write_me_a_check.mp3 |
7.2 MB |
| Hardcore, Gabber/Komum/khsl001/KOMUM 01 - A1 - RADIUM - Lilith Revenge.mp3 |
6.8 MB |
| Hardcore, Gabber/Komum/khsl001/KOMUM 01 - B1 - RASP - Mupshow.mp3 |
7.7 MB |
| Hardcore, Gabber/Komum/khsl001/KOMUM 01 - B2 - SPEEDYQ'S - Guns Right.mp3 |
9.5 MB |
| Hardcore, Gabber/Kotzaak Unltd/kotzm 04/a1_stickhead_-_i_dont_care-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Kotzaak Unltd/kotzm 04/a2_stickhead_-_death_rocker-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Kotzaak Unltd/kotzm 04/b1_stickhead_-_bloody_rain-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Kotzaak Unltd/kotzm 04/b2_stickhead_-_dive_into_steel_(stickheads_2006_mix)-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Ks/ksdivk000/a1_moleculez_-_ngn_the_engine-sq.mp3 |
11.2 MB |
| Hardcore, Gabber/Ks/ksdivk000/b1_moleculez_-_sweet_nightmare-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Ks/ksdivk000/b2_moleculez_-_prototyp_a-sq.mp3 |
10 MB |
| Hardcore, Gabber/Lethal Insanity 666/li666002/a1 - Unexist - Fistortion.mp3 |
5.2 MB |
| Hardcore, Gabber/Lethal Insanity 666/li666002/a2 - Unexist - Death After Dark (Hate Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Lethal Insanity 666/li666002/b1 - Unexist - Stood Up.mp3 |
904 KB |
| Hardcore, Gabber/Lethal Insanity 666/li666002/b2 - Unexist - Let The Show Begin.mp3 |
6.9 MB |
| Hardcore, Gabber/Lethal Insanity 666/li666002/b3 - Unexist - Crack Whore.mp3 |
4 MB |
| Hardcore, Gabber/Lethal Theory/ltr003/00-seduction_and_joey_riot-brainwashed_ep-(ltr003)-web-2007-ukhx.m3u |
96 B |
| Hardcore, Gabber/Lethal Theory/ltr003/00-seduction_and_joey_riot-brainwashed_ep-(ltr003)-web-2007-ukhx.nfo |
9 KB |
| Hardcore, Gabber/Lethal Theory/ltr003/00-seduction_and_joey_riot-brainwashed_ep-(ltr003)-web-2007-ukhx.sfv |
114 B |
| Hardcore, Gabber/Lethal Theory/ltr003/01-seduction_and_joey_riot-brainwashed.mp3 |
12.5 MB |
| Hardcore, Gabber/Lethal Theory/ltr003/02-seduction_and_joey_riot-bring_the_beat_back.mp3 |
12.2 MB |
| Hardcore, Gabber/Loop Records/[loop 002] - pure & liza 'n' eliaz - killerbees on acid/a - dj pure & liza'n'eliaz - killerbees on acid.mp3 |
9.2 MB |
| Hardcore, Gabber/Loop Records/[loop 002] - pure & liza 'n' eliaz - killerbees on acid/a - dj pure & liza'n'eliaz - tube travel.mp3 |
8.9 MB |
| Hardcore, Gabber/Loop Records/[loop 002] - pure & liza 'n' eliaz - killerbees on acid/r-205541-1099468341.jpg |
21 KB |
| Hardcore, Gabber/Loop Records/[loop 002] - pure & liza 'n' eliaz - killerbees on acid/r-205541-1099468364.jpg |
16 KB |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-a-doc.jpg |
118 KB |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-b-doc.jpg |
120 KB |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-c-doc.jpg |
126 KB |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-d-doc.jpg |
89 KB |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-doc.m3u |
254 B |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-doc.nfo |
13 KB |
| Hardcore, Gabber/Madness/mad001-5/00-1st_offense-throw_da_madness-(mad001-5)-vinyl-1997-doc.sfv |
499 B |
| Hardcore, Gabber/Madness/mad001-5/01-1st_offense-throw_da_madness-doc.mp3 |
7.7 MB |
| Hardcore, Gabber/Madness/mad001-5/02-1st_offense-wreck_this_place-doc.mp3 |
7.1 MB |
| Hardcore, Gabber/Madness/mad001-5/03-1st_offense-death_creator-doc.mp3 |
6.1 MB |
| Hardcore, Gabber/Man@Arms/m@a001/a1 the enticer - deathmoves.mp3 |
5.7 MB |
| Hardcore, Gabber/Man@Arms/m@a001/a2 the enticer - etched in stone.mp3 |
4.5 MB |
| Hardcore, Gabber/Man@Arms/m@a001/a3 the enticer - global killer.mp3 |
5.6 MB |
| Hardcore, Gabber/Man@Arms/m@a001/b1 sunjammer - burn down.mp3 |
6.4 MB |
| Hardcore, Gabber/Man@Arms/m@a001/b2 sunjammer - cut up.mp3 |
7.5 MB |
| Hardcore, Gabber/Man@Arms/m@a001/b3 sunjammer - satan.mp3 |
6.9 MB |
| Hardcore, Gabber/Master Maximum/mm1004/a1 - dj_fuck.mp3 |
5.2 MB |
| Hardcore, Gabber/Master Maximum/mm1004/a2 - pussy.mp3 |
6.4 MB |
| Hardcore, Gabber/Master Maximum/mm1004/b1 - motherfuck_(loempia_e.p.).mp3 |
5.4 MB |
| Hardcore, Gabber/Master Maximum/mm1004/b2 - city_of_house.mp3 |
6.3 MB |
| Hardcore, Gabber/Master Maximum/mm1005/A1 Charly Lownoise & Mental Theo - Tiroler Kaboemsch.mp3 |
4.6 MB |
| Hardcore, Gabber/Master Maximum/mm1005/A2 Charly Lownoise & Mental Theo - Berlin... Kick'M!!!.mp3 |
5.7 MB |
| Hardcore, Gabber/Master Maximum/mm1005/B1 Charly Lownoise & Mental Theo - Direct From Brooklyn.mp3 |
5.5 MB |
| Hardcore, Gabber/Master Maximum/mm1005/INCOMPLETE~A1 Charly Lownoise & Mental Theo - Tiroler Kaboemsch.mp3 |
4.3 MB |
| Hardcore, Gabber/Master Maximum/mm1006/A1 - Charly Lownoise & Mental Theo - The Ultimate Sextrack.mp3 |
6.8 MB |
| Hardcore, Gabber/Master Maximum/mm1006/A2 - Charly Lownoise & Mental Theo - Bang To The Beat.mp3 |
6.4 MB |
| Hardcore, Gabber/Master Maximum/mm1006/B1 - Charly Lownoise & Mental Theo - Are You Ready!.Mp3 |
4.2 MB |
| Hardcore, Gabber/Master Maximum/mm1006/B2 - Charly Lownoise & Mental Theo - Go down.mp3 |
5.4 MB |
| Hardcore, Gabber/Master Maximum/mm1007/mm1007 -a1- rob gee, repete & mc romeo - riot in n.y. (original).mp3 |
6.1 MB |
| Hardcore, Gabber/Master Maximum/mm1007/mm1007 -b1- rob gee, repete & mc romeo - riot in n.y. (mental lownoise rmx 1).mp3 |
7.2 MB |
| Hardcore, Gabber/Master Maximum/mm1007/mm1007 -b2- rob gee, repete & mc romeo - riot in n.y. (mental lownoise rmx 2).mp3 |
5.7 MB |
| Hardcore, Gabber/Master Maximum/mm1008/A1 - Charly Lownoise & Mental Theo - Party.Mp3 |
6.5 MB |
| Hardcore, Gabber/Master Maximum/mm1008/A2 - Charly Lownoise & Mental Theo - Energy.Mp3 |
7.3 MB |
| Hardcore, Gabber/Master Maximum/mm1008/B1 - Charly Lownoise & Mental Theo - Get Funky.Mp3 |
7.4 MB |
| Hardcore, Gabber/Master Maximum/mm1008/B2 - Charly Lownoise & Mental Theo - Childhood.Mp3 |
7.4 MB |
| Hardcore, Gabber/Master Maximum/mm1009/a1 - CL & MT - Live @ London (The Big Bang Mix).mp3 |
7.3 MB |
| Hardcore, Gabber/Master Maximum/mm1009/a2 - CL & MT - Live @ London (Radio Dub).mp3 |
4.5 MB |
| Hardcore, Gabber/Master Maximum/mm1009/b1 - CL & MT - Can You Feel It.mp3 |
8.8 MB |
| Hardcore, Gabber/Master Maximum/mm1012/a1 - Charly Lownoise & Mental Theo - Wonderful Days (Rotterdam Mix).mp3 |
7.8 MB |
| Hardcore, Gabber/Master Maximum/mm1012/b1 - Charly Lownoise & Mental Theo - Wonderful Days (Trance Mix).mp3 |
7.3 MB |
| Hardcore, Gabber/Master Maximum/mm1012/b2 - Charly Lownoise & Mental Theo - Wonderful Days (Radio Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Master Maximum/mm1017/A2 Omar Santana - Shake Dat Ass.mp3 |
4.6 MB |
| Hardcore, Gabber/Master Maximum/mm1019/a1 - charly lownoise & mental theo - stars (hardcore mix).mp3 |
7.7 MB |
| Hardcore, Gabber/Master Maximum/mm1019/b1 - charly lownoise & mental theo - rockin' party.mp3 |
5.8 MB |
| Hardcore, Gabber/Master Maximum/mm1019/b2 - charly lownoise & mental theo - stars (rave remix).mp3 |
6.2 MB |
| Hardcore, Gabber/Master Maximum/mm1021/a1-bass_d_and_king_matthew_-_its_magic-fnz.mp3 |
8.3 MB |
| Hardcore, Gabber/Master Maximum/mm1021/a2-bass_d_and_king_matthew_-_peaceland-fnz.mp3 |
8.2 MB |
| Hardcore, Gabber/Master Maximum/mm1021/b1-bass_d_and_king_matthew_-_dance-fnz.mp3 |
7.3 MB |
| Hardcore, Gabber/Master Maximum/mm1021/b2-bass_d_and_king_matthew_-_tranz_m-fnz.mp3 |
6.7 MB |
| Hardcore, Gabber/Master Maximum/mm1027/charly lownoise & mental theo - hardcore feelings (club mix).mp3 |
6 MB |
| Hardcore, Gabber/Master Maximum/mm1027/charly lownoise & mental theo - hardcore feelings (hardcore.mp3 |
4.5 MB |
| Hardcore, Gabber/Master Maximum/mm1027/charly lownoise & mental theo - hardcore feelings (trance mi.mp3 |
5.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/00_angerfist-broken_chan_e.p.-(moh-057)-vinyl-2006.m3u |
141 B |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/00_angerfist-broken_chan_e.p.-(moh-057)-vinyl-2006.nfo |
833 B |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/00_angerfist-broken_chan_e.p.-(moh-057)-vinyl-2006.sfv |
223 B |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/01_angerfist-broken_chan_(feat_crucifier).mp3 |
9.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/02_angerfist-twisting_my_mind.mp3 |
10.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/03_angerfist-dortmund_05.mp3 |
10.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/Angerfist-Broken_Chan_E.P.-(MOH-057)-Vinyl-2006-OBC/04_angerfist-chaos_and_evil.mp3 |
7.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/00_angerfist-mutilate_e.p.-(moh067)-vinyl-2008.m3u |
166 B |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/00_angerfist-mutilate_e.p.-(moh067)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/00_angerfist-mutilate_e.p.-(moh067)-vinyl-2008.sfv |
202 B |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/a1_angerfist-right_through_your_head.mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/a2_angerfist-gas_met_die_zooi_(tha_playah_remix).mp3 |
7.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/b1_angerfist-riotstarter.mp3 |
7.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/Angerfist-Mutilate_E.P.-(MOH067)-Vinyl-2008-hM_INT/b2_angerfist-strangle_and_mutilate.mp3 |
9.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp06/Dj JDA - A1 - The Game of Pain [FVV].mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp06/Dj JDA - B1 - Step the Fuck On [FVV].mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp07/j.d.a. vs bass-d & king matthew - purple pillz.mp3 |
5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp07/j.d.a. vs bass-d & king matthew - survivors of hardcore.mp3 |
5.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp08/a1_bass_d_and_king_matthew_vs_dj_outblast_-_partyfreakz-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp08/b1_bass_d_and_king_matthew_vs_dj_outblast_-_quiet_storm-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp09/Base Alert - Dewegwijzer.mp3 |
6.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp09/Base Alert - Jellyneck.mp3 |
7.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp10/01-the_masochist-the_reincarnation_of_forbidden_sounds-snd.mp3 |
9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh-sp10/02-the_masochist-schoom-snd.mp3 |
8.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh001/a1 - Rob Gee & J.D.A. - Rock The Natas.mp3 |
3.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh001/b1 - Bass-D & King Matthew - Overdose.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh002/a1 - Bass-D & King Matthew - Is New York In The House.mp3 |
3.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh002/a2 - Bass-D & King Matthew - Boogie Bandit (Hey).mp3 |
3.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh002/b1 - Bass-D & King Matthew - Oh Mary.mp3 |
4.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh002/b2 - Bass-D & King Matthew - Horny.mp3 |
3.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh003/a1 - Bass-D & King Matthew - Heaven (Placid K Remix).mp3 |
7.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh003/b1 - Bass-D & King Matthew - Heaven (Original Mix).mp3 |
7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh003/b2 - Bass-D & King Matthew - Heaven (Heaven Is In Hell Remix.mp3 |
6.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh004/a1 - Chronotrigger Vs. The Thundergods From Asgard - You Got.mp3 |
4.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh004/b1 - Chronotrigger Vs. The Thundergods From Asgard - This Wi.mp3 |
4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh004/b2 - Chronotrigger Vs. The Thundergods From Asgard - Drop Th.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh005/a1 - Bass-D & King Matthew Vs. Lady Dana & DJ Skorp - The ex.mp3 |
3.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh005/a2 - The Thundergods From Asgard - Terminate.mp3 |
4.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh005/b1 - Bass-D & King Matthew - House!.mp3 |
3.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh005/b2 - Lady Dana & Dj Skorp - Yours, Mine.mp3 |
3.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh006/a1 - Bass-D & King Matthew - Power Of Bass.mp3 |
6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh006/a2 - Bass-D & King Matthew - Jump Up.mp3 |
6.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh006/b1 - Bass-D & King Matthew - Fly Away.mp3 |
5.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh006/b2 - Bass-D & King Matthew - Hard Street Shit.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh006/b3 - Bass-D & King Matthew - Rule The Nation.mp3 |
6.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh007/a1 - Bass-D & King Matthew Vs. Lady Dana - Rock Steady.mp3 |
5.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh007/b1 - Bass-D & King Matthew - The pain.mp3 |
4.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh007/b2 - Lady Dana - Sirenes.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh008/a1 - Bass-D & King Matthew Vs. Buzz Fuzz - It's Alright.mp3 |
5.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh008/b1 - Bass-D & King Matthew - Totally Fucked.mp3 |
6.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh008/b2 - Buzz Fuzz - No Titties, No Go.mp3 |
4.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh009/a1 - Paul Elstak Vs. Bass-D & King Matthew - Something Evil.mp3 |
5.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh009/b1 - Bass-D & King Matthew - The Masterplan.mp3 |
5.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh009/b2 - Paul Elstak Vs. Bass-D & King Matthew - Don't Hold The .mp3 |
5.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh010/a1 - The Masochist Vs. Bass-D & King Matthew - Get Retarded.mp3 |
5.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh010/b1 - The Masochist - Sell Your Pussy.mp3 |
8.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh010/b2 - Bass D & King Matthew - Cold Medina.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh011/a1 - The Gatekeeper - Hard Attack (Bass-D & King Matthew Rem.mp3 |
5.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh011/b1 - The Gatekeeper - The Machine.mp3 |
4.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh012/a1 - Dj Buzz Fuzz vs. Bass-D & King Matthew - It's Alright (.mp3 |
4.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh012/a2 - Dj Buzz Fuzz vs. Bass-D & King Matthew - It's Alright (.mp3 |
7.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh012/a3 - Dj Buzz Fuzz vs. Bass-D & King Matthew - It's Alright.mp3 |
10.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh012/b1 - Bass-D & King Matthew - Power To The People.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh012/b2 - Bass-D & King Matthew - Blow Your Mind 2000.mp3 |
7.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh013/a1 - Bass-D & King Matthew Vs. Dr. Z-Vago - Chronic 2000.mp3 |
4.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh013/a2 - Bass-D & King Matthew - Fly Away (Neophyte Remix).mp3 |
3.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh013/b1 - Outblast - Do What You Wanna Do.mp3 |
3.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh013/b2 - Outblast - Won't Let Hardcore Down.mp3 |
4.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh014/a1 - The Masochist - Antimix (Neophyte Remix).mp3 |
5.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh014/a2 - The Masochist - Antimix.mp3 |
4.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh014/b1 - The Masochist - Wanna Fuck.mp3 |
3.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh014/b2 - The Masochist - Our House.mp3 |
5.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh015/a1 - Virus - New Elite Force.mp3 |
4.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh015/a2 - Virus - Evil Is Among Thee.mp3 |
5.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh015/b1 - Virus - Bodybag.mp3 |
4.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh015/b2 - Virus - Still Dreamin'.mp3 |
4.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh016/a1 - Bass-D & King Mattew - Suckerzz.mp3 |
5.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh016/b1 - Bass-D & King Matthew Vs. Lady Dana - Rock That.mp3 |
4.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh016/b2 - Bass-D & King Matthew - Buck Whylin'.mp3 |
5.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh017/a1 - Outblast - Eardrumz.mp3 |
7.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh017/b1 - Outblast - Hey Motherfuckers.mp3 |
7.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh017/b2 - Outblast - Prepare Yourself.mp3 |
6.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh018/a1 - Dj Delerium - Guess Who's Back.mp3 |
4.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh018/b1 - Dj Delirium - F.M. Radio.mp3 |
4.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh018/b2 - Dj Delirium - Don't Give a Fuck.mp3 |
4.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh019/a1 - The Masochist feat Dj Buzz Fuzz - Hardkoor.mp3 |
4.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh019/a2 - The Masochist - Anticipation (Buzz Fuzz Remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh019/b1 - The Masochist feat. Chosen Few - More Drugz.mp3 |
4.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh019/b2 - The Masochist Vs. Buzz Fuzz - Headclapper.mp3 |
7.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh020/a1 - J.D.A. - Voel Je Die Bass (Bass-D & King Matthew Remix).mp3 |
5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh020/b1 - J.D.A. - Voel Je Die Bass (Original Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh020/b2 - J.D.A feat Delta 9 - Real Hardcore & Anders Niks.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh021/A1 - DJ Outblast - Hardcore Time.mp3 |
3.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh021/B1 - DJ Outblast - The Gates Are Open.mp3 |
4.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh021/B2 - DJ Outblast - The Future.mp3 |
3.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh022/A1 Dj Paul Vs. Bass-D & King Matthew - The Masterplan Dj.mp3 |
3.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh022/B1 The Masochist Vs. Buzz Fuzz - Hardkoor Bass-D & King M.mp3 |
3.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh022/B2 The Masochist Vs. Bass-D & King Matthew - Get Retarded.mp3 |
3.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh023/A1 Bass-D & King Matthew vs. Impulse Factory - Rock The Whole Block.mp3 |
3.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh023/B1 Bass-D & King Matthew - Mass Hysteria.mp3 |
8.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh023/B2 Impulse Factory - Touch Down.mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh024/A1 - The Masochist Vs. Miss Flower - Pump It Up Y'all.mp3 |
3.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh024/A2 - The Masochist - Hard With The Hitshit.mp3 |
3.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh024/B1 The Masochist - Noizemakerz.mp3 |
5.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh024/B2 - The Masochist - Pump It Up Y'All.mp3 |
3.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh024/B3 - The Masochist - Pump It Up Y'All (Acapella).mp3 |
2.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh025/A1 - DJ Outblast - Eargazm.mp3 |
3.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh025/B1 - DJ Outblast - Communication (Catscan Remix).mp3 |
8.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh025/B2 - DJ Outblast - Communication (Original Mix).mp3 |
4.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh026/A1 - The Masochist Vs Neophyte - Loud & Proud.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh026/B1 - The Masochist Vs Neophyte - Hell No.mp3 |
9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh027/A1 - Kid Morbid - No Escape From My Wrath.mp3 |
8.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh027/A2 - Kid Morbid - Fight Music.mp3 |
5.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh027/B1 - Kid Morbid - The X-zone.mp3 |
5.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh027/B2 - Kid Morbid - Chocolate Milk.mp3 |
5.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh028/A1 - Bass-D & King Matthew Vs Re-Style - Land Of Hardcore.mp3 |
8.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh028/B1 - Bass-D & King Matthew Vs Re-Style - Snertjong.mp3 |
7.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh028/B2 - Bass-D & King Matthew Vs Re-Style - Give Ya House.mp3 |
6.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh029/A1 - The Masochist - Stomp.mp3 |
8.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh029/A2 - The Masochist - Fuck You Bitch.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh029/B1 - The Masochist - Chemistry.mp3 |
8.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh029/B2 - The Masochist - Fuck You Bitch (Acapella).mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh030/B1 - Shadowlands Terrorists - Shadowlands Anthem.mp3 |
8.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh031/A1 - Angerfist - Within The Darkness.mp3 |
5.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh031/A2 - Angerfist - It Never Stops.mp3 |
6.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh031/B1 - Angerfist - Sons Of Satan.mp3 |
7.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh031/B2 - Angerfist - The Passages.mp3 |
6.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh032/a1 Fuck what u heard.mp3 |
7.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh032/b1 Back online.mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh032/b2 Hey motherfuckers (Angerfist rmx).mp3 |
7.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh033/a1 Fuck them all.mp3 |
7.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh033/b1 Nuclear hardcore (Re-style rmx).mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh033/b2 Fuck them all (Ill-matic goes 200 fucking bpm mix).mp3 |
7.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh034/a1_digital_boy_vs_outblast_-_be_4_real-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh034/b1_oublast_-_blast_fm-sq.mp3 |
6.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh035/a1_angerfist_-_bonified_alcoholic_musik_making_muthafucka.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh035/a1_angerfist_-_bonified_alcoholic_musik_making_muthafucka.mp3.asd |
546 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh035/a2_angerfist_-_maniac_killa.mp3 |
8.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh035/b1_angerfist_-_necroslave.mp3 |
6.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh035/b2_angerfist_-_breakin'_society_down.mp3 |
6.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh035/b3_angerfist_-_killerfist-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh036/[A1] Drokz & Tafkat - Time 2 Unite.mp3 |
6.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh036/[A2] Drokz & Tafkat - Morfine.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh036/[B1] Drokz & Tafkat - Inner Crisis.mp3 |
6.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh036/[B2] Drokz & Tafkat - Dedicated 2 3SA.mp3 |
6.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh037/a1 Cannibal.mp3 |
6.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh037/a2 666 I'm six o sick.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh037/a3 Ik haat trance.mp3 |
6.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh037/b1 Fucking On The Dancefloor.mp3 |
4.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh037/b2 Keep the Vibes Alive.mp3 |
6.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh037/b3 In Fection.mp3 |
7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh038/a1_re_style_-_sacrifice-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh038/a2_re_style_-_break_it_down-sq.mp3 |
5.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh038/a3_re_style_-_stay_down_to_the_core-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh038/b1_angerfist_-_krazy-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh038/b2_illmatic_-_anger_is_easy-the_mix-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh038/b3_noisekick_-_oogkas_penetratie-sq.mp3 |
7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh039/a1 raw power.mp3 |
7.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh039/a2 hard ragge.mp3 |
7.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh039/b1 fuck what u heard (vince and sceletor remix).mp3 |
8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh039/b2 Antichrist superstar.mp3 |
6.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh040/[A1] Outblast Vs. Korsakoff - Unleash The Beast (The Official Masters Of Hardcore 2004 Anthem).mp3 |
7.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh040/[B1] Outblast Vs. Drokz - Black '04 (The Hardest State Of Emergency).mp3 |
9.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh040/[B2] DJ J.D.A. Vs. Bass-D & King Matthew - Survivors Of Hardcore (Art Of Fighters Remix).mp3 |
8.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh041/a1-angerfist - raise your fist.mp3 |
9.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh041/a2-angerfist - too weird to die.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh041/b1-angerfist - ultra rebel.mp3 |
11.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh041/b2-angerfist - vato.mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh042/a1 relytser.mp3 |
7.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh042/b1 right here right now.mp3 |
8.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh042/b2 no imitations.mp3 |
7.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh043/a1 life sentence for mankind (never say die).mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh043/b1 electro shocking.mp3 |
7.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh044/a1_angerfist_-_the_world_will_shiver_(official_masters_of_ha.mp3 |
8.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh044/b1_angerfist_-_take_u_back-sq.mp3 |
8.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh044/c1_base_alert_-_ojeeoink-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh044/c2_bass_d_and_king_matthew_vs._the_masochist_-_get_retarded-.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh044/d1_dj_outblast_-_masters_symphony-sq.mp3 |
8.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh044/d2_the_masochist_-_antimix_(neophyte_remix)-sq.mp3 |
6.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh045/01_united_hardcore_-_time_to_make_a_stand_(dj_neophyte_and_evil_activities_mix)-hb.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh045/02_united_hardcore_-_time_to_make_a_stand_(outblast_and_angerfist_mix)-hb.mp3 |
5.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh046/01-re_style-_hardcore_psychopaths_(no_cure_mix)-dgn.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh046/02-re_style-_hardcore_psychopaths_(no_escape_mix)-dgn.mp3 |
11.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh046/03-outblast_and_drokz-_conflict05-dgn.mp3 |
8.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh046/04-angerfist-_the_fast_lane-dgn.mp3 |
6.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh047/a1 serial killaz - eastside revolution.mp3 |
9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh047/a2 serial killaz - hall of fame.mp3 |
9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh047/b1 serial killaz - m.a.r.l.i.e.mp3 |
5.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh047/b2 serial killaz - buckle up.mp3 |
6.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh047/b3 serial killaz - gangster.mp3 |
6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh048/a1-tieum_-_what-hb.mp3 |
8.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh048/a2-tieum_-_show_me_the_devil-hb.mp3 |
7.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh048/b1-tieum_-_cold_world-hb.mp3 |
6.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh048/b2-tieum_-_metz-hb.mp3 |
7.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh049/01_angerfist_-_stainless_steel.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh049/02_angerfist_-_with_the_fresh_style.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh049/02_angerfist_-_with_the_fresh_style.mp3.asd |
585 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh049/03_angerfist_-_dance_with_the_wolves.mp3 |
3.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh050/01_bass_d_and_king_matthew_-_the_genesis_(masters_of_hardcore_2006_anthem).mp3 |
7.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh050/02_2men_kartel_-_the_2men_kartel.mp3 |
6.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh050/03_day-mar_-_fuckin_motherfuckin_slit.mp3 |
6.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh053/a1-serial_killaz_and_out_back_-_torture-hb.mp3 |
8.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh053/a2-crucifier_-_never_surrender-hb.mp3 |
8.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh053/a3-true_vandals_-_fucking_fake_wannabees-hb.mp3 |
9.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh053/b1-re-style_-_busted_choir-hb.mp3 |
6.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh053/b2-angerfist_-_shattered_hope-hb.mp3 |
12.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh053/b3-roland_and_sherman_-_wij_zijn_roland_and_sherman-hb.mp3 |
6.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh054/a1-outblast_-_styles_of_beyond-hb.mp3 |
10.6 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh054/a2-outblast_-_styles_of_beyond_(yq23_mix)-hb.mp3 |
7.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh054/b1-outblast_and_negative_a_-_scumworld-hb.mp3 |
9.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh054/b2-outblast_and_tieum_-_chain_of_command-hb.mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh055/00_day-mar_-_embrace_the_night-(moh055)-vinyl-2006.m3u |
104 B |
| Hardcore, Gabber/Masters Of Hardcore/moh055/00_day-mar_-_embrace_the_night-(moh055)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh055/00_day-mar_-_embrace_the_night-(moh055)-vinyl-2006.sfv |
134 B |
| Hardcore, Gabber/Masters Of Hardcore/moh055/a1_day-mar_-_embrace_the_night.mp3 |
9.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh055/b1_day-mar_-_dstr.mp3 |
8.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh055/b2_day-mar_-_embrace_the_night_(vocal_dub).mp3 |
5.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh056/00_dj_j.d.a.-con-x-ion_part_1-(moh056)-vinyl-2006.m3u |
167 B |
| Hardcore, Gabber/Masters Of Hardcore/moh056/00_dj_j.d.a.-con-x-ion_part_1-(moh056)-vinyl-2006.nfo |
1021 B |
| Hardcore, Gabber/Masters Of Hardcore/moh056/00_dj_j.d.a.-con-x-ion_part_1-(moh056)-vinyl-2006.sfv |
194 B |
| Hardcore, Gabber/Masters Of Hardcore/moh056/a1_dj_j.d.a._feat._dj_sagem-hardcore_wins_again.mp3 |
11.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh056/b1_dj_j.d.a._feat._dead_men_walkin-encore_(do_ya_want_more).mp3 |
11 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh056/b2_dj_j.d.a._feat._dj_redemption-what_the_fuck.mp3 |
11.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh057/00_angerfist-broken_chan_e.p.-(moh-057)-vinyl-2006.m3u |
141 B |
| Hardcore, Gabber/Masters Of Hardcore/moh057/00_angerfist-broken_chan_e.p.-(moh-057)-vinyl-2006.nfo |
833 B |
| Hardcore, Gabber/Masters Of Hardcore/moh057/00_angerfist-broken_chan_e.p.-(moh-057)-vinyl-2006.sfv |
223 B |
| Hardcore, Gabber/Masters Of Hardcore/moh057/01_angerfist-broken_chan_(feat_crucifier).mp3 |
9.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh057/02_angerfist-twisting_my_mind.mp3 |
10.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh057/03_angerfist-dortmund_05.mp3 |
10.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh057/04_angerfist-chaos_and_evil.mp3 |
7.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh058/00-masters_of_hardcore_-_raise_cain_ep-vinyl-2007-scan.jpg |
212 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh058/00-masters_of_hardcore_-_raise_cain_ep-vinyl-2007.m3u |
154 B |
| Hardcore, Gabber/Masters Of Hardcore/moh058/00-masters_of_hardcore_-_raise_cain_ep-vinyl-2007.nfo |
658 B |
| Hardcore, Gabber/Masters Of Hardcore/moh058/00-masters_of_hardcore_-_raise_cain_ep-vinyl-2007.sfv |
184 B |
| Hardcore, Gabber/Masters Of Hardcore/moh058/01-stunned_guys_-_raise_cain_(into_the_psychodrome).mp3 |
10.2 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh058/02-d_spirit_-_tinnitus.mp3 |
7.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh058/03-angerfist_-_the_world_wil_shiver_(t-junction_and_rudeboy_remix).mp3 |
8.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh059/00_re-style_-_motherfucking_bullit-(moh059)-trackfix-vinyl-2007.m3u |
44 B |
| Hardcore, Gabber/Masters Of Hardcore/moh059/00_re-style_-_motherfucking_bullit-(moh059)-trackfix-vinyl-2007.nfo |
622 B |
| Hardcore, Gabber/Masters Of Hardcore/moh059/00_re-style_-_motherfucking_bullit-(moh059)-trackfix-vinyl-2007.sfv |
53 B |
| Hardcore, Gabber/Masters Of Hardcore/moh059/a1_re-style_-_mega_drunk_style-trackfix.mp3 |
6.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh063/00_predator_-_silent_notes-(moh063)-vinyl-2007.jpg |
111 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh063/00_predator_-_silent_notes-(moh063)-vinyl-2007.m3u |
146 B |
| Hardcore, Gabber/Masters Of Hardcore/moh063/00_predator_-_silent_notes-(moh063)-vinyl-2007.nfo |
895 B |
| Hardcore, Gabber/Masters Of Hardcore/moh063/00_predator_-_silent_notes-(moh063)-vinyl-2007.sfv |
182 B |
| Hardcore, Gabber/Masters Of Hardcore/moh063/a1_predator_vs_angerfist_-_silent_notes.mp3 |
7.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh063/a2_dnme_-_1d_(back_off).mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh063/b1_predator_-_demon_pit.mp3 |
7.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh063/b2_predator_vs_angerfist_-_the_switch.mp3 |
7.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh064/00_tomcat_and_rudeboy_ft_angerfist_-_alles_kut_enter-(moh064)-vinyl-2008.jpg |
94 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh064/00_tomcat_and_rudeboy_ft_angerfist_-_alles_kut_enter-(moh064)-vinyl-2008.m3u |
153 B |
| Hardcore, Gabber/Masters Of Hardcore/moh064/00_tomcat_and_rudeboy_ft_angerfist_-_alles_kut_enter-(moh064)-vinyl-2008.nfo |
722 B |
| Hardcore, Gabber/Masters Of Hardcore/moh064/00_tomcat_and_rudeboy_ft_angerfist_-_alles_kut_enter-(moh064)-vinyl-2008.sfv |
180 B |
| Hardcore, Gabber/Masters Of Hardcore/moh064/a1_tomcat_and_rudeboy_ft_angerfist_-_alles_kut_enter.mp3 |
8.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh064/b1_tomcat_and_rudeboy_ft_angerfist_-_tnt.mp3 |
8.1 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh064/b2_tomcat_and_rudeboy_ft_angerfist_-_put_it_up.mp3 |
7.3 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh065/00_outblast_-_infinity-(moh065)-vinyl-2008.jpg |
128 KB |
| Hardcore, Gabber/Masters Of Hardcore/moh065/00_outblast_-_infinity-(moh065)-vinyl-2008.m3u |
107 B |
| Hardcore, Gabber/Masters Of Hardcore/moh065/00_outblast_-_infinity-(moh065)-vinyl-2008.nfo |
715 B |
| Hardcore, Gabber/Masters Of Hardcore/moh065/00_outblast_-_infinity-(moh065)-vinyl-2008.sfv |
134 B |
| Hardcore, Gabber/Masters Of Hardcore/moh065/a1_outblast_-_infinity.mp3 |
10 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh065/b1_outblast_-_eardrumz_(javi_boss_rmx).mp3 |
9.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/moh065/b2_outblast_-_ekses_die_naait.mp3 |
7.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp001/a1 - Buzz Fuzz & The Prophet - Go Get Ill (Original Mix).mp3 |
5.9 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp001/b1 - Buzz Fuzz & The Prophet - Go Get Ill (The Prophet Remix).mp3 |
4.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp002/a1 - Bass-D & King Matthew - More Than Rough.mp3 |
5.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp002/b1 - Bass-D & King Matthew - Resistance Is Futile.mp3 |
5.8 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp003/a1 - Outblast - Master's Symphony.mp3 |
5.4 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp003/b1 - Wicked - Dark Symphony.mp3 |
4.7 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp004/a1 - Bass-D & King Matthew - True Legends.mp3 |
7.5 MB |
| Hardcore, Gabber/Masters Of Hardcore/mohsp004/b1 - Bass-D & King Matthew - Nuclear Hardcore.mp3 |
7.1 MB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/00_goetia_vs._dj_mutante_-_brut_al_ep-(mos002)-vinyl-2008.m3u |
214 B |
| Hardcore, Gabber/Masters Of Speedcore/mos002/00_goetia_vs._dj_mutante_-_brut_al_ep-(mos002)-vinyl-2008.nfo |
8 KB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/00_goetia_vs._dj_mutante_-_brut_al_ep-(mos002)-vinyl-2008.sfv |
268 B |
| Hardcore, Gabber/Masters Of Speedcore/mos002/01_goetia_-_no_escape.mp3 |
11.5 MB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/02_goetia_-_my_body_s_killing_me.mp3 |
6.5 MB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/03_dj_mutante_-_suck_it.mp3 |
6.4 MB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/04_dj_mutante_-_i_dont_wanna_touch_you.mp3 |
7 MB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/05_dj_mutante_-_fucker.mp3 |
5.7 MB |
| Hardcore, Gabber/Masters Of Speedcore/mos002/06_dj_mutante_-_friendship_is_for_the_weak.mp3 |
1.7 MB |
| Hardcore, Gabber/Megarave/mrv001/a1 - Hardhead - I'm a Gabber Baby.mp3 |
6 MB |
| Hardcore, Gabber/Megarave/mrv001/b1 - Hardhead - Life is a Mystery.mp3 |
6 MB |
| Hardcore, Gabber/Megarave/mrv002/a1 - RTC. vs. Bass-D & King Matthew - Raveworld.mp3 |
5.6 MB |
| Hardcore, Gabber/Megarave/mrv002/b1 - RTC - Lost Zehn.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv003/a1 - Hardhead - Tu tu tu ep (Dark Mix).mp3 |
5.4 MB |
| Hardcore, Gabber/Megarave/mrv003/b1 - Hardhead - Tu tu tu ep (Gabber Mix).mp3 |
3.7 MB |
| Hardcore, Gabber/Megarave/mrv004/a1 - Rotterdam Terror Corps - Hardcore Slam.mp3 |
5.9 MB |
| Hardcore, Gabber/Megarave/mrv004/a2 - Rotterdam Terror Corps - Intro Humanoid.mp3 |
3.7 MB |
| Hardcore, Gabber/Megarave/mrv004/b1 - Rotterdam Terror Corps - We Are The Gabbers.mp3 |
6.1 MB |
| Hardcore, Gabber/Megarave/mrv004/b2 - Rotterdam Terror Corps - Classics Mix.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv005/a1 - Dr. Z-Vago - The Bat Device.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv005/b1 - Dr. Z-Vago - Superior.mp3 |
3.1 MB |
| Hardcore, Gabber/Megarave/mrv006/A1 - Rotterdam Terror Corps - You're Dealing With.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv006/A2 - Rotterdam Terror Corps - No Happy Shit.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv006/B1 - Rotterdam Terror Corps - The Program.mp3 |
5.3 MB |
| Hardcore, Gabber/Megarave/mrv006/B2 - Rotterdam Terror Corps - To Da Vogue.mp3 |
6.2 MB |
| Hardcore, Gabber/Megarave/mrv006/B3 - Rotterdam Terror Corps - We Are Mortal.mp3 |
1.9 MB |
| Hardcore, Gabber/Megarave/mrv007/A1 - Rotterdam Terror Corps - Megarave.mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv007/A2 - Rotterdam Terror Corps - Devastating mindbender.mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv007/B1 - Rotterdam Terror Corps - Megarave (Dr Z-Vago Remix).mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv008/A1 - Dr Z-Vago - I Control Your Mind.mp3 |
6.4 MB |
| Hardcore, Gabber/Megarave/mrv008/A2 - Dr Z-Vago - Vago.mp3 |
1.4 MB |
| Hardcore, Gabber/Megarave/mrv008/B1 - Dr Z-Vago - Big Decission.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv008/B2 - Dr Z-Vago - Slavery.mp3 |
4.6 MB |
| Hardcore, Gabber/Megarave/mrv009/A1 - Rotterdam Terror Corps - The Horror .mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv009/A2 - Rotterdam Terror Corps - We declare war.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv009/B1 - Rotterdam Terror Corps - We would die for Hardcore.mp3 |
3 MB |
| Hardcore, Gabber/Megarave/mrv009/B2 - Rotterdam Terror Corps - Aaaahaaaa (Cool-E-Mix).mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv010/a1_-_rtc_-_sick_&_twisted.mp3 |
5.2 MB |
| Hardcore, Gabber/Megarave/mrv010/a2_-_rtc_-_beethoven_on_xtc.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv010/b1_-_rtc_-_representing_hardcore.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv010/b2_-_rtc_-_i_believe.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv010/b3_-_rtc_-_the_horror_(buzz_fuzz_remix).mp3 |
6.4 MB |
| Hardcore, Gabber/Megarave/mrv011/A1 - Rotterdam Terror Corps - The Mix (In The Energiehal Rotterdam Mix).mp3 |
15.6 MB |
| Hardcore, Gabber/Megarave/mrv011/B1 - Rotterdam Terror Corps - The Horror (Waxweazle Remix).mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv011/B2 - Rotterdam Terror Corps - Hardcorps Remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Megarave/mrv011/B3 - Rotterdam Terror Corps - No Happy Shit (Dr Z-Vago Remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv012/A1 - United Gabbers of Rotterdam - Power of Rotterdam.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv012/B1 - United Gabbers of Rotterdam - Speaker blaster.mp3 |
4.2 MB |
| Hardcore, Gabber/Megarave/mrv013/A1 - Dr Z-Vago - Mo-Ther-Fu-Ckers.mp3 |
6.4 MB |
| Hardcore, Gabber/Megarave/mrv013/A2 - Dr Z-Vago - Russian Roulette.mp3 |
6.4 MB |
| Hardcore, Gabber/Megarave/mrv013/A3 - Dr Z-Vago - The Sperm.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv013/B1 - Dr Z-Vago - The Bat Device (Cola Mix).mp3 |
6.6 MB |
| Hardcore, Gabber/Megarave/mrv013/B2 - Dr Z-Vago - The Bat Device (Dj Mix).mp3 |
2.7 MB |
| Hardcore, Gabber/Megarave/mrv014/A1 - Rotterdam Terror Corps - There's only one terror.mp3 |
3.4 MB |
| Hardcore, Gabber/Megarave/mrv014/A2 - Rotterdam Terror Corps - Here come the drumz.mp3 |
3.6 MB |
| Hardcore, Gabber/Megarave/mrv014/B1 - Rotterdam Terror Corps - I fuck you now bitch.mp3 |
3.7 MB |
| Hardcore, Gabber/Megarave/mrv014/B2 - Rotterdam Terror Corps - Let yourself go.mp3 |
4.6 MB |
| Hardcore, Gabber/Megarave/mrv015/a1-hardhead - na na na.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv015/b1-hardhead - t.u.l.p. (instant coffee mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv015/b2-hardhead - t.u.l.p. (with milk & sugar mix).mp3 |
4.7 MB |
| Hardcore, Gabber/Megarave/mrv016/A1 - Rotterdam Terror Corps vs. Dr. Macabre - Macabre.MP3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv016/B1 - Rotterdam Terror Corps vs. Dr. Macabre - Apfelsaft.mp3 |
2.1 MB |
| Hardcore, Gabber/Megarave/mrv018/A1 - Rotterdam Terror Corps - Nobody harder.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv018/A2 - Rotterdam Terror Corps - Our vision.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv018/A3 - Rotterdam Terror Corps - Hardcore slam (Rushcorps Remix).mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv018/B1 - Rotterdam Terror Corps - From dusk till doom.mp3 |
3.6 MB |
| Hardcore, Gabber/Megarave/mrv018/B2 - Rotterdam Terror Corps - The music is too much (Hey hey).mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv018/B3 - Rotterdam Terror Corps - Niks te maken (Blijdorp Posse Mix).mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv019/A1 - Dr. Z-Vago - Theme From Vodka.MP3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv020/A1 - Dr. Macabre - Danse Macabre.mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv020/A2 - Dr. Macabre - Hiroshima.mp3 |
6.6 MB |
| Hardcore, Gabber/Megarave/mrv020/B1 - Dr. Macabre - Kiss My Entire Ass.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv020/B2 - Dr. Macabre - Seven.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv020/B3 - Dr. Macabre - Somebody Get Me A Kleenex.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv021/A1 - Rotterdam Terror Corps - Hardcore confrontation.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv021/B1 - Rotterdam Terror Corps - Ima pima.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv021/B2 - Rotterdam Terror Corps - God is a gabber.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv022/A1 - Rotterdam Terror Corps - Paranoid.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv023/A1 - Rotterdam Terror Corps - Nobody harder (G-Town Madness Remix).mp3 |
4.2 MB |
| Hardcore, Gabber/Megarave/mrv023/A2 - Rotterdam Terror Corps - We're gonna blow your mind (DJ Isaac Remix).mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv023/A3 - Rotterdam Terror Corps - We declare war (Dr Z-Vago Remix).mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv024/A1 - Rotterdam Terror Corps - Beyond our minds.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv024/A2 - Rushcorps - The power.mp3 |
5.4 MB |
| Hardcore, Gabber/Megarave/mrv024/A3 - The Dark Twins - Hall of heroes (Live at Megarave 1999).mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv024/B1 - Zolex - Beautiful inside (Orginal version).mp3 |
6.4 MB |
| Hardcore, Gabber/Megarave/mrv024/B2 - Dr Macabre - Sensations of the mind.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv024/B3 - Dr Z-Vago - A cry for help.mp3 |
4.6 MB |
| Hardcore, Gabber/Megarave/mrv025/A1 - Rotterdam Terror Corps - God is a gabber (DJ Paul Remix).mp3 |
7.4 MB |
| Hardcore, Gabber/Megarave/mrv025/A2 - Rotterdam Terror Corps - Beethoven on XTC (Dark Twins Remix).mp3 |
9.1 MB |
| Hardcore, Gabber/Megarave/mrv025/B2 - Rotterdam Terror Corps - The Music is too much (DJ Yves Remix).mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv025/B3 - Rotterdam Terror Corps - Maniac (Original Version).mp3 |
9.8 MB |
| Hardcore, Gabber/Megarave/mrv026/a1_-_rtc_-_are_you_prepared_to_die.mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv026/a2_-_rtc_-_dangerous.mp3 |
4.9 MB |
| Hardcore, Gabber/Megarave/mrv026/b1_-_rtc_-_armageddon.mp3 |
4.7 MB |
| Hardcore, Gabber/Megarave/mrv026/b2_-_rtc_-_industrial_life_2040.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv026/b3_-_rtc_feat_mc_kansloos_-_bas_plezant.mp3 |
3 MB |
| Hardcore, Gabber/Megarave/mrv027/a1 - rotterdam terror corps vs. the masochist - torture.mp3 |
4.6 MB |
| Hardcore, Gabber/Megarave/mrv027/a2 - dr. z-vago - the lab.mp3 |
3.6 MB |
| Hardcore, Gabber/Megarave/mrv027/a3 - the dark twins - jesus asked him.mp3 |
3.9 MB |
| Hardcore, Gabber/Megarave/mrv027/b1 - dr. macabre - alien syndrome.mp3 |
9.1 MB |
| Hardcore, Gabber/Megarave/mrv027/b2 - rotterdam terror corps feat. mc kansloos - ik ben mc ka.mp3 |
3.7 MB |
| Hardcore, Gabber/Megarave/mrv027/b2 - rotterdam terror corps feat. mc kansloos - ik ben mc kansloos.mp3 |
3.7 MB |
| Hardcore, Gabber/Megarave/mrv028/a1 - Dj Distortion vs Dj Paul Elstak - Fear.mp3 |
6.2 MB |
| Hardcore, Gabber/Megarave/mrv028/a2 - Rotterdam Terror Corps - Constrictor.mp3 |
5.3 MB |
| Hardcore, Gabber/Megarave/mrv028/a3 - Rotterdam Terror Corps - Terror Style.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv028/b1 - Rotterdam Terror Corps - The Haunted.mp3 |
5.7 MB |
| Hardcore, Gabber/Megarave/mrv028/b2 - Rotterdam Terror Corps - Terror Feelings.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv028/b3 - Rotterdam Terror Corps - God is a Gabber.mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv029/A1 - Dj Youri & Newbreed - Is Ya With Me (Party Mix).mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv030/A1 - Chosen Few - Doomzday.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv030/A2 - Chosen Few - Doomzday (Remix).mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv030/A3 - Stoophoor - Balkan Dreams.mp3 |
3.8 MB |
| Hardcore, Gabber/Megarave/mrv030/B1 - Chosen Few - Freakin' Out.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv030/B2 - Chosen Few vs Stoophoor - Psycho.mp3 |
10.2 MB |
| Hardcore, Gabber/Megarave/mrv032/a1 - dr z-vago - communism is gone.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv032/a2 - dr z-vago - jump the fuck up.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv032/b1 - dr z-vago - try to kill me.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv032/b2 - dr z-vago - 3 ways to give head.mp3 |
7.7 MB |
| Hardcore, Gabber/Megarave/mrv033/B1 - Mac Hill.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv033/B2 - Da Hoofdklappers - Gabberen.mp3 |
4.9 MB |
| Hardcore, Gabber/Megarave/mrv034/A1 - Marquiz de Sade - Sadizm.mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv034/B1 - Marquiz de Sade - The brother Marquiz.mp3 |
4.7 MB |
| Hardcore, Gabber/Megarave/mrv034/B2 - Marquiz de Sade - SOAB.mp3 |
5.9 MB |
| Hardcore, Gabber/Megarave/mrv035/A1 - The Alienator - Prey (Original Mix).mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv035/A2 - The Alienator - Prey (Headbanger Remix).mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv035/B1 - The Alienator - Aliens among us.mp3 |
9.7 MB |
| Hardcore, Gabber/Megarave/mrv035/B2 - The Alienator - Humanoid.mp3 |
8.1 MB |
| Hardcore, Gabber/Megarave/mrv036/(a1) dj distortion, dr. macabre - shut da fuck up.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv036/(a2) ear terror dj team - like this.mp3 |
5.2 MB |
| Hardcore, Gabber/Megarave/mrv036/(b1) dr. z-vago - the sound of gangsta shit.mp3 |
2 MB |
| Hardcore, Gabber/Megarave/mrv036/(b2) the dark twins - get down.mp3 |
2.7 MB |
| Hardcore, Gabber/Megarave/mrv037/(a1) hard sl - common sense.mp3 |
3.6 MB |
| Hardcore, Gabber/Megarave/mrv037/(a2) hard sl - the attack.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv037/(b1) hard sl - it's allright.mp3 |
7.7 MB |
| Hardcore, Gabber/Megarave/mrv038/(a1) rotterdam terror corps - rotter mother fucking terror.mp3 |
4 MB |
| Hardcore, Gabber/Megarave/mrv038/(a2) rotterdam terror corps - poison mind.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv038/(b1) rotterdam terror corps - we burn you down.mp3 |
2.7 MB |
| Hardcore, Gabber/Megarave/mrv038/(b2) dj distortion, dj paul elstak - the battle has begun.mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv039/A1 - Dj Dione - Confusing M.F.mp3 |
5.4 MB |
| Hardcore, Gabber/Megarave/mrv039/A2 - Dj Dione - Men of Vision.mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv039/B1 - Dj Dione - Human Infestation.mp3 |
4.6 MB |
| Hardcore, Gabber/Megarave/mrv039/B2 - Dj Dione - Bandkiller.mp3 |
5.4 MB |
| Hardcore, Gabber/Megarave/mrv040/(a1) the headbanger, mc alee - strike.mp3 |
3.3 MB |
| Hardcore, Gabber/Megarave/mrv040/(a2) the headbanger, mc ruffian - g-core.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv040/(b1) the headbanger, mc alee - this is war.mp3 |
3.6 MB |
| Hardcore, Gabber/Megarave/mrv040/(b2) the headbanger, mc ruffian - headbangin' beat.mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv041/a1 - DJ Distortion & DJ Paul - jetzt geht's los.mp3 |
3.8 MB |
| Hardcore, Gabber/Megarave/mrv041/a2 - DJ Distortion & DJ Paul - fear (masochist rmx).mp3 |
5.4 MB |
| Hardcore, Gabber/Megarave/mrv041/b1 - DJ Distortion & DJ Paul - dirty words & bonus blowjob.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv041/b2 - DJ Distortion & DJ Paul - fear (reactor & raoul rmx).mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv041/b3 - DJ Distortion & DJ Paul - fear (original mix).mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv042/B2 - Dr Z-Vago - Battle machine.mp3 |
4.9 MB |
| Hardcore, Gabber/Megarave/mrv042/dr z-vago - reloaded.mp3 |
3.4 MB |
| Hardcore, Gabber/Megarave/mrv042/dr. z-vago - dancin' on your grave.mp3 |
3.1 MB |
| Hardcore, Gabber/Megarave/mrv042/dr. z-vago - fuck the world.mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv042/dr. z-vago - stomp on ya brain.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv043/(a1) rotterdam terror corps, the headbanger - psycho game.mp3 |
8.8 MB |
| Hardcore, Gabber/Megarave/mrv043/(a2) rotterdam terror corps, the headbanger - hardcore generation.mp3 |
6.1 MB |
| Hardcore, Gabber/Megarave/mrv043/(b1) rotterdam terror corps, the headbanger - taking u on a trip.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv044/A1 - DJ Dione - Oh god.mp3 |
4.4 MB |
| Hardcore, Gabber/Megarave/mrv044/A2 - DJ Dione - Muddafuckas.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv044/B1 - DJ Dione - Ruff air head.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv044/B2 - DJ Dione - I lose my mind.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv045/(a1) the headbanger - are u afraid of the dark.mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv045/(a2) the headbanger - children of the damned.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv045/(b1) the headbanger - nailed by the king.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv045/(b2) the headbanger - the ninth gate.mp3 |
5.2 MB |
| Hardcore, Gabber/Megarave/mrv046/A1 - DJ Paul vs DJ Distortion - Motherfuckers.mp3 |
7.3 MB |
| Hardcore, Gabber/Megarave/mrv046/A2 - DJ Dione - Asshole.mp3 |
6.2 MB |
| Hardcore, Gabber/Megarave/mrv046/B1 - Dr Z-Vago - Whaazaa .mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv046/B2 - Hard SL - Ultimate soundz.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv047/A1 - Dj Delirium - All This Madness.mp3 |
4.3 MB |
| Hardcore, Gabber/Megarave/mrv047/B1 - Dj Delirium - Into The Light.mp3 |
5.2 MB |
| Hardcore, Gabber/Megarave/mrv047/B2 - Dj Delirium - Shut Up And Listen.mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv048/A1 - Dr. Z-Vago - Gangsta Gangsta.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv048/A2 - Dr. Z-Vago - Rising Sun.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv048/B1 - Dr. Z-Vago - Go Ahead.mp3 |
5.5 MB |
| Hardcore, Gabber/Megarave/mrv048/B2 - Dr. Z-Vago - To All My Underground Deejays.mp3 |
6.2 MB |
| Hardcore, Gabber/Megarave/mrv048/B3 - Dr. Z-Vago - Trippin' On XTC.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv049/A1 - Dj Dione - Time to Party.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv049/A2 - Dj Dione - Asshole.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv049/B1 - Dj Dione - Critical Damage.mp3 |
5.1 MB |
| Hardcore, Gabber/Megarave/mrv049/B2 - Dj Dione - 2 Damn Hard.mp3 |
4.7 MB |
| Hardcore, Gabber/Megarave/mrv050a/a1_dr._z_vago_-_world_of_chaos.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv051/A1 - The Headbanger - Violator.mp3 |
5.2 MB |
| Hardcore, Gabber/Megarave/mrv051/A2 - The Headbanger - Voodoo Magic.mp3 |
5.6 MB |
| Hardcore, Gabber/Megarave/mrv051/B1 - The Headbanger - Raven Was Called Sin.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv051/B2 - The Headbanger - Sweet Dreams... (You Bastard) [2002 Remix].mp3 |
3.4 MB |
| Hardcore, Gabber/Megarave/mrv052/A1 - The Alienator [The Headbanger] - Causin' Panic.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv052/A2 - The Alienator [The Headbanger] - Alien Ressurection.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv052/B1 - The Alienator [The Headbanger] - Species.mp3 |
9.1 MB |
| Hardcore, Gabber/Megarave/mrv052/B2 - The Alienator [The Headbanger] - Mars Needs Women.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv053/A1 - Dr. Z-Vago - Words Of Weapons.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv053/A2 - Dr. Z-Vago - Get The Fuck Up.mp3 |
7.6 MB |
| Hardcore, Gabber/Megarave/mrv053/B1 - Dr. Z-Vago - Flying High.mp3 |
4.7 MB |
| Hardcore, Gabber/Megarave/mrv053/B2 - Dr. Z-Vago - Light That Shit Up.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv054/A1 - Rotterdam Terror Corps - Unleash Hell [Original Mix].mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv054/B1 - Rotterdam Terror Corps - Unleash Hell [Terror Mix].mp3 |
3.2 MB |
| Hardcore, Gabber/Megarave/mrv055/a1 - Dj Dione - Erased from Existence.mp3 |
10.4 MB |
| Hardcore, Gabber/Megarave/mrv055/a2 - Dj Dione - War Against The Machines.mp3 |
9.6 MB |
| Hardcore, Gabber/Megarave/mrv055/b1 - Dj Dione - B-cool.mp3 |
9.9 MB |
| Hardcore, Gabber/Megarave/mrv055/b2 - Dj Dione - Face of Pain.mp3 |
10.4 MB |
| Hardcore, Gabber/Megarave/mrv056/A1 - Dj Dione vs. Dr. Z-Vago - Raw 2 The Core.mp3 |
7.7 MB |
| Hardcore, Gabber/Megarave/mrv056/dione & dr. z-vago - i will not be pushed.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv056/dione & dr. z-vago - out on parool.mp3 |
9.5 MB |
| Hardcore, Gabber/Megarave/mrv056/dione & dr. z-vago - rateling eardrumz.mp3 |
4.5 MB |
| Hardcore, Gabber/Megarave/mrv057/DJ Dione - no dominion.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv057/E-Noid - this is the ultimate.mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv057/Negative A - cocksucker fuck you.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv057/Paul & Distortion - dirty words (dione rmx).mp3 |
7.9 MB |
| Hardcore, Gabber/Megarave/mrv057/The Alienator - we warned you.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv059/A1 - The Alienator - The Terminator.mp3 |
9.5 MB |
| Hardcore, Gabber/Megarave/mrv059/A2 - The Alienator - War of the worldz.mp3 |
8.1 MB |
| Hardcore, Gabber/Megarave/mrv059/B1 - The Alienator - The invaders.mp3 |
9.2 MB |
| Hardcore, Gabber/Megarave/mrv059/B2 - The Alienator - The one.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv060/01-dr._z-vago-welcome_to_hellraiser-doc.mp3 |
8.8 MB |
| Hardcore, Gabber/Megarave/mrv060/02 - E-Noid - Razors Thru Flesh.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv060/03 - Dj Dione - Lightning Hell.mp3 |
7.6 MB |
| Hardcore, Gabber/Megarave/mrv060/04 - Justice - Born To Raise Hell.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv061/a1 dr. z-vago - the bone breaker.mp3 |
7.3 MB |
| Hardcore, Gabber/Megarave/mrv061/a2 dr. z-vago - gun clapping.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv061/b1 dr. z-vago - keep it underground.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv061/b2 dr. z-vago - read your mind.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv062/a1_rotterdam_terror_corps_-_i_will_never_surrender-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Megarave/mrv063/a1_headbanger_and_delirium_-_danger-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Megarave/mrv063/a2_headbanger_and_delirium_-_messin_with_the_devil-sq.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv063/b1_headbanger_and_delirium_-_dark_impulses_(original_mix)-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv063/b2_headbanger_and_delirium_-_the_exterminators-sq.mp3 |
6.4 MB |
| Hardcore, Gabber/Megarave/mrv064/01_dr.z-vago_vs_outblast_-_seiko_groupie-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Megarave/mrv064/02_dr.z-vago_vs_outblast_-_break_a_bitch_neck-sq.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv064/03_dr.z-vago_vs_outblast_-_fireballs-sq.mp3 |
7.7 MB |
| Hardcore, Gabber/Megarave/mrv064/04_dr.z-vago_vs_outblast_-_hands_down-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Megarave/mrv065/a1_paul_elstak_and_firestone_-_hardcore_hell-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Megarave/mrv065/b1_dione_-_pain_and_pleasure-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv065/b2_negative_a_-_the_greatest_suffering-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv066/a1_dj_dione_-_rock_the_place-sq.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv066/a2_dj_dione_-_supercrazy-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv066/b1_dj_dione_-_just_kickin_ass-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv066/b2_dj_dione_-_the_storm-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv067/a1_dj_dione_-_pain_till_i_die-djneo.mp3 |
7.3 MB |
| Hardcore, Gabber/Megarave/mrv067/a2_dj_paul_and_dj_distortion_-_why_the_fuck-djneo.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv067/b1_dj_paul_feat._the_dark_twins_-_god_is_the_ultimate_gangster-djneo.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv067/b2_va_corps_-_shift_functions-djneo.mp3 |
5.7 MB |
| Hardcore, Gabber/Megarave/mrv068/A1 - Dr Z-Vago - My destiny.mp3 |
5.9 MB |
| Hardcore, Gabber/Megarave/mrv068/A2 - Dr Z-Vago - Straight from the underground.mp3 |
6.1 MB |
| Hardcore, Gabber/Megarave/mrv068/B1 - Dr Z-Vago - Ruff rugged & raw.mp3 |
5 MB |
| Hardcore, Gabber/Megarave/mrv069/B1 The Headbanger - Dead By Dawn.mp3 |
6.8 MB |
| Hardcore, Gabber/Megarave/mrv069/B2 The Headbanger - Daywalker.mp3 |
8.5 MB |
| Hardcore, Gabber/Megarave/mrv070/Dione - Come Here And Die.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv070/Dr Z-vago - Lesson One.mp3 |
8.3 MB |
| Hardcore, Gabber/Megarave/mrv070/E-Noid - No Good No Evil.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv070/Headbanger Vs Delirium - Hell Send.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv070/Leviathan And Dione - Send Me To Hell.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv071/00_headbanger_vs._alienator_-_the_remixes-trackfix-(mrv071)-vinyl-2004-sq.m3u |
67 B |
| Hardcore, Gabber/Megarave/mrv071/00_headbanger_vs._alienator_-_the_remixes-trackfix-(mrv071)-vinyl-2004-sq.nfo |
7 KB |
| Hardcore, Gabber/Megarave/mrv071/a1_headbanger_-_violator_(tommyknocker_remix)-sq.mp3 |
7.3 MB |
| Hardcore, Gabber/Megarave/mrv071/a2_headbanger_feat._mc_alee_-_pray_for_daylight-sq.mp3 |
9 MB |
| Hardcore, Gabber/Megarave/mrv071/b1_alienator_-_prey_(promos_reyp_mix)-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv071/b2_headbanger_and_alienator_feat._mc_alee_-_strike_(outblast.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv071/b2_headbanger_and_alienator_feat._mc_alee_-_strike_(outblast_remix)-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv074/a1-dione - silence is loud.mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv074/a2-dione - go fuck yourself.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv074/b1-dione - out with the quickness.mp3 |
7.4 MB |
| Hardcore, Gabber/Megarave/mrv074/b2-dione - i grab my nine.mp3 |
6.1 MB |
| Hardcore, Gabber/Megarave/mrv074/b2-dione - i grab my nine.mp3.asd |
526 KB |
| Hardcore, Gabber/Megarave/mrv074/b3-dione - the noisy show.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv075b/01-a1_paul_elstak_and_distortion_feat._mc_ruffian-this_aint_.mp3 |
5.9 MB |
| Hardcore, Gabber/Megarave/mrv075b/02-a2_dr.z-vago-biohazard_muthafucka-dgn.mp3 |
8.3 MB |
| Hardcore, Gabber/Megarave/mrv075b/03-b1_dione-our_future-dgn.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv075b/04-b2_slavefriese-ecstacy_me-dgn.mp3 |
5.8 MB |
| Hardcore, Gabber/Megarave/mrv078/a1_e-noid_-_antichrist-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Megarave/mrv078/a2_alienator_-_7_gods_of_chaos-sq.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv078/b1_negative_a_and_darkcontroller_-_mad_insane-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv078/b2_d-xtreme_-_this_is_the_sound_of_the_underground-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Megarave/mrv078/b3_slavefriese_-_stay_down_with_the_hardcore-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv079/a1_chosen_few_-_doomzday-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv079/a2_dr._macabre_-_danse_macabre-sq.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv079/b1_rotterdam_terror_corps_-_schizophrenic-sq.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv079/b2_dr._z-vago_-_the_bat_device-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv080/a1-dione - the way is shut.mp3 |
9.2 MB |
| Hardcore, Gabber/Megarave/mrv080/a2-dione - fucking sacrilege.mp3 |
9.1 MB |
| Hardcore, Gabber/Megarave/mrv080/b1-dione - eye of the storm.mp3 |
9.3 MB |
| Hardcore, Gabber/Megarave/mrv080/b2-dione - global killer.mp3 |
8.6 MB |
| Hardcore, Gabber/Megarave/mrv081/a1_headbanger_feat._dione_-_pain_is_god-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv081/a2_headbanger_feat._mainframe_and_whiplash_-_clash_of_the_ti.mp3 |
6 MB |
| Hardcore, Gabber/Megarave/mrv081/b1_headbanger_feat._omar_santana_-_eye_of_hell-sq.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv081/b2_headbanger_feat._the_darktwins_-_nightterrors-sq.mp3 |
7 MB |
| Hardcore, Gabber/Megarave/mrv082/a1_dione_-_deluge-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Megarave/mrv082/a2_paul_elstak_and_headbanger_-_god_is_not_here_today-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv082/b1_dr._z-vago_and_dj_d_-_the_dead_walk-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Megarave/mrv082/b2_alienator_-_mindkiller-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv083/a1_rotterdam_terror_corps_-_the_legacy-sq.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv083/a2_dione_-_hold_on-sq.mp3 |
8.7 MB |
| Hardcore, Gabber/Megarave/mrv083/b1_alienator_-_causin_panic_(paul_elstak_remix)-sq.mp3 |
7.4 MB |
| Hardcore, Gabber/Megarave/mrv083/b2_dr._z-vago_-_live_transmission-sq.mp3 |
7.6 MB |
| Hardcore, Gabber/Megarave/mrv084/a1-paul_vs_distortion_-_stop_looking_at_me-hb.mp3 |
8.4 MB |
| Hardcore, Gabber/Megarave/mrv084/a2-alienator_-_prey_(headbanger_remix)-hb.mp3 |
8.3 MB |
| Hardcore, Gabber/Megarave/mrv084/b1-rotterdom_terror_corps_-_are_you_prepared_to_die-hb.mp3 |
8.7 MB |
| Hardcore, Gabber/Megarave/mrv085/a1-rotterdam_terror_corps_-_hardcore_gladiators-hb.mp3 |
8.2 MB |
| Hardcore, Gabber/Megarave/mrv085/a2-rotterdam_terror_corps_-_hardcore_gladiators_(classic_intro)-hb.mp3 |
4.8 MB |
| Hardcore, Gabber/Megarave/mrv085/b1-dione_and_dr_z-vago_-_depth_of_bass-hb.mp3 |
8.1 MB |
| Hardcore, Gabber/Megarave/mrv085/b2-headbanger_-_sacrifices-hb.mp3 |
7.7 MB |
| Hardcore, Gabber/Megarave/mrv088/00_dione_-_remixes_and_refixes-(mrv088)-vinyl-2006-sq.m3u |
229 B |
| Hardcore, Gabber/Megarave/mrv088/00_dione_-_remixes_and_refixes-(mrv088)-vinyl-2006-sq.nfo |
7 KB |
| Hardcore, Gabber/Megarave/mrv088/00_dione_-_remixes_and_refixes-(mrv088)-vinyl-2006-sq.sfv |
279 B |
| Hardcore, Gabber/Megarave/mrv088/a1_dione_-_ruff_confusing-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Megarave/mrv088/a2_dione_-_muddafuckas_(2005_refix)-sq.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv088/a3_dione_-_just_kickin_ass_(dj_paul_remix)-sq.mp3 |
8.6 MB |
| Hardcore, Gabber/Megarave/mrv088/b1_dione_-_rock_the_place_(omar_santana_remix)-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Megarave/mrv088/b2_dione_-_come_here_and_die_(dj_d_remix)-sq.mp3 |
9.5 MB |
| Hardcore, Gabber/Megarave/mrv090/a1_headbanger_-_apocolypse_(feat_mc_mouth_of_madness)-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Megarave/mrv090/a2_headbanger_-_straight_4_tha_headz-sq.mp3 |
8.5 MB |
| Hardcore, Gabber/Megarave/mrv090/b1_headbanger_-_devastator-sq.mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv090/b2_headbanger_-_serious_damage_(feat_mc_allee)-sq.mp3 |
8.7 MB |
| Hardcore, Gabber/Megarave/mrv091/a1_ear_terror_dj_team_-_like_this_(dione_remix)-sq.mp3 |
9.5 MB |
| Hardcore, Gabber/Megarave/mrv091/a2_ear_terror_dj_team_-_like_this-sq.mp3 |
10.3 MB |
| Hardcore, Gabber/Megarave/mrv091/b1_headbanger_feat_mc_alee_-_strike-sq.mp3 |
8.9 MB |
| Hardcore, Gabber/Megarave/mrv091/b2_distortion_and_paul_elstak_-_motherfucker-sq.mp3 |
9.2 MB |
| Hardcore, Gabber/Megarave/mrv091/b3_hardcore_factory_-_nobody_harder_two_(kickin_bass_mix)-sq.mp3 |
8.2 MB |
| Hardcore, Gabber/Megarave/mrv092/00_kasparov_-_deathrow-(mrv092)-vinyl-2006.m3u |
152 B |
| Hardcore, Gabber/Megarave/mrv092/00_kasparov_-_deathrow-(mrv092)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Megarave/mrv092/00_kasparov_-_deathrow-(mrv092)-vinyl-2006.sfv |
197 B |
| Hardcore, Gabber/Megarave/mrv092/a1_kasparov_-_scotch_attack.mp3 |
9.9 MB |
| Hardcore, Gabber/Megarave/mrv092/a2_kasparov_-_soundbending_bitch.mp3 |
9.9 MB |
| Hardcore, Gabber/Megarave/mrv092/a3_kasparov_-_accapella.mp3 |
4.1 MB |
| Hardcore, Gabber/Megarave/mrv092/b1_kasparov_-_the_world.mp3 |
9.2 MB |
| Hardcore, Gabber/Megarave/mrv092/b2_kasparov_-_deathrow.mp3 |
10.1 MB |
| Hardcore, Gabber/Megarave/mrv093/00_va_-_hellraiser_vs_megarave-(mrv093)-vinyl-2006.m3u |
309 B |
| Hardcore, Gabber/Megarave/mrv093/00_va_-_hellraiser_vs_megarave-(mrv093)-vinyl-2006.nfo |
8 KB |
| Hardcore, Gabber/Megarave/mrv093/00_va_-_hellraiser_vs_megarave-(mrv093)-vinyl-2006.sfv |
381 B |
| Hardcore, Gabber/Megarave/mrv093/a1_dione_-_protect_your_soul.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv093/a2_headbanger_-_enter_my_domain.mp3 |
8.1 MB |
| Hardcore, Gabber/Megarave/mrv093/b1_kasparov_-_hellraising.mp3 |
9 MB |
| Hardcore, Gabber/Megarave/mrv093/b2_source_code_and_reflect_-_i_am_forever_(hellraising_mix).mp3 |
10.3 MB |
| Hardcore, Gabber/Megarave/mrv093/c1_dr_z-vago_-_now_youre_fucked.mp3 |
8.9 MB |
| Hardcore, Gabber/Megarave/mrv093/c2_slavefriese_-_forever_and_eternity.mp3 |
7.7 MB |
| Hardcore, Gabber/Megarave/mrv093/d1_darkcontroller_-_insurruction.mp3 |
11 MB |
| Hardcore, Gabber/Megarave/mrv093/d2_s.r.b._-_snake_business.mp3 |
10.1 MB |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/00_dj_partyraiser_-_harder_dan_de_rest-(mrv094)-vinyl-2006.m3u |
158 B |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/00_dj_partyraiser_-_harder_dan_de_rest-(mrv094)-vinyl-2006.nfo |
7 KB |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/00_dj_partyraiser_-_harder_dan_de_rest-(mrv094)-vinyl-2006.sfv |
194 B |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/a1_dj_partyraiser_-_dancing_on_your_grave.mp3 |
7.9 MB |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/a2_dj_partyraiser_-_harder_dan_de_rest.mp3 |
7.1 MB |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/b1_dj_partyraiser_-_fuck_yall.mp3 |
8.6 MB |
| Hardcore, Gabber/Megarave/mrv094/DJ_Partyraiser_-_Harder_Dan_De_Rest-(MRV094)-Vinyl-2006-SQ/b2_dj_partyraiser_-_kraak-piep.mp3 |
4.2 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/00-headbanger_-_baddest_motherfucker_(mrv095)_2x12-vinyl-2007-nbd.m3u |
392 B |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/00-headbanger_-_baddest_motherfucker_(mrv095)_2x12-vinyl-2007-nbd.nfo |
10 KB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/00-headbanger_-_baddest_motherfucker_(mrv095)_2x12-vinyl-2007-nbd.sfv |
464 B |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/01-headbanger_-_baddest_motherfucker-nbd.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/02-headbanger_-_damn_u_to_hell_(feat._dione)-nbd.mp3 |
8.8 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/03-headbanger_-_god_of_hell-nbd.mp3 |
7.6 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/04-headbanger_-_come_out_to_play-nbd.mp3 |
8.3 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/05-headbanger_-_what_the_hell_are_you_waiting_4-nbd.mp3 |
8.1 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/06-headbanger_-_power_of_evil-nbd.mp3 |
8.2 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/07-headbanger_-_cant_stop_us_now_(feat._lords_of_dominion)-nbd.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv095/Headbanger_-_Baddest_Motherfucker_(MRV095)_2x12-Vinyl-2007-NBD/08-headbanger_-_partybanger_(feat._partyraiser)-nbd.mp3 |
8.4 MB |
| Hardcore, Gabber/Megarave/mrv096/00-kasparov_-_intrusion-vinyl-2007.m3u |
144 B |
| Hardcore, Gabber/Megarave/mrv096/00-kasparov_-_intrusion-vinyl-2007.nfo |
647 B |
| Hardcore, Gabber/Megarave/mrv096/00-kasparov_-_intrusion-vinyl-2007.sfv |
194 B |
| Hardcore, Gabber/Megarave/mrv096/01-kasparov_-_intrusion.mp3 |
10 MB |
| Hardcore, Gabber/Megarave/mrv096/02-kasparov_-_magic.mp3 |
9.1 MB |
| Hardcore, Gabber/Megarave/mrv096/03-kasparov_-_magic_(accapella).mp3 |
2.9 MB |
| Hardcore, Gabber/Megarave/mrv096/04-kasparov_-_speaker.mp3 |
9.7 MB |
| Hardcore, Gabber/Megarave/mrv096/05-kasparov_-_instruments.mp3 |
8.6 MB |
| Hardcore, Gabber/Megarave/mrv097/a1-pain_till_i_die.mp3 |
8.7 MB |
| Hardcore, Gabber/Megarave/mrv097/a2-pain_till_i_die_(the_headbanger_remix).mp3 |
8.9 MB |
| Hardcore, Gabber/Megarave/mrv097/b1-deluge_(kasparov_remix).mp3 |
9.8 MB |
| Hardcore, Gabber/Megarave/mrv097/b2-war_against_the_machines.mp3 |
8.9 MB |
| Hardcore, Gabber/Megarave/mrv098/00-partyraiser_and_triax-assassins_remixes-(mrv098)-vinyl-2007-1real.m3u |
271 B |
| Hardcore, Gabber/Megarave/mrv098/00-partyraiser_and_triax-assassins_remixes-(mrv098)-vinyl-2007-1real.nfo |
8 KB |
| Hardcore, Gabber/Megarave/mrv098/00-partyraiser_and_triax-assassins_remixes-(mrv098)-vinyl-2007-1real.sfv |
2 KB |
| Hardcore, Gabber/Megarave/mrv098/a1-partyraiser_and_triax-assassins_(nosferatu_one_shot_remix)-1real.mp3 |
9.6 MB |
| Hardcore, Gabber/Megarave/mrv098/a2-partyraiser_and_triax-assassins_(lunatic_and_miss_hysteria_remix)-1real.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv098/b1-partyraiser_and_triax-assassins_(hitmen_remix)-1real.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv098/b2-partyraiser_and_triax-assassins_(original_mix)-1real.mp3 |
9.3 MB |
| Hardcore, Gabber/Megarave/mrv100b/00_va_-_members_of_megarave_part_2-(mrv100b)-vinyl-2008.jpg |
125 KB |
| Hardcore, Gabber/Megarave/mrv100b/00_va_-_members_of_megarave_part_2-(mrv100b)-vinyl-2008.m3u |
204 B |
| Hardcore, Gabber/Megarave/mrv100b/00_va_-_members_of_megarave_part_2-(mrv100b)-vinyl-2008.nfo |
929 B |
| Hardcore, Gabber/Megarave/mrv100b/00_va_-_members_of_megarave_part_2-(mrv100b)-vinyl-2008.sfv |
240 B |
| Hardcore, Gabber/Megarave/mrv100b/a1_the_hitmen_ft_mc_raw_-_cradle_of_hardcore.mp3 |
8.3 MB |
| Hardcore, Gabber/Megarave/mrv100b/a2_lunatic_and_miss_hysteria_ft_mc_raw_-_the_point_of_no_return.mp3 |
8.5 MB |
| Hardcore, Gabber/Megarave/mrv100b/b1_partyraiser_ft_mc_raw_-_raw_raising.mp3 |
6.5 MB |
| Hardcore, Gabber/Megarave/mrv100b/b2_hardhead_-_t.u.l.p._(bonustrack).mp3 |
6.9 MB |
| Hardcore, Gabber/Megarave/mrv104/00_va_-_headbanger_presents_head_to_head_vol_3-(mrv104)-2xvinyl-2008.jpg |
130 KB |
| Hardcore, Gabber/Megarave/mrv104/00_va_-_headbanger_presents_head_to_head_vol_3-(mrv104)-2xvinyl-2008.m3u |
358 B |
| Hardcore, Gabber/Megarave/mrv104/00_va_-_headbanger_presents_head_to_head_vol_3-(mrv104)-2xvinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Megarave/mrv104/00_va_-_headbanger_presents_head_to_head_vol_3-(mrv104)-2xvinyl-2008.sfv |
430 B |
| Hardcore, Gabber/Megarave/mrv104/a1_headbanger_-_never_ever_scream.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv104/a2_headbanger_vs_dj_j.d.a._-_mark_u_4_death.mp3 |
7.2 MB |
| Hardcore, Gabber/Megarave/mrv104/b1_headbanger_vs_human_resource_-_beserker.mp3 |
8.1 MB |
| Hardcore, Gabber/Megarave/mrv104/b2_headbanger_vs_kasparov_-_die_you_motherfucker.mp3 |
7.8 MB |
| Hardcore, Gabber/Megarave/mrv104/c1_headbanger_-_god_abandoned_me.mp3 |
7.5 MB |
| Hardcore, Gabber/Megarave/mrv104/c2_headbanger_ft_mc_raw_-_end_of_days.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv104/d1_headbanger_vs_omar_santana_-_rock_the_masses.mp3 |
8 MB |
| Hardcore, Gabber/Megarave/mrv104/d2_headbanger_-_seek_revenge.mp3 |
7.4 MB |
| Hardcore, Gabber/Megarave/mrv105/00_dione_-_it_is_upon_us-(mrv105)-vinyl-2008.jpg |
126 KB |
| Hardcore, Gabber/Megarave/mrv105/00_dione_-_it_is_upon_us-(mrv105)-vinyl-2008.m3u |
115 B |
| Hardcore, Gabber/Megarave/mrv105/00_dione_-_it_is_upon_us-(mrv105)-vinyl-2008.nfo |
779 B |
| Hardcore, Gabber/Megarave/mrv105/00_dione_-_it_is_upon_us-(mrv105)-vinyl-2008.sfv |
151 B |
| Hardcore, Gabber/Megarave/mrv105/a1_dione_-_it_is_upon_us.mp3 |
6.3 MB |
| Hardcore, Gabber/Megarave/mrv105/a2_dione_-_drop_like_this.mp3 |
7.9 MB |
| Hardcore, Gabber/Megarave/mrv105/b1_dione_-_lights_out.mp3 |
7.4 MB |
| Hardcore, Gabber/Megarave/mrv105/b2_dione_-_no_funeral.mp3 |
7.2 MB |
| Hardcore, Gabber/Meta4/meta4 A/a1 - Bryan Fury - No Escape.mp3 |
7.7 MB |
| Hardcore, Gabber/Meta4/meta4 A/a2 - Deceiver - Corporate Little Bitches.mp3 |
4.9 MB |
| Hardcore, Gabber/Meta4/meta4 A/a3 - Ophidian - Asphyxia.mp3 |
4.4 MB |
| Hardcore, Gabber/Meta4/meta4 A/b1 - Forsaken Is Dead - Not Your Average Man.mp3 |
6.7 MB |
| Hardcore, Gabber/Meta4/meta4 A/b2 - Forsaken & Flatline - Embalming Fluid.mp3 |
7.7 MB |
| Hardcore, Gabber/Meta4/meta4 A/b3 - Tapage - Flowerbed Death Bed.mp3 |
3.3 MB |
| Hardcore, Gabber/Meta4/meta4 B/a1_forsaken_is_dead_-_let_me_in-sq.mp3 |
1.4 MB |
| Hardcore, Gabber/Meta4/meta4 B/a2_forsaken_is_dead_-_related_reasoning-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Meta4/meta4 B/a3_forsaken_is_dead_-_dead_inside-sq.mp3 |
7.9 MB |
| Hardcore, Gabber/Meta4/meta4 B/b1_forsaken_is_dead_-_brain_plate_techtonics-sq.mp3 |
6.7 MB |
| Hardcore, Gabber/Meta4/meta4 B/b2_forsaken_is_dead_-_id_rather_be_insane-sq.mp3 |
7 MB |
| Hardcore, Gabber/Meta4/meta4 B/b3_forsaken_is_dead_-_i_kill_anyone-sq.mp3 |
5.4 MB |
| Hardcore, Gabber/Meta4/meta4 C/a1_omkara_techichi_-_undefiled_wisdom-sq.mp3 |
11.8 MB |
| Hardcore, Gabber/Meta4/meta4 C/a2_skinnah_and_dj_ruffneck_-_push_the_envelope-sq.mp3 |
9.5 MB |
| Hardcore, Gabber/Meta4/meta4 C/b1_deceiver_-_shock_horror-sq.mp3 |
5.6 MB |
| Hardcore, Gabber/Meta4/meta4 C/b2_nosferatu_-_hot-headed-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Meta4/meta4 C/b3_tapage_and_meander_-_chestnut_theory_ice_cavern_(death)-sq.mp3 |
9.7 MB |
| Hardcore, Gabber/Meta4/meta4 D/a1_tieum_and_ophidian_-_de_la_rue-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Meta4/meta4 D/a2_tieum_and_ophidian_-_intolerated_obsessions-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Meta4/meta4 D/b1_tieum_and_ophidian_-_dark_is_a_part_of_you-sq.mp3 |
7.2 MB |
| Hardcore, Gabber/Meta4/meta4 D/b2_tieum_and_ophidian_-_what_frequencies_do_to_people-sq.mp3 |
6.9 MB |
| Hardcore, Gabber/Meta4/meta4 E/a1_ophidian_and_dj_ruffneck_-_noisemaker-sq.mp3 |
6.6 MB |
| Hardcore, Gabber/Meta4/meta4 E/a2_tapage_-_(llll)-sq.mp3 |
6.4 MB |
| Hardcore, Gabber/Meta4/meta4 E/b1_napalm_candy_-_dark_overdrive-sq.mp3 |
6.3 MB |
| Hardcore, Gabber/Meta4/meta4 E/b2_omkara_techichi_-_nocturnal_stasis-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Meta4/meta4 E/c1_serum_-_iron_cloud_rotating-sq.mp3 |
8.3 MB |
| Hardcore, Gabber/Meta4/meta4 E/c2_forsaken_is_dead_-_my_holy_war-sq.mp3 |
6.5 MB |
| Hardcore, Gabber/Meta4/meta4 E/d1_dj_triax_-_skin_rash.mp3 |
4 MB |
| Hardcore, Gabber/Meta4/meta4 E/d2_the_outside_agency_-_brainpainter.mp3 |
5.3 MB |
| Hardcore, Gabber/Meta4/meta4 E/e1_mortifer_-_message_from_hannover_(ft. mc mirender).mp3 |
4.6 MB |
| Hardcore, Gabber/Meta4/meta4 E/e2_deceiver_-_committed_it_all.mp3 |
4.5 MB |
| Hardcore, Gabber/Meta4/meta4 E/f1_nosferatu_-_unpredictable.mp3 |
4.7 MB |
| Hardcore, Gabber/Meta4/meta4 E/f2_tieum_-_annihilating_rhythm-sq.mp3 |
5.8 MB |
| Hardcore, Gabber/Meta4/meta4 I/00-ophidian_as_raziel-to_sing_of_desecration-(meta4_i)-vinyl-2007-1real.m3u |
950 B |
| Hardcore, Gabber/Meta4/meta4 I/00-ophidian_as_raziel-to_sing_of_desecration-(meta4_i)-vinyl-2007-1real.nfo |
8 KB |
| Hardcore, Gabber/Meta4/meta4 I/00-ophidian_as_raziel-to_sing_of_desecration-(meta4_i)-vinyl-2007-1real.sfv |
4 KB |
| Hardcore, Gabber/Meta4/meta4 I/a1-ophidian_as_raziel-when_adrift_in_yesteryear-1real.mp3 |
1.2 MB |
| Hardcore, Gabber/Meta4/meta4 I/a2-ophidian_as_raziel-to_deform_the_present-1real.mp3 |
6.9 MB |
| Hardcore, Gabber/Meta4/meta4 I/a3-ophidian_as_raziel-when_repelling_reflection-1real.mp3 |
462 KB |
| Hardcore, Gabber/Meta4/meta4 I/a4-ophidian_as_raziel-to_revere_completion-1real.mp3 |
7.7 MB |
| Hardcore, Gabber/Meta4/meta4 I/b1-ophidian_as_raziel-when_trapped_in_the_paradox-1real.mp3 |
548 KB |
| Hardcore, Gabber/Meta4/meta4 I/b2-ophidian_as_raziel-to_forbid_the_imperative-1real.mp3 |
7.9 MB |
| Hardcore, Gabber/Meta4/meta4 I/b3-ophidian_as_raziel-when_crying_in_the_mist-1real.mp3 |
732 KB |
| Hardcore, Gabber/Meta4/meta4 I/b4-ophidian_as_raziel-to_destroy_what_is_broken_(destroyed_by_serum)-1real.mp3 |
7.7 MB |
| Hardcore, Gabber/Meta4/meta4 I/c1-ophidian_as_raziel-when_caught_and_confused-1real.mp3 |
532 KB |
| Hardcore, Gabber/Meta4/meta4 I/c2-ophidian_as_raziel-to_banish_sanity-1real.mp3 |
8.4 MB |
| Hardcore, Gabber/Meta4/meta4 I/c3-ophidian_as_raziel-when_confronted_with_the_consequence-1real.mp3 |
548 KB |
| Hardcore, Gabber/Meta4/meta4 I/c4-ophidian_as_raziel-to_punish_the_weak_(punished_by_tapage)-1real.mp3 |
9.3 MB |
| Hardcore, Gabber/Meta4/meta4 I/d1-ophidian_as_raziel-when_cast_into_nullity-1real.mp3 |
1 MB |
| Hardcore, Gabber/Meta4/meta4 I/d2-ophidian_as_raziel-to_fabricate_the_future-1real.mp3 |
8.7 MB |
| Hardcore, Gabber/Meta4/meta4 I/d3-ophidian_as_raziel-when_awaiting_impending_collapse-1real.mp3 |
496 KB |
| Hardcore, Gabber/Meta4/meta4 I/d4-ophidian_as_raziel-to_pray_for_amnesia-1real.mp3 |
7 MB |
| Hardcore, Gabber/Metal/mtl004/00_c.o.r.e._system-system_output_1.01-(mtl04)-vinyl-2008.m3u |
73 B |
| Hardcore, Gabber/Metal/mtl004/00_c.o.r.e._system-system_output_1.01-(mtl04)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Metal/mtl004/00_c.o.r.e._system-system_output_1.01-(mtl04)-vinyl-2008.sfv |
91 B |
| Hardcore, Gabber/Metal/mtl004/a1_c.o.r.e._system-healthy_habitz.mp3 |
8.9 MB |
| Hardcore, Gabber/Metal/mtl004/b1_c.o.r.e._system-torn_down.mp3 |
7.9 MB |
| Hardcore, Gabber/Metal/mtl005/00_metal_head-rolling_phase-(mtl05)-vinyl-2008.m3u |
60 B |
| Hardcore, Gabber/Metal/mtl005/00_metal_head-rolling_phase-(mtl05)-vinyl-2008.nfo |
1 KB |
| Hardcore, Gabber/Metal/mtl005/00_metal_head-rolling_phase-(mtl05)-vinyl-2008.sfv |
78 B |
| Hardcore, Gabber/Metal/mtl005/a1_metal_head-rolling_phase.mp3 |
8 MB |
| Hardcore, Gabber/Metal/mtl005/b1_metal_head-phase_2.mp3 |
8.8 MB |
| Hardcore, Gabber/Mid-Town/middig026/00-dj_paul_estak-2007_hardcore_remixes_(middig026)-cdr-2007.m3u |
341 B |
| Hardcore, Gabber/Mid-Town/middig026/00-dj_paul_estak-2007_hardcore_remixes_(middig026)-cdr-2007.nfo |
791 B |
| Hardcore, Gabber/Mid-Town/middig026/00-dj_paul_estak-2007_hardcore_remixes_(middig026)-cdr-2007.sfv |
395 B |
| Hardcore, Gabber/Mid-Town/middig026/01-dj_paul_estak-rocking_beats_(accelerator_remix).mp3 |
7 MB |
| Hardcore, Gabber/Mid-Town/middig026/02-dj_paul_estak-life_is_like_a_dance_(the_hitmen_remix).mp3 |
6.8 MB |
| Hardcore, Gabber/Mid-Town/middig026/03-dj_paul_estak-code_red_(mainframe_remix).mp3 |
6.6 MB |
| Hardcore, Gabber/Mid-Town/middig026/04-dj_paul_estak-we_gonna_get_this_place_(dj_dione_remix).mp3 |
6.3 MB |
| Hardcore, Gabber/Mid-Town/middig026/05-dj_paul_estak-let_there_b_house_(accelerator_remix).mp3 |
7.6 MB |
| Hardcore, Gabber/Mid-Town/middig026/06-dj_paul_estak-noiken_in_de_koiken_(plague_remix).mp3 |
6.9 MB |
| Hardcore, Gabber/Mid-Town/midlp001/01 - Dyewitness - Observing the Earth.mp3 |
9.1 MB |
| Hardcore, Gabber/Mid-Town/midlp001/02 - Dyewitness - Battle for your Mind.mp3 |
9.7 MB |
| Hardcore, Gabber/Mid-Town/midlp001/03 - Dyewitness - What would you like to hear again.mp3 |
10.2 MB |
| Hardcore, Gabber/Mid-Town/midlp001/04 - Dyewitness - Brrr.mp3 |
8 MB |
| Hardcore, Gabber/Mid-Town/midlp001/05 - Dyewitness - I am the Creator (remix).mp3 |
11.6 MB |
| Hardcore, Gabber/Mid-Town/midlp001/06 - Dyewitness - Only if I had one more.mp3 |
9 MB |
| Hardcore, Gabber/Mid-Town/midlp001/07 - Dyewitness - Its On.mp3 |
9 MB |
| Hardcore, Gabber/Mid-Town/midlp001/08 - Dyewitness - Seven Days.mp3 |
9.3 MB |
| Hardcore, Gabber/Mid-Town/midlp001/09 - Dyewitness - The Future (Original Mix).mp3 |
19.8 MB |
| Hardcore, Gabber/Mid-Town/midlp001/10 - Dyewitness - Trancore.mp3 |
14 MB |
| Hardcore, Gabber/Mid-Town/midlp001/11 - Dyewitness - Boom.mp3 |
9.9 MB |
| Hardcore, Gabber/Mid-Town/midlp001/12 - Dyewitness - Observing the Earth (remix).mp3 |
9.6 MB |
| Hardcore, Gabber/MMR Productions/(mmr013) - dj freak & h. - tank source ep/_mmr013 (a).jpg |
223 KB |
| Hardcore, Gabber/MMR Productions/(mmr013) - dj freak & h. - tank source ep/_mmr013 (b).jpg |
251 KB |
| Hardcore, Gabber/MMR Productions/(mmr013) - dj freak & h. - tank source ep/a1 - dj freak & h - impossible.mp3 |
7.1 MB |
| Hardcore, Gabber/MMR Productions/(mmr013) - dj freak & h. - tank source ep/b1 - dj freak & h - kik fuk.mp3 |
6.9 MB |
| Hardcore, Gabber/MMR Productions/(mmr013) - dj freak & h. - tank source ep/b2 - dj freak & h - new yorker.mp3 |
6.4 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_-_Feel_the_Dream-(MOK18)-Vinyl-1994-EMP/a1-chosen_few_-_intro-emp.mp3 |
1.3 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_-_Feel_the_Dream-(MOK18)-Vinyl-1994-EMP/a2-chosen_few_-_maniac-emp.mp3 |
5.4 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_-_Feel_the_Dream-(MOK18)-Vinyl-1994-EMP/a3-chosen_few_-_im_a_ruffneck-emp.mp3 |
6.8 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_-_Feel_the_Dream-(MOK18)-Vinyl-1994-EMP/b1-chosen_few_-_feel_the_dream-emp.mp3 |
5.1 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_-_Feel_the_Dream-(MOK18)-Vinyl-1994-EMP/b2-chosen_few_-_loved_music-emp.mp3 |
6.1 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_-_Feel_the_Dream-(MOK18)-Vinyl-1994-EMP/b3-chosen_few_-_outro-emp.mp3 |
2.3 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/00-chosen_few_and_saphira-da_funky_beatz-(mok118)-web-2008.m3u |
177 B |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/00-chosen_few_and_saphira-da_funky_beatz-(mok118)-web-2008.nfo |
10 KB |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/00-chosen_few_and_saphira-da_funky_beatz-(mok118)-web-2008.sfv |
213 B |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/01-chosen_few_and_saphira-da_funky_beatz.mp3 |
15.5 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/02-chosen_few-i_move_heaven_and_hell.mp3 |
13.5 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/03-chosen_few-i_move_heaven_and_hell_(disillusion_mix).mp3 |
13 MB |
| Hardcore, Gabber/Mokum/Chosen_Few_and_sAphira-Da_Funky_Beatz-(MOK118)-WEB-2008-1KING/04-saphira-falling_away.mp3 |
15.4 MB |
| Hardcore, Gabber/Mokum/mok001/MOK 01 - Hooihouse - Pien An De Eure EP - Pien An De Eure (Z.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok001/MOK 01 - Vitamin (Dano) - The Point EP - Cosmic Trash.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok001/MOK 01 - Vitamin (Dano) - The Point EP - De Skippybal.mp3 |
2.8 MB |
| Hardcore, Gabber/Mokum/mok001/MOK 01 - Vitamin (The Prophet) - The Point EP - The Point.mp3 |
8 MB |
| Hardcore, Gabber/Mokum/mok002/A1 - Hooihouse - Pien An De Eure [Zure Melk Mix].mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok002/A2 - Hooihouse - Pien An De Eure [220 V].mp3 |
2.8 MB |
| Hardcore, Gabber/Mokum/mok002/A3 - Hooihouse - Pien An De Eure [Kuilgras Hop].mp3 |
2.8 MB |
| Hardcore, Gabber/Mokum/mok002/B1 - Hooihouse - Hu Peerd.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok002/B2 - Hooihouse - Groen Van Koen.mp3 |
5.9 MB |
| Hardcore, Gabber/Mokum/mok003/Chosen Few - A1 - Freedom.mp3 |
5.2 MB |
| Hardcore, Gabber/Mokum/mok003/Chosen Few - A2 - Wicked.mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok003/Chosen Few - B1 - Everything.mp3 |
3.5 MB |
| Hardcore, Gabber/Mokum/mok003/Chosen Few - B2 - To dominate.mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok004/A1 - Haardcore - Hakken.mp3 |
5.7 MB |
| Hardcore, Gabber/Mokum/mok004/A2 - Haardcore - One Tone A Time.mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok004/B1 - Haardcore - Ore Slope.mp3 |
6 MB |
| Hardcore, Gabber/Mokum/mok004/B2 - Haardcore - Jolly Jumper.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok005/Tellurian - A1- My name doesn't matter.mp3 |
6 MB |
| Hardcore, Gabber/Mokum/mok005/Tellurian - A2 - Psycho.mp3 |
5.7 MB |
| Hardcore, Gabber/Mokum/mok006/A1 - The Prophet - Muffin In Mokum.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok006/B1 - Dj Dano - De Woeste Man [Geb. 101 Mix].mp3 |
5 MB |
| Hardcore, Gabber/Mokum/mok006/B2 - Dj Dano - Alice In Donderland.mp3 |
4.3 MB |
| Hardcore, Gabber/Mokum/mok007/(a1) hammerhead - hardcore will bever die.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok007/(a2) hammerhead - hardcore will never die (acid overload remix).mp3 |
8.9 MB |
| Hardcore, Gabber/Mokum/mok007/(b1) hammerhead - orthox.mp3 |
5.3 MB |
| Hardcore, Gabber/Mokum/mok007/(b2) hammerhead - acid riot.mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok008/Chosen Few - A1 - Chosen anthem (Against Racism).mp3 |
3.9 MB |
| Hardcore, Gabber/Mokum/mok008/Chosen Few - A2 - Gabberdam.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok008/Chosen Few - B1 - Stringsz (Hakke Voor Gevorderen).mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok008/Chosen Few - B2 -Tranceparant.mp3 |
4.5 MB |
| Hardcore, Gabber/Mokum/mok009/(a1) high energy - intro.mp3 |
1.8 MB |
| Hardcore, Gabber/Mokum/mok009/(a2) high energy - the box.mp3 |
4.7 MB |
| Hardcore, Gabber/Mokum/mok009/(a3) high energy - the search 4 frank.mp3 |
4.7 MB |
| Hardcore, Gabber/Mokum/mok009/(b1) high energy - hellgate.mp3 |
5.3 MB |
| Hardcore, Gabber/Mokum/mok009/(b2) high energy - cenobites.mp3 |
7.1 MB |
| Hardcore, Gabber/Mokum/mok010/(a1) technohead - the passion.mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok010/(a2) technohead - planet hi-hat.mp3 |
4.5 MB |
| Hardcore, Gabber/Mokum/mok010/(b1) technohead - kiddy mix.mp3 |
4.8 MB |
| Hardcore, Gabber/Mokum/mok010/(b2) technohead - the passion.mp3 |
6.3 MB |
| Hardcore, Gabber/Mokum/mok011/Vitamin (Mokum Records 11) - De Ongestelde Flamingo (a1).mp3 |
5.3 MB |
| Hardcore, Gabber/Mokum/mok011/Vitamin (Mokum Records 11) - Energy Tribe (a2).mp3 |
6.8 MB |
| Hardcore, Gabber/Mokum/mok012/(a1) tellurian - the war against machines.mp3 |
3.9 MB |
| Hardcore, Gabber/Mokum/mok012/(a2) leviathan - i kill you.mp3 |
3.2 MB |
| Hardcore, Gabber/Mokum/mok012/(b1) leviathan - back to earth.mp3 |
3.8 MB |
| Hardcore, Gabber/Mokum/mok012/(b2) leviathan - mokum.mp3 |
3.5 MB |
| Hardcore, Gabber/Mokum/mok013/Haardcore (Mokum Records 13) - 250 BPM (a2).mp3 |
1.7 MB |
| Hardcore, Gabber/Mokum/mok013/Haardcore (Mokum Records 13) - Amsterdam (b2).mp3 |
5.4 MB |
| Hardcore, Gabber/Mokum/mok014/A2 I Control Your Body.mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok015/(a1) cookiemunsta - cook and curry (gangarden remix).mp3 |
5 MB |
| Hardcore, Gabber/Mokum/mok015/(a2) cookiemunsta - madnessinsanity (housesucker remix).mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok015/(b1) cookiemunsta - la rocca focca (lier remix).mp3 |
7.6 MB |
| Hardcore, Gabber/Mokum/mok015/(b2) cookiemunsta - de egotrip.mp3 |
5.4 MB |
| Hardcore, Gabber/Mokum/mok016/(a1) original gabber - the headbanger !.mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok016/(a2) original gabber - pump that puzzy.mp3 |
5.5 MB |
| Hardcore, Gabber/Mokum/mok016/(b1) original gabber - ad-da.mp3 |
5.6 MB |
| Hardcore, Gabber/Mokum/mok016/(b2) original gabber - paranoia.mp3 |
6.4 MB |
| Hardcore, Gabber/Mokum/mok017/high energy - Suck My Dick(Mokum).mp3 |
5.4 MB |
| Hardcore, Gabber/Mokum/mok018/(a1) chosen few - intro.mp3 |
1012 KB |
| Hardcore, Gabber/Mokum/mok018/(a2) chosen few - maniac.mp3 |
3.7 MB |
| Hardcore, Gabber/Mokum/mok018/(a3) chosen few - i'm a ruffneck.mp3 |
4.3 MB |
| Hardcore, Gabber/Mokum/mok018/(b1) chosen few - feel the dream.mp3 |
3.8 MB |
| Hardcore, Gabber/Mokum/mok018/(b2) chosen few - loved music.mp3 |
3.9 MB |
| Hardcore, Gabber/Mokum/mok018/(b3) chosen few - outro.mp3 |
1.5 MB |
| Hardcore, Gabber/Mokum/mok019/A1 - The Salami Brothers - Wet Salami [Mini Salami Mix].mp3 |
4.1 MB |
| Hardcore, Gabber/Mokum/mok019/B1 - The Salami Brothers - Gangsta Trax [G.T.O. Mix].mp3 |
5.5 MB |
| Hardcore, Gabber/Mokum/mok019/B2 - The Salami Brothers - Eat Zat Pizza [Veggie Mix].mp3 |
3.3 MB |
| Hardcore, Gabber/Mokum/mok020/a2 - tellurian - option to die.mp3 |
3.4 MB |
| Hardcore, Gabber/Mokum/mok020/b2 - tellurian - new world.mp3 |
3.7 MB |
| Hardcore, Gabber/Mokum/mok022/Maniac Of Noize - Immortality(Mokum).mp3 |
5.1 MB |
| Hardcore, Gabber/Mokum/mok022/Maniac Of Noize - Mokummania(Mokum).mp3 |
5 MB |
| Hardcore, Gabber/Mokum/mok023/annihilator - i'll show you my gun(Mokum).mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok023/annihilator - Into The Wild Style(Mokum).mp3 |
3.5 MB |
| Hardcore, Gabber/Mokum/mok023/Annihilator - S.D.R (Bam Bam)(Mokum).mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok024/Cyanide - Relatic(Mokum).mp3 |
5.5 MB |
| Hardcore, Gabber/Mokum/mok024/Cyanide - String X(Mokum).mp3 |
5.1 MB |
| Hardcore, Gabber/Mokum/mok025/Fistfuck - Pussy Poison(Mokum).mp3 |
3.1 MB |
| Hardcore, Gabber/Mokum/mok025/Fistfuck - Tyrannofuck(Mokum).mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok026/A1 - So Damn Tough.mp3 |
3.4 MB |
| Hardcore, Gabber/Mokum/mok026/A2 - Stay Down With The Hardcore.mp3 |
3.9 MB |
| Hardcore, Gabber/Mokum/mok026/B1 - Cocksuckers.mp3 |
4.1 MB |
| Hardcore, Gabber/Mokum/mok026/B2 - Booster Activated [Smokum Mix].mp3 |
4.1 MB |
| Hardcore, Gabber/Mokum/mok027/A1 - Search & Destroy [The Speedfreak] - Don't Need Nobody.mp3 |
6.9 MB |
| Hardcore, Gabber/Mokum/mok028/A1 - Technohead - Jetset #1.mp3 |
5.2 MB |
| Hardcore, Gabber/Mokum/mok028/A2 - Technohead - Jetset #2.mp3 |
6.4 MB |
| Hardcore, Gabber/Mokum/mok028/B1 - Technohead - Accelerator #4.mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok028/B2 - Technohead - Accelerator #3.mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok029/(a1) chosen few - after hourz (o.g. remix).mp3 |
5.7 MB |
| Hardcore, Gabber/Mokum/mok029/(a2) chosen few - after hourz (technohead remix).mp3 |
5.7 MB |
| Hardcore, Gabber/Mokum/mok029/(b1) chosen few - party !.mp3 |
1.2 MB |
| Hardcore, Gabber/Mokum/mok029/(b2) chosen few - party people.mp3 |
4.1 MB |
| Hardcore, Gabber/Mokum/mok030/A1 - Get Stupid.mp3 |
4 MB |
| Hardcore, Gabber/Mokum/mok030/A2 - Virtual Reality.mp3 |
3.5 MB |
| Hardcore, Gabber/Mokum/mok030/B1 - Hustlers.mp3 |
3.4 MB |
| Hardcore, Gabber/Mokum/mok030/B2 - Kicking It Loud.mp3 |
3.4 MB |
| Hardcore, Gabber/Mokum/mok031/Haardcore - Toxic(Mokum).mp3 |
5.1 MB |
| Hardcore, Gabber/Mokum/mok032/Technohead - Mary Jane.mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok032/technohead - stay down with the hardcore(Mokum).mp3 |
4.1 MB |
| Hardcore, Gabber/Mokum/mok033/The Original Gabba - Kick some Azz.mp3 |
7.5 MB |
| Hardcore, Gabber/Mokum/mok033/The Original Gabba - Life Is Like A Dance.mp3 |
7.5 MB |
| Hardcore, Gabber/Mokum/mok034/A1 - Work It !.mp3 |
7.2 MB |
| Hardcore, Gabber/Mokum/mok034/A2 - Music.mp3 |
8.6 MB |
| Hardcore, Gabber/Mokum/mok034/B1 - Iron Man.mp3 |
8.6 MB |
| Hardcore, Gabber/Mokum/mok034/B2 - Reach The Sky.mp3 |
5 MB |
| Hardcore, Gabber/Mokum/mok035/DJ Dano & Liza N Eliaz - Energy Boost.mp3 |
7 MB |
| Hardcore, Gabber/Mokum/mok035/DJ Dano & Liza N Eliaz - Gimme a Break.mp3 |
6.1 MB |
| Hardcore, Gabber/Mokum/mok036/A1 - Abba-Gabba [Speedfreak Mix].mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok036/A2 - We Keep Going On.mp3 |
3.6 MB |
| Hardcore, Gabber/Mokum/mok036/B1 - Who's Losing Who.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok036/B2 - Bad Feelings.mp3 |
5.1 MB |
| Hardcore, Gabber/Mokum/mok037/A1-I Wanna Be A Hippy (Original Mix).mp3 |
3 MB |
| Hardcore, Gabber/Mokum/mok037/A2-I Wanna Be A Hippy (Dano No Sweat Mix).mp3 |
4.8 MB |
| Hardcore, Gabber/Mokum/mok037/B1-I Wanna Be A Hippy (Flamman & Abraxas Mix).mp3 |
6.1 MB |
| Hardcore, Gabber/Mokum/mok037/B2-I Wanna Be A Hippy (Speedfreak Mix).mp3 |
5.6 MB |
| Hardcore, Gabber/Mokum/mok037.5/A1 - Technohead - I Wanna Be A Hippy [Zippy Mix].mp3 |
4 MB |
| Hardcore, Gabber/Mokum/mok037.5/A2 - Technohead - I Wanna Be A Hippy [Dano No Sweat Mix].mp3 |
4.8 MB |
| Hardcore, Gabber/Mokum/mok037.5/B1 - Technohead - I Wanna Be A Hippy [Flamman & Abraxas Radi.mp3 |
6.1 MB |
| Hardcore, Gabber/Mokum/mok037.5/B2 I Wanna Be A Hippy (Speedfreak Mix).mp3 |
5.6 MB |
| Hardcore, Gabber/Mokum/mok040/Pineapple Jack - Do That Dance.mp3 |
7.6 MB |
| Hardcore, Gabber/Mokum/mok040/Pineapple Jack - Go Out Of Your Mind.mp3 |
7 MB |
| Hardcore, Gabber/Mokum/mok041/A1-Squash The Floor.mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok041/A2-Bloody Fucking Hardcore.mp3 |
3.8 MB |
| Hardcore, Gabber/Mokum/mok041/B1-Get Them Off Me.mp3 |
4 MB |
| Hardcore, Gabber/Mokum/mok041/B2-Rendez-Vous.mp3 |
3.7 MB |
| Hardcore, Gabber/Mokum/mok043/A1 - Party Animals - Have You Ever Been Mellow [Tekno Mafia Mix].mp3 |
3.9 MB |
| Hardcore, Gabber/Mokum/mok043/A2 - Party Animals - Have You Ever Been Mellow [Flamman & Abraxas Radio Mix].mp3 |
3.6 MB |
| Hardcore, Gabber/Mokum/mok043/B1 - Party Animals - Used & Abused [Amnesia Mix].mp3 |
3 MB |
| Hardcore, Gabber/Mokum/mok043/B2 - Party Animals - E.H.B.O..mp3 |
4.7 MB |
| Hardcore, Gabber/Mokum/mok044/Annihilator - Mindwar.mp3 |
4 MB |
| Hardcore, Gabber/Mokum/mok044/Annihilator - Realm Of Darkness.mp3 |
6.1 MB |
| Hardcore, Gabber/Mokum/mok046/a1 - chosen few - name of the dj.mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok046/A1. Chosen Few - Name Of The DJ.mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok046/a2 - chosen few - love me bad.mp3 |
4.7 MB |
| Hardcore, Gabber/Mokum/mok046/A2. Chosen Few - Love Me Bad.mp3 |
4.7 MB |
| Hardcore, Gabber/Mokum/mok046/b1 - chosen few - daniça.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok046/B1. Chosen Few - Danica.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok046/b2 - chosen few - hellfire.mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok046/B2. Chosen Few - Hellfire.mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok048/a1 - spoetnik - the hard way.mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok048/a2 - spoetnik - mokum madness.mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok049/A1 - Move Your Butt [xTc].mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok049/A2 - Ugly Chicks [xTc].mp3 |
5.4 MB |
| Hardcore, Gabber/Mokum/mok049/B1 - Abba-Gabba ( Speedfreak Mutterficker Massaker ) [xTc].mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok049/B2 - 1000 Guns [xTc].mp3 |
4.8 MB |
| Hardcore, Gabber/Mokum/mok050/(a1) dj dano, liza'n'eliaz - manic cure.mp3 |
4.7 MB |
| Hardcore, Gabber/Mokum/mok050/(a2) dj dano, liza'n'eliaz - pawlow.mp3 |
4.5 MB |
| Hardcore, Gabber/Mokum/mok050/(b1) dj dano, liza'n'eliaz - starting up.mp3 |
3.6 MB |
| Hardcore, Gabber/Mokum/mok050/(b1) dj dano, liza'n'eliaz - stereotype.mp3 |
6 MB |
| Hardcore, Gabber/Mokum/mok051/(a2) tellurian - let's go.mp3 |
3.7 MB |
| Hardcore, Gabber/Mokum/mok051/(b1) tellurian - hardcore junkies.mp3 |
5.1 MB |
| Hardcore, Gabber/Mokum/mok051/(b2) tellurian - don't stop.mp3 |
5 MB |
| Hardcore, Gabber/Mokum/mok053/(a1) omar santana - mad creator (h2o remix).mp3 |
5 MB |
| Hardcore, Gabber/Mokum/mok053/(a2) omar santana - mad creator.mp3 |
5.2 MB |
| Hardcore, Gabber/Mokum/mok053/(b1) omar santana - panic button.mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok053/(b2) omar santana - a.m. mayhem.mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok054/(a1) party animals - hava naquila (tekno mafia remix).mp3 |
4.3 MB |
| Hardcore, Gabber/Mokum/mok054/(a2) party animals - hava naquila (flamman, abraxas radio edit).mp3 |
4.3 MB |
| Hardcore, Gabber/Mokum/mok054/(b1) party animals - wapperdewap.mp3 |
1.5 MB |
| Hardcore, Gabber/Mokum/mok054/(b2) party animals - hakkefest.mp3 |
4.5 MB |
| Hardcore, Gabber/Mokum/mok054/(b3) party animals - die nazi scum (whiplash remix).mp3 |
4.5 MB |
| Hardcore, Gabber/Mokum/mok055/(a1) rob gee, ralphie dee - sex, drugs and gabba house.mp3 |
3.8 MB |
| Hardcore, Gabber/Mokum/mok055/(a2) rob gee, ralphie dee - b.w.s.c..mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok055/(b1) rob gee, ralphie dee - mellow message.mp3 |
7.3 MB |
| Hardcore, Gabber/Mokum/mok055/(b2) rob gee, ralphie dee - dirty nursery rhymes.mp3 |
3.9 MB |
| Hardcore, Gabber/Mokum/mok056/A1. Chosen Few - Ø Chøsen.mp3 |
4 MB |
| Hardcore, Gabber/Mokum/mok056/A2. Chosen Few - Kold Dayz.mp3 |
3.7 MB |
| Hardcore, Gabber/Mokum/mok056/B1. Chosen Few - The Break.mp3 |
4.2 MB |
| Hardcore, Gabber/Mokum/mok056/B2. Chosen Few - Chosen Paradise.mp3 |
3.8 MB |
| Hardcore, Gabber/Mokum/mok057/Back 2 Bass - I Wanna Be With You (Chosen Few Mix).mp3 |
5.8 MB |
| Hardcore, Gabber/Mokum/mok057/Back 2 Bass - I Wanna Be With You (Extended Mix).mp3 |
8 MB |
| Hardcore, Gabber/Mokum/mok057/Back 2 Bass - I Wanna Be With You (Hard Mix).mp3 |
7 MB |
| Hardcore, Gabber/Mokum/mok057/Back 2 Bass - I Wanna Be With You (Radio Mix).mp3 |
4.6 MB |
| Hardcore, Gabber/Mokum/mok057/Back 2 Bass - I Wanna Be With You (Spoetnik Mix).mp3 |
5.3 MB |
| Hardcore, Gabber/Mokum/mok058/Search & Destroy - Deep in the Underground (GTO Mix).mp3 |
4.9 MB |
| Hardcore, Gabber/Mokum/mok059/(a2) party animals - aquarius (flamman, abraxas remix).mp3 |
4.4 MB |
| Hardcore, Gabber/Mokum/mok059/(b2) party animals - misadventures of the spiegel man (part 2).mp3 |
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |
|
0 B |